![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| ADJ 1.mp4 | 2025-02-03 10:17 | 36M | |
| ADJ 2.mp4 | 2025-02-03 10:18 | 14M | |
| Basic Sentence Structure 1.mp4 | 2025-02-03 10:03 | 12M | |
| Basic Sentence Structure 2.mp4 | 2025-02-03 10:04 | 32M | |
| Capitalization 1.mp4 | 2025-02-03 10:08 | 158M | |
| Capitalization 2.mp4 | 2025-02-03 10:07 | 16M | |
| CatchMoon.mp4 | 2025-02-03 10:47 | 12M | |
| Clauses 1.mp4 | 2025-02-03 10:22 | 14M | |
| Clauses 2.mp4 | 2025-02-03 10:22 | 8.0M | |
| Creative Non Fiction.mp4 | 2025-02-03 14:31 | 89M | |
| Essay 1.mp4 | 2025-02-03 10:38 | 9.0M | |
| Essay 2.mp4 | 2025-02-03 10:38 | 30M | |
| Lesson 2 1.mp4 | 2025-02-03 14:55 | 13M | |
| Lesson 2 2.mp4 | 2025-02-03 14:56 | 48M | |
| Lesson 2 3.mp4 | 2025-02-03 14:56 | 38M | |
| Lesson 3 1.mp4 | 2025-02-03 15:04 | 435M | |
| Lesson 3 3.mp4 | 2025-02-03 15:02 | 37M | |
| Lesson 3 4.mp4 | 2025-02-03 15:02 | 13M | |
| Lesson 4 1.mp4 | 2025-02-03 15:31 | 399M | |
| Lesson 4 2.mp4 | 2025-02-03 15:30 | 12M | |
| Lesson 4 3.mp4 | 2025-02-03 15:30 | 31M | |
| Modifiers 1.mp4 | 2025-02-03 10:32 | 26M | |
| Modifiers 2.mp4 | 2025-02-03 10:32 | 6.7M | |
| Parts of Speech 1.mp4 | 2025-02-03 09:59 | 21M | |
| Parts of Speech 2.mp4 | 2025-02-03 09:59 | 26M | |
| PreWriting 1.mp4 | 2025-02-03 15:53 | 9.2M | |
| PreWriting 2.mp4 | 2025-02-03 15:53 | 35M | |
| PreWriting 3.mp4.mp4 | 2025-02-03 15:53 | 25M | |
| Prep 1.mp4 | 2025-02-03 10:20 | 5.6M | |
| Prep 2.mp4 | 2025-02-03 10:20 | 25M | |
| Pronouns 1.mp4 | 2025-02-03 10:13 | 26M | |
| Pronouns 2.mp4 | 2025-02-03 10:14 | 115M | |
| Punctuation 2.mp4 | 2025-02-03 10:10 | 12M | |
| Punctutation 1.mp4 | 2025-02-03 10:10 | 32M | |
| Speculative Fiction.mp4 | 2025-02-03 15:36 | 31M | |
| Story Elements.mp4 | 2025-02-03 10:51 | 19M | |
| Structure 1.mp4 | 2025-02-03 10:34 | 7.7M | |
| Structure 2.mp4 | 2025-02-03 10:35 | 125M | |
| U3 Lesson 2 1.mp4 | 2025-02-03 16:48 | 13M | |
| U3 Lesson 2 2.mp4 | 2025-02-03 16:48 | 145M | |
| U3 Lesson 2 3.mp4 | 2025-02-03 16:49 | 106M | |
| U3 Lesson 3 1.mp4 | 2025-02-03 16:55 | 6.3M | |
| U3 Lesson 3 2.mp4 | 2025-02-03 16:57 | 111M | |
| U3 Lesson 3 3.mp4 | 2025-02-03 16:55 | 18M | |
| U3 Lesson 4 1.mp4 | 2025-02-03 16:58 | 11M | |
| U3 Lesson 4 2.mp4 | 2025-02-03 16:59 | 23M | |
| U3 Lesson 4 3.mp4 | 2025-02-03 16:59 | 10M | |
| U3 Lesson 5 1.mp4 | 2025-02-03 17:02 | 55M | |
| U3 Lesson 5 2.mp4 | 2025-02-03 17:02 | 5.9M | |
| U3 Lesson 5 3.mp4 | 2025-02-03 17:02 | 7.1M | |
| Unit 1 Lesson 1 1.mp4 | 2025-02-03 10:59 | 19M | |
| Unit 1 Lesson 1 1 S2.mp4 | 2025-02-03 13:46 | 25M | |
| Unit 1 Lesson 1 2.mp4 | 2025-02-03 10:59 | 329M | |
| Unit 1 Lesson 1 2 S2.mp4 | 2025-02-03 13:46 | 8.4M | |
| Unit 1 Lesson 1 3.mp4 | 2025-02-03 10:59 | 361M | |
| Unit 1 Lesson 1 3 S2.mp4 | 2025-02-03 13:46 | 42M | |
| Unit 1 Lesson 2 1.mp4 | 2025-02-03 11:04 | 26M | |
| Unit 1 Lesson 2 1 S2.mp4 | 2025-02-03 13:59 | 1.8M | |
| Unit 1 Lesson 2 2.mp4 | 2025-02-03 11:04 | 2.8M | |
| Unit 1 Lesson 2 2 S2.mp4 | 2025-02-03 13:59 | 2.1M | |
| Unit 1 Lesson 2 3.mp4 | 2025-02-03 11:05 | 186M | |
| Unit 1 Lesson 2 3 S2.mp4 | 2025-02-03 13:59 | 16M | |
| Unit 1 Lesson 3 1.mp4 | 2025-02-03 11:09 | 48M | |
| Unit 1 Lesson 3 1 S2.mp4 | 2025-02-03 14:12 | 11M | |
| Unit 1 Lesson 3 2.mp4 | 2025-02-03 11:09 | 12M | |
| Unit 1 Lesson 3 2 S2.mp4 | 2025-02-03 14:12 | 6.0M | |
| Unit 1 Lesson 3 3.mp4 | 2025-02-03 11:09 | 26M | |
| Unit 1 Lesson 3 3 S2.mp4 | 2025-02-03 14:12 | 41M | |
| Unit 1 Lesson 4 1.mp4 | 2025-02-03 11:14 | 223M | |
| Unit 1 Lesson 4 1 S2.mp4 | 2025-02-03 14:23 | 2.1M | |
| Unit 1 Lesson 4 2.mp4 | 2025-02-03 11:13 | 20M | |
| Unit 1 Lesson 4 2 S2.mp4 | 2025-02-03 14:23 | 76M | |
| Unit 1 Lesson 4 3.mp4 | 2025-02-03 11:15 | 191M | |
| Unit 1 Lesson 4 3 S2.mp4 | 2025-02-03 14:22 | 4.4M | |
| Unit 1 Overview 1.mp4 | 2025-02-03 13:34 | 22M | |
| Unit 1 Overview 2.mp4 | 2025-02-03 13:34 | 2.8M | |
| Unit 1 Overview 3.mp4 | 2025-02-03 13:35 | 67M | |
| Unit 1 Overview 4.mp4 | 2025-02-03 13:36 | 199M | |
| Unit 2 Lesson 1 1.mp4 | 2025-02-03 11:29 | 22M | |
| Unit 2 Lesson 1 1 S2.mp4 | 2025-02-03 14:49 | 15M | |
| Unit 2 Lesson 1 2.mp4 | 2025-02-03 11:29 | 16M | |
| Unit 2 Lesson 1 2 S2.mp4 | 2025-02-03 14:49 | 14M | |
| Unit 2 Lesson 1 3.mp4 | 2025-02-03 11:30 | 21M | |
| Unit 2 Lesson 1 3 S2.mp4 | 2025-02-03 14:49 | 15M | |
| Unit 2 Lesson 2 1.mp4 | 2025-02-03 11:35 | 15M | |
| Unit 2 Lesson 2 2.mp4 | 2025-02-03 11:35 | 65M | |
| Unit 2 Lesson 2 3.mp4 | 2025-02-03 11:35 | 25M | |
| Unit 2 Lesson 3 1.mp4 | 2025-02-03 12:02 | 19M | |
| Unit 2 Lesson 3 2.mp4 | 2025-02-03 12:02 | 9.8M | |
| Unit 2 Lesson 3 3.mp4 | 2025-02-03 12:02 | 25M | |
| Unit 2 Lesson 4 1.mp4 | 2025-02-03 12:12 | 17M | |
| Unit 2 Lesson 4 2.mp4 | 2025-02-03 12:12 | 16M | |
| Unit 2 Lesson 4 3.mp4 | 2025-02-03 12:12 | 13M | |
| Unit 2 Lesson 5 1.mp4 | 2025-02-03 12:17 | 33M | |
| Unit 2 Lesson 5 2.mp4 | 2025-02-03 12:17 | 23M | |
| Unit 2 Lesson 5 3.mp4 | 2025-02-03 12:18 | 18M | |
| Unit 2 Overview 1.mp4 | 2025-02-03 11:23 | 8.2M | |
| Unit 2 Overview 1 S2.mp4 | 2025-02-03 14:39 | 41M | |
| Unit 2 Overview 2.mp4 | 2025-02-03 11:24 | 158M | |
| Unit 2 Overview 2 S2.mp4 | 2025-02-03 14:39 | 34M | |
| Unit 2 Overview 3.mp4 | 2025-02-03 11:23 | 16M | |
| Unit 2 Overview 3 S2.mp4 | 2025-02-03 14:39 | 13M | |
| Unit 2 Overview 4.mp4 | 2025-02-03 11:24 | 57M | |
| Unit 2 Overview 4 S2.mp4 | 2025-02-03 14:39 | 23M | |
| Unit 3 Lesson 1 1.mp4 | 2025-02-03 12:51 | 10M | |
| Unit 3 Lesson 1 2.mp4 | 2025-02-03 12:51 | 138M | |
| Unit 3 Lesson 1 3.mp4 | 2025-02-03 12:51 | 11M | |
| Unit 3 Lesson 2 1.mp4 | 2025-02-03 12:59 | 45M | |
| Unit 3 Lesson 2 2.mp4 | 2025-02-03 12:59 | 23M | |
| Unit 3 Lesson 2 3.mp4 | 2025-02-03 12:59 | 43M | |
| Unit 3 Lesson 3 1.mp4 | 2025-02-03 13:04 | 1.6M | |
| Unit 3 Lesson 3 2.mp4 | 2025-02-03 13:04 | 2.1M | |
| Unit 3 Lesson 3 3.mp4 | 2025-02-03 13:04 | 2.0M | |
| Unit 3 Lesson 4 1.mp4 | 2025-02-03 13:09 | 14M | |
| Unit 3 Lesson 4 2.mp4 | 2025-02-03 13:09 | 9.0M | |
| Unit 3 Lesson 4 3.mp4 | 2025-02-03 13:09 | 12M | |
| Unit 3 Overview 1.mp4 | 2025-02-03 12:31 | 10M | |
| Unit 3 Overview 1 S2.mp4 | 2025-02-03 15:47 | 38M | |
| Unit 3 Overview 2.mp4 | 2025-02-03 12:31 | 9.4M | |
| Unit 3 Overview 2 S2.mp4 | 2025-02-03 15:47 | 5.0M | |
| Unit 3 Overview 3.mp4 | 2025-02-03 12:31 | 101M | |
| Unit 3 Overview 3 S2.mp4 | 2025-02-03 15:47 | 95M | |
| Unit 3 Overview 4.mp4 | 2025-02-03 12:31 | 14M | |
| Unit 3 Overview 4 S2.mp4 | 2025-02-03 15:47 | 6.5M | |
| Unit 3 Overview 5 S2.mp4 | 2025-02-03 15:47 | 11M | |
| Unit 3 Poetry Project.mp4 | 2025-02-03 13:25 | 15M | |