![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| impact Craters.png | 2022-06-01 09:29 | 237K | |
| impact Craters banner.png | 2022-06-01 09:27 | 271K | |
| 1st Grade Language Arts Videos/ | 2024-11-13 12:32 | - | |
| 2nd Grade Language Arts Videos/ | 2024-11-22 17:10 | - | |
| 10 Largest Craters on Earth.png | 2022-05-31 12:42 | 1.0M | |
| 10 Resolutions.png | 2022-05-19 17:15 | 276K | |
| 10 Strage.PNG | 2022-06-06 13:02 | 760K | |
| 37QuestionsWithAndreaGhez.PNG | 2022-09-21 12:40 | 828K | |
| ACM.png | 2022-06-03 10:32 | 597K | |
| AHS HIst.png | 2022-05-04 13:41 | 174K | |
| AST.png | 2022-05-27 10:09 | 585K | |
| A Star is Born.PNG | 2022-05-13 13:40 | 506K | |
| Abbes.PNG | 2022-09-23 10:19 | 880K | |
| Active Galaxies.PNG | 2022-09-21 12:34 | 969K | |
| Active Volcanoes on Mars.png | 2022-06-02 08:29 | 525K | |
| Adatp Optics.png | 2022-05-19 17:18 | 634K | |
| After James Webb.png | 2022-05-26 15:01 | 694K | |
| Age of Star Clusters.PNG | 2022-05-16 15:38 | 878K | |
| Age of Universe.PNG | 2022-09-21 14:47 | 726K | |
| Age of the Universe.png | 2022-09-22 14:43 | 91K | |
| Alamiro Bridgr.png | 2022-05-11 10:53 | 436K | |
| Alaska Flag.PNG | 2022-05-09 14:04 | 314K | |
| Alaska State Flag.PNG | 2022-05-09 11:57 | 64K | |
| Alaska flag Banner.png | 2022-05-09 14:11 | 255K | |
| AllAboutSunSports.png | 2022-06-07 14:52 | 710K | |
| Altude.PNG | 2022-05-06 09:49 | 321K | |
| American-HS-Astronomy.pdf | 2022-05-04 12:37 | 5.4M | |
| American HS Astronomy.png | 2022-05-04 13:14 | 171K | |
| American High School Astronomy.png | 2022-05-13 09:37 | 246K | |
| Anatomy of Light.png | 2022-05-18 15:49 | 191K | |
| Ancient Astronomy.PNG | 2022-05-13 15:14 | 396K | |
| Ancient Astronomy Banner.png | 2022-05-13 15:08 | 292K | |
| Ancient Greek Paper Sundials.png | 2022-05-10 15:34 | 555K | |
| Andromena.PNG | 2022-09-21 13:19 | 961K | |
| Angle of the Suns rays.PNG | 2022-05-06 10:00 | 1.0M | |
| Angular Momentum.PNG | 2022-05-16 12:35 | 722K | |
| Anient Astronomy.png | 2022-05-13 15:08 | 518K | |
| Anthropic Pfincicpl.PNG | 2022-09-23 13:39 | 820K | |
| Antropic Principle.PNG | 2022-09-21 14:50 | 953K | |
| Aparent Mag.PNG | 2022-06-13 14:04 | 464K | |
| Apparent.PNG | 2022-06-13 13:51 | 77K | |
| Apparent dolar time.png | 2022-05-17 10:17 | 597K | |
| Approaching Earth.PNG | 2022-06-06 09:39 | 899K | |
| Ascentention.png | 2022-05-17 08:42 | 529K | |
| Asrrology vs Astronomy.PNG | 2022-05-16 08:55 | 609K | |
| Asterioid sun banner.png | 2022-09-27 13:43 | 246K | |
| Asteroid Belt.PNG | 2022-05-16 14:24 | 688K | |
| Asteroid Simulation.png | 2022-05-31 12:51 | 599K | |
| Asteroids.PNG | 2022-05-16 14:18 | 609K | |
| Asteroids.png | 2022-06-03 10:42 | 189K | |
| Asteroids Banner.png | 2022-06-03 10:41 | 316K | |
| Asteroids and Planentary Defence.png | 2022-06-06 09:31 | 301K | |
| Asteroids and comets.PNG | 2022-05-16 14:12 | 545K | |
| Astro instruments.png | 2022-05-20 09:57 | 167K | |
| Astrology.png | 2022-05-16 08:53 | 376K | |
| Astrology Banner.png | 2022-05-16 08:50 | 475K | |
| Astromical telescope.png | 2022-05-05 14:55 | 434K | |
| Astromincal Telescope.PNG | 2022-05-06 12:35 | 437K | |
| Astronauts on the Moon.png | 2022-05-27 09:12 | 707K | |
| Astronmical Instruments.png | 2022-09-26 15:55 | 275K | |
| Astronmical units banner.png | 2022-09-26 15:45 | 399K | |
| Astronomy-OP_zItt6LJ (2).pdf | 2022-05-12 16:54 | 154M | |
| Astronomy Banner.png | 2022-09-26 10:10 | 382K | |
| Astronomy Telescope Banner.png | 2022-05-13 09:43 | 139K | |
| Astro vs Astrom.PNG | 2022-09-13 13:23 | 841K | |
| Atmoshphere.png | 2022-05-27 15:29 | 392K | |
| Atmoshphere Banner.png | 2022-05-27 15:25 | 400K | |
| Atmosphere and Greenhouse Effect.png | 2022-05-31 08:48 | 137K | |
| Atmosphere of planets.PNG | 2022-06-10 08:53 | 748K | |
| Atmospheric Compostion.png | 2022-05-27 15:42 | 727K | |
| Atom Banner.png | 2022-05-06 10:00 | 375K | |
| Atomic Nuc.png | 2022-06-08 11:45 | 383K | |
| Atomic Nucleus.png | 2022-05-19 12:25 | 272K | |
| A tour of the Universe.PNG | 2022-05-13 12:19 | 389K | |
| Banner Universe banner.png | 2022-09-23 11:30 | 319K | |
| Behaviior of Light.png | 2022-05-18 14:24 | 309K | |
| Behavior of Light.png | 2022-05-18 14:51 | 365K | |
| Behavior of Light Banner.png | 2022-05-18 14:20 | 187K | |
| Below the Clouds.png | 2022-06-02 16:27 | 672K | |
| Benny Benson.png | 2022-05-09 14:01 | 142K | |
| Big Bang.PNG | 2022-09-23 10:02 | 383K | |
| BigBang.PNG | 2022-09-21 13:45 | 460K | |
| Big Bang Discovery.PNG | 2022-09-23 11:00 | 1.0M | |
| Big and Little Dipper.PNG | 2022-05-09 12:22 | 613K | |
| Binary Stars.PNG | 2022-09-15 08:40 | 598K | |
| Biology Lab rubric | 2022-05-04 09:31 | 614K | |
| Birth of Astronomy.png | 2022-05-13 13:15 | 214K | |
| Birth of Astronomy1.png | 2022-05-13 13:17 | 214K | |
| Birth of Modern Astronomy.PNG | 2022-05-16 09:44 | 1.0M | |
| Birth of True Light.PNG | 2022-09-23 10:57 | 1.2M | |
| Birth of a Universe.PNG | 2022-09-23 10:04 | 913K | |
| Brightness of Stars.png | 2022-06-09 14:26 | 517K | |
| BuzAldrin.png | 2022-05-31 15:29 | 643K | |
| CCD.PNG | 2022-05-20 10:42 | 163K | |
| CMB.png | 2022-09-23 10:49 | 268K | |
| CMB banner.png | 2022-09-23 11:15 | 325K | |
| Calculate.PNG | 2022-06-13 14:39 | 393K | |
| Calendar.png | 2022-05-17 12:41 | 171K | |
| Calendar Banner.png | 2022-05-17 12:39 | 105K | |
| Calendars Around the World.png | 2022-05-17 12:49 | 781K | |
| Callisto.png | 2022-06-02 15:43 | 677K | |
| Cap.PNG | 2022-05-13 13:35 | 1.0M | |
| Cass.PNG | 2022-05-09 13:33 | 581K | |
| Cassinio Mission.png | 2022-06-02 11:39 | 623K | |
| Cassiopeia.png | 2022-05-09 12:48 | 137K | |
| Cassiopeia Banner.png | 2022-05-09 12:47 | 357K | |
| Celesestrial Differnces.PNG | 2022-09-22 12:30 | 671K | |
| Celesestrial Sphere.PNG | 2022-05-13 14:22 | 963K | |
| Celestrial Equator.PNG | 2022-05-13 14:26 | 219K | |
| Cellustrail banner.png | 2022-09-14 13:42 | 401K | |
| Ceneter of Mass.png | 2022-05-12 15:43 | 490K | |
| Center of Gravity.png | 2022-05-12 15:34 | 505K | |
| Central Dogma.png | 2022-05-05 17:47 | 333K | |
| Central Nervous System.png | 2022-05-04 11:40 | 338K | |
| Ceres Asteroid.png | 2022-06-03 11:15 | 632K | |
| Characteritics of Planets.png | 2022-05-27 11:04 | 486K | |
| Characteritics of the Sun.png | 2022-06-07 11:05 | 193K | |
| Chromosphere.png | 2022-06-07 11:09 | 381K | |
| Climate Change.png | 2022-05-31 08:25 | 324K | |
| Climate Change Banner.png | 2022-05-31 07:56 | 311K | |
| Climate Change on Mars.png | 2022-06-02 09:16 | 419K | |
| Collisions.png | 2022-05-27 11:12 | 616K | |
| Collission That Formed the Moon.png | 2022-05-26 15:32 | 503K | |
| Colors of Stars.png | 2022-06-13 14:26 | 158K | |
| Comessun.png | 2022-09-27 13:49 | 202K | |
| Comets.PNG | 2022-06-06 10:09 | 714K | |
| Comets Asteroids.png | 2022-06-03 10:14 | 272K | |
| Comets Atmosphere.PNG | 2022-06-06 10:14 | 367K | |
| Comets and Asteroids.png | 2022-06-03 10:09 | 472K | |
| Composition of Stucture.png | 2022-05-27 09:38 | 751K | |
| Conclusion.PNG | 2022-05-13 12:35 | 418K | |
| Conduction.png | 2022-06-08 12:48 | 433K | |
| Conservation of Energy.png | 2022-06-07 16:20 | 374K | |
| Copernicus Heliocentric.PNG | 2022-05-16 09:55 | 875K | |
| Cosmic Calendars.png | 2022-05-31 12:38 | 612K | |
| Cosmic Influences on earth.png | 2022-05-31 12:31 | 248K | |
| Cosmic Influences on earth Banner.png | 2022-05-31 12:29 | 235K | |
| Cosmic Samples.png | 2022-06-06 11:28 | 255K | |
| Cosmic Tug of War.PNG | 2022-09-23 09:58 | 759K | |
| Cosmo.PNG | 2022-09-22 14:49 | 180K | |
| Cosmology.PNG | 2022-05-13 15:21 | 1.0M | |
| Crater Counts.png | 2022-06-01 09:50 | 463K | |
| Crater Formation.png | 2022-06-01 09:46 | 191K | |
| Craters.png | 2022-05-31 15:22 | 244K | |
| Criminal-Law.pdf | 2022-05-13 11:15 | 58M | |
| Critical Density.PNG | 2022-09-23 09:50 | 373K | |
| Dark Energy.png | 2022-09-23 11:25 | 233K | |
| Day and Night.png | 2022-05-12 16:11 | 479K | |
| Day on Earth.png | 2022-05-17 10:09 | 285K | |
| Death of a Star.PNG | 2022-09-22 15:00 | 787K | |
| Dectors and Instsruments.PNG | 2022-05-20 10:37 | 1.0M | |
| Den.PNG | 2022-05-16 12:44 | 324K | |
| Detectors.png | 2022-05-19 15:28 | 812K | |
| Detectors and Instruments.png | 2022-05-19 15:27 | 361K | |
| DialTheSunBanner.png | 2022-05-11 08:14 | 333K | |
| Difference.png | 2022-05-17 15:56 | 643K | |
| Difference between them.PNG | 2022-05-16 09:28 | 920K | |
| Different types of neb.PNG | 2022-09-22 10:25 | 1.0M | |
| Discovery of Galaxies.png | 2022-09-22 09:58 | 338K | |
| Distance of Stars.PNG | 2022-09-22 12:33 | 643K | |
| Diverg.png | 2022-06-02 09:28 | 246K | |
| Divergent.png | 2022-06-02 09:23 | 229K | |
| Does the Moon Rotate.png | 2022-05-17 14:01 | 571K | |
| Doppler Effect.png | 2022-05-18 14:08 | 599K | |
| Doppler Effect1.png | 2022-05-19 14:53 | 163K | |
| Doppler Effect banner.png | 2022-05-19 14:51 | 287K | |
| Drone Sundial Bridge.png | 2022-05-11 11:09 | 614K | |
| Early Stargazers.png | 2022-05-04 13:18 | 252K | |
| Earth's Atmosphere.png | 2022-05-26 14:02 | 685K | |
| Earth From Space.PNG | 2022-05-16 12:05 | 760K | |
| Earth Moon Formation.png | 2022-06-01 10:54 | 426K | |
| Earth Sun Angle.png | 2022-05-04 15:45 | 265K | |
| Earth and Sky.png | 2022-05-17 08:13 | 81K | |
| Earth banner.png | 2022-05-31 09:29 | 302K | |
| Earthlike Planets.png | 2022-06-01 13:18 | 100K | |
| Earth rotation banner.png | 2022-05-05 15:41 | 304K | |
| Earths Atmosphere.png | 2022-05-27 11:50 | 876K | |
| Earths Atomsphere.png | 2022-05-27 15:38 | 450K | |
| EarthsInterior.PNG | 2022-09-22 08:47 | 925K | |
| Earths Magentic Field.png | 2022-05-27 12:37 | 605K | |
| Earths Rotation and Revolution.png | 2022-05-05 16:05 | 361K | |
| Earths Rotation from Space.PNG | 2022-05-06 13:33 | 281K | |
| Earths climate.png | 2022-06-07 14:48 | 663K | |
| Earthshine.png | 2022-05-12 16:05 | 96K | |
| Earthshine Banner.png | 2022-05-12 16:03 | 322K | |
| Earthshiney.png | 2022-05-12 16:17 | 397K | |
| Earthsine.png | 2022-05-12 16:14 | 243K | |
| Eclip.png | 2022-05-17 16:04 | 524K | |
| Eclipse.png | 2022-05-17 15:45 | 178K | |
| Eclipse Banner.png | 2022-05-17 15:43 | 121K | |
| Eclipseseses.png | 2022-05-17 15:50 | 330K | |
| Eclipsing Binary Stars.PNG | 2022-09-15 09:39 | 328K | |
| Ecliptic.png | 2022-05-10 08:34 | 126K | |
| Ecliptic Plane.png | 2022-05-10 08:32 | 350K | |
| Edmond Hailey.PNG | 2022-06-06 10:20 | 831K | |
| Edwin Hubble.PNG | 2022-09-22 10:18 | 471K | |
| Electro.PNG | 2022-06-13 15:03 | 523K | |
| Electromagnetic Spectrum Banner.png | 2022-05-18 16:13 | 48K | |
| Electron Behavior.png | 2022-05-19 12:37 | 185K | |
| Eletromagnetic Spectrum.png | 2022-05-18 14:06 | 753K | |
| Ellipical Galaxy.PNG | 2022-09-22 10:52 | 674K | |
| Emision and Absorb.png | 2022-05-19 14:17 | 206K | |
| EndofTheMilkyWay.PNG | 2022-09-21 13:49 | 1.0M | |
| Energy Balnce.png | 2022-06-08 12:25 | 536K | |
| Energy Balnce of the Sun.png | 2022-06-08 12:42 | 464K | |
| Energy Sources.png | 2022-05-04 08:53 | 320K | |
| Energy Sources Banner.png | 2022-05-04 09:49 | 292K | |
| Energy converted into mass.png | 2022-06-08 11:41 | 159K | |
| Environment.png | 2022-05-04 10:41 | 257K | |
| Eq Axis.PNG | 2022-05-06 12:53 | 386K | |
| Equals Solcitce.png | 2022-05-11 12:46 | 514K | |
| Evolution fo earth.png | 2022-05-31 09:32 | 261K | |
| Evolution of Mars.png | 2022-06-02 10:06 | 697K | |
| Evolution of the Atmosphere.png | 2022-05-31 08:45 | 492K | |
| Expanding univers banner.png | 2022-09-22 12:41 | 350K | |
| Expanding universe.png | 2022-09-22 12:39 | 114K | |
| Explaining the Summer Solstice.png | 2022-05-11 15:25 | 784K | |
| Exploration of the Moon.png | 2022-05-31 15:53 | 285K | |
| Explorning Pluto.png | 2022-05-27 10:54 | 485K | |
| Face in the Moon.png | 2022-05-12 13:27 | 488K | |
| Fat side of the moon.png | 2022-05-12 13:48 | 501K | |
| Fission and fussion.PNG | 2022-09-23 10:39 | 389K | |
| Fitness abd Wellness Banner.png | 2022-06-09 11:14 | 286K | |
| Footprints on the Moon.png | 2022-06-01 08:57 | 713K | |
| FormationofGalaxy.png | 2022-09-21 13:30 | 174K | |
| FormationofGalaxy1.png | 2022-09-21 14:44 | 761K | |
| Formation of the Moon.png | 2022-06-01 10:35 | 443K | |
| Formation of the Planets.png | 2022-05-26 15:36 | 438K | |
| Formation of the Solar Syste.png | 2022-05-27 09:28 | 559K | |
| Formation of the Solar System.PNG | 2022-06-06 13:24 | 679K | |
| Formations of Ions.png | 2022-05-19 14:21 | 358K | |
| Four Fundamental Forces.PNG | 2022-09-23 12:38 | 457K | |
| French - La Famille.png | 2022-08-29 09:54 | 117K | |
| Frequency.png | 2022-05-18 15:26 | 242K | |
| Fusion Energy.png | 2022-06-08 11:49 | 499K | |
| Gal.png | 2022-09-21 15:36 | 425K | |
| Gal Moons.png | 2022-06-02 15:36 | 251K | |
| Galax banner.png | 2022-09-22 10:13 | 371K | |
| Galaxies.PNG | 2022-09-21 15:42 | 758K | |
| Galaxy.png | 2022-09-21 12:18 | 204K | |
| Galaxy Banner 1.png | 2022-09-22 10:39 | 367K | |
| Galaxy Formation.PNG | 2022-09-23 12:03 | 886K | |
| Galaxy a.png | 2022-09-22 10:43 | 241K | |
| Galaxy banner.png | 2022-09-21 09:38 | 385K | |
| Galaxy banner1.png | 2022-09-21 12:15 | 151K | |
| Gal banner.png | 2022-09-21 15:39 | 423K | |
| Galieo .png | 2022-06-02 11:36 | 764K | |
| Galliean Moons.png | 2022-06-02 15:35 | 212K | |
| Gallieo Discoveries.PNG | 2022-05-16 10:04 | 968K | |
| Galxies.PNG | 2022-09-22 10:07 | 745K | |
| Ganymede Moon.png | 2022-06-02 15:49 | 627K | |
| Geological Time.PNG | 2022-06-06 15:41 | 754K | |
| Geology of Mars.png | 2022-06-02 08:12 | 752K | |
| George.png | 2022-05-19 17:11 | 832K | |
| Giant PLanet.png | 2022-06-02 12:35 | 134K | |
| Giant planets.png | 2022-09-27 11:35 | 176K | |
| Giant planets banner.png | 2022-09-27 11:29 | 109K | |
| Glaxay without dark matter.PNG | 2022-09-21 12:08 | 744K | |
| Global.png | 2022-05-27 13:14 | 255K | |
| Global Perspective.png | 2022-05-27 12:27 | 353K | |
| Global Perspective Banner.png | 2022-05-27 13:11 | 185K | |
| GrandUnitedTheories.PNG | 2022-09-23 12:33 | 1.0M | |
| Gravity.png | 2022-05-16 10:28 | 251K | |
| Gravity Banner.png | 2022-05-12 15:24 | 122K | |
| Gravity Explained.PNG | 2022-05-16 13:43 | 1.0M | |
| Gravity Gradient.png | 2022-05-12 15:26 | 256K | |
| Gravity Gradient 1.png | 2022-05-12 15:38 | 332K | |
| Gravity and Orbit.PNG | 2022-05-13 15:29 | 580K | |
| Gravity on other Planets.PNG | 2022-05-16 15:26 | 482K | |
| Growing.png | 2022-09-22 14:40 | 204K | |
| HR Diagams.PNG | 2022-09-15 10:32 | 384K | |
| HR Diagran.png | 2022-09-15 10:22 | 84K | |
| Heliocentric Theory.PNG | 2022-05-16 10:08 | 779K | |
| Henery Russsell Diagram.PNG | 2022-09-15 10:36 | 119K | |
| History Earth.png | 2022-06-02 10:01 | 425K | |
| History of Astrology.PNG | 2022-05-16 09:01 | 895K | |
| History of Astronomy.PNG | 2022-05-13 13:30 | 864K | |
| History of Earth.png | 2022-05-31 12:46 | 606K | |
| History of ISlam.png | 2022-05-03 11:52 | 668K | |
| History of Mars.png | 2022-06-01 15:05 | 285K | |
| History of Spectra Lines.png | 2022-05-19 13:50 | 479K | |
| History of the Sejunks.png | 2022-05-03 11:56 | 803K | |
| History of the Universe.PNG | 2022-09-23 11:59 | 792K | |
| How Bright is a Star.PNG | 2022-06-13 14:12 | 1.1M | |
| How Comets Form.PNG | 2022-06-06 10:26 | 548K | |
| How Do Sattelites Work.PNG | 2022-05-16 15:01 | 516K | |
| How Many Moons.png | 2022-05-10 11:40 | 275K | |
| How Neptune Was Discovered.PNG | 2022-05-16 15:30 | 312K | |
| How Saturn got its Rings.png | 2022-06-03 09:36 | 340K | |
| How can the Universe be Flat.png | 2022-05-10 11:30 | 661K | |
| How telescopes work.png | 2022-05-19 16:33 | 668K | |
| How the Calendar Was Invented.png | 2022-05-17 12:59 | 642K | |
| How the Moon Controls BIology.png | 2022-05-12 12:39 | 589K | |
| How the Tides Work.png | 2022-05-17 14:28 | 614K | |
| How to Find Polaris.PNG | 2022-05-06 10:28 | 863K | |
| How to date a planet.png | 2022-05-27 10:43 | 465K | |
| How to find Ursa Minor.PNG | 2022-05-09 13:40 | 386K | |
| How was the Solar System Formed.png | 2022-05-27 09:08 | 481K | |
| Hubble Time.PNG | 2022-09-22 14:53 | 252K | |
| Hubble Whats Happening.png | 2022-05-26 14:14 | 328K | |
| Hubbles Law.PNG | 2022-09-22 14:29 | 715K | |
| Hubbles tour.png | 2022-06-02 10:58 | 670K | |
| Human Impact on Earth.png | 2022-05-31 08:51 | 549K | |
| IO.png | 2022-06-02 15:47 | 603K | |
| I TOO SING AMERICA AND I HEAR AMERICA SINGING COMPARISON POEMS.pdf | 2022-05-26 09:24 | 188K | |
| Idenitfy a.PNG | 2022-06-06 12:58 | 1.1M | |
| Identify a Metorite.PNG | 2022-06-06 12:13 | 829K | |
| Images of Venus.png | 2022-06-01 15:48 | 649K | |
| Impact Craters.png | 2022-06-01 09:38 | 756K | |
| Infared Light.PNG | 2022-05-20 10:49 | 1.0M | |
| Inside Telescope.png | 2022-05-26 14:19 | 698K | |
| International Dateline.png | 2022-05-17 10:23 | 620K | |
| International Dateline banner.png | 2022-05-17 10:35 | 187K | |
| Interplanetary.PNG | 2022-05-16 15:05 | 707K | |
| In the Sky.png | 2022-05-17 08:28 | 542K | |
| IntroductionToBusiness-OP_8D04gAa.pdf | 2022-05-13 12:08 | 53M | |
| Irrgular Galaxy.PNG | 2022-09-22 10:56 | 875K | |
| James Clerk Maxwell.png | 2022-05-18 15:18 | 418K | |
| James Webb Space.png | 2022-05-26 14:54 | 619K | |
| James Webb Space Telescope.png | 2022-05-19 16:30 | 593K | |
| Journey to Milky Way.PNG | 2022-09-15 11:03 | 654K | |
| Journey to the Sun.png | 2022-05-11 16:08 | 759K | |
| Jovial Planets.PNG | 2022-06-06 13:47 | 613K | |
| Jovian Planets.png | 2022-06-02 14:57 | 279K | |
| Juno.png | 2022-06-02 11:46 | 475K | |
| Jup.png | 2022-06-02 12:47 | 674K | |
| Jupiter banner.png | 2022-05-20 10:21 | 171K | |
| Jupiters Moons.png | 2022-06-02 15:38 | 732K | |
| Jupiter system.png | 2022-06-02 15:00 | 682K | |
| Keepler and Tycho.PNG | 2022-05-16 11:56 | 906K | |
| Keeplers laws.PNG | 2022-05-16 12:00 | 641K | |
| Kip belt.PNG | 2022-06-06 10:31 | 535K | |
| Large Telescopes.png | 2022-05-26 14:49 | 670K | |
| Large moons of Jupiter.png | 2022-06-02 13:33 | 429K | |
| Law of Gravational.png | 2022-05-16 13:00 | 102K | |
| Laws of Motion.PNG | 2022-05-16 13:46 | 332K | |
| Laws of Planetary Motion.PNG | 2022-05-16 11:48 | 395K | |
| Layers.png | 2022-06-07 11:13 | 577K | |
| Layers of the Earth.png | 2022-05-27 11:47 | 568K | |
| Layers of the Sun.png | 2022-06-07 08:49 | 679K | |
| Lght Travel.PNG | 2022-05-13 12:16 | 432K | |
| Libration of the Moon.png | 2022-05-12 15:54 | 575K | |
| Lifetime of a star.PNG | 2022-09-15 09:49 | 847K | |
| Light Waves.png | 2022-05-18 14:02 | 620K | |
| Live Mars.png | 2022-06-02 08:19 | 625K | |
| Long Hair Comets.png | 2022-06-06 10:02 | 156K | |
| Long Haired Commets banner.png | 2022-06-06 09:59 | 454K | |
| Longest Day of the Year.png | 2022-05-11 12:53 | 461K | |
| Lookinginsideearth.png | 2022-05-27 12:43 | 721K | |
| Lunar.png | 2022-06-01 08:28 | 158K | |
| Lunar Soil.png | 2022-06-01 08:47 | 380K | |
| Lunar Surface Banner.png | 2022-06-01 08:24 | 190K | |
| Magnetosphere.PNG | 2022-09-22 09:09 | 326K | |
| MainSrquenceStars.PNG | 2022-09-15 10:40 | 390K | |
| Mars.png | 2022-06-01 13:25 | 490K | |
| Mars Geology.png | 2022-06-01 16:44 | 140K | |
| Mars Polar Caps.png | 2022-06-02 09:13 | 438K | |
| Mars Timeline.png | 2022-06-01 13:28 | 461K | |
| Mars and Jupiter.png | 2022-05-27 10:37 | 722K | |
| Mars banner.png | 2022-06-01 16:43 | 287K | |
| Mass Stellar.png | 2022-09-15 08:29 | 142K | |
| Massess of Galaxies.PNG | 2022-09-22 11:24 | 143K | |
| Massive Canyons on mars.png | 2022-06-02 08:32 | 566K | |
| Mass of the Gala.PNG | 2022-09-21 09:44 | 1.1M | |
| Mass of the Glaxy.png | 2022-09-21 09:40 | 334K | |
| Measuring Stellar Masses.PNG | 2022-09-15 08:34 | 241K | |
| Media-Innovation-and-Entrepreneurship-1605896410.pdf | 2022-05-13 12:08 | 13M | |
| Mercury.png | 2022-06-01 11:19 | 156K | |
| Mercury Banner.png | 2022-06-01 11:15 | 122K | |
| Mercurys Orbit.png | 2022-06-01 11:33 | 377K | |
| Mercuy Planet.png | 2022-06-01 11:29 | 450K | |
| Merdian.png | 2022-05-17 08:37 | 146K | |
| Meteorites Banner.png | 2022-06-06 12:17 | 55K | |
| Meteors band.png | 2022-06-06 11:46 | 180K | |
| Meteros Banner.png | 2022-06-06 11:44 | 230K | |
| Metero showers.PNG | 2022-06-06 11:54 | 782K | |
| Metorites.PNG | 2022-06-06 12:09 | 1.0M | |
| Metorites 1.png | 2022-06-06 12:21 | 299K | |
| Milky Way.png | 2022-09-15 11:00 | 495K | |
| Milky Way Banner.png | 2022-09-15 10:58 | 414K | |
| Milkyway.png | 2022-09-27 15:43 | 268K | |
| Milky way Arms.PNG | 2022-09-21 09:06 | 860K | |
| Models of the Universe.PNG | 2022-09-23 09:20 | 715K | |
| Modern Astronomy.png | 2022-05-16 09:42 | 268K | |
| Modern Astronomy Banner.png | 2022-05-16 09:39 | 300K | |
| Moels of the Universe.PNG | 2022-09-23 09:24 | 932K | |
| Monthly Moon Cycle.png | 2022-05-12 12:43 | 76K | |
| Moon 1.png | 2022-05-12 13:24 | 137K | |
| Moon Banner.png | 2022-05-12 12:30 | 65K | |
| Moon Banner 1.png | 2022-05-12 13:20 | 135K | |
| Moon Banner 2.png | 2022-05-31 15:36 | 135K | |
| Moon Control the Tides.png | 2022-05-17 14:32 | 628K | |
| Moon Formation Simulation.png | 2022-06-01 10:40 | 247K | |
| Moon Origin.png | 2022-06-01 10:21 | 184K | |
| Moon Phases.png | 2022-05-17 13:43 | 267K | |
| Moon Phases Ovrer a Single Month.png | 2022-05-12 12:47 | 288K | |
| Moon Phass.png | 2022-05-12 12:36 | 230K | |
| Moon Properties.png | 2022-05-31 15:38 | 267K | |
| Moon and Mervury.png | 2022-05-31 15:59 | 572K | |
| Moon banner 5.png | 2022-06-01 10:19 | 101K | |
| Moons Orbit Animation.png | 2022-05-12 13:35 | 153K | |
| Moons of All the planets.png | 2022-05-10 11:24 | 514K | |
| Motions of Satellites.PNG | 2022-05-16 14:53 | 465K | |
| Moving Martian Clouds.png | 2022-06-02 09:09 | 517K | |
| Multiverse Theory.PNG | 2022-09-23 13:44 | 777K | |
| Multple uses.PNG | 2022-09-23 13:54 | 529K | |
| Music-Appreciation-1621008016.pdf | 2022-05-13 12:41 | 27M | |
| Myth of Cassiopia.PNG | 2022-05-09 13:25 | 153K | |
| Nasa.PNG | 2022-06-06 11:38 | 626K | |
| Nature of Science.PNG | 2022-05-13 11:06 | 389K | |
| Near Earth Objects.PNG | 2022-06-06 09:43 | 294K | |
| Nearest Planets banner.png | 2022-06-01 14:51 | 231K | |
| Nearest planets.png | 2022-06-01 15:01 | 294K | |
| Neptun1e.png | 2022-06-02 12:51 | 563K | |
| Neptune.png | 2022-05-16 15:46 | 154K | |
| Neptune Banner.png | 2022-05-16 15:44 | 113K | |
| Nervous System 1 Banner.png | 2022-05-04 11:38 | 194K | |
| New Alien Life.png | 2022-05-26 12:08 | 667K | |
| New Binary Star.PNG | 2022-09-15 08:59 | 556K | |
| Newtons Great Synthesis.PNG | 2022-05-16 12:24 | 426K | |
| Newtons Law.png | 2022-05-16 13:03 | 311K | |
| Newtons law of gravity.PNG | 2022-05-16 12:51 | 457K | |
| Newtons law of motion.PNG | 2022-05-16 12:30 | 657K | |
| North Star.png | 2022-05-05 13:34 | 246K | |
| North Star1.png | 2022-05-05 13:45 | 109K | |
| North Star Banner.png | 2022-05-05 13:32 | 154K | |
| Numbers in Astronomy.PNG | 2022-05-13 11:21 | 394K | |
| Nursing-Fundamentals-1650419452.pdf | 2022-05-13 11:57 | 86M | |
| Nursing-Skills-1649165302 (2).pdf | 2022-05-13 11:57 | 137M | |
| OCeans.png | 2022-05-11 16:19 | 245K | |
| Observations from the Earths Atmosphere.png | 2022-05-19 15:31 | 393K | |
| Observatiory 1.png | 2022-05-19 17:00 | 220K | |
| Observatiory Banner.png | 2022-05-19 16:58 | 279K | |
| Observatory.png | 2022-05-13 09:53 | 301K | |
| Observatory banner.png | 2022-05-19 16:19 | 277K | |
| Observe meteor shower.PNG | 2022-06-06 11:58 | 596K | |
| Observing the Sky.PNG | 2022-05-13 14:13 | 435K | |
| Obsevatory Banner.png | 2022-05-05 16:24 | 200K | |
| Ocean Moon Tides.png | 2022-05-17 14:17 | 65K | |
| Ocean Moon Tides1.png | 2022-05-17 14:22 | 126K | |
| Ocean Moon Tides banner.png | 2022-05-17 14:13 | 263K | |
| Oceans Absorb More Heat.png | 2022-05-11 16:02 | 759K | |
| Oceans banner.png | 2022-05-11 16:16 | 413K | |
| Ocean tides.png | 2022-05-19 15:01 | 565K | |
| Olympus Mons.PNG | 2022-06-06 15:45 | 540K | |
| Oort Cloud.PNG | 2022-06-06 10:34 | 456K | |
| Opposite SIde.png | 2022-05-17 14:54 | 608K | |
| Orbits.png | 2022-05-16 14:04 | 138K | |
| Orbits banner.png | 2022-05-16 14:03 | 267K | |
| Orbits in the Solar System.PNG | 2022-05-16 13:58 | 427K | |
| Organisms and Their Environment.png | 2022-05-04 11:49 | 314K | |
| Organisms and Their Environment Banner.png | 2022-05-04 11:48 | 400K | |
| Origin.PNG | 2022-06-06 12:54 | 254K | |
| Origin.png | 2022-05-26 15:41 | 691K | |
| Origin of the Moon.png | 2022-05-31 15:31 | 465K | |
| Origin of the moon1.png | 2022-06-01 10:32 | 446K | |
| Origins of Comets.png | 2022-06-03 10:35 | 184K | |
| Ottamnan Empire.png | 2022-05-03 11:48 | 541K | |
| Our Universe.PNG | 2022-09-21 14:34 | 273K | |
| Outer PLan.png | 2022-06-02 11:32 | 399K | |
| Outer PLan Ba.png | 2022-06-02 12:20 | 144K | |
| Outer Planets.png | 2022-06-02 11:27 | 258K | |
| Outer Planets Banner.png | 2022-06-02 11:25 | 326K | |
| Outer plan banner.png | 2022-06-02 12:17 | 346K | |
| P Model.PNG | 2022-05-13 15:26 | 312K | |
| Particle Model oF Light.png | 2022-05-18 15:37 | 273K | |
| Patterns of the Sun.png | 2022-05-17 09:02 | 321K | |
| Perspective.png | 2022-09-21 15:56 | 277K | |
| Phases Moon.png | 2022-05-17 13:32 | 89K | |
| Phases Moon1.png | 2022-05-17 13:34 | 87K | |
| Phases of the Moons.png | 2022-05-17 13:39 | 146K | |
| Phases of the moon.png | 2022-05-12 13:45 | 601K | |
| Photosphere.png | 2022-06-07 13:36 | 348K | |
| Photosynthesis Argument Driven Inquiry - Data Set (Unit 4 Virtual Lab).pdf | 2022-05-04 09:15 | 257K | |
| Photosynthesis Argument Driven Inquiry - Lab Guide Worksheet (Unit 4 Virtual Lab).pdf | 2022-05-05 08:30 | 154K | |
| Pilates.png | 2022-05-18 12:53 | 271K | |
| Pinwheel Galaxsy.PNG | 2022-09-22 11:28 | 906K | |
| Planet Atmosphere.png | 2022-06-02 12:38 | 472K | |
| Planet Orbits.PNG | 2022-05-16 10:50 | 887K | |
| Planet System banner.png | 2022-06-06 14:01 | 353K | |
| Planet Theory.png | 2022-05-27 11:20 | 140K | |
| Planet and the Zodiac.PNG | 2022-05-06 13:14 | 385K | |
| Planetary Defense.PNG | 2022-06-06 09:34 | 845K | |
| Planetary Motion.PNG | 2022-05-16 10:34 | 723K | |
| Planetary Rings.png | 2022-06-03 09:32 | 175K | |
| Planetary Rings1.png | 2022-06-03 09:33 | 190K | |
| Planetary System.png | 2022-05-27 09:00 | 253K | |
| Planetary System1.png | 2022-06-06 14:03 | 287K | |
| Planetary System Banner.png | 2022-05-27 08:58 | 280K | |
| Planetary Systems1.PNG | 2022-06-06 14:08 | 670K | |
| Planet astrology.png | 2022-05-05 15:24 | 321K | |
| Planets.png | 2022-05-27 09:50 | 50K | |
| Planets1.png | 2022-06-01 14:55 | 281K | |
| Planets Banner.png | 2022-05-27 09:49 | 195K | |
| PlanetsBecomeMoons.png | 2022-05-10 11:34 | 804K | |
| Planets and Moon.png | 2022-05-10 11:13 | 149K | |
| Planets and Moon Banner.png | 2022-05-10 11:11 | 126K | |
| Planets and the Zodiac.png | 2022-05-05 15:27 | 283K | |
| Plate Tectnoics.png | 2022-05-03 13:15 | 260K | |
| Plate tect.png | 2022-05-27 14:14 | 516K | |
| Plate tectonics Banner.png | 2022-05-03 13:07 | 470K | |
| Plnetary Motion.png | 2022-05-16 11:22 | 229K | |
| Plnetary Motion banner.png | 2022-05-16 11:16 | 244K | |
| Pluto.png | 2022-06-03 08:48 | 352K | |
| Pluto Banner.png | 2022-06-03 09:01 | 120K | |
| Pluto Char.png | 2022-06-03 09:06 | 84K | |
| Pluto Characterisrtics.png | 2022-06-03 08:42 | 428K | |
| Pluto Charon.png | 2022-06-03 08:35 | 185K | |
| Pluto Surface.png | 2022-06-03 08:45 | 704K | |
| Pluto a.png | 2022-06-03 08:38 | 603K | |
| Pluto and Charon.png | 2022-06-02 14:13 | 350K | |
| Polaris, The North Star.png | 2022-05-05 13:49 | 633K | |
| Problems with Big Bang Theory.PNG | 2022-09-23 12:28 | 771K | |
| Projects.png | 2022-05-05 17:04 | 36K | |
| Projects 1.png | 2022-05-05 17:07 | 127K | |
| Properites of the Moon.png | 2022-05-31 15:24 | 328K | |
| Properties of Earth.png | 2022-05-27 12:31 | 189K | |
| Properties of Galaxies.PNG | 2022-09-22 11:12 | 896K | |
| Properties of Light.png | 2022-05-19 09:12 | 399K | |
| Radar Astronomy.png | 2022-05-26 12:11 | 464K | |
| Radiation Spectra.png | 2022-05-18 13:23 | 181K | |
| Radio Telesceopes.png | 2022-05-26 12:01 | 787K | |
| Radio Telescope.png | 2022-05-26 11:57 | 236K | |
| Radio Telescope Banner.png | 2022-05-26 11:55 | 440K | |
| Radio waves from space.png | 2022-05-26 12:05 | 579K | |
| Reason for the Seasons.png | 2022-05-11 15:19 | 507K | |
| Red Shift.png | 2022-05-19 15:03 | 212K | |
| Resubmission Policy | 2022-05-04 09:27 | 374K | |
| Rings and Moons.png | 2022-06-02 14:54 | 263K | |
| Rings of Saturn.png | 2022-06-03 09:43 | 466K | |
| Rotation of Mercury.png | 2022-06-01 11:42 | 82K | |
| Rotation of the Earth.PNG | 2022-05-06 13:36 | 457K | |
| Rotation vs Rev.PNG | 2022-05-06 13:29 | 356K | |
| Sattellite banner.png | 2022-05-16 15:08 | 250K | |
| Saturn.png | 2022-06-02 12:45 | 361K | |
| Science and Society.png | 2022-05-04 12:29 | 105K | |
| Science and Society Banner.png | 2022-05-04 12:12 | 394K | |
| Science and the Universe.png | 2022-05-13 10:29 | 281K | |
| Scopes.png | 2022-05-26 14:33 | 197K | |
| Seasons.png | 2022-05-17 08:54 | 348K | |
| Seasons1.png | 2022-05-17 09:21 | 355K | |
| Seasons in the year.png | 2022-05-05 17:56 | 436K | |
| Seasosn Banner.png | 2022-05-17 09:12 | 389K | |
| Sesmic Waves.PNG | 2022-09-22 08:50 | 462K | |
| Signs and Planets.png | 2022-05-05 15:31 | 553K | |
| Sky Above.png | 2022-05-13 13:53 | 249K | |
| Solar Banner.png | 2022-06-09 08:11 | 304K | |
| Solar C.png | 2022-06-07 14:22 | 606K | |
| Solar Cycle.png | 2022-06-07 08:52 | 688K | |
| Solar Cycle 1.png | 2022-06-07 12:34 | 258K | |
| Solar Cycle Banner.png | 2022-06-07 12:31 | 190K | |
| Solar Eclipse.png | 2022-05-17 16:00 | 374K | |
| Solar Flare.png | 2022-06-07 14:17 | 674K | |
| Solar Flares.png | 2022-06-07 14:11 | 772K | |
| Solar Interior.png | 2022-06-08 12:17 | 305K | |
| Solar Spot and Sun Ccyle.png | 2022-06-07 13:00 | 569K | |
| Solar Storms.png | 2022-06-07 14:42 | 753K | |
| Solar System.png | 2022-06-06 13:10 | 269K | |
| Solar System Image.png | 2022-05-03 09:32 | 194K | |
| Solar System Nebula.png | 2022-05-27 11:16 | 568K | |
| Solar Systems.png | 2022-05-26 15:28 | 168K | |
| Solar interior banner.png | 2022-06-08 12:13 | 228K | |
| Solar system banner.png | 2022-06-06 13:08 | 256K | |
| Solar vs Slid.png | 2022-05-17 10:13 | 363K | |
| Solictice and Equinox.png | 2022-05-05 18:00 | 259K | |
| Soltice.png | 2022-05-11 12:37 | 115K | |
| Sources of Energy.png | 2022-06-07 16:50 | 264K | |
| Sp Weather.png | 2022-06-07 14:36 | 183K | |
| Space Expo Banner.png | 2022-05-03 11:23 | 154K | |
| Space Station.png | 2022-05-03 12:25 | 204K | |
| Space Weather.png | 2022-06-07 08:55 | 554K | |
| Space Weather Explained.png | 2022-06-07 14:39 | 577K | |
| Space Weather banner.png | 2022-06-07 14:33 | 219K | |
| Spacecraft.png | 2022-05-16 15:10 | 228K | |
| Spec in Astronomy.png | 2022-05-19 09:07 | 105K | |
| Spect.PNG | 2022-05-20 10:45 | 347K | |
| Spectra Line.png | 2022-06-08 12:52 | 255K | |
| Spectra Lines.png | 2022-05-19 13:45 | 104K | |
| Spectra Lines Banner.png | 2022-05-19 13:36 | 309K | |
| Spectrsopy.png | 2022-05-19 09:02 | 320K | |
| Spectrsopy1.png | 2022-05-19 09:04 | 154K | |
| Spectrum.png | 2022-05-18 16:26 | 205K | |
| Spiral Arms.PNG | 2022-09-21 09:14 | 476K | |
| Spiral Galaxy.png | 2022-09-21 08:01 | 267K | |
| Spiral Galaxy banner.png | 2022-09-21 08:04 | 359K | |
| Spiral Shapped Galaxies.PNG | 2022-09-21 09:10 | 1.0M | |
| Spiral galaxy 1.PNG | 2022-09-21 08:54 | 1.0M | |
| Star Blocked by the moon.PNG | 2022-09-15 09:36 | 101K | |
| Star Clusters.PNG | 2022-05-16 15:34 | 717K | |
| Star Colors.PNG | 2022-06-13 14:33 | 1.0M | |
| Star Dust.PNG | 2022-06-13 15:11 | 923K | |
| Star Luminosity.png | 2022-06-09 14:34 | 645K | |
| Star Size Comparison.PNG | 2022-09-15 09:31 | 918K | |
| Star Spectra.png | 2022-06-09 14:30 | 656K | |
| Stargazer Banner.png | 2022-05-04 13:05 | 295K | |
| Starlight.png | 2022-06-09 13:59 | 676K | |
| Starlight5.png | 2022-06-09 14:20 | 378K | |
| Starlight51.png | 2022-06-09 14:24 | 1.1M | |
| Starlight banner.png | 2022-09-15 10:19 | 281K | |
| Stars.png | 2022-09-15 09:16 | 220K | |
| Stars1.png | 2022-09-15 09:18 | 283K | |
| Stars Banner.png | 2022-06-13 13:38 | 413K | |
| Stars Bright.png | 2022-06-13 13:42 | 316K | |
| Stars Diameter Banner.png | 2022-09-15 09:14 | 305K | |
| Stars and Population.PNG | 2022-09-21 13:08 | 946K | |
| Stars from.PNG | 2022-09-23 13:47 | 455K | |
| Stefan Bolizmann Law.png | 2022-05-18 16:40 | 232K | |
| Stellar.png | 2022-09-14 13:39 | 265K | |
| Stellar Census.PNG | 2022-09-14 12:05 | 186K | |
| Stellar Mass Banner.png | 2022-09-15 08:26 | 367K | |
| Stellar Masses.PNG | 2022-09-14 13:47 | 68K | |
| Stellar Pop.png | 2022-09-21 12:58 | 215K | |
| Stellar Population.PNG | 2022-09-21 12:51 | 622K | |
| Steller Spectra.png | 2022-05-19 09:14 | 121K | |
| Stonehenge.png | 2022-05-17 13:18 | 599K | |
| Strs banners.png | 2022-06-13 14:20 | 305K | |
| Structure and Compostion of the universe.PNG | 2022-09-23 11:54 | 306K | |
| Structure and Compure of Sun.png | 2022-06-07 11:01 | 281K | |
| Structure of Mercury.png | 2022-06-01 11:37 | 479K | |
| Structure of an Atom.png | 2022-05-19 11:30 | 128K | |
| Structure of an Atom Banner.png | 2022-05-19 11:34 | 246K | |
| Structure of the Moon.png | 2022-05-31 15:50 | 310K | |
| Summer Soltice.png | 2022-05-17 09:07 | 311K | |
| Summer and Winter.png | 2022-05-11 14:29 | 881K | |
| Summer and Winter banner.png | 2022-05-11 14:23 | 350K | |
| Sun.png | 2022-06-07 11:22 | 257K | |
| Sun Activity.png | 2022-06-07 14:07 | 635K | |
| SunShine Banner.png | 2022-06-07 16:46 | 403K | |
| SunSports.png | 2022-06-07 12:50 | 560K | |
| Sun banner.png | 2022-06-07 11:22 | 125K | |
| Sundial banner.png | 2022-05-10 15:27 | 331K | |
| Sundials Anatomy with a stick.png | 2022-05-10 15:39 | 616K | |
| SundialsAncient.png | 2022-05-11 08:12 | 189K | |
| Sundialss.png | 2022-05-10 15:31 | 726K | |
| Sundial work.png | 2022-05-04 14:46 | 337K | |
| Sun energy.png | 2022-06-07 16:11 | 398K | |
| Sunrise.png | 2022-05-04 15:17 | 142K | |
| Sunrise banner.png | 2022-05-04 15:15 | 264K | |
| Sunset at Sundial Bridge.png | 2022-05-11 10:48 | 787K | |
| SuperMassiveBlackHoles.PNG | 2022-09-21 12:30 | 747K | |
| Surey YTelescope.PNG | 2022-05-06 12:47 | 1.1M | |
| Surface of mars.png | 2022-06-01 15:44 | 639K | |
| Sych.png | 2022-05-17 14:05 | 97K | |
| Telecope Astronomy.png | 2022-09-26 10:27 | 229K | |
| Telescope1.png | 2022-05-19 16:22 | 172K | |
| Telescopes today.png | 2022-05-19 17:06 | 585K | |
| Teory.png | 2022-06-08 09:40 | 366K | |
| Terr Planets.PNG | 2022-06-06 13:45 | 792K | |
| The 8 Phases of the Moon.png | 2022-05-17 13:49 | 511K | |
| The BiG Dipper Video.PNG | 2022-05-09 11:51 | 714K | |
| The Big Dipper.png | 2022-05-09 11:39 | 298K | |
| The Big Dipper Banner.png | 2022-05-09 11:29 | 203K | |
| The Bohr Atom.png | 2022-05-19 12:33 | 66K | |
| The Center of the Galaxy.PNG | 2022-09-21 12:27 | 924K | |
| The Crusts.png | 2022-05-27 14:11 | 573K | |
| The Doppler Effect.png | 2022-05-19 14:58 | 780K | |
| The Earth's Crust.png | 2022-05-27 14:07 | 566K | |
| The Ecliptic.png | 2022-05-10 09:37 | 68K | |
| The Ecliptic of the Sun.png | 2022-05-10 10:27 | 523K | |
| The Ecliptics.png | 2022-05-10 10:22 | 435K | |
| The Electromagnetic Spectrum.png | 2022-05-18 16:28 | 602K | |
| The Extra.png | 2022-09-22 12:20 | 137K | |
| The Extra Distance Scale.PNG | 2022-09-22 11:54 | 575K | |
| The First 10 seconds.PNG | 2022-09-23 10:34 | 1.0M | |
| The Gas Giants.png | 2022-06-02 10:52 | 559K | |
| The Giant Planets.png | 2022-05-27 10:01 | 686K | |
| The Great Bear.PNG | 2022-05-09 13:43 | 141K | |
| The Hubble Space Telescope.png | 2022-05-26 14:09 | 588K | |
| The JuliandGrogorian .png | 2022-05-17 13:12 | 362K | |
| The Laws of Nature.PNG | 2022-05-13 10:39 | 382K | |
| The Laws of Nature 1.PNG | 2022-05-13 10:46 | 788K | |
| The Laws of nature 2.PNG | 2022-05-13 11:10 | 376K | |
| The Moon.png | 2022-05-31 15:48 | 575K | |
| The Nature of Astronomy.PNG | 2022-05-13 09:57 | 395K | |
| The Nature of Science.PNG | 2022-05-13 10:35 | 634K | |
| The Outer Planets.png | 2022-06-02 10:39 | 370K | |
| The Sun.PNG | 2022-05-06 09:53 | 898K | |
| The Sun.png | 2022-06-07 08:47 | 323K | |
| The first day of summer.png | 2022-05-11 15:50 | 529K | |
| Theory of Re.png | 2022-06-07 16:16 | 914K | |
| They Sky Abov.PNG | 2022-05-13 14:16 | 336K | |
| Tides Explained.png | 2022-05-17 14:45 | 309K | |
| Time Lapse.png | 2022-05-10 16:30 | 886K | |
| Time Lapse Solar System.PNG | 2022-06-06 11:34 | 690K | |
| Timeline.png | 2022-05-17 10:38 | 258K | |
| Timeline of Venus.png | 2022-06-01 15:08 | 269K | |
| Tital Moon Vol.png | 2022-06-02 16:21 | 281K | |
| Tital Mooons.png | 2022-06-02 16:07 | 142K | |
| Top 5 Famous Cometsd.PNG | 2022-06-06 10:05 | 609K | |
| Tour of the Universe.PNG | 2022-05-13 10:42 | 405K | |
| Track Solar Cyclw.png | 2022-06-07 12:56 | 557K | |
| Trition Moon.png | 2022-06-02 14:10 | 665K | |
| Triton Moons.png | 2022-06-02 16:13 | 439K | |
| Tritron Moon.png | 2022-06-02 16:16 | 237K | |
| Types of Galaxies.PNG | 2022-09-22 10:45 | 1.0M | |
| Types of Galaxies 1.PNG | 2022-09-22 11:32 | 412K | |
| Types of Meter.PNG | 2022-06-06 12:46 | 692K | |
| Types of Rna.png | 2022-05-05 17:49 | 286K | |
| Types of Spectra.png | 2022-05-19 09:18 | 187K | |
| Types of Stars.PNG | 2022-09-21 13:03 | 932K | |
| Types of Telescopes.png | 2022-05-19 15:24 | 361K | |
| UV Rays.png | 2022-05-18 16:36 | 306K | |
| Understanding Music_ Past and Present.pdf | 2022-05-13 12:42 | 8.7M | |
| Understanding universal law.PNG | 2022-05-16 10:43 | 915K | |
| Unexplained Craters.png | 2022-06-01 10:02 | 595K | |
| Universe.png | 2022-09-23 10:12 | 335K | |
| Universe0 Banner.png | 2022-09-13 08:26 | 443K | |
| Universe Banner.png | 2022-05-03 09:26 | 382K | |
| Universe Banner1.png | 2022-09-23 08:43 | 278K | |
| Universe Banner 2.png | 2022-09-23 10:12 | 278K | |
| Universe on large Scale.PNG | 2022-05-13 12:22 | 422K | |
| Universe small.PNG | 2022-05-13 12:26 | 419K | |
| Uranus System.png | 2022-06-02 15:03 | 181K | |
| Uranus and Neptune.png | 2022-06-03 09:46 | 743K | |
| Ursa vs Ursa.PNG | 2022-05-09 12:14 | 273K | |
| Variable Star.PNG | 2022-09-22 12:23 | 950K | |
| Venus.png | 2022-06-01 13:22 | 611K | |
| Venus2.png | 2022-06-01 15:38 | 453K | |
| Venus Atmosphere.png | 2022-06-01 16:17 | 319K | |
| Venus Atmosphere Banner.png | 2022-06-01 16:15 | 211K | |
| Venus Banner.png | 2022-06-01 15:27 | 378K | |
| Venus Geo.png | 2022-06-01 15:29 | 230K | |
| Venus Surface.png | 2022-06-01 15:51 | 652K | |
| Venus and Mars.png | 2022-06-01 15:12 | 804K | |
| Venus now and then.png | 2022-06-02 09:57 | 502K | |
| Vesta Asteroid.png | 2022-06-03 11:12 | 371K | |
| Vesto.PNG | 2022-09-22 14:12 | 370K | |
| Visbible Light.png | 2022-05-20 10:29 | 182K | |
| Volcanoes.png | 2022-05-27 14:17 | 552K | |
| WInter soltice banner.png | 2022-05-11 12:13 | 291K | |
| Warming oCeans.png | 2022-05-11 15:59 | 615K | |
| Water on Mars.png | 2022-06-02 09:00 | 410K | |
| Water on mars1.png | 2022-06-02 09:06 | 772K | |
| Weather and Atmosphere.png | 2022-05-04 08:39 | 173K | |
| Weather and Atmosphere Banner.png | 2022-05-04 08:36 | 426K | |
| Weather and Climate.png | 2022-05-27 15:46 | 574K | |
| Weighing the Galaxy.PNG | 2022-09-21 09:56 | 731K | |
| What Constellations Mean.PNG | 2022-05-13 14:31 | 847K | |
| What are Ateroids.png | 2022-06-03 10:49 | 429K | |
| Whatis Astronomy.PNG | 2022-05-16 09:07 | 697K | |
| What is CMB.PNG | 2022-09-23 11:11 | 957K | |
| What is Climate Change.png | 2022-05-27 11:52 | 576K | |
| What is Climate Change 1.png | 2022-05-31 08:31 | 590K | |
| What is Cosmic Background.PNG | 2022-09-23 10:53 | 772K | |
| What is Dark.PNG | 2022-09-21 11:22 | 943K | |
| What is Dark Matter.PNG | 2022-09-21 10:00 | 1.0M | |
| What is a Met Shower.PNG | 2022-06-06 12:03 | 503K | |
| What is a Refracting Telescope.png | 2022-05-19 16:38 | 510K | |
| What is a Soltice.png | 2022-05-05 18:05 | 589K | |
| What is a Spiral Galaxy.PNG | 2022-09-22 10:50 | 899K | |
| What is a cOMET.PNG | 2022-06-06 10:39 | 1.0M | |
| What is a meteorer.PNG | 2022-06-06 11:30 | 679K | |
| What is an Equinox.png | 2022-05-11 12:50 | 352K | |
| What is a satellite.PNG | 2022-05-16 14:57 | 551K | |
| What is redshift.PNG | 2022-09-22 14:18 | 372K | |
| What is so special about the north star.PNG | 2022-05-06 11:55 | 729K | |
| What is the Ecliptic.png | 2022-05-10 10:30 | 639K | |
| What is the Universe Made of.PNG | 2022-09-23 11:33 | 857K | |
| White Dward Stars.PNG | 2022-09-14 13:51 | 468K | |
| White Dwarf stars.PNG | 2022-09-15 10:44 | 872K | |
| Wht is an Asteroid.png | 2022-06-03 10:29 | 526K | |
| Why Do Stars Shine.PNG | 2022-06-13 13:46 | 676K | |
| Why Do we Have Seasons.png | 2022-05-11 15:36 | 320K | |
| Why Do we Have Tides.png | 2022-05-17 14:50 | 663K | |
| Why Do we have different seasons.png | 2022-05-17 08:59 | 434K | |
| Why Polaris is Important.PNG | 2022-05-06 10:54 | 1.0M | |
| Why The Moon.png | 2022-06-01 08:52 | 165K | |
| Why Zodiac still Matter.PNG | 2022-05-09 16:28 | 967K | |
| Why do Planets have Rings.png | 2022-06-03 09:39 | 689K | |
| Why is the Universe Expaning.PNG | 2022-09-22 14:06 | 636K | |
| William Herchel.PNG | 2022-09-15 11:22 | 964K | |
| Winter Soltice.png | 2022-05-11 12:59 | 132K | |
| Winter Soltice Explained.png | 2022-05-11 15:31 | 668K | |
| Xrays and Gamma Rays.png | 2022-05-18 16:32 | 449K | |
| Zodia1.png | 2022-05-09 15:50 | 228K | |
| Zodiac.PNG | 2022-05-06 13:21 | 1.0M | |
| Zodiac Banner.png | 2022-05-09 15:48 | 364K | |
| Zodiac Constellations.PNG | 2022-05-09 16:25 | 722K | |
| Zodiac Constellations 1.png | 2022-05-09 16:33 | 277K | |
| Zodiac Signs and Planets.PNG | 2022-05-06 13:18 | 537K | |
| Zodiac Signs and their meanings.PNG | 2022-05-09 16:22 | 678K | |
| Zodiacs.PNG | 2022-05-09 16:18 | 935K | |
| consequences.PNG | 2022-05-13 12:57 | 426K | |
| earth Crust.png | 2022-05-27 14:01 | 222K | |
| earth Crust Banner.png | 2022-05-27 13:57 | 347K | |
| earth Rotation.png | 2022-05-05 15:46 | 205K | |
| earth Sun and Moo.png | 2022-05-03 10:05 | 387K | |
| earth Sun and Moon B1.png | 2022-05-03 09:56 | 88K | |
| earth and.png | 2022-09-26 13:06 | 247K | |
| earth and Sky Banne.png | 2022-05-17 08:09 | 451K | |
| earth as a Planet.png | 2022-05-27 11:39 | 307K | |
| earths Atmosphere 12.png | 2022-05-27 15:34 | 379K | |
| earthshine video.png | 2022-05-12 16:07 | 619K | |
| earth venus Mars.png | 2022-09-27 09:08 | 214K | |
| earth venus Mars Banner.png | 2022-09-27 09:02 | 296K | |
| environment banner.png | 2022-05-04 10:39 | 345K | |
| galatic Halo.PNG | 2022-09-21 14:07 | 653K | |
| galaxy simultion.PNG | 2022-09-21 13:40 | 929K | |
| giant Asteroids near Earth.PNG | 2022-06-06 09:47 | 115K | |
| giant Planet banner.png | 2022-06-02 12:33 | 221K | |
| giant Planets.png | 2022-06-02 12:22 | 703K | |
| history of the Atom.png | 2022-05-19 11:46 | 554K | |
| how do Satelites stay in orbit.PNG | 2022-05-16 10:55 | 793K | |
| human Body.png | 2022-05-04 11:24 | 139K | |
| human Body1.png | 2022-05-04 11:26 | 353K | |
| human body banner.png | 2022-05-04 11:22 | 321K | |
| index.jpg | 2022-05-19 08:59 | 13K | |
| inflation model.png | 2022-09-23 12:12 | 322K | |
| inflation theory explained.PNG | 2022-09-23 12:25 | 258K | |
| ion energy.png | 2022-05-19 14:26 | 458K | |
| james Webb.png | 2022-05-26 14:57 | 465K | |
| lunar Surfaces.png | 2022-06-01 09:00 | 311K | |
| mars on water.png | 2022-06-02 09:02 | 299K | |
| mass Energy.png | 2022-06-08 10:55 | 560K | |
| met types.PNG | 2022-06-06 12:48 | 693K | |
| milkywaybanner.png | 2022-09-27 15:39 | 314K | |
| nature of Science 1.png | 2022-09-13 13:28 | 65K | |
| orbital.PNG | 2022-05-16 13:51 | 357K | |
| paper Sundial.png | 2022-05-10 15:29 | 372K | |
| planet earth.PNG | 2022-06-06 15:35 | 479K | |
| radioactive Decay.png | 2022-05-27 10:49 | 424K | |
| reflector telescope.png | 2022-05-19 16:43 | 502K | |
| skin.png | 2022-09-22 11:47 | 76K | |
| sky ABove 1.png | 2022-05-13 13:56 | 303K | |
| telescope.png | 2022-05-05 14:06 | 421K | |
| telescope Banner.png | 2022-05-05 14:38 | 235K | |
| terr Planets.png | 2022-05-27 10:05 | 448K | |
| the Great Circles.png | 2022-05-17 08:34 | 467K | |
| the Largest Plantary System Banner.png | 2022-05-27 09:04 | 700K | |
| the Solar Cycle.png | 2022-06-07 12:39 | 555K | |
| the Solar System.PNG | 2022-06-06 13:40 | 833K | |
| theory of Relativ.png | 2022-06-08 09:42 | 379K | |
| top Ten Largest.png | 2022-06-03 10:56 | 314K | |
| types of Metroties.PNG | 2022-06-06 12:39 | 1.0M | |
| ultramassive gallery.PNG | 2022-09-22 10:22 | 1.0M | |
| what is a Brown Dward.PNG | 2022-09-14 13:56 | 752K | |
