![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Unit 1 Vocabulary1.pdf | 2024-04-10 11:45 | 2.4M | |
| Unit 1 Scientific Method.pdf | 2024-04-10 11:45 | 6.8M | |
| Unit 10 Acids Bases and Salt Banner Vocabulary.pdf | 2024-04-10 11:45 | 1.2M | |
| Unit 10 Acids Bases and Salt Banner 1.pdf | 2024-04-10 11:45 | 6.0M | |
| Unit 11 Chemical Reactions.pdf | 2024-04-10 11:45 | 9.4M | |
| Unit 11 Chemical Reactions (1).pdf | 2024-04-10 11:45 | 9.4M | |
| Unit 11 Vocabulary1.pdf | 2024-04-10 11:45 | 1.0M | |
| Unit 12 Vocabulary1.pdf | 2024-04-10 11:45 | 126K | |
| Unit 13 Forms of Energy.pdf | 2024-04-10 11:45 | 3.6M | |
| Unit 14 Force and Motion.pdf | 2024-04-10 11:45 | 4.7M | |
| Unit 14 Vocabulary1.pdf | 2024-04-10 11:45 | 870K | |
| Unit 13 Vocabulary1.pdf | 2024-04-10 11:45 | 205K | |
| Unit 15 Macchines.pdf | 2024-04-10 11:46 | 7.3M | |
| Unit 16 Magnetisim.pdf | 2024-04-10 11:46 | 5.7M | |
| Unit 16 Vocabulary1.pdf | 2024-04-10 11:46 | 1.5M | |
| Unit 17 Electricty.pdf | 2024-04-10 11:46 | 7.3M | |
| Unit 17 Vocabulary1.pdf | 2024-04-10 11:46 | 1.2M | |
| Unit 15 Vocabulary1.pdf | 2024-04-10 11:46 | 962K | |
| Unit 18 Nuclear Energy.pdf | 2024-04-10 11:46 | 8.5M | |
| Unit 19 Temprature.pdf | 2024-04-10 11:46 | 4.9M | |
| Unit 19 Vocabulary1.pdf | 2024-04-10 11:46 | 1.0M | |
| Unit 2 Scientific Measurement.pdf | 2024-04-10 11:46 | 3.8M | |
| Unit 2 Vocabulary1.pdf | 2024-04-10 11:46 | 1.7M | |
| Unit 20 Vocabulary1.pdf | 2024-04-10 11:46 | 318K | |
| Unit 20 Waves.pdf | 2024-04-10 11:46 | 4.4M | |
| Unit 21 Science Society.pdf | 2024-04-10 11:47 | 5.3M | |
| Unit 18 Vocabulary1.pdf | 2024-04-10 11:47 | 1.0M | |
| Unit 21 Vocabulary1.pdf | 2024-04-10 11:47 | 382K | |
| Unit 3 Vocabulary1.pdf | 2024-04-10 11:47 | 967K | |
| Unit 4 Changes in Matter.pdf | 2024-04-10 11:47 | 1.0M | |
| Unit 4 Vocabulary1.pdf | 2024-04-10 11:47 | 134K | |
| Unit 5 Introduction to the Atom.pdf | 2024-04-10 11:47 | 4.9M | |
| Unit 5 Vocabulary1.pdf | 2024-04-10 11:47 | 695K | |
| Unit 6 Atomic Theory.pdf | 2024-04-10 11:47 | 9.4M | |
| Unit 6 Vocabulary1.pdf | 2024-04-10 11:47 | 520K | |
| Unit 3 Matter.pdf | 2024-04-10 11:47 | 3.6M | |
| Unit 7 Structure of Matter.pdf | 2024-04-10 11:47 | 3.5M | |
| Unit 7 Vocabulary1.pdf | 2024-04-10 11:47 | 197K | |
| Unit 8 Chemical Equations (1).pdf | 2024-04-10 11:47 | 3.3M | |
| Unit 8 Vocabulary1.pdf | 2024-04-10 11:47 | 189K | |
| Unit 9 Solutions and Suspensions.pdf | 2024-04-10 11:47 | 2.3M | |
| Unit 9 Vocabulary1.pdf | 2024-04-10 11:47 | 318K | |
| Unit 8 Chemical Equations.pdf | 2024-04-10 11:47 | 3.3M | |
![[IMG]](/icons/image2.gif) | 2.png | 2024-04-10 11:49 | 643K | |
| 1.png | 2024-04-10 11:49 | 574K | |
| 3.png | 2024-04-10 11:49 | 649K | |
| 4.png | 2024-04-10 11:49 | 663K | |
| 5.png | 2024-04-10 11:49 | 471K | |
| 6.png | 2024-04-10 11:49 | 419K | |
| 7.png | 2024-04-10 11:49 | 349K | |
| 8.png | 2024-04-10 11:49 | 479K | |
| 9.png | 2024-04-10 11:49 | 544K | |
| 10.png | 2024-04-10 11:49 | 342K | |
| 11.png | 2024-04-10 11:49 | 577K | |
| 12.png | 2024-04-10 11:49 | 709K | |
| 13.png | 2024-04-10 11:49 | 529K | |
| 14.png | 2024-04-10 11:49 | 736K | |
| 15.png | 2024-04-10 11:49 | 704K | |
| 16.png | 2024-04-10 11:49 | 1.0M | |
| 17.png | 2024-04-10 11:49 | 358K | |
| 18.png | 2024-04-10 11:49 | 964K | |
| 19.png | 2024-04-10 11:49 | 611K | |
| 20.png | 2024-04-10 11:49 | 813K | |
| 21.png | 2024-04-10 11:49 | 638K | |
| Unit 12 Energy Force and Work.pdf | 2024-04-10 14:55 | 1.3M | |
|
|---|
