![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | (New Purchases Included.png | 2024-03-15 11:35 | 887K | |
![[VID]](/icons/movie.gif) | 1.5 Graphing Linear Functions Inequalities.mp4 | 2024-08-27 11:48 | 42M | |
| 1.png | 2024-03-21 10:23 | 283K | |
| 1 2 Graduated Commission.mp4 | 2024-08-28 10:10 | 35M | |
| 1Similar Polygons.mp4 | 2024-04-04 09:22 | 26M | |
| 1Vertical Angle Theorem.mp4 | 2024-04-03 19:24 | 4.3M | |
| 3-minute Concept.mp4 | 2024-03-27 15:12 | 18M | |
| 4 Types Of Annuity In 2023.mp4 | 2024-09-19 12:56 | 131M | |
| 5-1 Perpendicular and Angle Bisectors.mp4 | 2024-04-03 18:06 | 22M | |
| 5 tips to improve your writing skills.mp4 | 2024-04-02 14:39 | 102M | |
| 7-2 Similar Polygons (Part 2).mp4 | 2024-04-04 09:27 | 5.4M | |
| 7 Tips to Improve Your Writing.mp4 | 2024-04-02 14:41 | 66M | |
| 10 Tips to Improve Your Reading Comprehension.mp4 | 2024-04-02 14:31 | 25M | |
| 11 Components of Fitness.mp4 | 2024-11-05 13:16 | 24M | |
| 21st Century Belong to Asia.mp4 | 2024-04-07 18:54 | 36M | |
| 30-60-90 Triangles.mp4 | 2024-04-04 10:45 | 7.4M | |
| 35 ORDINAL NUMBERS.mp4 | 2025-01-23 13:03 | 19M | |
| 45-45-90 Triangles.mp4 | 2024-04-04 10:53 | 13M | |
| 1314 Review of Factoring Polynomials.mp4 | 2024-08-27 08:06 | 33M | |
| 1968 America in Turmoil Presidential Election.mp4 | 2025-02-10 13:42 | 5.5M | |
![[ ]](/icons/layout.gif) | 2018_final_review_ws_with_answers.pdf | 2024-03-06 11:45 | 199K | |
| ADBM.png | 2024-03-15 10:36 | 83K | |
| A History of the Republican Party.mp4 | 2025-02-10 13:43 | 47M | |
| AL Real Numbes.png | 2024-03-20 11:58 | 364K | |
| ASA Postulate and AAS Theorem.mp4 | 2024-04-03 16:46 | 4.4M | |
| Ab Valule.png | 2024-04-18 10:11 | 48K | |
| Absolute Advantage vs. Comparative Advantage.mp4 | 2024-04-01 11:35 | 25M | |
| Absolute Values.mp4 | 2024-08-27 08:12 | 75M | |
| Absolutism In Europe.mp4 | 2025-02-07 12:27 | 225M | |
| Absolutism in Europe.mp4 | 2024-04-07 14:46 | 29M | |
| Acccoutn.png | 2024-03-15 09:30 | 151K | |
| Account State.png | 2024-03-12 16:38 | 1.0M | |
| Account Statements-1.mp4 | 2024-09-19 12:35 | 12M | |
| Account Statements.mp4 | 2024-09-19 12:35 | 12M | |
| Account Statements.png | 2024-03-12 16:31 | 151K | |
| Account Statements2.png | 2024-03-15 09:24 | 852K | |
| Account Summary.png | 2024-04-18 08:49 | 16K | |
| Acids Bases and Salts.mp4 | 2025-01-09 12:15 | 49M | |
| Adam Smith.mp4 | 2024-03-27 15:22 | 7.4M | |
| Adaptation.mp4 | 2024-08-27 21:25 | 69M | |
| Add Sub Poly.png | 2024-04-18 10:41 | 53K | |
| Adding and Subtracting Polynomials.mp4 | 2024-08-27 08:06 | 33M | |
| Adding and Subtracting Radical Expressions.mp4 | 2024-03-26 11:55 | 20M | |
| Adding and Subtracting Rational Expressions.mp4 | 2024-08-27 11:48 | 73M | |
| Add sub rational.png | 2024-04-18 11:02 | 106K | |
| Adolescence.mp4 | 2024-10-15 14:24 | 91M | |
| Adolf Hitler1919.mp4 | 2024-04-06 17:56 | 254M | |
| African Empires in Ancient America.mp4 | 2025-02-07 10:02 | 7.4M | |
| Alexanders Empire.png | 2024-03-19 13:38 | 1.0M | |
| Alexander the Great.png | 2024-03-19 13:45 | 253K | |
| Alg Thining.png | 2024-04-18 10:16 | 105K | |
| Algebraic Expressions.mp4 | 2024-08-27 08:16 | 24M | |
| Algebraic Expressions.pdf | 2024-03-20 11:43 | 325K | |
| Algebraic Expressions 1.png | 2024-04-18 10:10 | 157K | |
| Algebraic Thinking.mp4 | 2025-01-10 12:50 | 19M | |
| Allied Powers vs. Axis Powers WWII.mp4 | 2025-02-10 13:43 | 24M | |
| Alternate, Corresponding and Allied Angles.mp4 | 2024-04-03 11:46 | 7.5M | |
| America in World War.mp4 | 2025-02-05 16:51 | 113M | |
| America in World War I.mp4 | 2024-04-06 14:46 | 146M | |
| American Postwar Prosperity.mp4 | 2025-02-05 12:13 | 45M | |
| Americas Advantages and Challenges.mp4 | 2025-02-04 16:52 | 41M | |
| An Introduction to the Pythagorean Theorem.mp4 | 2024-04-04 09:59 | 32M | |
| Ancient Greece.mp4 | 2025-02-06 17:59 | 252M | |
| Ancient Rome.mp4 | 2024-04-07 13:12 | 192M | |
| Angle Basics.mp4 | 2024-09-27 13:41 | 28M | |
| Angle Measures and Segment Lengths.mp4 | 2024-10-01 12:54 | 10M | |
| Angle Pair Relationships.mp4 | 2024-04-02 16:58 | 219M | |
| Angle Relationships with Parallel Lines.mp4 | 2024-09-27 13:41 | 9.8M | |
| Angle of Elevation and Angle of Depression.mp4 | 2024-09-30 14:20 | 7.5M | |
| Angle of depression using trigonometry.mp4 | 2024-04-04 11:23 | 57M | |
| Angles formed by Chords, Secants, or Tangents.mp4 | 2024-04-04 16:17 | 8.6M | |
| Animated grammer.mp4 | 2024-04-15 11:18 | 7.2M | |
| Annual Percentage Rate.mp4 | 2024-04-10 14:01 | 23M | |
| Annuities.png | 2024-03-13 11:19 | 186K | |
| Annuities1.png | 2024-03-13 12:07 | 712K | |
| Applying the properties of a rhombus.mp4 | 2024-04-04 09:01 | 38M | |
| Arcs in CircleS.mp4 | 2024-10-01 12:53 | 6.5M | |
| Area and Perimeter of Rhombuses and Kites.mp4 | 2024-10-01 12:53 | 8.9M | |
| Area of Regular Polygons.mp4 | 2024-10-02 11:22 | 5.7M | |
| Area of a Circle Step by Step.mp4 | 2024-04-03 09:31 | 29M | |
| Area of a Circle Study.mp4 | 2024-10-01 12:54 | 5.9M | |
| Area of a Parallelogram.mp4 | 2024-10-01 12:54 | 5.4M | |
| Area of a Rhombus.mp4 | 2024-04-04 12:31 | 3.7M | |
| Area of a Triangle.mp4 | 2024-04-04 12:25 | 7.0M | |
| Area of a regular polygon.mp4 | 2024-10-01 12:54 | 8.6M | |
| Assessments .png | 2024-03-25 11:18 | 766K | |
| Assessments.png | 2024-03-18 13:33 | 174K | |
| Assyrian Empire.png | 2024-03-18 10:00 | 325K | |
| Atomic number, Atomic mass, Mass number.mp4 | 2024-10-08 11:38 | 41M | |
| Atrom Intro.mp4 | 2024-10-08 11:37 | 13M | |
| Automated Teller Machine.mp4 | 2024-09-18 09:46 | 12M | |
| Average Daily.png | 2024-03-15 10:26 | 238K | |
| Average Daily Balance.mp4 | 2024-04-10 13:24 | 39M | |
| Average Monthly Balance.mp4 | 2024-04-10 13:22 | 12M | |
| Average Monthly Expenditures.mp4 | 2024-09-18 09:46 | 24M | |
| Average Monthly Expenditures.png | 2024-03-11 15:09 | 808K | |
| Average mont.png | 2024-03-11 15:23 | 139K | |
| BRICS economies.mp4 | 2024-04-01 12:11 | 19M | |
| Bank Deposits.png | 2024-03-12 10:38 | 212K | |
| Bank Fees.mp4 | 2024-08-29 09:33 | 29M | |
| Bank Statement.mp4 | 2024-09-18 17:19 | 37M | |
| Bank Statement.png | 2024-03-12 12:33 | 1.0M | |
| Bank Statement Reconciliation.mp4 | 2024-09-18 09:46 | 29M | |
| Basics of Polynomials.mp4 | 2024-08-27 08:05 | 32M | |
| Biconditional Statement How to Write.mp4 | 2024-04-03 10:18 | 49M | |
| Biconditional Statements if and only if.mp4 | 2024-09-27 13:41 | 24M | |
| Bisectors of Triangles GEOMETRY.mp4 | 2024-09-30 14:22 | 98M | |
| Blue Payroll.png | 2024-03-25 09:21 | 202K | |
| Body Systems.mp4 | 2024-08-27 21:24 | 21M | |
| Breakdown.mp4 | 2024-04-10 16:34 | 229M | |
| British Literature.mp4 | 2024-04-02 15:23 | 14M | |
| Browser Basics-1.mp4 | 2024-04-02 08:08 | 45M | |
| Budget.png | 2024-03-12 09:01 | 231K | |
| Budget Sheet.png | 2024-03-11 15:46 | 734K | |
| Budget sheet1.png | 2024-03-11 15:53 | 222K | |
| Byzantine Empire.mp4 | 2025-02-07 10:03 | 352M | |
| CPCTC.mp4 | 2024-04-03 17:14 | 63M | |
| Calculate Apr.png | 2024-03-20 12:23 | 285K | |
| Calculate Circumference.mp4 | 2024-04-04 13:27 | 27M | |
| Calculate Hourly.mp4 | 2024-08-28 12:36 | 7.9M | |
| Calculate Paycheck.mp4 | 2024-04-09 13:50 | 51M | |
| Calculate Straight time pay.png | 2024-03-07 14:12 | 761K | |
| Calculate US sales tax.mp4 | 2024-09-18 17:23 | 69M | |
| Calculate Weekly Time Card.png | 2024-03-08 10:58 | 692K | |
| Calculate Yearly Salary.mp4 | 2024-08-28 12:36 | 4.5M | |
| Calculate a Discount and Sale Price.mp4 | 2024-09-18 17:22 | 27M | |
| Calculating Closing Costs.mp4 | 2024-09-18 17:21 | 23M | |
| Calculating Down Payment for a Mortgage Loan.mp4 | 2024-09-18 17:21 | 14M | |
| Calculating Monthly Payments.mp4 | 2024-09-18 17:22 | 24M | |
| Car Dealer Invoice.mp4 | 2024-09-18 17:24 | 136M | |
| Car Insurance explained.mp4 | 2024-09-18 17:24 | 80M | |
| Car Shipping.mp4 | 2024-09-18 17:23 | 55M | |
| Cardiovascular Endurance.mp4 | 2024-11-05 13:16 | 30M | |
| Cards.png | 2024-03-15 09:05 | 231K | |
| Cart.png | 2024-04-18 12:03 | 213K | |
| Cartesian Product.mp4 | 2024-08-27 11:48 | 108M | |
| Cash Purchases.png | 2024-03-13 12:53 | 885K | |
| Cash and Credit.png | 2024-03-13 14:21 | 281K | |
| Cash and Credit1.png | 2024-03-13 14:25 | 199K | |
| Cash and Credit2.png | 2024-03-13 14:27 | 205K | |
| Cash buy.png | 2024-03-13 12:58 | 317K | |
| Cell Growth and Reproduction.mp4 | 2024-08-27 21:24 | 22M | |
| Cells The Basic Unit of Life.mp4 | 2024-08-27 21:23 | 20M | |
| Changes in Matter.mp4 | 2024-04-08 12:22 | 9.5M | |
| Changes of States of Matter.mp4 | 2024-04-09 09:12 | 13M | |
| Characteristics of Living Things.mp4 | 2024-08-27 21:24 | 85M | |
| Charge Accounts and Credit Cards.png | 2024-03-15 09:00 | 825K | |
| Charge And New Balance.mp4 | 2024-09-18 17:23 | 14M | |
| Charging interest.mp4 | 2024-09-18 17:23 | 13M | |
| Check Register.mp4 | 2024-09-18 17:23 | 5.0M | |
| Check Register.png | 2024-03-12 11:26 | 862K | |
| Check Register 1.png | 2024-03-12 11:28 | 863K | |
| Check Register12.png | 2024-03-12 11:32 | 278K | |
| Checkig.png | 2024-03-12 09:47 | 100K | |
| Checkig1.png | 2024-03-12 09:49 | 70K | |
| Checkig2.png | 2024-03-12 09:50 | 118K | |
| Checking Account.mp4 | 2024-09-18 17:25 | 12M | |
| Checking Account.png | 2024-03-12 09:33 | 247K | |
| Checking Accounts.png | 2024-03-12 09:29 | 1.1M | |
| Checking and Savings Accounts.mp4 | 2024-09-18 17:27 | 58M | |
| Checks.png | 2024-03-12 11:16 | 128K | |
| Chemical Equation Basics-1.mp4 | 2024-10-08 11:36 | 13M | |
| Chemical Equation Basics.mp4 | 2024-10-08 11:37 | 13M | |
| Chemical Equations.mp4 | 2025-01-09 12:18 | 124M | |
| Chemical Reactions.mp4 | 2025-01-09 12:15 | 40M | |
| Chords in Circles Lesson.mp4 | 2024-10-01 12:54 | 16M | |
| Chores.mp4 | 2025-01-23 13:02 | 9.1M | |
| Circle Geomtry Identifying Congruent.mp4 | 2024-04-04 16:08 | 8.2M | |
| Circle Theorems involving Angle Measures.mp4 | 2024-04-04 16:22 | 46M | |
| Circles, Chords And Diameters.mp4 | 2024-04-04 16:12 | 11M | |
| Circles - Area, Circumference, Radius Diameter.mp4 | 2024-09-27 13:41 | 23M | |
| Circles in the Coordinate Plane Lesson.mp4 | 2024-10-01 12:54 | 7.1M | |
| Circumference of a circle Geometry.mp4 | 2024-04-03 09:12 | 2.4M | |
| Civil Rights Liberties.mp4 | 2024-10-03 11:06 | 78M | |
| Classification of Living Things.mp4 | 2024-08-27 21:21 | 18M | |
| Classification of Numbers.mp4 | 2024-08-26 15:45 | 57M | |
| Classifying Angles.mp4 | 2024-04-02 16:51 | 7.1M | |
| Click Here.png | 2024-03-14 09:32 | 56K | |
| Closing Cost.png | 2024-03-21 14:04 | 1.1M | |
| Closing cost explained.png | 2024-03-21 12:57 | 192K | |
| Clothes.mp4 | 2025-01-23 16:40 | 6.8M | |
| Clothing Store.mp4 | 2025-01-23 16:55 | 8.0M | |
| Cold War Conflicts.mp4 | 2025-02-10 13:42 | 15M | |
| Collinear Points.mp4 | 2024-04-03 09:39 | 17M | |
| Collision Insurance.mp4 | 2024-09-19 11:44 | 109M | |
| Commission.png | 2024-03-08 15:48 | 572K | |
| Commission1.png | 2024-03-25 09:57 | 274K | |
| Commission Word Problems.mp4 | 2024-08-28 12:37 | 44M | |
| Commission pay Examples.png | 2024-03-25 10:47 | 115K | |
| Communication.png | 2024-03-07 11:43 | 400K | |
| Compare Shopping.png | 2024-03-14 09:55 | 385K | |
| Comparing Prices.mp4 | 2024-09-18 17:27 | 54M | |
| Comparison Shopping.mp4 | 2024-09-18 17:27 | 29M | |
| Comparison Shopping.png | 2024-03-14 09:50 | 684K | |
| Comparrison.mp4 | 2025-01-23 16:30 | 27M | |
| Completion of a Set.png | 2024-04-18 12:02 | 167K | |
| Compound Interest (Daily).mp4 | 2024-09-18 17:26 | 6.9M | |
| Compound Interest.png | 2024-03-13 09:21 | 1.1M | |
| Compound Interest 1.png | 2024-04-18 09:02 | 51K | |
| Compound Interest Formula.png | 2024-03-13 09:33 | 39K | |
| Compound Interest Table.mp4 | 2024-09-19 12:35 | 7.7M | |
| Compound Interest Tables.png | 2024-03-13 09:49 | 824K | |
| Compound Interest Tables 1.png | 2024-03-13 10:00 | 53K | |
| Concurrent Lines.mp4 | 2024-04-03 18:23 | 9.5M | |
| Congruence in Overlapping Triangles.mp4 | 2024-04-03 17:19 | 8.4M | |
| Congruent Complements Theorem.mp4 | 2024-04-03 11:05 | 31M | |
| Congruent Segments.mp4 | 2024-04-02 17:07 | 13M | |
| Congruent Supplements Theorem.mp4 | 2024-04-03 19:28 | 70M | |
| Conservation of Energy.mp4 | 2024-04-08 14:57 | 28M | |
| Construct an Angle Bisector using arcs on MathsPad.mp4 | 2024-04-02 17:09 | 6.8M | |
| Constructing Perpendicular from Point to Line.mp4 | 2024-04-03 12:24 | 50M | |
| Constructing a Parallel Line Through a Given Point.mp4 | 2024-04-03 12:26 | 9.5M | |
| Constructing a Triangle Using the AAS Theorem.mp4 | 2024-04-03 16:43 | 11M | |
| Construction 2-Congruent Angle.mp4 | 2024-04-02 17:05 | 6.2M | |
| Consumer Health Trends.mp4 | 2024-11-05 13:16 | 39M | |
| Consumer Math.png | 2024-03-06 11:45 | 36K | |
| Consumer Mathematics banner.png | 2024-03-06 11:45 | 688K | |
| Consumerism.mp4 | 2024-10-15 12:58 | 138M | |
| Consumer math book.png | 2024-03-07 14:48 | 1.0M | |
| Converse, Inverse, Contrapositive, Biconditional Statements.mp4 | 2024-04-03 10:07 | 64M | |
| Converse Pythagorean Theorem.mp4 | 2024-04-04 10:12 | 10M | |
| Coupons.png | 2024-03-14 10:29 | 387K | |
| Coupons and Rebates.png | 2024-03-14 10:21 | 554K | |
| Course Outline.png | 2024-03-07 10:16 | 1.3M | |
| Create Montlhy B Sheet.mp4 | 2024-09-18 17:28 | 128M | |
| Cross Section of a Cone, Cylinder, Rectangular Prism and Pyramid.mp4 | 2024-04-04 13:38 | 4.5M | |
| Cultures of the Mountains and Sea.png | 2024-03-19 09:54 | 1.2M | |
| DIFFERENCE BETWEEN SIMILAR CONGRUENT FIGURES.mp4 | 2024-04-03 13:04 | 14M | |
| Daily Compounding.png | 2024-03-13 10:19 | 285K | |
| Daily Compounding1.png | 2024-03-13 10:37 | 1.0M | |
| Dealer’s Cost.png | 2024-03-20 14:10 | 883K | |
| Dealer Fees.mp4 | 2024-09-18 17:35 | 138M | |
| Dealers cost 1.png | 2024-03-20 14:14 | 59K | |
| Deductible Coinsurance.mp4 | 2024-09-18 17:33 | 63M | |
| Deductive Reasoning.mp4 | 2024-04-03 10:25 | 6.5M | |
| Deductive Reasoning Lesson.mp4 | 2024-09-27 13:40 | 6.6M | |
| Defining the Unemployment Rate.mp4 | 2024-04-01 10:43 | 21M | |
| Definiteindefinite articles in Spanish beginner explanation artículos definidosindefinidos, el la.mp4 | 2024-04-15 09:13 | 17M | |
| Definition of Functions.png | 2024-04-18 12:51 | 112K | |
| Definition of Plane Figures in Geometry.mp4 | 2024-04-02 16:40 | 8.7M | |
| Definition of Plane Figures in Geometry High School Geometry.mp4 | 2024-04-03 09:41 | 8.7M | |
| Definition of democracy.mp4 | 2024-10-03 11:04 | 8.2M | |
| Democracy and Greece’s Golden Age.png | 2024-03-19 12:59 | 922K | |
| Deposit Savings.png | 2024-03-12 15:35 | 247K | |
| Deposits(1).png | 2024-03-12 15:19 | 604K | |
| Deposits.png | 2024-03-12 10:16 | 879K | |
| Determine salary.png | 2024-03-08 12:52 | 1.0M | |
| Determining angle of rotation.mp4 | 2024-04-04 11:58 | 4.2M | |
| Determining the APR.png | 2024-03-20 09:55 | 835K | |
| Different Installment Loands.mp4 | 2024-04-10 13:36 | 11M | |
| Different types.mp4 | 2024-04-10 13:45 | 11M | |
| Dilation Lesson.mp4 | 2024-10-01 12:54 | 6.8M | |
| Dilations Geometry Transformations.mp4 | 2024-04-04 12:01 | 17M | |
| Dist Prop.png | 2024-04-18 10:21 | 156K | |
| Distance.png | 2024-04-18 12:07 | 125K | |
| District News Integrating Technology.mp4 | 2024-04-02 14:29 | 68M | |
| Dividing monomials.mp4 | 2024-08-27 08:06 | 42M | |
| Domir.mp4 | 2025-01-23 10:48 | 38M | |
| Double-Time vs Overtime.mp4 | 2024-08-28 12:36 | 30M | |
| Drawing a Rotation Image.mp4 | 2024-04-04 11:57 | 12M | |
| Early National Period.mp4 | 2025-02-05 13:56 | 179M | |
| Earnings Management.mp4 | 2024-08-28 19:53 | 15M | |
| Earth System Science.mp4 | 2024-11-01 11:01 | 51M | |
| Economic Systems.mp4 | 2024-03-27 15:09 | 34M | |
| Economics - The Economic Way of Thinking.mp4 | 2024-04-01 12:22 | 35M | |
| Economics and Politics.mp4 | 2024-04-01 11:01 | 18M | |
| Economy. Basic concepts.mp4 | 2024-03-27 13:15 | 4.7M | |
| Ecosystem Ecology.mp4 | 2024-11-01 11:01 | 52M | |
| Electricity.mp4 | 2025-01-09 12:15 | 39M | |
| Electron Configurations and Valence Electrons.mp4 | 2024-10-08 11:36 | 9.5M | |
| Emergency Funds.mp4 | 2024-09-18 17:38 | 215M | |
| Employer Group Health Insurance.mp4 | 2024-08-28 19:54 | 109M | |
| Enviro.mp4 | 2024-04-08 16:11 | 112M | |
| Environmental Science.mp4 | 2024-08-27 21:23 | 78M | |
| Equality and Congruence.mp4 | 2024-04-03 10:55 | 5.5M | |
| Equation of a Line.mp4 | 2024-08-27 11:46 | 22M | |
| Escape Velocity.mp4 | 2024-04-08 15:57 | 46M | |
| Eulers Formula.mp4 | 2024-04-04 13:37 | 14M | |
| Expenditures for July.png | 2024-04-18 08:43 | 88K | |
| Experimental Group and Control Group.mp4 | 2024-10-08 11:37 | 10M | |
| Exploring Rocks and Minerals 1.mp4 | 2024-12-04 12:00 | 104M | |
| Extreme Fractions.png | 2024-04-18 11:42 | 37K | |
| FIRST-AID BASICS.mp4 | 2024-10-15 12:56 | 24M | |
| Face-to-Face Communication.mp4 | 2024-04-02 14:50 | 138M | |
| Factoring Poly.png | 2024-04-18 10:49 | 62K | |
| Fall of The Soviet Union.mp4 | 2024-04-07 19:06 | 66M | |
| Fascism Explained World History.mp4 | 2024-04-07 18:33 | 345M | |
| Federal Income Tax.png | 2024-03-11 10:55 | 958K | |
| Federal Reserve.mp4 | 2024-04-01 10:56 | 21M | |
| Finance Charge Unpaid-Balance Method.png | 2024-03-15 10:10 | 886K | |
| Financial Assets.mp4 | 2024-03-27 16:03 | 27M | |
| Financial Math ime Cards-1.mp4 | 2024-08-28 12:36 | 31M | |
| Financial Math ime Cards.mp4 | 2024-04-09 14:00 | 31M | |
| Financial Statements.mp4 | 2024-09-18 17:33 | 63M | |
| Find Segment Lengths in Circles.mp4 | 2024-04-04 16:23 | 77M | |
| Finding Arc Length.mp4 | 2024-04-04 13:25 | 31M | |
| Finding Area of Kites and Rhombus.mp4 | 2024-04-04 12:30 | 33M | |
| Finding Interior and Exterior Angles in a Polygon.mp4 | 2024-09-30 14:22 | 52M | |
| Finding Perimeter of Shapes on A Coordinate Plane.mp4 | 2024-04-03 09:34 | 6.2M | |
| Finding Slopes of Parallel and Perpendicular Lines.mp4 | 2024-09-27 13:41 | 13M | |
| Finding The Area of a Sector of a Circle.mp4 | 2024-04-04 13:31 | 1.9M | |
| Finding a Counterexample-1.mp4 | 2024-04-03 10:05 | 17M | |
| Finding the Area of a Segment Of a Circle.mp4 | 2024-04-04 13:32 | 5.0M | |
| Finding the Equation of a Line from a Graph (y mxb).mp4 | 2024-04-03 12:33 | 7.2M | |
| Finding the Midpoint of a Line Segment.mp4 | 2024-04-03 09:05 | 14M | |
| Finding the Slope.mp4 | 2024-09-27 13:41 | 12M | |
| Finding the Volume of a Sphere.mp4 | 2024-04-04 14:39 | 27M | |
| Finding the area of irregular shapes.mp4 | 2024-04-03 09:33 | 33M | |
| Find the Area of a Parallelogram.mp4 | 2024-04-04 12:24 | 21M | |
| Find the angle of elevation when given the length of a shadow.mp4 | 2024-04-04 11:25 | 38M | |
| Find the value of x. Congruent Triangles.mp4 | 2024-04-03 13:06 | 11M | |
| First Indian and Chinese Civilizations.mp4 | 2025-02-06 17:58 | 193M | |
| Fixed Costs vs Variable Costs.mp4 | 2024-09-18 17:33 | 19M | |
| Fixed and Variable Expenses.mp4 | 2024-09-18 17:34 | 92M | |
| Florida Ecosystems.mp4 | 2024-03-26 16:52 | 33M | |
| Foil Method.png | 2024-04-18 10:47 | 110K | |
| Food Chains vs Food Webs.mp4 | 2024-11-01 11:00 | 20M | |
| For Piecework.mp4 | 2024-08-28 12:35 | 16M | |
| Forces and Motions.mp4 | 2025-01-09 12:18 | 106M | |
| Foreign Domestic Policy.mp4 | 2024-10-03 11:04 | 11M | |
| Foreign Policy.mp4 | 2025-02-05 13:40 | 130M | |
| Formation of Glaciers.mp4 | 2024-12-04 11:59 | 22M | |
| FormsTypesofEnergy.mp4 | 2024-10-08 11:38 | 30M | |
| Forms of Energy-1.mp4 | 2025-01-09 12:17 | 58M | |
| Forms of Energy.mp4 | 2024-10-08 11:38 | 30M | |
| Formulas using variables.png | 2024-04-18 10:26 | 37K | |
| Fossils.mp4 | 2024-12-04 12:01 | 143M | |
| Foundations of American Government.mp4 | 2024-10-03 11:04 | 16M | |
| France Revolution 1815-1848.mp4 | 2025-02-07 12:38 | 327M | |
| Free Enterprise System.mp4 | 2024-03-27 15:15 | 7.6M | |
| Fsmily members.mp4 | 2025-01-23 10:23 | 6.4M | |
| Full Commission and Salary Plus Commission.mp4 | 2024-08-28 12:36 | 44M | |
| Functions.mp4 | 2024-08-27 11:47 | 101M | |
| Functions.png | 2024-04-18 12:16 | 105K | |
| Functions1.png | 2024-04-18 12:53 | 47K | |
| Functions2.png | 2024-04-18 12:54 | 54K | |
| Future Value.png | 2024-04-18 09:04 | 123K | |
| GEOMETRY PROOFS.mp4 | 2024-09-27 13:41 | 16M | |
| Geo.png | 2024-04-18 12:05 | 261K | |
| Geography culture facts to learn if youre bored.mp4 | 2025-02-06 16:51 | 250M | |
| Geometry Conditional Statements.mp4 | 2024-04-03 10:10 | 18M | |
| Geometry Construct a Perpendicular Bisector.mp4 | 2024-04-02 17:08 | 17M | |
| Geometry Inscribed Angles.mp4 | 2024-10-01 12:54 | 7.3M | |
| Geometry Week 2 - segment addition postulate.mp4 | 2024-04-02 16:47 | 9.5M | |
| Geometry notes 7-9 Write Equations of Parallel Perpendicular Lines.mp4 | 2024-04-03 12:43 | 15M | |
| George W. Bush A Controversial Presidency.mp4 | 2025-02-10 13:48 | 195M | |
| Globalization.mp4 | 2024-04-01 12:18 | 18M | |
| Glossary.pdf | 2024-03-06 11:45 | 1.3M | |
| Golden Age.png | 2024-03-19 12:46 | 411K | |
| Government.png | 2024-03-18 14:17 | 179K | |
| Government Revenue and Spending.mp4 | 2024-03-27 15:38 | 27M | |
| Government Spending.mp4 | 2024-03-27 15:52 | 40M | |
| Grad State Income Tax.mp4 | 2024-08-28 19:53 | 24M | |
| Graduated Commission.mp4 | 2024-08-28 12:35 | 26M | |
| Graduated Commission1.mp4 | 2024-08-28 12:35 | 35M | |
| Graduated Commission1.png | 2024-03-25 10:36 | 946K | |
| Graduated Commission2.png | 2024-03-25 10:42 | 599K | |
| Graduated Commission2323.mp4 | 2024-08-28 12:35 | 50M | |
| Graduated State Income Tax.mp4 | 2024-08-28 19:52 | 42M | |
| Graduated State Tax.png | 2024-03-11 12:44 | 820K | |
| Graduated State income Tax.png | 2024-03-11 12:36 | 184K | |
| Graph 1.png | 2024-04-18 12:59 | 67K | |
| Graph 2.png | 2024-04-18 13:00 | 52K | |
| Graph 3.png | 2024-04-18 13:02 | 48K | |
| Graph 4.png | 2024-04-18 13:03 | 86K | |
| Graph 5.png | 2024-04-18 13:04 | 102K | |
| Graphing Parallel and Perpendicular Lines.mp4 | 2024-08-27 11:45 | 23M | |
| Graphing Quads.png | 2024-04-18 12:55 | 190K | |
| Graphing a Basic Function.mp4 | 2024-08-27 09:22 | 12M | |
| Graphing uadratic in factored form.mp4 | 2024-08-27 11:45 | 15M | |
| Gregor Mendel and DNA.mp4 | 2024-08-27 21:23 | 71M | |
| Gross Income.png | 2024-03-07 12:45 | 683K | |
| Gross Income Vs Net Income.mp4 | 2024-08-28 12:37 | 183M | |
| Gross Net.png | 2024-03-07 13:51 | 112K | |
| Gross income 1.png | 2024-03-07 13:20 | 198K | |
| Group Health.png | 2024-03-11 13:25 | 324K | |
| Gupta Dynasty.mp4 | 2025-02-07 10:24 | 16M | |
| HMO, EPO and PPO.mp4 | 2024-09-18 17:37 | 137M | |
| Health In.png | 2024-03-22 11:22 | 234K | |
| Health Insurance Benefits.png | 2024-03-22 11:16 | 726K | |
| Health Insurance Prem.png | 2024-03-22 10:41 | 117K | |
| Health Insurance Prem1.png | 2024-03-22 10:44 | 277K | |
| Health Insurance Premiums.mp4 | 2024-09-18 17:35 | 58M | |
| Health Insurance Premiums.png | 2024-03-22 10:35 | 550K | |
| Health and Life.png | 2024-03-22 10:20 | 311K | |
| Hierarchy of Nutrition Body Composition.mp4 | 2024-11-05 13:17 | 117M | |
| Hiroshima Dropping The Bomb.mp4 | 2025-02-10 13:44 | 49M | |
| History of Atomic Theory.mp4 | 2025-01-09 12:17 | 49M | |
| History of Banking.mp4 | 2024-04-01 10:54 | 19M | |
| History of Mexico Documentary.mp4 | 2025-01-23 09:33 | 41M | |
| History of Spain.mp4 | 2025-01-15 13:09 | 186M | |
| History of U.S. Federal Income Tax.mp4 | 2024-08-28 17:03 | 24M | |
| History of the NAACP and Civil Rights.mp4 | 2025-02-04 16:53 | 42M | |
| Homeowners Insurance.png | 2024-03-21 15:04 | 896K | |
| Homeowners Insurance Coverage.mp4 | 2024-09-18 17:55 | 689M | |
| Homeowners Insurance Coverage1.mp4 | 2024-04-10 16:25 | 713M | |
| Homeowners insurn.png | 2024-03-21 15:07 | 224K | |
| Hourly Pay.png | 2024-03-08 16:06 | 778K | |
| Hour to salary.png | 2024-03-22 13:55 | 84K | |
| House Mortage.png | 2024-03-21 11:22 | 200K | |
| Housing Cost.mp4 | 2024-09-18 17:46 | 354M | |
| Housing Cost.png | 2024-03-21 10:50 | 1.2M | |
| Housing Costs 1.png | 2024-03-21 10:52 | 215K | |
| Housing Costs 2.png | 2024-03-21 11:08 | 218K | |
| Housing Crash Will Happen.mp4 | 2024-09-18 17:44 | 317M | |
| How Do Property Taxes Work.mp4 | 2024-09-18 17:42 | 149M | |
| How Mortgage Interest Works.mp4 | 2024-09-18 17:40 | 81M | |
| How Mountains Are Formed.mp4 | 2024-12-04 11:59 | 42M | |
| How Rivers.mp4 | 2024-12-04 11:59 | 6.6M | |
| How To Determine If Two Lines are Parallel to Apply Angle Theorems.mp4 | 2024-04-03 12:39 | 13M | |
| How To Improve Your English Writing Skills.mp4 | 2024-04-02 15:42 | 81M | |
| How To Plot Inequalities on a Number Line.mp4 | 2024-08-27 08:05 | 14M | |
| How To Solve Quadratic Equations.mp4 | 2024-08-27 08:04 | 13M | |
| How To Tell If Two Lines Are Parallel, Perpendicular, or Neither.mp4 | 2024-04-03 12:40 | 4.4M | |
| How did Arabs become one of the Unspoke.mp4 | 2024-04-07 18:59 | 30M | |
| How does the stock market work.mp4 | 2024-04-01 09:22 | 23M | |
| How to Balance Chemical Equations.mp4 | 2024-10-08 11:38 | 55M | |
| How to Balance a Checkbook.mp4 | 2024-09-18 17:41 | 29M | |
| How to Calculate Overtime Pay.mp4 | 2024-08-28 12:34 | 40M | |
| How to Calculate Simple Interest.mp4 | 2024-09-18 17:41 | 7.4M | |
| How to Construct the Midpoint of a Segment.mp4 | 2024-04-02 16:45 | 14M | |
| How to Improve Your Reading Skills.mp4 | 2024-04-02 15:02 | 49M | |
| How to Negotiate a NEW Car.mp4 | 2024-09-18 17:49 | 179M | |
| How to Read a Chemical Equation-1.mp4 | 2024-10-08 11:37 | 14M | |
| How to Read a Chemical Equation.mp4 | 2024-10-08 11:38 | 14M | |
| How to Read a Credit Card Statement.mp4 | 2024-09-18 17:45 | 36M | |
| How to Read a Topo Map.mp4 | 2024-12-04 12:01 | 98M | |
| How to Read the Periodic Table.mp4 | 2024-10-08 11:38 | 13M | |
| How to Reconcile Bank Accounts.mp4 | 2024-09-18 17:46 | 69M | |
| How to Solve a Tangent Ratio Lessons in Math.mp4 | 2024-04-04 11:14 | 8.0M | |
| How to Use the Verb Estar in Spanish.mp4 | 2024-04-15 09:52 | 4.8M | |
| How to Write A Check.mp4 | 2024-09-18 17:45 | 7.3M | |
| How to find Percent Markdown.mp4 | 2024-09-18 17:42 | 17M | |
| How to make a deposit-1.mp4 | 2024-09-18 17:44 | 60M | |
| How to make a deposit.mp4 | 2024-09-19 11:34 | 60M | |
| Hypotenuse - Leg Congruence Theorem.mp4 | 2024-04-03 17:11 | 4.8M | |
| IInstallment Loan.mp4 | 2024-09-18 17:46 | 21M | |
| INEQUALITIES IN TRIANGLES.mp4 | 2024-09-30 14:20 | 11M | |
| Identifying.mp4 | 2024-04-03 11:30 | 17M | |
| Identifying Angle Pairs.mp4 | 2024-04-02 17:00 | 17M | |
| Identifying Geometric Patterns.mp4 | 2024-09-27 13:41 | 8.5M | |
| Identifying Special Quadrilaterals.mp4 | 2024-04-03 12:22 | 31M | |
| Identifying parallel and perpendicular lines.mp4 | 2024-04-03 12:01 | 4.8M | |
| Identifying parallel and perpendicular lines1.mp4 | 2024-04-03 19:06 | 4.8M | |
| If - Then Statements Lesson.mp4 | 2024-09-27 13:41 | 6.6M | |
| Image 1.png | 2024-03-21 12:46 | 3.6K | |
| Image 2.png | 2024-03-21 12:46 | 3.7K | |
| Image 3.png | 2024-03-21 12:46 | 7.5K | |
| Image 4.png | 2024-03-21 12:46 | 12K | |
| Imperialism.mp4 | 2024-04-07 18:07 | 172M | |
| Incenter, Circumcenter, Centroid, Orthocenter.mp4 | 2024-04-03 18:26 | 188M | |
| Income Statement.mp4 | 2024-08-28 19:52 | 64M | |
| Indirect Measurement.mp4 | 2024-09-30 14:20 | 6.6M | |
| Indirect Measurement and the Triangle Midsegment Theorem.mp4 | 2024-04-03 17:32 | 6.9M | |
| Indirect Proof.mp4 | 2024-04-03 19:12 | 4.6M | |
| Indirect Proof Example-1.mp4 | 2024-04-03 19:14 | 37M | |
| Indirect Proof Example.mp4 | 2024-09-30 14:21 | 31M | |
| Inequalities on a Number line.png | 2024-04-18 10:24 | 52K | |
| Inscribed Angle Theorem Maths.mp4 | 2024-04-04 16:16 | 23M | |
| Inside Atoms.mp4 | 2024-10-08 11:39 | 20M | |
| Installment Loands.png | 2024-03-19 16:08 | 249K | |
| Installment Loans.png | 2024-03-19 16:02 | 703K | |
| Installment Loans Allocation of Monthly Payment.png | 2024-03-20 08:30 | 864K | |
| Installment loans1.png | 2024-03-20 08:36 | 212K | |
| Insurance.png | 2024-03-21 08:52 | 195K | |
| Insurance Types.png | 2024-03-22 09:03 | 454K | |
| Interior and Exterior Angles in a Polygon.mp4 | 2024-09-30 14:22 | 52M | |
| Intersection and Union.png | 2024-04-18 12:00 | 75K | |
| Introduction - What Is American Literature.mp4 | 2024-04-02 15:12 | 23M | |
| Introduction to Ecology.mp4 | 2024-04-08 16:27 | 16M | |
| Introduction to Economics.mp4 | 2024-03-27 12:26 | 35M | |
| Introduction to the Atom.mp4 | 2025-01-09 12:16 | 17M | |
| Intro to lines, line segments, and rays-1.mp4 | 2024-04-03 09:43 | 4.2M | |
| Intro to lines, line segments, and rays.mp4 | 2024-04-02 16:42 | 4.2M | |
| Inverse Sine, Cosine, and Tangent Functions.mp4 | 2024-04-04 11:13 | 5.8M | |
| Is This a Good.mp4 | 2024-09-18 17:52 | 205M | |
| Is gravity a force.mp4 | 2024-10-08 11:40 | 74M | |
| Isosceles Triangle Theorem - Proof.mp4 | 2024-09-27 13:42 | 10M | |
| Jimmy Carter BIO.mp4 | 2025-02-10 13:43 | 32M | |
| Kingdoms, Phyla, and More.mp4 | 2024-11-01 11:01 | 78M | |
| Knights of Labor.mp4 | 2025-02-05 10:35 | 65M | |
| Labor Employment.mp4 | 2024-03-27 15:34 | 53M | |
| Labor Markets.mp4 | 2024-03-27 15:31 | 128M | |
| Latin American Revolution.mp4 | 2025-02-07 12:50 | 291M | |
| Law of Conservation of Mass.mp4 | 2024-10-08 11:38 | 1.9M | |
| Law of Detachment.mp4 | 2024-04-03 10:26 | 5.2M | |
| Law of Syllogism.mp4 | 2024-04-03 10:28 | 16M | |
| Learn Spanish alphabet and vowels with BASHO FRIENDS - El Alfabeto.mp4 | 2025-01-23 10:22 | 14M | |
| Leasing.png | 2024-03-21 10:08 | 85K | |
| Leasing a Car.png | 2024-03-21 09:56 | 451K | |
| Leasing a Vehicle.mp4 | 2024-09-18 17:47 | 27M | |
| Lesson 1 section 3 Measuring Segments.mp4 | 2024-09-27 13:42 | 11M | |
| Line of Equation.png | 2024-04-18 12:11 | 65K | |
| Line of reflection example.mp4 | 2024-04-04 11:54 | 2.3M | |
| Lines and Angles.mp4 | 2024-09-27 13:43 | 52M | |
| LoaNS1.png | 2024-03-15 12:06 | 211K | |
| Loan app.png | 2024-03-15 12:49 | 196K | |
| Loans.png | 2024-03-15 11:51 | 1.3M | |
| Loans 2.png | 2024-03-15 12:24 | 447K | |
| Logical Reasoning.mp4 | 2024-09-27 13:42 | 22M | |
| Loss of Coverage.mp4 | 2024-04-10 16:27 | 57M | |
| Machu.png | 2024-04-24 10:35 | 318K | |
| Macroeconomics.mp4 | 2024-04-01 10:23 | 162M | |
| Magnetism.mp4 | 2025-01-09 12:20 | 140M | |
| Major Ocean Currents.mp4 | 2024-11-01 10:59 | 10M | |
| Make a deposit.mp4 | 2024-09-18 17:50 | 60M | |
| M and D Radicals.png | 2024-04-18 11:27 | 84K | |
| Margin.mp4 | 2024-03-27 13:18 | 7.0M | |
| Marine PLants.mp4 | 2024-11-01 11:05 | 186M | |
| Marine Resources.mp4 | 2024-11-01 11:02 | 66M | |
| Markdown.png | 2024-03-14 11:07 | 387K | |
| Markdowns.png | 2024-03-14 10:48 | 311K | |
| Market equilibrium.mp4 | 2024-04-01 10:59 | 13M | |
| Markups and Markdowns.mp4 | 2024-09-18 17:50 | 34M | |
| Master Simplifying Rational Expressions.mp4 | 2024-08-27 11:47 | 156M | |
| Matter.mp4 | 2025-01-09 12:18 | 41M | |
| Medicare.png | 2024-03-11 13:10 | 262K | |
| Menu.png | 2024-04-18 09:16 | 254K | |
| Midpoint.png | 2024-04-18 12:08 | 47K | |
| Midpoint Formula.mp4 | 2024-08-27 11:45 | 73M | |
| Midpoint and Distance in the Coordinate Plane.mp4 | 2024-09-27 13:42 | 20M | |
| Money, Banking, and the Federal Reserve.mp4 | 2024-04-01 10:50 | 103M | |
| Monthly Installment Loan Payment.mp4 | 2024-09-18 17:50 | 22M | |
| Monthly Payment.png | 2024-03-21 12:41 | 1.0M | |
| Monthly Payment 1.png | 2024-03-21 14:23 | 573K | |
| Monthly Payment Allocation.mp4 | 2024-09-18 17:51 | 40M | |
| Mortgage 1.png | 2024-04-18 09:24 | 12K | |
| Mortgage 2.png | 2024-04-18 09:29 | 27K | |
| Mortgage Loans.png | 2024-03-21 11:18 | 713K | |
| Mortgage Stement.png | 2024-03-21 14:27 | 214K | |
| Mortgage percent.png | 2024-03-21 12:30 | 173K | |
| Mortgages Explained What is a Mortgage.mp4 | 2024-09-18 17:52 | 75M | |
| Mountains and Sea.png | 2024-03-19 09:34 | 529K | |
| Multi Mon.png | 2024-04-18 10:43 | 146K | |
| Multi Rational Expressions.png | 2024-04-18 11:04 | 133K | |
| Multimedia Technology in the Classroom.mp4 | 2024-04-02 15:21 | 9.3M | |
| Multiply and Divide Radical Expressions.mp4 | 2024-03-26 11:55 | 20M | |
| Multiplying Conjugates.mp4 | 2024-03-26 12:37 | 2.7M | |
| Multiplying Polynomials.mp4 | 2024-08-27 08:04 | 48M | |
| Multiplying and Dividing Rational Expressions.mp4 | 2024-08-27 11:45 | 59M | |
| Muscular Fitness.mp4 | 2024-11-05 13:17 | 87M | |
| Naming components of the scientific method.mp4 | 2024-10-08 11:39 | 8.1M | |
| National Savings.mp4 | 2024-03-27 15:59 | 19M | |
| Nationalism in Europe.mp4 | 2025-02-07 14:39 | 25M | |
| Nations, States, Nation States.mp4 | 2025-02-07 10:51 | 149M | |
| Negotiate a Used Car.mp4 | 2024-09-18 17:56 | 175M | |
| Net Income banner.png | 2024-03-11 10:00 | 1.0M | |
| New Directions in Government and Society.png | 2024-03-18 13:56 | 828K | |
| New Frontier.mp4 | 2025-02-10 13:46 | 92M | |
| New Ideas.mp4 | 2025-02-07 15:03 | 359M | |
| Nuc Power PLant.mp4 | 2024-10-08 11:39 | 25M | |
| Nuclear Energy-1.mp4 | 2025-01-09 12:17 | 15M | |
| Nuclear Energy.mp4 | 2024-04-08 15:27 | 11M | |
| Nutrition.mp4 | 2024-10-15 12:56 | 16M | |
| Obama Discusses Managing Stress.mp4 | 2024-10-15 12:56 | 25M | |
| Ocean Sediments.mp4 | 2024-11-01 11:02 | 41M | |
| Ocean Waves.mp4 | 2025-01-09 12:20 | 131M | |
| Ocean Waves Basics.mp4 | 2024-11-01 11:03 | 77M | |
| Ocean Zones.mp4 | 2024-11-01 11:02 | 26M | |
| Online Banking.png | 2024-03-12 14:38 | 205K | |
| Online Banking 1.png | 2024-03-12 14:51 | 659K | |
| Operating and Maintain.png | 2024-03-21 09:06 | 259K | |
| Operating and Maintaining a Vehicle.mp4 | 2024-09-18 17:53 | 47M | |
| Operating and Maintaining a Vehicle.png | 2024-03-21 09:49 | 776K | |
| Optimal decision.mp4 | 2024-03-27 15:05 | 11M | |
| Order of Operation.pdf | 2024-03-20 11:41 | 1.2M | |
| Order of Operations - PEMDAS (Learn Algebra 1).mp4 | 2024-08-27 08:12 | 107M | |
| Order of Operations.png | 2024-04-18 10:07 | 31K | |
| Organ Systems.mp4 | 2024-08-27 21:22 | 36M | |
| Original Pearl Harbor.mp4 | 2025-02-04 16:49 | 316M | |
| Other Housing Costs.png | 2024-03-22 08:39 | 697K | |
| Our Environment.mp4 | 2024-12-04 12:03 | 222M | |
| Overtime.png | 2024-03-08 10:16 | 189K | |
| Overtime Calculations.mp4 | 2024-04-09 13:49 | 14M | |
| Overtime Pay1.png | 2024-03-08 15:55 | 916K | |
| Overtime Pay Figure.png | 2024-03-08 10:02 | 890K | |
| Overtime pay.png | 2024-03-22 14:46 | 221K | |
| Overtime pay1.png | 2024-03-22 14:48 | 255K | |
| Overview of the Middle Ages.mp4 | 2025-02-07 10:02 | 47M | |
| P and P lines.png | 2024-04-18 12:12 | 110K | |
| Parallel, Intersection and Perpendicular Line.mp4 | 2024-04-03 12:19 | 8.2M | |
| Parallel Planes and Lines.mp4 | 2024-04-03 11:31 | 8.5M | |
| Parallelogram Angles Diagonals.mp4 | 2024-04-04 08:33 | 21M | |
| Parallelograms.mp4 | 2024-04-04 08:44 | 28M | |
| Parts of house.mp4 | 2024-04-15 11:05 | 34M | |
| Pay Periods.mp4 | 2024-08-28 12:33 | 37M | |
| Paying Off Simple Interest.mp4 | 2024-09-18 17:53 | 30M | |
| Paying off.png | 2024-03-20 09:11 | 682K | |
| Paying off Simple Interest Isntallment.png | 2024-03-20 09:32 | 155K | |
| Payoff Simple Interest.mp4 | 2024-09-18 17:55 | 35M | |
| Payroll.png | 2024-03-08 10:14 | 190K | |
| Perpendicular Bisectors in a Triangle Dont Memorise.mp4 | 2024-09-30 14:21 | 4.8M | |
| Perpendicular Transversal Theorem.mp4 | 2024-09-27 13:42 | 2.0M | |
| Persian Empire.png | 2024-03-19 12:10 | 353K | |
| Personal_finance_(2020).pdf | 2024-04-03 09:54 | 51M | |
| Physical and Chemical Properties.mp4 | 2024-10-08 11:40 | 41M | |
| Physical benefits of Physical Activity.mp4 | 2024-11-05 13:17 | 72M | |
| Piecework.png | 2024-03-08 12:28 | 81K | |
| Piecework Basis(2).png | 2024-03-08 12:55 | 1.0M | |
| Piecework Basis.png | 2024-03-08 12:26 | 723K | |
| Piecework Pay.mp4 | 2024-08-28 12:33 | 33M | |
| Places in town.mp4 | 2024-04-15 10:58 | 116M | |
| Plankton.mp4 | 2024-11-01 11:04 | 53M | |
| Plastics Out.mp4 | 2024-11-01 11:04 | 69M | |
| Plate Tectonics.mp4 | 2024-04-08 16:00 | 13M | |
| Plate Tectonics Basics.mp4 | 2024-12-04 12:00 | 41M | |
| Poder.mp4 | 2025-01-23 10:48 | 4.8M | |
| Point Slope FOrm.png | 2024-04-18 12:14 | 49K | |
| Point Slope Form.mp4 | 2024-08-27 11:44 | 20M | |
| Point Slope Form of a Line.mp4 | 2024-04-03 12:35 | 22M | |
| Points, Lines, Planes.mp4 | 2024-09-27 13:43 | 39M | |
| Political Interest Groups.mp4 | 2024-10-03 11:06 | 65M | |
| Politics of the Twenties.mp4 | 2024-10-03 11:05 | 35M | |
| Polygon Angle Sum Theorems.mp4 | 2024-04-04 09:39 | 10M | |
| Polyhedrons Lesson-1.mp4 | 2024-10-01 12:42 | 9.8M | |
| Polyhedrons Lesson.mp4 | 2024-10-01 12:54 | 9.8M | |
| Population and Economy.mp4 | 2024-04-01 10:28 | 12M | |
| Possessive adjectives in SPANISH.mp4 | 2025-01-23 10:22 | 8.8M | |
| Postwar America.mp4 | 2025-02-10 13:44 | 18M | |
| Poverty and Income Distribution.mp4 | 2024-04-01 10:30 | 34M | |
| Pre Columbian America.mp4 | 2025-02-04 17:27 | 162M | |
| Preparing a Budget Sheet.mp4 | 2024-09-18 17:55 | 28M | |
| Principal Interest.mp4 | 2024-09-18 17:55 | 43M | |
| Principal Payments.mp4 | 2024-09-18 17:57 | 86M | |
| Priniple pay.png | 2024-03-21 14:11 | 303K | |
| Prisms Lesson.mp4 | 2024-10-01 12:54 | 9.1M | |
| Product Property.png | 2024-04-18 11:24 | 138K | |
| Proof Sum of measures of angles.mp4 | 2024-09-27 13:42 | 6.0M | |
| Properties of Equality and Congruence.mp4 | 2024-04-03 10:57 | 23M | |
| Properties of Ocean Water.mp4 | 2024-11-01 11:02 | 7.9M | |
| Properties of Parallel Lines.mp4 | 2024-09-27 13:42 | 13M | |
| Properties of a Kite in Geometry.mp4 | 2024-09-30 14:21 | 4.3M | |
| Properties of the Triangle Proportionality Theorem.mp4 | 2024-04-04 09:54 | 7.7M | |
| Property taxes.png | 2024-03-21 14:44 | 336K | |
| Proportions.png | 2024-04-18 11:45 | 60K | |
| Proportions Geo Concepts.mp4 | 2024-09-30 14:22 | 20M | |
| Propotions.png | 2024-04-18 11:48 | 153K | |
| Proving Lines are Parallel.mp4 | 2024-04-03 11:54 | 14M | |
| Proving Overlapping Triangles Congruent.mp4 | 2024-04-03 17:24 | 22M | |
| Proving Parallel Lines.mp4 | 2024-09-27 13:44 | 47M | |
| Proving Triangles Similar.mp4 | 2024-04-04 09:32 | 9.4M | |
| Proving Triangles are Congruent.mp4 | 2024-04-03 13:05 | 8.2M | |
| Proving a Quadrilateral is a Parallelogram.mp4 | 2024-04-04 08:43 | 13M | |
| Purchased a Used Vehicle.png | 2024-03-20 15:44 | 852K | |
| Purchasing a Vehicle.png | 2024-03-20 13:35 | 1.1M | |
| Purchasing a new vehichle.png | 2024-03-20 13:39 | 211K | |
| Pyramids Lesson.mp4 | 2024-10-01 12:54 | 12M | |
| Pythagorean Theorem A Step-by-Step Guide.mp4 | 2024-04-04 09:57 | 30M | |
| Quad Poly.png | 2024-04-18 10:51 | 207K | |
| Rad.png | 2024-04-18 11:28 | 95K | |
| Radical Expressions.png | 2024-04-18 11:26 | 56K | |
| Ratio and Proportion.mp4 | 2024-08-27 11:43 | 31M | |
| Ratio and Proportion Word Problems.mp4 | 2024-04-04 09:16 | 16M | |
| Ratios and Proportions.mp4 | 2024-04-04 09:15 | 9.1M | |
| Ratios and Proportions.png | 2024-04-18 11:43 | 67K | |
| ReDriven.mp4 | 2024-09-18 18:02 | 173M | |
| Read Compound Interest Tables.mp4 | 2024-09-18 17:58 | 118M | |
| Read a Credit Card Statement.mp4 | 2024-09-18 17:56 | 36M | |
| Reagan_Foreign_Policy.mp4 | 2025-02-06 16:03 | 357M | |
| Real Estate Taxes.mp4 | 2024-09-18 17:56 | 18M | |
| Real Estate Taxes.png | 2024-03-21 14:40 | 1.0M | |
| Reasons for ExploringColonization.mp4 | 2025-02-07 10:37 | 47M | |
| Reconcil Statement.png | 2024-03-12 12:56 | 600K | |
| Reconstruction After the Civil War.mp4 | 2025-02-04 18:19 | 523M | |
| Record Keep.png | 2024-03-11 14:24 | 173K | |
| Record Keeping.png | 2024-03-11 14:21 | 916K | |
| Record Keeping Tips.mp4 | 2024-09-18 18:01 | 173M | |
| Record a Cash Purchase.mp4 | 2024-09-18 17:56 | 5.5M | |
| Reflection Across the X and Y Axis.mp4 | 2024-04-04 11:53 | 45M | |
| Reflections Lesson1.mp4 | 2024-10-01 12:54 | 6.7M | |
| Relating Parallel and Perpendicular Lines.mp4 | 2024-04-03 12:00 | 6.6M | |
| Relating Parallel and Perpendicular Lines1.mp4 | 2024-04-03 19:03 | 6.6M | |
| Renewable Energy.mp4 | 2024-04-08 16:07 | 46M | |
| Renting.mp4 | 2024-09-18 17:57 | 18M | |
| Renting II.mp4 | 2024-04-10 15:13 | 12M | |
| Renting a Vehicle.png | 2024-03-21 10:15 | 780K | |
| Revolutions of 1848 in France.mp4 | 2024-04-07 15:55 | 101M | |
| Right Triangles.mp4 | 2024-09-27 13:43 | 16M | |
| Riptide.mp4 | 2025-02-10 13:44 | 22M | |
| Rise of Industrial America.mp4 | 2025-02-05 12:59 | 202M | |
| Road to Revolution.mp4 | 2025-02-04 16:55 | 389M | |
| Rotations Lesson.mp4 | 2024-10-01 12:54 | 6.9M | |
| SAS Postulate.mp4 | 2024-04-03 16:39 | 16M | |
| SER and ESTAR Conjugation.mp4 | 2024-04-15 11:07 | 12M | |
| SSS, SAS, and AA 128-2.28.mp4 | 2024-04-04 09:33 | 25M | |
| SSS and SAS Congruence Theorem.mp4 | 2024-09-27 13:44 | 57M | |
| STANDARD EQUATION OF A CIRCLE FORMULA.mp4 | 2024-04-04 16:29 | 16M | |
| Salary.png | 2024-03-08 16:09 | 1.1M | |
| Salary Pay vs. Hourly Pay.mp4 | 2024-08-28 12:06 | 26M | |
| Salary Per Payroll.png | 2024-03-25 09:13 | 1.2M | |
| Salary VS Hourly.mp4 | 2024-08-28 12:34 | 104M | |
| Salary vs Hourly Wage Whats the Difference.mp4 | 2024-08-28 12:32 | 11M | |
| Sale Price.png | 2024-03-14 14:45 | 572K | |
| Sale Price 1.png | 2024-03-14 14:49 | 193K | |
| Sales Tax.png | 2024-03-13 15:15 | 1.0M | |
| Sales Tax 1.png | 2024-03-13 15:11 | 93K | |
| Savings, Investment, and the Financial System.mp4 | 2024-04-01 09:26 | 19M | |
| Savings Accoint.png | 2024-03-12 13:45 | 655K | |
| Savings Account 1.png | 2024-03-12 13:50 | 65K | |
| Savings Pig.png | 2024-03-12 14:06 | 174K | |
| Savings Withdrawls.png | 2024-03-12 16:23 | 825K | |
| School Subjects.mp4 | 2024-04-15 09:32 | 16M | |
| Science and Society.mp4 | 2024-04-09 10:28 | 47M | |
| Science and Society Lecture One.mp4 | 2025-01-09 12:20 | 78M | |
| Scientifc Method.mp4 | 2024-08-27 21:25 | 189M | |
| Scientific Measurement.mp4 | 2025-01-09 12:19 | 31M | |
| Sea Floor Spreading Lecture.mp4 | 2024-11-01 11:03 | 19M | |
| Sea Floor Spreading Lecture copy.mp4 | 2024-10-17 09:05 | 10M | |
| Seawater Chemistry.mp4 | 2024-11-01 11:05 | 57M | |
| Selective Service Act Rights and Responsibilities.mp4 | 2025-02-04 18:28 | 270M | |
| Self Esteem.mp4 | 2024-10-15 12:58 | 79M | |
| Set of Real Numbers.png | 2024-04-18 10:05 | 104K | |
| Sets, Unions and Intersections.mp4 | 2024-08-27 11:42 | 27M | |
| Sets.mp4 | 2024-08-27 11:43 | 38M | |
| Sexually Transmitted Diseases.mp4 | 2024-10-15 12:56 | 12M | |
| Similar Polygons (Part 1).mp4 | 2024-04-04 09:26 | 24M | |
| Simp Rat Expressions.png | 2024-04-18 10:54 | 22K | |
| Simp Rational.png | 2024-04-18 10:53 | 253K | |
| Simple Interest Formula.png | 2024-03-13 08:53 | 150K | |
| Simple Interest Installment Loans.png | 2024-03-19 16:48 | 623K | |
| Simple Interest Isntallment.png | 2024-03-19 17:01 | 123K | |
| Simple Interest Rates.png | 2024-03-13 08:44 | 1.2M | |
| Simple Interest Rates 1.png | 2024-03-13 08:49 | 1.2M | |
| Simple Machines.mp4 | 2025-01-13 18:21 | 9.3M | |
| Simple interest loans.png | 2024-03-19 16:50 | 186K | |
| Simple vs. Compound Interest-1.mp4 | 2024-09-18 17:59 | 87M | |
| Simplifying A Radical Expression Three Methods.mp4 | 2024-08-27 11:10 | 28M | |
| Simplying Radicals.png | 2024-04-18 11:22 | 245K | |
| Single Payment Loans.png | 2024-03-15 13:20 | 706K | |
| Slope Formula.mp4 | 2024-08-27 11:42 | 26M | |
| Slope Intercept.png | 2024-04-18 12:09 | 151K | |
| Social Security and Medicare Tax.mp4 | 2024-08-28 19:53 | 147M | |
| Social Security and Medicare Taxes1.png | 2024-03-11 13:05 | 1.1M | |
| Social Security is Taxed.mp4 | 2024-08-28 19:50 | 66M | |
| Social and Medi.png | 2024-03-11 13:12 | 223K | |
| Solar System.mp4 | 2024-12-04 12:02 | 79M | |
| Solutions Suspensions.mp4 | 2025-01-09 09:58 | 51M | |
| Solve for Commissions.mp4 | 2024-08-28 12:31 | 17M | |
| Solving Angles in a Parallelogram.mp4 | 2024-04-04 08:35 | 30M | |
| Solving Basic Equations.mp4 | 2024-08-27 08:11 | 25M | |
| Solving Basic Equations1.mp4 | 2024-08-27 11:41 | 25M | |
| Solving Equations.png | 2024-04-18 10:19 | 27K | |
| Solving Equations 1.png | 2024-04-18 11:07 | 129K | |
| Solving Equations with Variables on Both Sides.mp4 | 2024-08-27 08:11 | 29M | |
| Solving Inequalities.mp4 | 2024-08-27 11:41 | 6.5M | |
| Solving Quadratic Equations by Factoring.mp4 | 2024-08-27 08:35 | 174M | |
| Solving Similar Triangles.mp4 | 2024-08-27 11:43 | 152M | |
| Solving Special Right Triangles.mp4 | 2024-09-30 14:22 | 16M | |
| Solving Systems of Equations.mp4 | 2024-08-27 11:41 | 66M | |
| Solving inequalties.png | 2024-04-18 11:10 | 35K | |
| Sources Of Energy.mp4 | 2024-03-27 11:33 | 15M | |
| Space Exploration Accomplishments.mp4 | 2024-12-04 12:04 | 184M | |
| Spanish AR Verbs.mp4 | 2024-04-15 09:45 | 7.0M | |
| Spanish AR Verbs in Present Tense - Spanish Verb Videos.mp4 | 2024-04-15 15:14 | 7.0M | |
| Spanish Verb IR - to go.mp4 | 2024-04-15 09:56 | 14M | |
| Spanish conjugation animated explanation video.mp4 | 2024-04-16 10:16 | 6.1M | |
| Spatial Reasoning - Solid Geometry.mp4 | 2025-01-10 16:17 | 22M | |
| Spheres Lesson.mp4 | 2024-10-01 12:54 | 6.5M | |
| State Taxes.png | 2024-03-11 12:25 | 146K | |
| State and Local Government.mp4 | 2024-03-27 15:48 | 25M | |
| State income tax banner.png | 2024-03-11 12:15 | 724K | |
| Statement.png | 2024-03-12 12:36 | 217K | |
| Statement Earnings.png | 2024-03-11 14:00 | 196K | |
| Statement of Account.mp4 | 2024-09-18 17:58 | 4.9M | |
| Statement of Earnings.png | 2024-03-11 13:52 | 928K | |
| States of Matter.mp4 | 2024-10-08 11:42 | 103M | |
| Stocks How Equity Earns You Money.mp4 | 2024-04-01 09:33 | 40M | |
| Straight-Time Pay Calculations.mp4 | 2024-04-09 12:56 | 48M | |
| Straight Commission.mp4 | 2024-08-28 12:35 | 144M | |
| Straight Time Pay.png | 2024-03-07 14:27 | 153K | |
| Stronger connections.mp4 | 2024-10-15 12:57 | 19M | |
| Structure of Local Government.mp4 | 2024-10-03 11:05 | 15M | |
| Structure of Matter. atoms, molecules,.mp4 | 2024-04-08 14:43 | 46M | |
| Structure of Matter. atoms.mp4 | 2024-04-08 13:09 | 46M | |
| Structure of Mattera .mp4 | 2025-01-13 18:38 | 46M | |
| Sun, Earth Moon.mp4 | 2024-12-04 12:02 | 10M | |
| Surface Area and Volume of Cones.mp4 | 2024-04-04 13:54 | 44M | |
| Surface Area of Cones and Pyramids.mp4 | 2024-10-01 12:55 | 31M | |
| Surface Area of a Cylinder.mp4 | 2024-04-04 13:45 | 27M | |
| Surface Area of a Rectangular Prism.mp4 | 2024-04-04 13:49 | 10M | |
| Surface Area of a Sphere.mp4 | 2024-04-04 14:34 | 1.5M | |
| TSUMTHER.mp4 | 2024-04-03 12:17 | 13M | |
| Tan Lines.mp4 | 2024-04-04 14:45 | 15M | |
| Tangent Lines Lesson.mp4 | 2024-10-01 12:54 | 4.6M | |
| Tax Friendly States.mp4 | 2024-08-28 19:53 | 230M | |
| Taxes.mp4 | 2024-03-27 15:44 | 141M | |
| Tax on Federal Income.mp4 | 2024-08-28 19:49 | 22M | |
| Telling Time in Spanish.mp4 | 2024-04-15 11:17 | 8.1M | |
| Temperature Vs Heat.mp4 | 2025-01-09 15:48 | 59M | |
| Term Life Insurance.png | 2024-03-22 11:55 | 1.0M | |
| Term vs Whole Life Insurance.mp4 | 2024-09-18 18:06 | 225M | |
| Testing for Collinear Points Using Determinants.mp4 | 2024-04-02 16:38 | 17M | |
| The Atmosphere.mp4 | 2024-12-04 12:03 | 90M | |
| The Atmosphere1.mp4 | 2024-04-08 16:04 | 62M | |
| The Atomic Theory-1.mp4 | 2024-10-08 11:39 | 26M | |
| The Average Daily Balance Method.mp4 | 2024-09-18 17:59 | 14M | |
| The Basics of Sales Tax.mp4 | 2024-09-18 18:00 | 21M | |
| The Biology of Marine Mammals - Palomar College.mp4 | 2024-11-01 11:05 | 99M | |
| The Business Cycle.mp4 | 2024-04-01 10:32 | 8.0M | |
| The Clinton Years, or the 1990s Crash Course US History 45.mp4 | 2025-02-10 13:49 | 151M | |
| The Cold War.mp4 | 2024-04-07 18:49 | 149M | |
| The Difference Between Dependence, Addiction, Abuse, and Misuse.mp4 | 2024-04-05 11:19 | 42M | |
| The Different Types of Loans.mp4 | 2024-09-18 18:03 | 130M | |
| The Distance Formula.mp4 | 2024-08-27 11:39 | 20M | |
| The Distributive Property of Multiplication.mp4 | 2024-08-27 08:10 | 26M | |
| The Earth, Moon and Sun Science.mp4 | 2024-04-08 15:54 | 58M | |
| The Egyptian Civilization.mp4 | 2025-02-06 16:59 | 118M | |
| The Electromagnetic field.mp4 | 2024-10-08 11:41 | 51M | |
| The Evolution of Money.mp4 | 2024-04-01 10:52 | 9.2M | |
| The French Revolution.mp4 | 2025-02-07 14:37 | 236M | |
| The Global Transition to Capitalism.mp4 | 2024-04-01 12:16 | 22M | |
| The Human Body Organ Systems.mp4 | 2024-04-08 16:23 | 91M | |
| The Industrial Revolution (18-19th Century).mp4 | 2024-04-07 16:48 | 13M | |
| The Interwar Years.mp4 | 2024-04-07 18:24 | 49M | |
| The Iran Hostage Crisis of 1979.mp4 | 2025-02-10 13:48 | 138M | |
| The Labor Movement.mp4 | 2024-03-27 15:27 | 24M | |
| The Law of Conservation of Energy.mp4 | 2024-10-08 11:40 | 9.1M | |
| The Mayflower Compact.mp4 | 2025-02-04 17:46 | 347M | |
| The Nervous System.mp4 | 2024-04-08 16:25 | 66M | |
| The New Deal Crash.mp4 | 2025-02-04 18:49 | 838M | |
| The Periodic Table.mp4 | 2024-10-08 11:41 | 28M | |
| The Periodic Table Every Year.mp4 | 2024-04-08 14:26 | 45M | |
| The Persian Empire.png | 2024-03-18 11:55 | 322K | |
| The Power of Compound.mp4 | 2024-09-18 18:01 | 19M | |
| The Presidents Reagan Foreign Policy.mp4 | 2025-02-10 13:46 | 42M | |
| The Problem with Globalization.mp4 | 2024-04-01 12:20 | 13M | |
| The Progressive Era.mp4 | 2025-02-04 16:57 | 172M | |
| The Pythagorean Theorem.mp4 | 2024-09-30 14:22 | 9.2M | |
| The Renaissance and the Reformation 1300-1600.mp4 | 2024-04-07 13:56 | 18M | |
| The Reproductive System.mp4 | 2024-10-15 12:57 | 24M | |
| The Revolutions of 1848.mp4 | 2025-02-07 15:09 | 101M | |
| The Russian Revolution 1917.mp4 | 2024-04-07 18:20 | 229M | |
| The Scientific Method-1.mp4 | 2025-01-09 16:42 | 268M | |
| The Scientific Method.mp4 | 2024-10-08 11:40 | 16M | |
| The Scientific Process.mp4 | 2024-03-27 08:29 | 18M | |
| The Set of Real Numbers.pdf | 2024-03-20 11:50 | 634K | |
| The Set of Real Numbers.png | 2024-03-20 12:09 | 908K | |
| The Sherman Anti-Trust Act.mp4 | 2025-02-10 10:39 | 54M | |
| The Solar System.mp4 | 2024-04-08 15:50 | 19M | |
| The Stormy 60s.mp4 | 2025-02-10 13:48 | 47M | |
| The Theorems for Parallelograms.mp4 | 2024-09-30 14:23 | 35M | |
| The Three Branches of Government How They Function.mp4 | 2024-04-05 09:06 | 29M | |
| The Treaty of Versailles.mp4 | 2025-02-05 13:17 | 88M | |
| The Triangle Midsegment Theorem.mp4 | 2024-09-30 14:22 | 6.3M | |
| The Triangle Proportionality Theorem.mp4 | 2024-04-04 09:52 | 9.4M | |
| The U.S. Homefront During WWII.mp4 | 2025-02-10 13:48 | 41M | |
| The U S Federal System-1.mp4 | 2024-04-05 09:02 | 122M | |
| The U S Federal System.mp4 | 2024-10-03 11:07 | 238M | |
| The Value of Basic Scientific Research.mp4 | 2024-04-08 16:29 | 27M | |
| The Water Cycle.mp4 | 2024-12-04 12:04 | 145M | |
| The distance formula made easy.mp4 | 2024-04-03 09:03 | 7.0M | |
| The rise and fall of the Berlin Wal.mp4 | 2025-02-10 13:47 | 36M | |
| Three Branches of Government.mp4 | 2024-04-04 16:55 | 29M | |
| Tides.mp4 | 2024-11-01 11:04 | 32M | |
| Timecard.png | 2024-03-22 15:36 | 238K | |
| Topic 15.3 Classifying Quadrilaterals.mp4 | 2024-04-04 08:52 | 8.2M | |
| To prefer El verbo preferir tiempo presente.mp4 | 2025-01-23 10:49 | 65M | |
| Total Purchase.png | 2024-03-14 08:36 | 116K | |
| Total Purchase Price.mp4 | 2024-04-10 12:07 | 28M | |
| Total Purchase Price.png | 2024-03-13 15:49 | 789K | |
| Trade Barriers.mp4 | 2024-04-01 11:36 | 7.1M | |
| Trade Deficits and Surpluses.mp4 | 2024-04-01 11:39 | 20M | |
| Transformations and Isometries.mp4 | 2024-04-04 11:40 | 7.2M | |
| Translations Lesson.mp4 | 2024-10-01 12:54 | 6.7M | |
| Triangle Congruence Theorems ASA or AAS.mp4 | 2024-09-27 13:43 | 8.5M | |
| Triangle Congruency.mp4 | 2024-04-03 11:43 | 7.9M | |
| Triangle Proportionality Lesson.mp4 | 2024-09-30 14:22 | 7.8M | |
| Triangle Sum Theorem.mp4 | 2024-04-03 12:15 | 7.8M | |
| Trig Ratios.mp4 | 2024-04-04 11:08 | 85M | |
| Trigonometry Trig Ratios.mp4 | 2024-04-04 11:18 | 52M | |
| Two similar polygons.mp4 | 2024-09-30 14:23 | 21M | |
| Types Of Life Insurance Explained.mp4 | 2024-09-18 18:02 | 33M | |
| Types of Angles and Angle Relationships.mp4 | 2024-09-27 13:43 | 16M | |
| Types of Chemical Reactions.mp4 | 2024-10-08 11:41 | 23M | |
| Types of Matter.mp4 | 2024-10-08 11:41 | 8.5M | |
| U.S. Prohibition (1920-33).mp4 | 2025-02-05 12:20 | 69M | |
| U1L1 Telehistoria Repaso-1.mp4 | 2025-01-23 10:12 | 24M | |
| U1L1 Telehistoria Repaso.mp4 | 2025-02-05 09:29 | 42M | |
| U1L2 Telehistoria.mp4 | 2025-01-23 10:14 | 16M | |
| U1L2 Telehistoria2.mp4 | 2025-02-10 10:17 | 87M | |
| U1L2 Telehistoria Repaso-1.mp4 | 2025-01-23 12:51 | 40M | |
| U1L2 Telehistoria Repaso.mp4 | 2024-04-15 09:10 | 12M | |
| U2 L1 Telehistoria.mp4 | 2025-01-23 10:17 | 11M | |
| U2L1 Telehistoria Repaso-1.mp4 | 2025-01-23 08:37 | 15M | |
| U2L1 Telehistoria Repaso.mp4 | 2025-01-23 10:03 | 16M | |
| U2 L2 Telehistoria.mp4 | 2024-04-15 09:48 | 5.4M | |
| U2L2 Telehistoria Repaso-1.mp4 | 2025-02-05 09:35 | 243M | |
| U2L2 Telehistoria Repaso.mp4 | 2024-04-15 09:50 | 11M | |
| US Becomes a World Power.mp4 | 2025-02-04 16:51 | 352M | |
| US sales tax.mp4 | 2024-04-10 12:12 | 160M | |
| Understanding Metric System.mp4 | 2025-01-10 10:54 | 8.3M | |
| Understanding Substance Misuse, Abuse, Dependence and Addiction.mp4 | 2024-10-15 12:50 | 7.7M | |
| Understanding the Great Depression.mp4 | 2025-02-05 11:50 | 75M | |
| Understanding the U.S. Tax System.mp4 | 2024-08-28 18:38 | 63M | |
| Unit 1 Estados Unidos - Un rato con los amigos.png | 2024-04-15 13:09 | 868K | |
| Unit 2 Mexico.png | 2024-04-15 15:59 | 897K | |
| Unit 2 Voc.pdf | 2024-03-19 15:35 | 2.6M | |
| Unit 3 pr.png | 2024-04-16 08:50 | 885K | |
| Unit 5.png | 2024-04-16 15:30 | 869K | |
| Unit Price.mp4 | 2024-09-18 18:06 | 153M | |
| Unit Pricing.mp4 | 2024-09-18 18:02 | 12M | |
| Unit Pricing.png | 2024-03-14 08:42 | 242K | |
| Unit Pricing 1.png | 2024-03-14 08:49 | 795K | |
| Unpaid Balance Method.mp4 | 2024-09-18 18:02 | 20M | |
| Unpaid Balance method.png | 2024-03-15 10:05 | 68K | |
| Unt 1 Vocab.pdf | 2024-03-20 11:27 | 642K | |
| Used cards.png | 2024-03-20 15:51 | 298K | |
| Using Algebraic Expressions.mp4 | 2024-08-26 15:13 | 24M | |
| Using a Budget.png | 2024-03-11 16:08 | 455K | |
| Using corresponding parts of congruent triangles to find the missing value.mp4 | 2024-09-27 13:43 | 17M | |
| Using properties of kites to solve problems.mp4 | 2024-04-04 09:08 | 6.1M | |
| Using properties of trapezoids.mp4 | 2024-04-04 09:09 | 7.9M | |
| Using the Pythagorean Theorem.mp4 | 2024-04-04 10:03 | 30M | |
| Utility costs on the rise.mp4 | 2024-09-18 18:03 | 29M | |
![[ ]](/icons/unknown.gif) | VIDEO CAPTIONS PP.lnk | 2025-01-09 11:28 | 593 | |
| VOCABULARIO EN CONTEXTO PARTE 1 TEORÍA.mp4 | 2025-01-23 13:25 | 180M | |
| Vehicle.png | 2024-03-20 13:01 | 238K | |
| Vehicle Insurance.png | 2024-03-21 08:49 | 901K | |
| Vehicle Transportation.png | 2024-03-20 12:56 | 1.2M | |
| Venn Diagrams.mp4 | 2024-08-27 11:40 | 43M | |
| Verb tener.mp4 | 2024-04-15 09:41 | 3.4M | |
| Vertical Angle Theorem.mp4 | 2024-04-03 11:03 | 4.3M | |
| Victorian Era.mp4 | 2025-02-07 14:38 | 23M | |
| Vinn D.png | 2024-04-18 11:59 | 44K | |
| Vinn Digrams.png | 2024-04-18 11:50 | 99K | |
| Vocab.png | 2024-04-18 10:22 | 173K | |
| Vocabulario 3.1 Avancemos 1.mp4 | 2025-01-23 10:21 | 27M | |
| Volume Of A Cylinder.mp4 | 2024-04-04 14:05 | 9.9M | |
| Volume Of Prisms.mp4 | 2024-04-04 14:03 | 86M | |
| Volume and Surface Area of a Box.mp4 | 2024-04-04 13:41 | 27M | |
| Volume of Composite Rectangular Prisms.mp4 | 2024-04-04 14:06 | 18M | |
| Volume of a Cone.mp4 | 2024-04-04 14:31 | 21M | |
| Volume of a Pyramid.mp4 | 2024-04-04 14:29 | 21M | |
| Volumes of Prisms and Cylinders.mp4 | 2024-10-01 12:55 | 22M | |
| Warm-Blooded vs. Cold-Blooded What’s The Difference.mp4 | 2024-11-01 11:05 | 46M | |
| Warring.png | 2024-03-19 11:09 | 171K | |
| Warring City-States.png | 2024-03-19 10:28 | 966K | |
| Wartime Productions.mp4 | 2025-02-10 13:49 | 52M | |
| Weekly Time Card.png | 2024-03-22 15:28 | 867K | |
| Weekly Time Card Calculator.mp4 | 2024-08-28 12:31 | 15M | |
| Weekly Time Sheet.png | 2024-03-08 11:04 | 229K | |
| Weekly Timecard.mp4 | 2024-08-28 12:32 | 26M | |
| Westward Expansion.mp4 | 2025-02-05 11:29 | 120M | |
| What Are Deductibles, Coinsurance, and Copays.mp4 | 2024-09-18 18:04 | 22M | |
| What Are the Types of Pay Periods.mp4 | 2024-08-28 12:31 | 32M | |
| What Is Term Life Insurance.mp4 | 2024-09-18 18:09 | 50M | |
| What Is a Finance Charge.mp4 | 2024-09-18 18:05 | 31M | |
| What Is a Savings Account1.mp4 | 2024-09-18 18:06 | 25M | |
| What Is a Savings Account12.mp4 | 2024-09-18 18:06 | 25M | |
| What Is an Annuity.mp4 | 2024-09-18 18:09 | 235M | |
| What Is an Installment Loan.mp4 | 2024-09-18 18:07 | 21M | |
| What Makes An Economy Grow.mp4 | 2024-04-01 12:14 | 13M | |
| What are Closing Costs.mp4 | 2024-09-18 18:05 | 91M | |
| What are Congruent Figures.mp4 | 2024-09-27 13:44 | 6.5M | |
| What are Congruent and Similar Figures.mp4 | 2024-09-27 13:44 | 19M | |
| What are Medians (In depth explanation).mp4 | 2024-09-30 14:23 | 7.8M | |
| What are Rebates.mp4 | 2024-09-18 18:05 | 58M | |
| What are the Truth Definitions for Biconditional.mp4 | 2024-04-03 10:20 | 9.3M | |
| What is APR.mp4 | 2024-04-10 13:59 | 187M | |
| What is Commission.png | 2024-03-25 10:08 | 845K | |
| What is Data Analysis.mp4 | 2025-01-10 16:57 | 26M | |
| What is Economic Development.mp4 | 2024-04-01 12:13 | 10M | |
| What is Economics Economics.mp4 | 2024-03-27 11:49 | 41M | |
| What is Electric Charge.mp4 | 2024-10-08 11:42 | 55M | |
| What is GDP CNBC Explains.mp4 | 2024-04-01 10:26 | 58M | |
| What is Group Health Insurance.mp4 | 2024-08-28 19:48 | 8.0M | |
| What is Hourly Pay.png | 2024-03-22 13:36 | 606K | |
| What is Inflation.mp4 | 2024-04-01 10:34 | 45M | |
| What is International Trade.mp4 | 2024-04-01 11:33 | 14M | |
| What is Nuclear Energy.mp4 | 2024-10-08 11:42 | 29M | |
| What is Number Sense.mp4 | 2025-01-09 17:54 | 70M | |
| What is Online Banking.mp4 | 2024-09-18 18:08 | 46M | |
| What is Online Banking How Does it Work.mp4 | 2024-09-18 18:07 | 33M | |
| What is Overtime Pay.png | 2024-03-22 14:25 | 457K | |
| What is Selling Price.mp4 | 2024-09-19 12:34 | 6.4M | |
| What is Simple Interest-1.mp4 | 2024-09-18 18:07 | 23M | |
| What is Trigonometry.mp4 | 2024-09-30 14:23 | 7.5M | |
| What is a Function.mp4 | 2024-08-27 11:41 | 63M | |
| What is a Magnet.mp4 | 2024-04-08 15:20 | 30M | |
| What is a Monimal.png | 2024-04-18 10:46 | 240K | |
| What is a Savings Account.mp4 | 2024-09-18 18:06 | 25M | |
| What is a Set Complement.mp4 | 2024-08-27 11:40 | 47M | |
| What is a coupon.mp4 | 2024-09-18 18:04 | 13M | |
| What is an Expense.mp4 | 2024-09-18 18:06 | 8.5M | |
| What is compound interest.mp4 | 2024-09-18 18:08 | 72M | |
| What is flexibility.mp4 | 2024-11-05 13:17 | 13M | |
| What is the Congruent Complements Theorem.mp4 | 2024-04-03 19:30 | 31M | |
| What is the Sticker Price.mp4 | 2024-09-18 18:08 | 27M | |
| What is the Triangle Midsegment Theorem.mp4 | 2024-04-03 17:35 | 36M | |
| What is the overlapping area when you rotate a right triangle.mp4 | 2024-09-27 13:44 | 7.7M | |
| What is the world wide web.mp4 | 2024-04-02 14:58 | 12M | |
| Work, Energy, and Power Crash Course Physics 9.mp4 | 2025-01-09 12:59 | 123M | |
| Working with Absolute Value.pdf | 2024-03-20 11:56 | 208K | |
| Working with Poly.png | 2024-04-18 10:37 | 77K | |
| World War I - The Great War (1914-1918).mp4 | 2024-04-06 14:35 | 11M | |
| World War I Aftermath.mp4 | 2024-04-07 18:10 | 24M | |
| World War II-1.mp4 | 2025-02-10 13:50 | 179M | |
| World War II-2.mp4 | 2024-04-07 18:44 | 214M | |
| World War II.mp4 | 2025-02-10 13:50 | 111M | |
| Worlds Major Events of 19th Century.mp4 | 2024-04-07 17:58 | 37M | |
| Write a Paragraph Proo1.mp4 | 2024-04-03 19:22 | 5.0M | |
| Write a Paragraph Proof.mp4 | 2024-04-03 11:01 | 5.0M | |
| Write an Indirect Proof.mp4 | 2024-04-03 19:17 | 13M | |
| Write and Graph Equations of Circles.mp4 | 2024-04-04 16:27 | 41M | |
| Writing Biconditionals.mp4 | 2024-04-03 10:21 | 5.4M | |
| Writing Checks.png | 2024-03-12 11:13 | 837K | |
| Writing Equations of Perpendicular Lines.mp4 | 2024-04-03 12:46 | 17M | |
| Writing Research Reports.mp4 | 2024-04-02 15:06 | 64M | |
| Writing a Two Column Proof to Prove Two Triangles are Congruent.mp4 | 2024-04-03 16:55 | 59M | |
| Zhou Dynasty.png | 2024-03-18 12:33 | 284K | |
| amb1.png | 2024-04-13 16:20 | 272K | |
| average.png | 2024-03-15 11:21 | 113K | |
| bank recon.png | 2024-03-12 13:01 | 108K | |
| beds.png | 2024-04-13 11:58 | 108K | |
| calculator.png | 2024-03-11 09:41 | 265K | |
| chap01.pdf | 2024-03-06 11:45 | 1.1M | |
| chap02.pdf | 2024-03-06 11:45 | 1.1M | |
| chap03.pdf | 2024-03-06 11:45 | 850K | |
| chap04.pdf | 2024-03-06 11:45 | 964K | |
| chap05.pdf | 2024-03-06 11:45 | 1.1M | |
| chap06.pdf | 2024-03-06 11:45 | 951K | |
| chap07.pdf | 2024-03-06 11:45 | 1.0M | |
| chap08.pdf | 2024-03-06 11:45 | 1.0M | |
| chap09.pdf | 2024-03-06 11:45 | 1.1M | |
| chap10.pdf | 2024-03-06 11:45 | 914K | |
| chap11.pdf | 2024-03-06 11:45 | 833K | |
| chapter_2_extra_review_fit_questions_.pdf | 2024-03-06 11:45 | 841K | |
| chapter_3_and_4_review_ws_answer_key.pdf | 2024-03-06 11:45 | 6.6M | |
| chapter_3_and_4_review_ws_download.pdf | 2024-03-06 11:45 | 111K | |
| chapter_5_review_download.pdf | 2024-03-06 11:45 | 106K | |
| chapter_6_review_ws_download.pdf | 2024-03-06 11:45 | 3.1M | |
| chapter_7_review_download.pdf | 2024-03-06 11:45 | 583K | |
| chapter_7_review_key.pdf | 2024-03-06 11:45 | 4.0M | |
| chapter_8_review_ws.pdf | 2024-03-06 11:45 | 209K | |
| cpr.png | 2024-04-13 16:39 | 74K | |
| diagonals and properties of a rectangle.mp4 | 2024-04-04 08:55 | 43M | |
| direct object pronouns.mp4 | 2025-01-23 10:50 | 21M | |
| doctor.png | 2024-04-13 11:14 | 223K | |
| ebook.png | 2024-04-16 09:18 | 52K | |
| economic policy.mp4 | 2024-04-05 09:50 | 147M | |
| emergency.png | 2024-04-13 16:22 | 307K | |
| exterior angle sum theorem to find the value of x.mp4 | 2024-04-04 09:37 | 26M | |
| federal income tax 2.png | 2024-03-11 11:01 | 112K | |
| food.mp4 | 2024-04-15 10:23 | 11M | |
| graph a linear equation when it is in slope intercept form.mp4 | 2024-04-03 12:31 | 21M | |
| group Health Insurance.png | 2024-03-11 13:24 | 609K | |
| hat Anatomy Structure How to Make Biology Function.mp4 | 2024-03-26 16:45 | 90M | |
| healing plantd.png | 2024-04-13 16:58 | 374K | |
| healthscience u1l1.png | 2024-04-13 11:17 | 785K | |
| healthscience u1l2.png | 2024-04-13 11:21 | 1.0M | |
| healthscience u1l3.png | 2024-04-13 11:24 | 807K | |
| healthscience u1l4.png | 2024-04-13 11:30 | 887K | |
| healthscience u1l5.png | 2024-04-13 11:35 | 1.1M | |
| healthscience u1l6.png | 2024-04-13 11:40 | 722K | |
| healthscience u2l1.png | 2024-04-13 11:47 | 962K | |
| healthscience u2l2.png | 2024-04-13 11:53 | 773K | |
| healthscience u2l3.png | 2024-04-13 15:36 | 815K | |
| healthscience u2l4.png | 2024-04-13 15:39 | 856K | |
| healthscience u2l5.png | 2024-04-13 15:47 | 709K | |
| healthscience u3l1.png | 2024-04-13 15:55 | 1.0M | |
| healthscience u3l2.png | 2024-04-13 15:59 | 1.0M | |
| healthscience u3l3.png | 2024-04-13 16:02 | 1.1M | |
| healthscience u3l4.png | 2024-04-13 16:10 | 1.3M | |
| healthscience u3l5.png | 2024-04-13 16:12 | 1.2M | |
| healthscience u4l1.png | 2024-04-13 16:25 | 909K | |
| healthscience u4l2.png | 2024-04-13 16:28 | 824K | |
| healthscience u4l3.png | 2024-04-13 16:31 | 797K | |
| healthscience u4l4.png | 2024-04-13 16:37 | 882K | |
| healthscience u4l5.png | 2024-04-13 16:42 | 935K | |
| healthscience u4l6.png | 2024-04-13 16:44 | 951K | |
| healthscience u5l1.png | 2024-04-13 16:47 | 907K | |
| healthscience u5l2.png | 2024-04-13 16:49 | 1.0M | |
| healthscience u5l3.png | 2024-04-13 16:51 | 930K | |
| healthscience u5l4.png | 2024-04-13 16:53 | 962K | |
| healthscience u5l5.png | 2024-04-13 16:59 | 1.0M | |
| healthscience u5l6.png | 2024-04-13 17:01 | 724K | |
| healthscience u6l1.png | 2024-04-13 17:04 | 929K | |
| healthscience u6l2.png | 2024-04-13 17:11 | 1.0M | |
| healthscience u6l3.png | 2024-04-13 17:14 | 679K | |
| healthscience u6l4.png | 2024-04-13 17:19 | 1.0M | |
| healthscience u7l1.png | 2024-04-13 17:21 | 604K | |
| healthscience u7l2.png | 2024-04-13 17:23 | 820K | |
| healthscience u7l3.png | 2024-04-13 17:25 | 663K | |
| healthscience u7l4.png | 2024-04-13 17:28 | 489K | |
| healthscience u7l5.png | 2024-04-13 17:30 | 1.1M | |
| healthscience u8l1.png | 2024-04-13 17:35 | 804K | |
| healthscience u8l2.png | 2024-04-13 17:37 | 918K | |
| healthscience u8l3.png | 2024-04-13 17:39 | 820K | |
| healthscience u8l4.png | 2024-04-13 17:43 | 731K | |
| healthscience u8l5.png | 2024-04-13 17:46 | 722K | |
| healthscience u8l6.png | 2024-04-13 17:49 | 752K | |
| healthscience u9l1.png | 2024-04-13 17:53 | 837K | |
| healthscience u9l2.png | 2024-04-13 17:55 | 883K | |
| healthscience u9l3.png | 2024-04-13 17:57 | 819K | |
| healthscience u9l4.png | 2024-04-13 18:00 | 1.0M | |
| healthscience u9l5.png | 2024-04-13 18:03 | 924K | |
| healthscience u9l6.png | 2024-04-13 18:06 | 1.0M | |
| healthscience u10l1.png | 2024-04-13 18:15 | 927K | |
| healthscience u10l2.png | 2024-04-13 18:17 | 819K | |
| healthscience u10l3.png | 2024-04-13 18:21 | 627K | |
| healthscience u10l4.png | 2024-04-13 18:23 | 663K | |
| healthscience u10l5.png | 2024-04-13 18:25 | 737K | |
| hourly pay.png | 2024-03-22 13:39 | 375K | |
| housing cost.png | 2024-03-22 08:44 | 261K | |
| illusration.png | 2024-03-25 10:57 | 45K | |
| insurance.png | 2024-03-22 09:47 | 308K | |
| keeping.png | 2024-03-11 14:31 | 68K | |
| lab.png | 2024-04-13 11:27 | 123K | |
| lab1.png | 2024-04-13 11:42 | 92K | |
| lab2.png | 2024-04-13 11:49 | 205K | |
| life insurance.mp4 | 2024-09-18 17:49 | 92M | |
| measurement.png | 2024-04-13 16:35 | 160K | |
| microscope.png | 2024-04-13 11:26 | 116K | |
| money.png | 2024-04-13 11:38 | 93K | |
| mri.png | 2024-04-13 11:56 | 81K | |
| multiplying monomials.mp4 | 2024-08-27 08:04 | 26M | |
| net income.png | 2024-03-11 09:34 | 125K | |
| net income 1.png | 2024-03-11 10:28 | 224K | |
| omeowners Insurance.mp4 | 2024-09-18 17:53 | 59M | |
| parallelogram Properties.mp4 | 2024-09-30 14:22 | 51M | |
| pay periods.png | 2024-03-08 14:36 | 156K | |
| polynomials.png | 2024-04-18 10:39 | 42K | |
| rhombus, rectangle, and a square.mp4 | 2024-10-01 09:00 | 17M | |
| scatter.png | 2024-03-25 09:05 | 266K | |
| stock market work.mp4 | 2024-03-27 15:56 | 23M | |
| structure function of the 3 branches of government in the Constitution.mp4 | 2024-10-03 11:05 | 42M | |
| tangent to find circle.mp4 | 2024-04-04 14:46 | 5.9M | |
| term Life.png | 2024-03-22 12:51 | 113K | |
| term Life vs whole.png | 2024-03-22 13:18 | 76K | |
| the Fertile Crescent (c. 10,000 BCE).mp4 | 2025-02-06 17:59 | 289M | |
| the United Nations Exist.mp4 | 2025-02-05 12:35 | 52M | |
| transfor.mp4 | 2024-04-04 11:42 | 5.5M | |
| transport.png | 2024-03-20 13:06 | 119K | |
| unit 4.png | 2024-04-16 12:12 | 908K | |
| vocab.png | 2024-04-15 11:44 | 94K | |
| weathering erosion and deposition.mp4 | 2024-12-04 12:04 | 100M | |
| withdraw.png | 2024-03-12 16:17 | 254K | |
|
|---|
.png){kind=link}
.png){kind=link}
