![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| x01.png | 2023-03-24 09:41 | 1.8K | |
| x3.png | 2023-03-24 09:38 | 1.9K | |
| 5x.PNG | 2023-03-23 16:29 | 2.6K | |
| Absolute Value graph.png | 2023-03-24 10:36 | 8.2K | |
| Operation with Real NUmbers.PNG | 2023-03-23 14:52 | 8.8K | |
| 3x.PNG | 2023-03-24 09:04 | 9.5K | |
| Compound inequality.png | 2023-03-24 09:52 | 11K | |
| Absolute Value banner.png | 2023-03-24 10:20 | 16K | |
| Absolute Value.png | 2023-03-24 10:14 | 16K | |
| TTS Banner.png | 2023-03-28 10:31 | 22K | |
| FS Project.png | 2023-03-28 09:41 | 22K | |
| Absolute Value equation1.png | 2023-03-24 10:40 | 23K | |
| Real Numbers Definition.png | 2023-03-23 15:00 | 25K | |
| Absolute Value equation.png | 2023-03-24 10:40 | 33K | |
| College Ed.png | 2023-03-24 12:24 | 35K | |
| Absolute Value banner1.png | 2023-03-24 10:22 | 36K | |
| Equations both sides.png | 2023-03-23 16:33 | 39K | |
| Two Step.png | 2023-03-23 13:41 | 41K | |
| Letter of Rec.png | 2023-03-28 12:21 | 47K | |
| College Admisions Banner.png | 2023-03-28 11:07 | 50K | |
| Solving Equations.png | 2023-03-23 13:49 | 53K | |
| CpIneual.png | 2023-03-24 09:46 | 58K | |
| Forming and Solving.png | 2023-03-23 14:09 | 60K | |
| Inequalities with one variable.png | 2023-03-24 08:51 | 64K | |
| Linear Equation.png | 2023-03-23 15:40 | 66K | |
| Give back.png | 2023-03-24 15:25 | 76K | |
| Search.png | 2023-03-24 13:18 | 89K | |
| Looking forwartd.png | 2023-03-24 14:49 | 91K | |
| Equations and Inequalities.png | 2023-03-23 13:18 | 95K | |
| System of Equation.png | 2023-03-23 14:06 | 96K | |
| App Process.png | 2023-03-28 10:47 | 96K | |
| Subsets.PNG | 2023-03-23 15:15 | 99K | |
| Putting it together.png | 2023-03-28 13:53 | 115K | |
| Compound Inequal.png | 2023-03-24 09:32 | 116K | |
| Literal Equation.png | 2023-03-24 08:30 | 125K | |
| Mcat.png | 2023-03-24 15:55 | 127K | |
| Solving Compound.PNG | 2023-03-24 10:06 | 129K | |
| College Just AHead.png | 2023-03-24 13:46 | 130K | |
| Line eq.png | 2023-03-24 09:08 | 130K | |
| What is important.png | 2023-03-24 13:35 | 138K | |
| Operations on real Numbers.png | 2023-03-23 14:21 | 144K | |
| Solving and graph.PNG | 2023-03-24 09:22 | 149K | |
| College Money1.png | 2023-03-28 12:58 | 152K | |
| SolvingLinear Equation.png | 2023-03-23 15:44 | 153K | |
| Literak Equations and Formulas.png | 2023-03-24 08:15 | 154K | |
| CAE BANNER.png | 2023-03-28 12:09 | 168K | |
| Hairs and Fibers.png | 2023-03-28 09:27 | 172K | |
| Scholarhip banner.png | 2023-03-28 13:15 | 173K | |
| College Essay.png | 2023-03-28 12:16 | 174K | |
| Choices.png | 2023-03-24 14:19 | 177K | |
| College Just Ahead1.png | 2023-03-28 11:12 | 180K | |
| Applications.png | 2023-03-28 11:56 | 195K | |
| Fin Aid.png | 2023-03-28 13:07 | 199K | |
| Literal Equations.PNG | 2023-03-24 08:36 | 200K | |
| Search Banner.png | 2023-03-24 13:13 | 203K | |
| College Money.png | 2023-03-28 12:57 | 203K | |
| Cpu College App.png | 2023-03-28 12:05 | 203K | |
| What to Do Banner.png | 2023-03-28 11:25 | 206K | |
| College Ca,[is.png | 2023-03-24 14:04 | 207K | |
| Envision Algebra 1.png | 2023-03-23 10:15 | 209K | |
| College Ave.png | 2023-03-28 12:01 | 209K | |
| TT Taking.png | 2023-03-28 10:40 | 213K | |
| How to Apply for College.png | 2023-03-28 11:37 | 216K | |
| Recomend Letter.png | 2023-03-28 12:28 | 217K | |
| Academics Banner.png | 2023-03-24 15:43 | 218K | |
| Discover banner.png | 2023-03-24 13:23 | 224K | |
| College and Carreer.png | 2023-03-24 13:41 | 227K | |
| College Interview.png | 2023-03-28 12:38 | 230K | |
| Fin Aid Banner.png | 2023-03-28 13:02 | 231K | |
| Challenge Yourself.png | 2023-03-24 14:44 | 237K | |
| Formulas.PNG | 2023-03-24 08:40 | 239K | |
| Sets.PNG | 2023-03-23 15:12 | 242K | |
| Fork in road.png | 2023-03-24 14:12 | 248K | |
| College Tutiton.png | 2023-03-28 13:35 | 258K | |
| Map Road.png | 2023-03-24 12:59 | 259K | |
| Fadsa.png | 2023-03-28 13:10 | 260K | |
| Solutions.PNG | 2023-03-23 16:39 | 261K | |
| Challenge yourslef.png | 2023-03-24 14:38 | 267K | |
| School Money Options.png | 2023-03-28 13:26 | 267K | |
| Solving Equations both Sides.PNG | 2023-03-23 16:36 | 268K | |
| Ft Project.png | 2023-03-28 09:35 | 271K | |
| Correct Path.png | 2023-03-24 15:35 | 273K | |
| College Admin.png | 2023-03-28 11:16 | 273K | |
| College Fair.png | 2023-03-24 13:57 | 273K | |
| Academ.png | 2023-03-24 15:48 | 275K | |
| What to Do.png | 2023-03-28 11:30 | 278K | |
| Roadtrip.png | 2023-03-24 12:21 | 292K | |
| Schorship.png | 2023-03-28 13:18 | 298K | |
| Put it all.png | 2023-03-28 14:02 | 300K | |
| College Banner.png | 2023-03-24 13:50 | 312K | |
| Lines.png | 2023-03-31 09:02 | 315K | |
| Roadmap Banner.png | 2023-03-24 12:51 | 328K | |
| Admissions.png | 2023-03-28 10:26 | 330K | |
| Equations with Variables on Both Sides.png | 2023-03-23 16:06 | 341K | |
| Foundation Banner.png | 2023-03-24 12:42 | 348K | |
| Fire nd expllosion.png | 2023-03-28 09:45 | 350K | |
| And Or.PNG | 2023-03-24 10:01 | 397K | |
| List of colleges.png | 2023-03-24 14:25 | 416K | |
| Rewite.PNG | 2023-03-24 08:43 | 435K | |
| Both Sides.PNG | 2023-03-24 09:16 | 439K | |
| Basic Inequality.PNG | 2023-03-24 09:12 | 527K | |
| Linear Equation Step by Step.PNG | 2023-03-23 15:59 | 538K | |
| List of Col.png | 2023-03-24 14:29 | 560K | |
| Sets and Subsets.PNG | 2023-03-23 15:17 | 586K | |
| Inequal Abso.PNG | 2023-03-24 11:04 | 604K | |
| Linear Equation 1 variable.PNG | 2023-03-23 15:51 | 618K | |
| How to write.PNG | 2023-03-24 10:58 | 632K | |
| Consecutive integers problems.PNG | 2023-03-23 15:55 | 643K | |
| How to Solve.PNG | 2023-03-24 11:01 | 644K | |
| Compound inequalities.PNG | 2023-03-24 09:56 | 694K | |
| Solving Equations and Inequalites.PNG | 2023-03-23 14:01 | 772K | |
| Variables on Both Sides.PNG | 2023-03-23 16:46 | 783K | |
