![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | zeros polynomial functions.PNG | 2023-03-08 14:47 | 1.0M | |
![[IMG]](/icons/image2.gif) | Imaginary Unit.PNG | 2023-03-07 12:14 | 1.0M | |
![[IMG]](/icons/image2.gif) | Log Explained.PNG | 2023-03-13 13:35 | 917K | |
![[IMG]](/icons/image2.gif) | Inverse Re and Fun.PNG | 2023-03-10 16:20 | 911K | |
![[IMG]](/icons/image2.gif) | D Day.PNG | 2023-03-21 13:41 | 843K | |
![[IMG]](/icons/image2.gif) | Quad dratic.PNG | 2023-03-07 14:29 | 841K | |
![[IMG]](/icons/image2.gif) | Direct.PNG | 2023-03-07 15:19 | 821K | |
![[IMG]](/icons/image2.gif) | Focus.PNG | 2023-03-07 15:23 | 810K | |
![[IMG]](/icons/image2.gif) | X Intercepts.PNG | 2023-03-07 10:56 | 808K | |
![[IMG]](/icons/image2.gif) | Pascals Triangle.PNG | 2023-03-08 13:12 | 807K | |
![[IMG]](/icons/image2.gif) | Bionmal.PNG | 2023-03-23 09:29 | 792K | |
![[IMG]](/icons/image2.gif) | What is a variable.PNG | 2023-03-17 12:13 | 777K | |
![[IMG]](/icons/image2.gif) | Solving Radical.PNG | 2023-03-10 15:06 | 767K | |
![[IMG]](/icons/image2.gif) | Properties of Exp.PNG | 2023-03-10 13:13 | 751K | |
![[IMG]](/icons/image2.gif) | Co identies.PNG | 2023-03-16 10:54 | 745K | |
![[IMG]](/icons/image2.gif) | Adding and Subtracting.PNG | 2023-03-08 11:54 | 734K | |
![[IMG]](/icons/image2.gif) | Complex Conjugates.PNG | 2023-03-07 12:05 | 729K | |
![[IMG]](/icons/image2.gif) | Standard form Poly.PNG | 2023-03-08 11:09 | 712K | |
![[IMG]](/icons/image2.gif) | Cubic Function.PNG | 2023-03-08 16:30 | 700K | |
![[IMG]](/icons/image2.gif) | inverse of a func.PNG | 2023-03-10 16:16 | 699K | |
![[IMG]](/icons/image2.gif) | Change of the Base Formula.PNG | 2023-03-13 15:29 | 698K | |
![[IMG]](/icons/image2.gif) | Tangent Functions.PNG | 2023-03-16 14:57 | 697K | |
![[IMG]](/icons/image2.gif) | Composition of Functions.PNG | 2023-03-10 15:37 | 693K | |
![[IMG]](/icons/image2.gif) | Phase Shift.PNG | 2023-03-17 08:41 | 688K | |
![[IMG]](/icons/image2.gif) | Sine or cosine.PNG | 2023-03-17 08:57 | 683K | |
![[IMG]](/icons/image2.gif) | how to grpah.PNG | 2023-03-16 15:04 | 667K | |
![[IMG]](/icons/image2.gif) | Parabola 3 points.PNG | 2023-03-07 10:26 | 666K | |
![[IMG]](/icons/image2.gif) | Degree and Leading Co.PNG | 2023-03-08 11:06 | 654K | |
![[IMG]](/icons/image2.gif) | Natural Base e.PNG | 2023-03-13 12:43 | 642K | |
![[IMG]](/icons/image2.gif) | Piecewise functions Videos.PNG | 2023-03-06 10:43 | 632K | |
![[IMG]](/icons/image2.gif) | Factored Form.PNG | 2023-03-07 10:53 | 629K | |
![[IMG]](/icons/image2.gif) | Graphing Standard Form.PNG | 2023-03-07 10:20 | 624K | |
![[IMG]](/icons/image2.gif) | Coterminal Angles.PNG | 2023-03-16 11:43 | 620K | |
![[IMG]](/icons/image2.gif) | Varaibles.PNG | 2023-03-17 12:10 | 614K | |
![[IMG]](/icons/image2.gif) | Z Scores.PNG | 2023-03-21 15:12 | 614K | |
![[IMG]](/icons/image2.gif) | multiplying polynomials1.PNG | 2023-03-08 12:01 | 613K | |
![[IMG]](/icons/image2.gif) | Sin and Cos.PNG | 2023-03-16 15:00 | 612K | |
![[IMG]](/icons/image2.gif) | Vertex form of Quad.PNG | 2023-03-06 16:54 | 606K | |
![[IMG]](/icons/image2.gif) | conduct Study.PNG | 2023-03-17 14:04 | 601K | |
![[IMG]](/icons/image2.gif) | Inequalites.PNG | 2023-03-06 12:38 | 586K | |
![[IMG]](/icons/image2.gif) | The Factor Therom.PNG | 2023-03-08 13:48 | 585K | |
![[IMG]](/icons/image2.gif) | Add and Sub.PNG | 2023-03-09 16:08 | 585K | |
![[IMG]](/icons/image2.gif) | Rec Trig Functions.PNG | 2023-03-16 10:58 | 581K | |
![[IMG]](/icons/image2.gif) | Polynomials Divisions.PNG | 2023-03-08 13:44 | 581K | |
![[IMG]](/icons/image2.gif) | Quad Equation.PNG | 2023-03-06 14:33 | 580K | |
![[IMG]](/icons/image2.gif) | Compound Interest Formula.PNG | 2023-03-13 12:34 | 579K | |
![[IMG]](/icons/image2.gif) | Compound Fractions.PNG | 2023-03-09 16:12 | 575K | |
![[IMG]](/icons/image2.gif) | Geo Seq and Ser.PNG | 2023-03-14 08:07 | 575K | |
![[IMG]](/icons/image2.gif) | Exp Function Videos.PNG | 2023-03-13 10:59 | 573K | |
![[IMG]](/icons/image2.gif) | Piecewise Functions.PNG | 2023-03-06 10:34 | 570K | |
![[IMG]](/icons/image2.gif) | Poly Func.PNG | 2023-03-08 16:36 | 569K | |
![[IMG]](/icons/image2.gif) | Logar Vid.PNG | 2023-03-13 14:26 | 564K | |
![[IMG]](/icons/image2.gif) | Basic Probability.PNG | 2023-03-22 09:16 | 562K | |
![[IMG]](/icons/image2.gif) | Synthetic Division.PNG | 2023-03-08 13:52 | 562K | |
![[IMG]](/icons/image2.gif) | Radical and Raional Exponents.PNG | 2023-03-10 10:24 | 557K | |
![[IMG]](/icons/image2.gif) | Growth and Decay.PNG | 2023-03-13 11:20 | 557K | |
![[IMG]](/icons/image2.gif) | The Linear Equation.PNG | 2023-03-06 13:24 | 556K | |
![[IMG]](/icons/image2.gif) | Inverse Varation1.PNG | 2023-03-09 10:40 | 556K | |
![[IMG]](/icons/image2.gif) | Radical Equations.PNG | 2023-03-10 14:59 | 552K | |
![[IMG]](/icons/image2.gif) | Equation of a Para.PNG | 2023-03-07 15:26 | 549K | |
![[IMG]](/icons/image2.gif) | Adding Rational Expressions.PNG | 2023-03-09 16:05 | 547K | |
![[IMG]](/icons/image2.gif) | Math Errors.PNG | 2023-03-21 17:29 | 547K | |
![[IMG]](/icons/image2.gif) | Properties of radicals.PNG | 2023-03-10 13:16 | 537K | |
![[IMG]](/icons/image2.gif) | Composite function.PNG | 2023-03-10 15:34 | 534K | |
![[IMG]](/icons/image2.gif) | Compliment of an Event.PNG | 2023-03-22 10:40 | 532K | |
![[IMG]](/icons/image2.gif) | Percentiles.PNG | 2023-03-21 15:05 | 525K | |
![[IMG]](/icons/image2.gif) | Conditinal Prob.PNG | 2023-03-22 13:07 | 525K | |
![[IMG]](/icons/image2.gif) | Linear Inqualities.PNG | 2023-03-06 13:28 | 522K | |
![[IMG]](/icons/image2.gif) | Sampling.PNG | 2023-03-21 17:24 | 511K | |
![[IMG]](/icons/image2.gif) | Quadratic Formulas.PNG | 2023-03-06 16:42 | 488K | |
![[IMG]](/icons/image2.gif) | Unit ICrcle.PNG | 2023-03-16 11:55 | 476K | |
![[IMG]](/icons/image2.gif) | Nature of Roots.PNG | 2023-03-07 14:38 | 475K | |
![[IMG]](/icons/image2.gif) | Linear vs non.PNG | 2023-03-03 09:29 | 471K | |
![[IMG]](/icons/image2.gif) | Simplied.PNG | 2023-03-09 17:08 | 470K | |
![[IMG]](/icons/image2.gif) | Uniform Dis.PNG | 2023-03-22 16:20 | 466K | |
![[IMG]](/icons/image2.gif) | Quad Systems.PNG | 2023-03-07 16:22 | 462K | |
![[IMG]](/icons/image2.gif) | Fundamentalk.PNG | 2023-03-22 14:22 | 451K | |
![[IMG]](/icons/image2.gif) | Period and freq.PNG | 2023-03-16 14:13 | 448K | |
![[IMG]](/icons/image2.gif) | Theroems.PNG | 2023-03-08 15:43 | 447K | |
![[IMG]](/icons/image2.gif) | Rational Functions.PNG | 2023-03-09 09:14 | 444K | |
![[IMG]](/icons/image2.gif) | Inverse Varation.PNG | 2023-03-09 10:33 | 439K | |
![[IMG]](/icons/image2.gif) | Null Hypo.PNG | 2023-03-21 17:55 | 437K | |
![[IMG]](/icons/image2.gif) | Graphing Radical Functions.PNG | 2023-03-10 13:55 | 435K | |
![[IMG]](/icons/image2.gif) | Linear Quadratic Systems.PNG | 2023-03-07 16:18 | 433K | |
![[IMG]](/icons/image2.gif) | Dependennt Events.PNG | 2023-03-22 13:16 | 430K | |
![[IMG]](/icons/image2.gif) | Applications of Linear.PNG | 2023-03-07 16:24 | 425K | |
![[IMG]](/icons/image2.gif) | Exp and logs.PNG | 2023-03-13 09:56 | 420K | |
![[IMG]](/icons/image2.gif) | Rational Expressions.PNG | 2023-03-09 12:48 | 419K | |
![[IMG]](/icons/image2.gif) | comapring functions.PNG | 2023-03-13 14:35 | 417K | |
![[IMG]](/icons/image2.gif) | Conditional Ptob.PNG | 2023-03-22 13:25 | 408K | |
![[IMG]](/icons/image2.gif) | Even and off Functions.PNG | 2023-03-08 16:27 | 396K | |
![[IMG]](/icons/image2.gif) | Irrational Conjugates.PNG | 2023-03-08 15:51 | 394K | |
![[IMG]](/icons/image2.gif) | Fair.PNG | 2023-03-23 09:27 | 393K | |
![[IMG]](/icons/image2.gif) | Binomal.PNG | 2023-03-22 16:14 | 388K | |
![[IMG]](/icons/image2.gif) | Stats Sample Method.PNG | 2023-03-17 13:57 | 388K | |
![[IMG]](/icons/image2.gif) | Writing Decay Function.PNG | 2023-03-13 11:24 | 387K | |
![[IMG]](/icons/image2.gif) | Solving.PNG | 2023-03-06 12:33 | 385K | |
![[IMG]](/icons/image2.gif) | inverse relation.PNG | 2023-03-10 16:18 | 380K | |
![[IMG]](/icons/image2.gif) | Margin of Error 1.PNG | 2023-03-21 17:21 | 377K | |
![[IMG]](/icons/image2.gif) | Radical Expressions.PNG | 2023-03-10 11:41 | 373K | |
![[IMG]](/icons/image2.gif) | Radical banner.png | 2023-03-10 11:00 | 368K | |
![[IMG]](/icons/image2.gif) | Proper of logs 1.PNG | 2023-03-13 15:03 | 364K | |
![[IMG]](/icons/image2.gif) | nNth Root Properties.PNG | 2023-03-10 13:20 | 358K | |
![[IMG]](/icons/image2.gif) | Asymtopes.PNG | 2023-03-09 10:47 | 357K | |
![[IMG]](/icons/image2.gif) | Introduction to Quad Equations.PNG | 2023-03-07 10:13 | 347K | |
![[IMG]](/icons/image2.gif) | log prop.PNG | 2023-03-13 15:37 | 345K | |
![[IMG]](/icons/image2.gif) | Zero Product Property.PNG | 2023-03-07 10:59 | 345K | |
![[IMG]](/icons/image2.gif) | Quad Banner.png | 2023-03-07 13:58 | 336K | |
![[IMG]](/icons/image2.gif) | Reference Angles Alg2.PNG | 2023-03-16 11:45 | 333K | |
![[IMG]](/icons/image2.gif) | Amp and Mid.PNG | 2023-03-16 14:04 | 331K | |
![[IMG]](/icons/image2.gif) | Degree of Polynomial.PNG | 2023-03-08 11:01 | 323K | |
![[IMG]](/icons/image2.gif) | Identiy.PNG | 2023-03-08 13:09 | 322K | |
![[IMG]](/icons/image2.gif) | Aritmetic Banner.png | 2023-03-06 10:50 | 321K | |
![[IMG]](/icons/image2.gif) | Multiplying Rational Expressions.PNG | 2023-03-09 15:17 | 319K | |
![[IMG]](/icons/image2.gif) | Parabola banner.png | 2023-03-07 14:47 | 318K | |
![[IMG]](/icons/image2.gif) | Independent and Dependent EVENTS.PNG | 2023-03-22 10:49 | 312K | |
![[IMG]](/icons/image2.gif) | Shape.PNG | 2023-03-21 14:35 | 306K | |
![[IMG]](/icons/image2.gif) | basic properties.PNG | 2023-03-13 15:35 | 302K | |
![[IMG]](/icons/image2.gif) | phase equation.PNG | 2023-03-17 08:54 | 299K | |
![[IMG]](/icons/image2.gif) | Cat Vs Stat.PNG | 2023-03-17 12:01 | 294K | |
![[IMG]](/icons/image2.gif) | Euations Banner.png | 2023-03-06 11:41 | 294K | |
![[IMG]](/icons/image2.gif) | Quad form banner.png | 2023-03-07 10:35 | 293K | |
![[IMG]](/icons/image2.gif) | Step Functions.PNG | 2023-03-06 10:38 | 293K | |
![[IMG]](/icons/image2.gif) | Virtual Classroom Banner.png | 2023-03-02 16:12 | 289K | |
![[IMG]](/icons/image2.gif) | Trif Funch.PNG | 2023-03-16 13:22 | 288K | |
![[IMG]](/icons/image2.gif) | Trig Fun 1.PNG | 2023-03-16 13:24 | 288K | |
![[IMG]](/icons/image2.gif) | Trig func 2.PNG | 2023-03-16 13:26 | 287K | |
![[IMG]](/icons/image2.gif) | Pascal Triangle.png | 2023-03-08 12:59 | 281K | |
![[IMG]](/icons/image2.gif) | Geometric Sequence.PNG | 2023-03-14 08:12 | 279K | |
![[IMG]](/icons/image2.gif) | LInear Functions banner.png | 2023-03-02 16:32 | 277K | |
![[IMG]](/icons/image2.gif) | Unti 3 Lesson 6 Apply.png | 2023-03-07 09:20 | 270K | |
![[IMG]](/icons/image2.gif) | Solving Inequalities.PNG | 2023-03-06 12:18 | 266K | |
![[IMG]](/icons/image2.gif) | Linear1.png | 2023-03-03 09:52 | 265K | |
![[IMG]](/icons/image2.gif) | Largortehimihc.PNG | 2023-03-13 16:09 | 264K | |
![[IMG]](/icons/image2.gif) | Stat questions.PNG | 2023-03-17 12:05 | 263K | |
![[IMG]](/icons/image2.gif) | Polynomial banner1.png | 2023-03-08 12:11 | 263K | |
![[IMG]](/icons/image2.gif) | logarithms header.png | 2023-03-13 14:42 | 262K | |
![[IMG]](/icons/image2.gif) | Probability Banner 2.png | 2023-03-22 09:48 | 261K | |
![[IMG]](/icons/image2.gif) | multiplying polynomials.PNG | 2023-03-08 11:58 | 259K | |
![[IMG]](/icons/image2.gif) | Types of Data2.png | 2023-03-17 09:56 | 258K | |
![[IMG]](/icons/image2.gif) | Dividing Polynomials.png | 2023-03-08 13:28 | 257K | |
![[IMG]](/icons/image2.gif) | Functions banner.png | 2023-03-03 13:43 | 257K | |
![[IMG]](/icons/image2.gif) | Arithmetic Sequence.PNG | 2023-03-06 11:08 | 255K | |
![[IMG]](/icons/image2.gif) | Normal Distribution.PNG | 2023-03-21 14:22 | 253K | |
![[IMG]](/icons/image2.gif) | Properties of Rational Expondents.png | 2023-03-10 10:32 | 245K | |
![[IMG]](/icons/image2.gif) | Cimbinations.PNG | 2023-03-22 14:15 | 244K | |
![[IMG]](/icons/image2.gif) | Properties of Rational Expondents1.png | 2023-03-10 10:32 | 238K | |
![[IMG]](/icons/image2.gif) | Types of Data1.png | 2023-03-17 09:53 | 236K | |
![[IMG]](/icons/image2.gif) | Types of Data.png | 2023-03-17 09:53 | 236K | |
![[IMG]](/icons/image2.gif) | polynomial identies.png | 2023-03-08 12:23 | 236K | |
![[IMG]](/icons/image2.gif) | Discriminant.PNG | 2023-03-07 14:34 | 232K | |
![[IMG]](/icons/image2.gif) | Prob Models.png | 2023-03-23 08:21 | 227K | |
![[IMG]](/icons/image2.gif) | Cofunctions.PNG | 2023-03-16 10:51 | 224K | |
![[IMG]](/icons/image2.gif) | Real Zero.png | 2023-03-08 14:40 | 223K | |
![[IMG]](/icons/image2.gif) | Completing the square method.PNG | 2023-03-07 13:11 | 222K | |
![[IMG]](/icons/image2.gif) | Function Operations.PNG | 2023-03-10 15:32 | 222K | |
![[IMG]](/icons/image2.gif) | Rational expression1.png | 2023-03-09 16:57 | 219K | |
![[IMG]](/icons/image2.gif) | Linear.png | 2023-03-03 09:50 | 218K | |
![[IMG]](/icons/image2.gif) | Trig func.PNG | 2023-03-14 09:07 | 218K | |
![[IMG]](/icons/image2.gif) | Opertiongs with Functions1.png | 2023-03-10 15:25 | 217K | |
![[IMG]](/icons/image2.gif) | Basic Prin2.png | 2023-03-22 09:41 | 216K | |
![[IMG]](/icons/image2.gif) | Transformations.png | 2023-03-08 16:10 | 215K | |
![[IMG]](/icons/image2.gif) | Standard Normal Distrubutions.PNG | 2023-03-21 15:08 | 214K | |
![[IMG]](/icons/image2.gif) | Solving Rational Equations.PNG | 2023-03-09 17:01 | 212K | |
![[IMG]](/icons/image2.gif) | Natural Logs.PNG | 2023-03-13 13:40 | 211K | |
![[IMG]](/icons/image2.gif) | Random Sampling.PNG | 2023-03-17 14:07 | 211K | |
![[IMG]](/icons/image2.gif) | Graphing Eq.png | 2023-03-06 11:57 | 211K | |
![[IMG]](/icons/image2.gif) | Prob Dist.png | 2023-03-22 16:02 | 211K | |
![[IMG]](/icons/image2.gif) | Normal Dis.png | 2023-03-21 15:00 | 209K | |
![[IMG]](/icons/image2.gif) | Degree of poly.png | 2023-03-08 10:29 | 205K | |
![[IMG]](/icons/image2.gif) | Rational Functions Introduction.PNG | 2023-03-09 12:42 | 204K | |
![[IMG]](/icons/image2.gif) | Properites of log.PNG | 2023-03-13 14:57 | 201K | |
![[IMG]](/icons/image2.gif) | Linear Systems1.png | 2023-03-06 13:04 | 198K | |
![[IMG]](/icons/image2.gif) | extraneous solutions.PNG | 2023-03-09 17:04 | 197K | |
![[IMG]](/icons/image2.gif) | Graph Rad Func.PNG | 2023-03-10 14:16 | 196K | |
![[IMG]](/icons/image2.gif) | Alternative Hypoo.PNG | 2023-03-21 17:49 | 194K | |
![[IMG]](/icons/image2.gif) | Murually.PNG | 2023-03-22 10:52 | 192K | |
![[IMG]](/icons/image2.gif) | Glossary Banner.png | 2023-03-03 10:15 | 192K | |
![[IMG]](/icons/image2.gif) | Prob Dist1.PNG | 2023-03-22 16:17 | 191K | |
![[IMG]](/icons/image2.gif) | RRT.PNG | 2023-03-08 15:47 | 191K | |
![[IMG]](/icons/image2.gif) | poly definition.png | 2023-03-08 10:33 | 189K | |
![[IMG]](/icons/image2.gif) | Nnth Roots.PNG | 2023-03-10 11:35 | 189K | |
![[IMG]](/icons/image2.gif) | Basic Prin1.png | 2023-03-22 09:38 | 189K | |
![[IMG]](/icons/image2.gif) | Algebra 2 Cover.png | 2023-03-02 16:53 | 188K | |
![[IMG]](/icons/image2.gif) | Basic Prin.png | 2023-03-22 09:36 | 181K | |
![[IMG]](/icons/image2.gif) | exp Equations.PNG | 2023-03-13 16:06 | 180K | |
![[IMG]](/icons/image2.gif) | Radical Dunctions.PNG | 2023-03-10 14:22 | 179K | |
![[IMG]](/icons/image2.gif) | Rewrite.PNG | 2023-03-09 12:53 | 178K | |
![[IMG]](/icons/image2.gif) | Standard Deviation.PNG | 2023-03-21 14:28 | 177K | |
![[IMG]](/icons/image2.gif) | Expected Values.PNG | 2023-03-22 17:02 | 175K | |
![[IMG]](/icons/image2.gif) | Interval.PNG | 2023-03-03 13:07 | 173K | |
![[IMG]](/icons/image2.gif) | incositant systems.PNG | 2023-03-06 13:46 | 173K | |
![[IMG]](/icons/image2.gif) | Polynomial Function.png | 2023-03-08 10:18 | 170K | |
![[IMG]](/icons/image2.gif) | reference angle.PNG | 2023-03-16 11:32 | 170K | |
![[IMG]](/icons/image2.gif) | ectreaneous Solution.PNG | 2023-03-10 15:02 | 169K | |
![[IMG]](/icons/image2.gif) | roots.png | 2023-03-08 15:33 | 168K | |
![[IMG]](/icons/image2.gif) | Algebra 2 Banner.png | 2023-03-02 15:12 | 167K | |
![[IMG]](/icons/image2.gif) | Curriculum Banner.png | 2023-03-02 15:48 | 167K | |
![[IMG]](/icons/image2.gif) | Hypo Testing.PNG | 2023-03-21 17:53 | 167K | |
![[IMG]](/icons/image2.gif) | Piecewise Function Banner1.png | 2023-03-03 14:58 | 166K | |
![[IMG]](/icons/image2.gif) | Polynomial banner.png | 2023-03-08 11:18 | 165K | |
![[IMG]](/icons/image2.gif) | Mult and Div Banner.png | 2023-03-09 14:32 | 165K | |
![[IMG]](/icons/image2.gif) | Conitional Proabiity.png | 2023-03-22 13:03 | 164K | |
![[IMG]](/icons/image2.gif) | Compound.PNG | 2023-03-13 12:38 | 163K | |
![[IMG]](/icons/image2.gif) | Stat banner.png | 2023-03-17 10:11 | 161K | |
![[IMG]](/icons/image2.gif) | Hypot Test.png | 2023-03-21 17:37 | 160K | |
![[IMG]](/icons/image2.gif) | Linear Systems Banner.png | 2023-03-06 12:45 | 160K | |
![[IMG]](/icons/image2.gif) | Transformation of functions.PNG | 2023-03-03 14:29 | 159K | |
![[IMG]](/icons/image2.gif) | Binomem Ther.PNG | 2023-03-08 13:05 | 158K | |
![[IMG]](/icons/image2.gif) | Prob Dis.png | 2023-03-22 15:43 | 157K | |
![[IMG]](/icons/image2.gif) | Expected Value Banner.png | 2023-03-22 16:28 | 156K | |
![[IMG]](/icons/image2.gif) | Decision making.PNG | 2023-03-23 09:22 | 155K | |
![[IMG]](/icons/image2.gif) | Real World Problem.PNG | 2023-03-07 13:39 | 155K | |
![[IMG]](/icons/image2.gif) | logsform.png | 2023-03-13 14:20 | 154K | |
![[IMG]](/icons/image2.gif) | Zero product.PNG | 2023-03-08 14:52 | 154K | |
![[IMG]](/icons/image2.gif) | Interval Notation.PNG | 2023-03-03 12:49 | 153K | |
![[IMG]](/icons/image2.gif) | Probabily banner 3.png | 2023-03-23 08:08 | 150K | |
![[IMG]](/icons/image2.gif) | Rational Functions Banner.png | 2023-03-09 08:47 | 149K | |
![[IMG]](/icons/image2.gif) | Margin Of Error Banner.png | 2023-03-21 15:19 | 147K | |
![[IMG]](/icons/image2.gif) | Complex Numbers banner.png | 2023-03-07 11:28 | 147K | |
![[IMG]](/icons/image2.gif) | Calc Exp Val.PNG | 2023-03-22 16:52 | 146K | |
![[IMG]](/icons/image2.gif) | Trig functions 1.png | 2023-03-16 12:44 | 146K | |
![[IMG]](/icons/image2.gif) | Common Log.PNG | 2023-03-13 13:37 | 145K | |
![[IMG]](/icons/image2.gif) | Completing the Square Example.PNG | 2023-03-07 13:35 | 145K | |
![[IMG]](/icons/image2.gif) | PF Definition.png | 2023-03-06 10:29 | 143K | |
![[IMG]](/icons/image2.gif) | Data and Stats banner.png | 2023-03-17 09:08 | 143K | |
![[IMG]](/icons/image2.gif) | Data an.png | 2023-03-17 09:16 | 142K | |
![[IMG]](/icons/image2.gif) | Rational Equations.png | 2023-03-09 15:12 | 141K | |
![[IMG]](/icons/image2.gif) | Quad Standard form.png | 2023-03-07 10:05 | 141K | |
![[IMG]](/icons/image2.gif) | Understanding Polynomials.PNG | 2023-03-08 10:25 | 141K | |
![[IMG]](/icons/image2.gif) | exp log functions.png | 2023-03-13 09:59 | 140K | |
![[IMG]](/icons/image2.gif) | Data Dist.png | 2023-03-21 13:50 | 140K | |
![[IMG]](/icons/image2.gif) | Parabola.PNG | 2023-03-06 16:58 | 139K | |
![[IMG]](/icons/image2.gif) | Precal.PNG | 2023-03-13 10:18 | 138K | |
![[IMG]](/icons/image2.gif) | density.png | 2023-03-22 16:06 | 138K | |
![[IMG]](/icons/image2.gif) | Simplied Form.PNG | 2023-03-09 15:23 | 137K | |
![[IMG]](/icons/image2.gif) | Average Rate of Change.PNG | 2023-03-03 13:14 | 137K | |
![[IMG]](/icons/image2.gif) | Bd.PNG | 2023-03-22 16:58 | 133K | |
![[IMG]](/icons/image2.gif) | Imaginary Numbers.PNG | 2023-03-07 12:11 | 133K | |
![[IMG]](/icons/image2.gif) | Exp Functions1.png | 2023-03-13 10:52 | 133K | |
![[IMG]](/icons/image2.gif) | Polynomial equations banner.png | 2023-03-08 15:14 | 132K | |
![[IMG]](/icons/image2.gif) | Properties of Exponents.png | 2023-03-10 10:44 | 131K | |
![[IMG]](/icons/image2.gif) | Permutations.png | 2023-03-22 13:58 | 130K | |
![[IMG]](/icons/image2.gif) | Zero1.png | 2023-03-08 14:37 | 129K | |
![[IMG]](/icons/image2.gif) | Exp Models.png | 2023-03-13 11:53 | 129K | |
![[IMG]](/icons/image2.gif) | Quad Standard form1.png | 2023-03-07 10:07 | 129K | |
![[IMG]](/icons/image2.gif) | perm Combo.png | 2023-03-22 14:12 | 128K | |
![[IMG]](/icons/image2.gif) | Quad eq 1.png | 2023-03-06 14:51 | 124K | |
![[IMG]](/icons/image2.gif) | Zero.png | 2023-03-08 14:36 | 123K | |
![[IMG]](/icons/image2.gif) | Different.PNG | 2023-03-13 14:30 | 120K | |
![[IMG]](/icons/image2.gif) | Function Operations Banner.png | 2023-03-10 15:13 | 119K | |
![[IMG]](/icons/image2.gif) | Graphing Rational functions.png | 2023-03-09 09:22 | 118K | |
![[IMG]](/icons/image2.gif) | Properties of Logs.PNG | 2023-03-13 15:01 | 117K | |
![[IMG]](/icons/image2.gif) | Completing the square.png | 2023-03-07 13:04 | 115K | |
![[IMG]](/icons/image2.gif) | inverse of a function banner1.png | 2023-03-10 16:02 | 114K | |
![[IMG]](/icons/image2.gif) | Trig Ident.png | 2023-03-14 15:43 | 113K | |
![[IMG]](/icons/image2.gif) | Peridoic Function.PNG | 2023-03-16 14:16 | 112K | |
![[IMG]](/icons/image2.gif) | Unit Circle.png | 2023-03-16 11:23 | 111K | |
![[IMG]](/icons/image2.gif) | Reflection of Functions.PNG | 2023-03-03 14:36 | 110K | |
![[IMG]](/icons/image2.gif) | Stats.png | 2023-03-17 09:29 | 109K | |
![[IMG]](/icons/image2.gif) | Stat Studies Banner.png | 2023-03-17 13:38 | 109K | |
![[IMG]](/icons/image2.gif) | logarithmic Equations banner.png | 2023-03-13 15:11 | 108K | |
![[IMG]](/icons/image2.gif) | Properties.png | 2023-03-13 14:52 | 108K | |
![[IMG]](/icons/image2.gif) | One Dollar Coin.png | 2023-03-22 08:35 | 106K | |
![[IMG]](/icons/image2.gif) | Translation and Reflection.PNG | 2023-03-03 14:33 | 106K | |
![[IMG]](/icons/image2.gif) | Quad Definiton.png | 2023-03-06 14:54 | 106K | |
![[IMG]](/icons/image2.gif) | Linear Equations.png | 2023-03-03 09:43 | 105K | |
![[IMG]](/icons/image2.gif) | Quadratic Equation banner.png | 2023-03-06 14:06 | 105K | |
![[IMG]](/icons/image2.gif) | Radical Notation.PNG | 2023-03-10 11:37 | 105K | |
![[IMG]](/icons/image2.gif) | Log Banner.png | 2023-03-13 12:50 | 103K | |
![[IMG]](/icons/image2.gif) | Events Independent.png | 2023-03-22 12:36 | 103K | |
![[IMG]](/icons/image2.gif) | Recursive Defintion.PNG | 2023-03-06 11:21 | 102K | |
![[IMG]](/icons/image2.gif) | Exp Functions.png | 2023-03-13 10:44 | 101K | |
![[IMG]](/icons/image2.gif) | Simplify.png | 2023-03-09 15:09 | 101K | |
![[IMG]](/icons/image2.gif) | Common Ratio.PNG | 2023-03-14 08:10 | 100K | |
![[IMG]](/icons/image2.gif) | Sigma Notation.PNG | 2023-03-06 11:33 | 99K | |
![[IMG]](/icons/image2.gif) | Opertiongs with Functions.png | 2023-03-10 15:23 | 98K | |
![[IMG]](/icons/image2.gif) | Graphing Trig Func.png | 2023-03-16 15:09 | 98K | |
![[IMG]](/icons/image2.gif) | Six Functions.png | 2023-03-16 10:43 | 97K | |
![[IMG]](/icons/image2.gif) | Types of Samples.png | 2023-03-17 13:52 | 95K | |
![[IMG]](/icons/image2.gif) | zero product 1 peroprly.PNG | 2023-03-08 14:56 | 94K | |
![[IMG]](/icons/image2.gif) | Example 1.png | 2023-03-16 13:57 | 93K | |
![[IMG]](/icons/image2.gif) | Rational Exponents.png | 2023-03-10 09:34 | 91K | |
![[IMG]](/icons/image2.gif) | Exponntial Models Banner.png | 2023-03-13 11:31 | 91K | |
![[IMG]](/icons/image2.gif) | Lesson 1-4 apply.png | 2023-03-06 15:33 | 90K | |
![[IMG]](/icons/image2.gif) | Solving radical Equations Bannner.png | 2023-03-10 14:42 | 89K | |
![[IMG]](/icons/image2.gif) | Geometric banner1.png | 2023-03-13 15:45 | 88K | |
![[IMG]](/icons/image2.gif) | Geometric banner.png | 2023-03-13 15:44 | 87K | |
![[IMG]](/icons/image2.gif) | Zeros of Polynomial Functions.png | 2023-03-08 14:17 | 87K | |
![[IMG]](/icons/image2.gif) | Divide Rational Expressions.PNG | 2023-03-09 15:20 | 87K | |
![[IMG]](/icons/image2.gif) | Cond Prob Banner.png | 2023-03-22 12:49 | 86K | |
![[IMG]](/icons/image2.gif) | roots and radicals.png | 2023-03-10 11:29 | 85K | |
![[IMG]](/icons/image2.gif) | GTF.png | 2023-03-16 14:24 | 84K | |
![[IMG]](/icons/image2.gif) | Transfgormation.png | 2023-03-16 15:52 | 84K | |
![[IMG]](/icons/image2.gif) | Properties of rat Exponents.png | 2023-03-10 10:47 | 84K | |
![[IMG]](/icons/image2.gif) | General Rule.png | 2023-03-06 11:04 | 83K | |
![[IMG]](/icons/image2.gif) | Linear Systems2.png | 2023-03-06 13:06 | 82K | |
![[IMG]](/icons/image2.gif) | Quad Functions.png | 2023-03-06 14:37 | 81K | |
![[IMG]](/icons/image2.gif) | factorials.PNG | 2023-03-22 14:18 | 79K | |
![[IMG]](/icons/image2.gif) | EX 34.PNG | 2023-03-08 11:44 | 79K | |
![[IMG]](/icons/image2.gif) | Data analysis.PNG | 2023-03-17 09:45 | 78K | |
![[IMG]](/icons/image2.gif) | Normal.png | 2023-03-21 14:45 | 78K | |
![[IMG]](/icons/image2.gif) | Sine and Cosin.png | 2023-03-16 13:43 | 77K | |
![[IMG]](/icons/image2.gif) | Laf.png | 2023-03-13 10:15 | 77K | |
![[IMG]](/icons/image2.gif) | Polynomial Functions banner.png | 2023-03-08 16:05 | 75K | |
![[IMG]](/icons/image2.gif) | Absolute vlaue Function.png | 2023-03-06 10:21 | 74K | |
![[IMG]](/icons/image2.gif) | Properties of rat Exponents1.png | 2023-03-10 10:49 | 73K | |
![[IMG]](/icons/image2.gif) | inverse of a function banner.png | 2023-03-10 16:00 | 73K | |
![[IMG]](/icons/image2.gif) | Graph Poly Funct.png | 2023-03-08 10:40 | 73K | |
![[IMG]](/icons/image2.gif) | Quad Functions1.png | 2023-03-06 14:39 | 73K | |
![[IMG]](/icons/image2.gif) | Prob 1.png | 2023-03-22 08:53 | 72K | |
![[IMG]](/icons/image2.gif) | Square banner.png | 2023-03-07 12:35 | 72K | |
![[IMG]](/icons/image2.gif) | Expected Value 2.png | 2023-03-22 16:50 | 71K | |
![[IMG]](/icons/image2.gif) | Rules.png | 2023-03-13 14:50 | 71K | |
![[IMG]](/icons/image2.gif) | Indy.png | 2023-03-22 16:09 | 71K | |
![[IMG]](/icons/image2.gif) | Growth and Decay 1.png | 2023-03-13 11:56 | 70K | |
![[IMG]](/icons/image2.gif) | Adding and Subtracting Banner.png | 2023-03-09 15:30 | 68K | |
![[IMG]](/icons/image2.gif) | Vertex Banner.png | 2023-03-06 15:10 | 67K | |
![[IMG]](/icons/image2.gif) | Graphing.png | 2023-03-09 09:22 | 67K | |
![[IMG]](/icons/image2.gif) | Reciprocal Function banner.png | 2023-03-09 09:37 | 64K | |
![[IMG]](/icons/image2.gif) | Transformation.png | 2023-03-03 14:15 | 62K | |
![[IMG]](/icons/image2.gif) | Operations with Complex Numbers.png | 2023-03-07 11:58 | 61K | |
![[IMG]](/icons/image2.gif) | Graph Rational Functions.png | 2023-03-09 09:04 | 59K | |
![[IMG]](/icons/image2.gif) | Logar Functions Banner.png | 2023-03-13 13:49 | 58K | |
![[IMG]](/icons/image2.gif) | Prob of Events.png | 2023-03-22 10:13 | 57K | |
![[IMG]](/icons/image2.gif) | Ident trig.png | 2023-03-14 15:45 | 56K | |
![[IMG]](/icons/image2.gif) | Functions Trig.png | 2023-03-16 10:39 | 52K | |
![[IMG]](/icons/image2.gif) | EX 2.PNG | 2023-03-08 11:40 | 52K | |
![[IMG]](/icons/image2.gif) | Events.png | 2023-03-22 10:17 | 50K | |
![[IMG]](/icons/image2.gif) | Formual Quad.png | 2023-03-07 14:21 | 50K | |
![[IMG]](/icons/image2.gif) | Trig Functions1.png | 2023-03-14 09:01 | 49K | |
![[IMG]](/icons/image2.gif) | Trig Banner.png | 2023-03-16 12:20 | 48K | |
![[IMG]](/icons/image2.gif) | EX 3.PNG | 2023-03-08 11:42 | 48K | |
![[IMG]](/icons/image2.gif) | Trig functions2.png | 2023-03-14 15:41 | 48K | |
![[IMG]](/icons/image2.gif) | Zero of a Function.png | 2023-03-03 12:37 | 47K | |
![[IMG]](/icons/image2.gif) | Qual Varaibles.png | 2023-03-17 11:54 | 45K | |
![[IMG]](/icons/image2.gif) | Dividing Polynomials 1.png | 2023-03-08 13:39 | 45K | |
![[IMG]](/icons/image2.gif) | Equationg Quad.png | 2023-03-06 14:45 | 44K | |
![[IMG]](/icons/image2.gif) | Quad Header.png | 2023-03-07 09:28 | 44K | |
![[IMG]](/icons/image2.gif) | rationaal graphs.png | 2023-03-09 12:58 | 43K | |
![[IMG]](/icons/image2.gif) | Probability banner1.png | 2023-03-21 18:05 | 43K | |
![[IMG]](/icons/image2.gif) | Graphing Functrions.png | 2023-03-08 10:56 | 42K | |
![[IMG]](/icons/image2.gif) | Unit Circle Banner.png | 2023-03-16 11:08 | 41K | |
![[IMG]](/icons/image2.gif) | radicand ex.png | 2023-03-10 14:56 | 41K | |
![[IMG]](/icons/image2.gif) | Linear Functions.png | 2023-03-02 16:41 | 41K | |
![[IMG]](/icons/image2.gif) | Ex 1.PNG | 2023-03-08 11:37 | 40K | |
![[IMG]](/icons/image2.gif) | Reference Angles.png | 2023-03-16 11:36 | 40K | |
![[IMG]](/icons/image2.gif) | Add Sub.png | 2023-03-09 15:57 | 40K | |
![[IMG]](/icons/image2.gif) | lin bnner.png | 2023-03-07 15:38 | 38K | |
![[IMG]](/icons/image2.gif) | Normal Curve.png | 2023-03-21 14:51 | 38K | |
![[IMG]](/icons/image2.gif) | Exp Func Bannr.png | 2023-03-13 10:31 | 38K | |
![[IMG]](/icons/image2.gif) | Transformation banner.png | 2023-03-16 15:39 | 37K | |
![[IMG]](/icons/image2.gif) | A Rational Function.png | 2023-03-09 08:57 | 36K | |
![[IMG]](/icons/image2.gif) | Radical Functions banner.png | 2023-03-10 13:35 | 36K | |
![[IMG]](/icons/image2.gif) | Y equals.png | 2023-03-08 16:18 | 35K | |
![[IMG]](/icons/image2.gif) | Vertex form.png | 2023-03-06 15:59 | 34K | |
![[IMG]](/icons/image2.gif) | Complex Nmbers.png | 2023-03-07 11:47 | 34K | |
![[IMG]](/icons/image2.gif) | poly func banner.png | 2023-03-07 16:44 | 34K | |
![[IMG]](/icons/image2.gif) | Linear Function1.png | 2023-03-03 10:04 | 33K | |
![[IMG]](/icons/image2.gif) | Exponents and radicals banner.png | 2023-03-10 11:51 | 31K | |
![[IMG]](/icons/image2.gif) | Parabola Equation.png | 2023-03-07 15:00 | 30K | |
![[IMG]](/icons/image2.gif) | Rational banner.png | 2023-03-09 16:33 | 30K | |
![[IMG]](/icons/image2.gif) | Exp.png | 2023-03-22 09:29 | 28K | |
![[IMG]](/icons/image2.gif) | Margin of Error.png | 2023-03-21 15:27 | 28K | |
![[IMG]](/icons/image2.gif) | Trig functions Table.png | 2023-03-16 13:14 | 27K | |
![[IMG]](/icons/image2.gif) | Rational Functios Banner.png | 2023-03-09 10:54 | 25K | |
![[IMG]](/icons/image2.gif) | logs1.png | 2023-03-13 13:27 | 24K | |
![[IMG]](/icons/image2.gif) | Dividing Polys.png | 2023-03-08 13:36 | 22K | |
![[IMG]](/icons/image2.gif) | Theo.png | 2023-03-22 09:29 | 22K | |
![[IMG]](/icons/image2.gif) | line1.png | 2023-03-07 15:57 | 22K | |
![[IMG]](/icons/image2.gif) | sqroot.png | 2023-03-10 13:09 | 22K | |
![[IMG]](/icons/image2.gif) | Graph 1.png | 2023-03-06 16:07 | 22K | |
![[IMG]](/icons/image2.gif) | Linear Functions Banner.png | 2023-03-03 11:54 | 21K | |
![[IMG]](/icons/image2.gif) | Quad eq.png | 2023-03-06 14:28 | 21K | |
![[IMG]](/icons/image2.gif) | rational exponents 1.png | 2023-03-10 12:08 | 20K | |
![[IMG]](/icons/image2.gif) | Prob 2.png | 2023-03-22 09:02 | 20K | |
![[IMG]](/icons/image2.gif) | Forms Factored.png | 2023-03-07 10:51 | 19K | |
![[IMG]](/icons/image2.gif) | Logr Banner.png | 2023-03-10 16:44 | 18K | |
![[IMG]](/icons/image2.gif) | Log Functions.png | 2023-03-13 08:59 | 18K | |
![[IMG]](/icons/image2.gif) | Standard Form.png | 2023-03-07 14:12 | 18K | |
![[IMG]](/icons/image2.gif) | logs12.png | 2023-03-13 14:12 | 17K | |
![[IMG]](/icons/image2.gif) | Right Anmgle.png | 2023-03-14 08:49 | 17K | |
![[IMG]](/icons/image2.gif) | Aute Angles Banner.png | 2023-03-16 10:28 | 17K | |
![[IMG]](/icons/image2.gif) | logs.png | 2023-03-13 13:25 | 16K | |
![[IMG]](/icons/image2.gif) | Linear Function.png | 2023-03-03 10:03 | 15K | |
![[IMG]](/icons/image2.gif) | inverse of a raltion.png | 2023-03-10 16:10 | 15K | |
![[IMG]](/icons/image2.gif) | Trig Functions.png | 2023-03-14 08:54 | 14K | |
![[IMG]](/icons/image2.gif) | right tria.PNG | 2023-03-16 11:26 | 14K | |
![[IMG]](/icons/image2.gif) | Complex Nmbers1.png | 2023-03-07 11:55 | 13K | |
![[IMG]](/icons/image2.gif) | Lin.png | 2023-03-07 15:55 | 13K | |
![[IMG]](/icons/image2.gif) | Margin of Error1.png | 2023-03-21 15:30 | 11K | |
![[IMG]](/icons/image2.gif) | Trig Func Ban.png | 2023-03-14 08:41 | 10K | |
![[IMG]](/icons/image2.gif) | Zero of a Function1.png | 2023-03-03 12:39 | 10K | |
![[IMG]](/icons/image2.gif) | Step 1.PNG | 2023-03-06 11:51 | 9.8K | |
![[IMG]](/icons/image2.gif) | Table 2.png | 2023-03-16 13:53 | 9.5K | |
![[IMG]](/icons/image2.gif) | Table 3.png | 2023-03-16 13:53 | 9.5K | |
![[IMG]](/icons/image2.gif) | Step 2.PNG | 2023-03-06 11:53 | 8.8K | |
![[IMG]](/icons/image2.gif) | RF.png | 2023-03-09 10:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | sub 16.PNG | 2023-03-10 14:54 | 6.6K | |
![[IMG]](/icons/image2.gif) | Figure 1.PNG | 2023-03-16 12:57 | 6.5K | |
![[IMG]](/icons/image2.gif) | Sn log.png | 2023-03-13 16:02 | 6.5K | |
![[IMG]](/icons/image2.gif) | Cancel.PNG | 2023-03-09 15:02 | 5.8K | |
![[IMG]](/icons/image2.gif) | radicand.png | 2023-03-10 13:52 | 5.6K | |
![[IMG]](/icons/image2.gif) | Table 1.png | 2023-03-16 13:53 | 4.9K | |
![[IMG]](/icons/image2.gif) | y over x.PNG | 2023-03-09 14:47 | 4.4K | |
![[IMG]](/icons/image2.gif) | sqrt.PNG | 2023-03-10 14:51 | 4.3K | |
![[IMG]](/icons/image2.gif) | ex1.PNG | 2023-03-09 14:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | Emperical Rule.png | 2023-03-21 14:57 | 3.6K | |
![[IMG]](/icons/image2.gif) | Permutations Form.png | 2023-03-22 14:10 | 3.1K | |
![[IMG]](/icons/image2.gif) | Graph Rational Functions1.png | 2023-03-09 09:05 | 2.0K | |
![[IMG]](/icons/image2.gif) | priwise.PNG | 2023-03-06 10:09 | 1.8K | |
![[IMG]](/icons/image2.gif) | histogram.png | 2023-03-21 14:17 | 883 | |
|