![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![Capital Punishment].PNG](Capital%20Punishment%5d.PNG){kind=link}
![[ ]](/icons/layout.gif){kind=icon}
![Healthy lifestyle banner].png](Healthy%20lifestyle%20banner%5d.png){kind=link}
![Juvenile system broken].png](Juvenile%20system%20broken%5d.png){kind=link}
![[VID]](/icons/movie.gif){kind=icon}
.png){kind=link}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 5 Facts.PNG | 2022-10-26 12:15 | 803K | |
| 5 components of language.png | 2022-11-30 12:21 | 207K | |
| 19thcenturyart1Banner.png | 2022-10-05 10:57 | 323K | |
| 19thcenturyartbanner.png | 2022-10-05 08:55 | 447K | |
| 20th Century art banner.png | 2022-10-05 12:24 | 355K | |
| AE Banner.png | 2022-10-03 12:40 | 349K | |
| Abstract Expressionism.PNG | 2022-10-06 15:07 | 697K | |
| Abstract and Non Objective Art.PNG | 2022-10-06 14:38 | 792K | |
| Acteus Reus.PNG | 2022-11-04 10:02 | 574K | |
| Acting Skills.png | 2022-10-10 12:04 | 217K | |
| Acting Skills Banner.png | 2022-10-10 11:58 | 234K | |
| Activating Prior Knowledge.png | 2022-09-30 11:52 | 374K | |
| Adapations in Fish.PNG | 2022-10-25 14:51 | 299K | |
| Aerbobic.PNG | 2022-10-14 14:43 | 610K | |
| Aesthetic Appreciation.PNG | 2022-10-10 08:29 | 590K | |
| Aestic Qualities.PNG | 2022-10-06 09:12 | 479K | |
| African Banner.png | 2022-10-04 12:11 | 380K | |
| Albert Pinkham Ryder.png | 2022-10-05 11:46 | 67K | |
| All About Arthopods.PNG | 2022-10-24 09:18 | 796K | |
| All About Mollusk.png | 2022-10-21 15:02 | 612K | |
| Amensia.png | 2022-11-30 16:06 | 532K | |
| Amp.png | 2022-10-26 10:06 | 333K | |
| Amp Banner.png | 2022-10-26 12:49 | 323K | |
| Amp Evolution.png | 2022-10-26 11:52 | 531K | |
| Amp Wave.PNG | 2022-11-29 11:56 | 485K | |
| Amphib.PNG | 2022-10-26 13:05 | 571K | |
| Amphib Banner.png | 2022-10-26 11:42 | 292K | |
| Amphibian Egg Monitoring.PNG | 2022-10-26 10:18 | 1.1M | |
| Amphibian Growth Banner.png | 2022-10-26 09:53 | 355K | |
| Amphibian Header.png | 2022-10-26 10:54 | 274K | |
| Amphibians Banner.png | 2022-10-26 09:12 | 186K | |
| Ancient Civil Banner.png | 2022-10-21 09:13 | 509K | |
| Animal Behave.PNG | 2022-10-20 10:05 | 810K | |
| Animal Behavior.png | 2022-10-20 09:58 | 430K | |
| Animal Behavior Banner.png | 2022-10-20 09:48 | 361K | |
| Animal Cell Structure and Function.PNG | 2022-10-19 15:10 | 510K | |
| Animal Class.PNG | 2022-10-20 09:09 | 1.0M | |
| Animal Classification banner.png | 2022-10-19 15:57 | 430K | |
| Animal Classifications.PNG | 2022-10-19 15:05 | 784K | |
| Animal Imprinting.png | 2022-10-21 09:44 | 418K | |
| Animal Life Cycles.PNG | 2022-10-19 15:15 | 954K | |
| Animal Parental Care.png | 2022-10-21 09:54 | 374K | |
| Animals.png | 2022-10-19 13:50 | 330K | |
| Animals Banner.png | 2022-10-19 12:55 | 467K | |
| Animals Elephant Behavior Banner.png | 2022-10-20 11:17 | 352K | |
| Animals header.png | 2022-10-19 14:42 | 350K | |
| Animotic Egg.PNG | 2022-10-26 15:36 | 391K | |
| Anxiety Disorder.png | 2022-12-09 14:03 | 548K | |
| Areas of Lifespan Development.png | 2022-12-06 08:28 | 108K | |
| Art Critiscism Banner.png | 2022-09-30 15:42 | 217K | |
| Art History 1.png | 2022-09-30 10:56 | 143K | |
| Art History Banner.png | 2022-09-30 10:50 | 435K | |
| Art History Banner 1.png | 2022-10-03 10:28 | 338K | |
| Art History Book Cover 1.png | 2022-09-30 11:31 | 243K | |
| Art History Paintings.png | 2022-09-30 13:04 | 321K | |
| Art History and Critisicm.png | 2022-10-05 14:07 | 378K | |
| Art Theatre banner.png | 2022-10-11 14:19 | 177K | |
| Arthropod Classifications.PNG | 2022-10-24 09:23 | 884K | |
| Arthropod Evolution.PNG | 2022-10-24 09:27 | 703K | |
| Artistic Discipline.PNG | 2022-10-07 14:14 | 927K | |
| Artist toolkid.PNG | 2022-09-30 15:28 | 463K | |
| Art of Asia Banner.png | 2022-10-03 16:49 | 358K | |
| Art of Civilization Banner.png | 2022-10-03 10:58 | 353K | |
| Art of Native America.PNG | 2022-10-04 11:54 | 642K | |
| AsteroidsDart.png | 2022-09-28 14:58 | 265K | |
| Astronomy Banner.png | 2022-10-04 13:31 | 221K | |
| Athropods Bannner.png | 2022-10-24 08:44 | 380K | |
| Atmospheres .png | 2022-09-28 13:43 | 587K | |
| Authors View Point.PNG | 2022-10-11 10:52 | 747K | |
| Aves Class.PNG | 2022-10-27 09:26 | 448K | |
| BMR.PNG | 2022-10-17 14:29 | 552K | |
| BPS Model.png | 2022-11-28 10:03 | 14K | |
| BWA Maks.PNG | 2022-10-06 13:13 | 557K | |
| Baby Bird Hatchlings.PNG | 2022-10-27 11:32 | 954K | |
| Baby Birds Banner.png | 2022-10-27 11:08 | 320K | |
| Barricuda Banner.png | 2022-10-25 15:45 | 323K | |
| Basic Anatomy of a Sponge.png | 2022-10-21 13:07 | 316K | |
| Basic Bird Anatomy.PNG | 2022-10-27 10:14 | 593K | |
| Basic Concepts of Criminal Law.PNG | 2022-11-04 09:55 | 787K | |
| Bears Polar.png | 2022-10-28 10:50 | 274K | |
| Behavior.png | 2022-10-13 13:51 | 288K | |
| Behavior Banner.png | 2022-10-13 11:04 | 266K | |
| Behavior Modifcation.PNG | 2022-10-18 13:18 | 194K | |
| Behavior mod.png | 2022-10-13 11:43 | 205K | |
| Behind the Scenes.PNG | 2022-10-11 10:15 | 894K | |
| Behind the Scenes 1.png | 2022-10-11 10:24 | 241K | |
| Bio.png | 2022-11-28 10:24 | 64K | |
| Biopsychology.png | 2022-11-23 14:43 | 635K | |
| Biopsychology1.png | 2022-11-28 09:55 | 98K | |
| Biopsychology Bannner.png | 2022-11-28 09:39 | 459K | |
| Biopsychology banner.png | 2022-11-23 13:34 | 215K | |
| Bird Banner.png | 2022-10-24 16:01 | 271K | |
| Bird Banner 1.png | 2022-10-27 09:43 | 336K | |
| Bird Class Banner.png | 2022-10-27 12:18 | 288K | |
| Bird Courtship.PNG | 2022-10-27 11:26 | 1.0M | |
| Bird Diet.PNG | 2022-10-27 13:58 | 782K | |
| Bird Ecology Banner.png | 2022-10-27 13:38 | 316K | |
| Bird Flying.png | 2022-10-27 09:19 | 219K | |
| Bird evol.png | 2022-10-27 13:09 | 206K | |
| Bird evolution banner.png | 2022-10-27 12:58 | 322K | |
| Birds.png | 2022-10-27 12:28 | 372K | |
| Birds Banner.png | 2022-10-27 09:11 | 311K | |
| Birds Flight.PNG | 2022-10-27 13:28 | 531K | |
| Birds Incubate Eggs.PNG | 2022-10-27 11:29 | 814K | |
| Boast Met.PNG | 2022-10-17 14:17 | 599K | |
| Bodihv.PNG | 2022-10-06 12:01 | 812K | |
| Body Comp.PNG | 2022-10-14 10:27 | 224K | |
| Bony Fish.PNG | 2022-10-31 10:47 | 1.0M | |
| Brain.png | 2022-11-30 15:26 | 344K | |
| Brain Size Comparision.PNG | 2022-10-28 10:30 | 855K | |
| Brain and Mitro.PNG | 2022-10-28 12:29 | 508K | |
| Brain scan.png | 2022-11-23 14:31 | 228K | |
| Building You Acting Skills.PNG | 2022-10-10 12:10 | 845K | |
| Butter Banner.png | 2022-10-21 10:56 | 323K | |
| CJ Banner.png | 2022-11-01 11:18 | 219K | |
| CPSCU.PNG | 2022-10-18 13:34 | 538K | |
| Calcelians.PNG | 2022-10-26 11:26 | 1.0M | |
| Camille Pissario.PNG | 2022-10-06 09:47 | 571K | |
| Capital Punishment].PNG | 2022-11-09 11:01 | 709K | |
| Cap punish.PNG | 2022-11-09 11:05 | 155K | |
| Cardio.PNG | 2022-10-17 12:09 | 368K | |
| Cardioresp endurance.PNG | 2022-10-14 10:11 | 778K | |
| Careers in Psyschology.PNG | 2022-11-22 14:33 | 427K | |
| Cartiligous Fish.PNG | 2022-10-25 15:56 | 554K | |
| Cave Paintings.PNG | 2022-10-06 10:02 | 1.1M | |
| Cell Banner.png | 2022-11-09 14:50 | 201K | |
| Chamelons.PNG | 2022-10-27 08:53 | 729K | |
| Charachter masks.PNG | 2022-10-11 15:14 | 744K | |
| Character.png | 2022-10-10 15:32 | 255K | |
| Characterization What is.PNG | 2022-10-10 15:25 | 462K | |
| Characterization banner.png | 2022-10-10 15:05 | 41K | |
| Character of reprtiles.PNG | 2022-10-26 14:57 | 872K | |
| Cheetah Banner.png | 2022-10-28 12:44 | 326K | |
| Cheetah Fast.PNG | 2022-10-28 12:52 | 908K | |
| Cheetah runs so fast.PNG | 2022-10-28 13:05 | 790K | |
| Childe Hassam.PNG | 2022-10-06 09:39 | 1.0M | |
| Chimps.PNG | 2022-10-20 15:15 | 1.1M | |
| Chordate Character.PNG | 2022-10-24 12:38 | 234K | |
| City County State.PNG | 2022-11-04 14:24 | 608K | |
| Civil Vs Criminal LAw.PNG | 2022-11-04 09:25 | 720K | |
| Civilizations banner.png | 2022-10-03 13:25 | 412K | |
| Class Reptila.PNG | 2022-10-27 08:56 | 963K | |
| Classical.png | 2022-11-29 15:24 | 241K | |
| Classical Conditioning.PNG | 2022-11-29 15:35 | 562K | |
| Classical Vs Opera.PNG | 2022-11-29 15:41 | 628K | |
| Classification.png | 2022-10-26 11:16 | 144K | |
| Classification of Reptiles.PNG | 2022-10-27 08:48 | 451K | |
| Clowning.PNG | 2022-10-11 12:30 | 649K | |
| Cognitive Dessoance.png | 2022-12-08 11:39 | 606K | |
| Color Wheel.PNG | 2022-09-30 14:36 | 106K | |
| ColoredPencils Overview.png | 2022-10-04 12:42 | 238K | |
| Colors tours of Egypt.png | 2022-10-03 11:47 | 121K | |
| Comets.png | 2022-09-28 15:02 | 508K | |
| Comets ands Asteroids.png | 2022-09-28 14:52 | 492K | |
| Common Mental Illness.PNG | 2022-12-12 10:13 | 214K | |
| Common Sleep Problems.PNG | 2022-11-28 13:10 | 245K | |
| Community Theatre.PNG | 2022-10-11 11:27 | 844K | |
| Components of Physical Fitness.PNG | 2022-10-13 10:16 | 1.0M | |
| Concept of Prison .png | 2022-11-10 11:24 | 511K | |
| Conciousness.png | 2022-11-28 12:45 | 338K | |
| Conciousness1.png | 2022-11-28 12:49 | 225K | |
| Conciousness banner.png | 2022-11-28 10:55 | 216K | |
| Conflict Model.PNG | 2022-11-01 15:00 | 870K | |
| Conflict Theory.png | 2022-11-02 11:20 | 314K | |
| Contempltion Stage.PNG | 2022-10-13 14:26 | 172K | |
| Contrappotos.PNG | 2022-10-06 10:47 | 687K | |
| Copyright.PNG | 2022-10-11 09:23 | 892K | |
| Coritiahan capital.PNG | 2022-10-06 10:53 | 898K | |
| Corrections.png | 2022-11-09 13:11 | 215K | |
| Corrections banner.png | 2022-11-09 12:52 | 238K | |
| Cours banner.png | 2022-11-07 09:28 | 414K | |
| Course Resources.png | 2022-10-07 09:22 | 327K | |
| Creating Art Banner.png | 2022-09-30 15:07 | 352K | |
| Creative Drama.png | 2022-10-10 10:38 | 304K | |
| Creative Drama banner.png | 2022-10-10 10:11 | 270K | |
| Creative Writing in Dialogue.PNG | 2022-10-07 13:23 | 278K | |
| Creeatures.PNG | 2022-10-28 12:32 | 1.2M | |
| Crime.png | 2022-11-02 09:42 | 451K | |
| Crime Banner.png | 2022-11-01 15:44 | 229K | |
| Crime Header.png | 2022-11-04 09:07 | 243K | |
| Crime Picture.png | 2022-11-04 09:17 | 277K | |
| Criminal1 Court.png | 2022-11-08 16:03 | 386K | |
| Criminal Court.png | 2022-11-04 15:59 | 297K | |
| Criminal Court Banner.png | 2022-11-04 15:46 | 203K | |
| Criminal Defense Attorney .png | 2022-11-08 14:42 | 588K | |
| Criminal Justice.pdf | 2022-11-01 10:03 | 133M | |
| Criminal Justice Banner.png | 2022-11-01 12:56 | 222K | |
| Criminal Justice Book Cover.PNG | 2022-11-01 13:16 | 475K | |
| Criminal Justice Reform.PNG | 2022-11-09 11:32 | 1.0M | |
| Criminal Justice W.png | 2022-11-01 13:21 | 193K | |
| Criminal Justice in Action (Larry K. Gaines, Roger LeRoy Miller)-1.pdf | 2022-11-01 11:00 | 133M | |
| Criminal Justice in Action.pdf | 2022-11-01 11:04 | 133M | |
| Criminal LAw.png | 2022-11-04 09:49 | 69K | |
| Criminal Law Banner.png | 2022-11-04 09:41 | 394K | |
| Criminal Law Banner5.png | 2022-11-08 15:47 | 273K | |
| Criminnal Just system.PNG | 2022-11-01 13:36 | 271K | |
| Cross Training.PNG | 2022-10-17 11:40 | 1.0M | |
| Cyber.png | 2022-11-10 12:37 | 311K | |
| Cyber Crime Banner.png | 2022-11-10 13:55 | 147K | |
| CyberCrimes.png | 2022-11-10 14:07 | 186K | |
| Cybercrime.png | 2022-11-10 12:27 | 292K | |
| Cycle banner.png | 2022-10-13 13:31 | 336K | |
| DOC.png | 2022-11-09 13:17 | 215K | |
| DOC1.png | 2022-11-09 13:35 | 247K | |
| David Squierio.png | 2022-10-05 13:01 | 33K | |
| Day in the life of a screenwriter.PNG | 2022-10-11 11:30 | 676K | |
| Definitions Banner.png | 2022-11-07 11:29 | 263K | |
| Deinc.PNG | 2022-10-27 13:24 | 486K | |
| Department of Corrections.PNG | 2022-11-09 13:27 | 843K | |
| Dept of Homeland.PNG | 2022-11-04 11:51 | 929K | |
| Design Qualities.PNG | 2022-10-06 09:23 | 920K | |
| Deut.png | 2022-10-21 12:58 | 245K | |
| Development Lifespan.png | 2022-12-06 13:30 | 205K | |
| Diego Rivera.png | 2022-10-05 13:01 | 30K | |
| Different types of Puppets.PNG | 2022-10-11 15:07 | 299K | |
| Different types of Stages.PNG | 2022-10-11 07:52 | 1.1M | |
| Digestive system.png | 2022-10-21 11:31 | 249K | |
| Digital Art.PNG | 2022-10-06 15:13 | 517K | |
| Discovering Ancient Egypt.PNG | 2022-10-03 13:06 | 1.0M | |
| Diversity of Invertebrates.png | 2022-10-21 12:50 | 568K | |
| Diversity of Mol.png | 2022-10-21 15:44 | 738K | |
| Domestic Terror.PNG | 2022-11-04 14:36 | 742K | |
| Drama Creative.png | 2022-10-10 11:29 | 418K | |
| Drama banner.png | 2022-10-10 10:06 | 222K | |
| Dry Media Options.PNG | 2022-10-06 08:57 | 547K | |
| Early Mammals.PNG | 2022-10-31 09:25 | 1.0M | |
| Early history.png | 2022-11-23 14:35 | 157K | |
| Earths Atmosphere facts.png | 2022-09-28 13:10 | 601K | |
| EarthsCrust.png | 2022-09-28 12:10 | 676K | |
| Echinoderms.PNG | 2022-10-24 10:06 | 1.2M | |
| Ecto.PNG | 2022-10-26 09:30 | 1.0M | |
| Ectothermy.PNG | 2022-10-25 08:28 | 918K | |
| Edouard Manet.png | 2022-10-05 10:07 | 52K | |
| Eggs Hatching.png | 2022-10-26 15:26 | 149K | |
| Egypt Banner Art.png | 2022-10-03 12:17 | 324K | |
| Egypt Map.png | 2022-10-03 13:02 | 235K | |
| Elements banner.png | 2022-11-17 11:57 | 371K | |
| Elements of Art.png | 2022-10-05 17:08 | 617K | |
| Elements of Music.PNG | 2022-11-17 13:48 | 901K | |
| Elements of Visual Arts.png | 2022-10-05 16:38 | 1.0M | |
| ElisabethVigee Lebrun.png | 2022-10-05 10:07 | 49K | |
| Ellipitical Types.PNG | 2022-10-17 12:03 | 895K | |
| Emotion Banner.png | 2022-12-06 16:10 | 99K | |
| Emotion Stress lifestyle.png | 2022-12-09 10:45 | 543K | |
| Emotion and Motovstion.png | 2022-12-06 17:01 | 695K | |
| Emotions banner.png | 2022-12-07 08:28 | 364K | |
| Enchidoderms banner.png | 2022-10-24 09:47 | 512K | |
| Endangered Birds.PNG | 2022-10-27 14:07 | 707K | |
| Endangered Fish.PNG | 2022-10-31 10:58 | 833K | |
| Endo and Echmo.PNG | 2022-10-25 08:32 | 1.2M | |
| Enhance memory.png | 2022-11-30 16:10 | 350K | |
| Essential Nutrients.PNG | 2022-10-17 13:06 | 1.0M | |
| Ethics.png | 2022-11-22 17:13 | 160K | |
| Evaluation End Of Course Survey.png | 2022-10-05 14:29 | 286K | |
| Evolution Vert.png | 2022-10-25 08:16 | 246K | |
| Evolution of American Law.PNG | 2022-11-04 11:36 | 968K | |
| Evolution of Amph.PNG | 2022-10-26 12:05 | 1.0M | |
| Evolution of Birds.PNG | 2022-10-27 13:15 | 954K | |
| Evolution of Fish.PNG | 2022-10-25 08:24 | 962K | |
| Exercise Banner.png | 2022-10-14 11:54 | 337K | |
| Exercise Prescription.png | 2022-10-14 12:14 | 343K | |
| Exercise Prescription Banner.png | 2022-10-14 12:37 | 208K | |
| Exercise Prescriptons.PNG | 2022-10-14 14:34 | 775K | |
| Exploring-Theatre-textbook.pdf | 2022-10-06 15:29 | 48M | |
| Exploring Theatre Book Cover.png | 2022-10-06 15:31 | 331K | |
| Expressionism.PNG | 2022-10-06 14:34 | 660K | |
| Expressive Quality.PNG | 2022-10-06 09:31 | 1.2M | |
| Ext Vs IXT Moto.png | 2022-12-07 09:38 | 434K | |
| Eye Conciousness.png | 2022-11-28 11:12 | 340K | |
| Eye Conciousness banner.png | 2022-11-28 12:30 | 254K | |
| Facts about Birds.PNG | 2022-10-27 12:47 | 940K | |
| Facts about Reptiles.PNG | 2022-10-26 15:44 | 1.0M | |
| Facts about Sponges.png | 2022-10-21 13:13 | 644K | |
| Fad Diets.PNG | 2022-10-17 14:07 | 738K | |
| F and W.png | 2022-10-18 12:52 | 448K | |
| Felonies and Misdermeanors.PNG | 2022-11-04 09:29 | 658K | |
| Figure 5.1.png | 2022-12-06 14:58 | 55K | |
| Fine vs Applied Art.png | 2022-10-05 16:54 | 768K | |
| Fish.png | 2022-10-25 13:06 | 244K | |
| Fish Anatomy.PNG | 2022-10-25 14:43 | 923K | |
| Fish Ecology.PNG | 2022-10-31 10:52 | 867K | |
| Fish Evolution.png | 2022-10-31 10:40 | 76K | |
| Fish Evolution Banner.png | 2022-10-25 16:20 | 350K | |
| Fish Laravae.PNG | 2022-10-25 15:29 | 433K | |
| Fish Organ Systems.PNG | 2022-10-25 14:45 | 461K | |
| Fish Production.png | 2022-10-25 15:04 | 320K | |
| Fish Reproduction.PNG | 2022-10-25 15:24 | 256K | |
| Fish banner.png | 2022-10-25 12:44 | 376K | |
| Fit and Wellness.png | 2022-10-18 13:09 | 292K | |
| Fit and well.png | 2022-10-14 14:20 | 175K | |
| Fitness and Wellness.PNG | 2022-10-12 15:29 | 706K | |
| Fitness and Wellness Book Cover.PNG | 2022-10-12 14:58 | 1.0M | |
| Fitness header.png | 2022-10-13 15:01 | 322K | |
| Fitness wellness.pdf | 2022-10-11 13:10 | 25M | |
| Fixed vs growth Mindset.PNG | 2022-10-13 14:35 | 225K | |
| Flatworm Factsd.png | 2022-10-21 14:09 | 878K | |
| Flightless birds.PNG | 2022-10-27 12:36 | 1.1M | |
| Flying Birds.PNG | 2022-10-27 12:41 | 837K | |
| Food.png | 2022-10-18 09:18 | 328K | |
| Francis Summer.png | 2022-11-23 12:46 | 511K | |
| Frequency.PNG | 2022-10-10 12:52 | 1.0M | |
| Frog Defense.PNG | 2022-10-26 12:19 | 896K | |
| Frogs Breathe.PNG | 2022-10-26 09:37 | 1.0M | |
| Frogs and toads.PNG | 2022-10-26 11:23 | 1.0M | |
| Functions.png | 2022-11-30 13:55 | 83K | |
| Functions of Lit.png | 2022-10-11 13:31 | 333K | |
| Furry Frogs.png | 2022-10-26 12:58 | 377K | |
| Future visits.png | 2022-12-06 10:28 | 672K | |
| Gab.png | 2022-09-30 12:03 | 126K | |
| Galaxies Banner.png | 2022-09-28 11:17 | 458K | |
| Galaxies and th Big Bang.png | 2022-09-28 11:22 | 160K | |
| Gastropods.png | 2022-10-21 15:40 | 462K | |
| Gavel Banner.png | 2022-11-01 14:15 | 272K | |
| General Adapation.PNG | 2022-10-17 15:47 | 289K | |
| Geology og Mars.png | 2022-09-28 13:18 | 540K | |
| Georges Rouault.png | 2022-10-05 13:01 | 36K | |
| Glossary Banner.png | 2022-11-22 15:20 | 181K | |
| Golden Eagle.png | 2022-10-27 13:47 | 136K | |
| Greek Art.png | 2022-10-03 14:47 | 86K | |
| Greek Art1.png | 2022-10-03 14:52 | 56K | |
| Greek Art2.png | 2022-10-03 14:52 | 59K | |
| Greek Art Banner.png | 2022-10-03 13:51 | 341K | |
| Greek City States.PNG | 2022-10-06 11:10 | 1.0M | |
| Greek Roman Art.PNG | 2022-10-03 16:20 | 648K | |
| HIIT.PNG | 2022-10-14 14:48 | 634K | |
| Harlo Sharp.PNG | 2022-12-16 16:30 | 756K | |
| Healthy lifestyle.png | 2022-10-18 08:54 | 318K | |
| Healthy lifestyle banner].png | 2022-10-18 08:29 | 384K | |
| Hemoglobin.PNG | 2022-10-18 13:48 | 712K | |
| Henri Matisse.png | 2022-10-05 13:01 | 39K | |
| High Blood Pressure explained.PNG | 2022-10-18 09:54 | 543K | |
| History of Prisons.png | 2022-11-10 09:53 | 322K | |
| History of Psychology.PNG | 2022-11-22 14:22 | 627K | |
| Homeland Security.PNG | 2022-11-01 15:21 | 1.0M | |
| HowATelescopeMade.png | 2022-09-28 11:51 | 700K | |
| How Criminal Courts Work.PNG | 2022-11-07 09:22 | 570K | |
| How Does Memory Work.png | 2022-11-30 16:01 | 651K | |
| How Sleep Works.PNG | 2022-11-28 13:04 | 881K | |
| How Wet Media Works.PNG | 2022-10-06 09:00 | 692K | |
| How stories work.PNG | 2022-10-11 14:09 | 904K | |
| Http.png | 2022-10-12 13:51 | 317K | |
| Https.png | 2022-10-26 08:58 | 408K | |
| Human Genetics.PNG | 2022-11-28 10:33 | 583K | |
| Humanistic theory.png | 2022-12-07 17:30 | 391K | |
| Hunger.png | 2022-12-07 09:42 | 700K | |
| Hyporthermia.PNG | 2022-10-18 13:22 | 713K | |
| ISO.png | 2022-12-08 12:29 | 122K | |
| ISO1.png | 2022-12-08 12:51 | 100K | |
| ISO Psychology.png | 2022-12-08 13:14 | 527K | |
| Importance of Birds.PNG | 2022-10-27 13:54 | 592K | |
| Importance of Fitness Testing.PNG | 2022-10-14 09:56 | 873K | |
| Importance of Physical Activity.PNG | 2022-10-13 10:22 | 506K | |
| Improv.png | 2022-10-10 13:38 | 173K | |
| Improv Banner.png | 2022-10-10 13:33 | 247K | |
| India China Banner.png | 2022-10-04 09:16 | 411K | |
| Indus Valley Civilization.PNG | 2022-10-06 11:51 | 843K | |
| Inherit.PNG | 2022-10-20 11:43 | 696K | |
| Inheritied Learned Behavior.PNG | 2022-10-20 11:34 | 862K | |
| Innate Behavior.PNG | 2022-10-20 11:00 | 648K | |
| Innated Intelligence.PNG | 2022-10-20 11:07 | 326K | |
| Institute of rch.png | 2022-10-03 11:41 | 126K | |
| Intelligence.png | 2022-11-30 11:48 | 299K | |
| Intelligence2.png | 2022-11-30 12:28 | 182K | |
| Intelligence Banner.png | 2022-11-29 16:14 | 203K | |
| Intra.PNG | 2022-10-20 15:30 | 1.0M | |
| Introduction to Ectotherms.PNG | 2022-10-26 15:07 | 771K | |
| Inuit Art.PNG | 2022-10-06 12:22 | 1.0M | |
| Invert.png | 2022-10-21 10:32 | 302K | |
| Invertebrate Banner.png | 2022-10-21 10:28 | 286K | |
| Invertebrates.png | 2022-10-21 10:42 | 557K | |
| Invertebratres.png | 2022-10-21 11:16 | 168K | |
| Invertebratres Collections.png | 2022-10-21 12:07 | 143K | |
| Invertrabe Nervous system.png | 2022-10-21 11:35 | 543K | |
| Invertrbrate Chordate.PNG | 2022-10-24 10:23 | 464K | |
| Inver vs Vert.PNG | 2022-10-20 09:21 | 906K | |
| J.M.W. Turner.png | 2022-10-05 10:07 | 43K | |
| JUup.png | 2022-12-06 10:19 | 410K | |
| Jacque Louis David.png | 2022-10-05 10:07 | 45K | |
| Jail.png | 2022-11-09 15:01 | 301K | |
| Jean Auguste Dominique.png | 2022-10-05 10:07 | 47K | |
| Jose Clemente Orozzo.png | 2022-10-05 13:01 | 51K | |
| Journal Entry.png | 2022-10-07 10:08 | 87K | |
| Jury Selection.png | 2022-11-08 16:09 | 335K | |
| Juvenile Deliquency causes.png | 2022-11-10 13:11 | 197K | |
| Juvenile Justice.png | 2022-11-10 12:27 | 198K | |
| Juvenile Justice 1.png | 2022-11-10 12:56 | 127K | |
| Juvenile Justice Banner.png | 2022-11-10 12:47 | 79K | |
| Juvenile Justice System banner.png | 2022-11-10 13:04 | 516K | |
| Juvenile system broken].png | 2022-11-10 13:15 | 564K | |
| Keeplers law of planetary motion.png | 2022-09-28 11:35 | 427K | |
| Key Elements.png | 2022-12-06 16:45 | 199K | |
| Kingdom of Ethiopia.PNG | 2022-10-06 13:10 | 960K | |
| LMS.png | 2022-11-29 12:33 | 202K | |
| Law Enforcement Today.PNG | 2022-11-04 10:57 | 762K | |
| Law Enforcement header.png | 2022-11-04 11:12 | 442K | |
| Learned Behavior.PNG | 2022-10-20 11:39 | 265K | |
| Learning Theories.png | 2022-11-29 13:24 | 262K | |
| Learning Theories banner.png | 2022-11-29 15:09 | 187K | |
| Learning Theory.PNG | 2022-11-29 13:47 | 1.1M | |
| LifeSpan Development Image.png | 2022-12-06 08:38 | 704K | |
| LifespanAreas.png | 2022-12-06 08:29 | 108K | |
| Lifespan Banner.png | 2022-12-05 15:03 | 326K | |
| Lifespan Banner 2.png | 2022-12-06 12:34 | 229K | |
| Lifespan Developement.png | 2022-12-05 17:25 | 205K | |
| Lifespan Developement1.png | 2022-12-06 08:13 | 232K | |
| Lifespan Psychology.png | 2022-12-05 15:33 | 178K | |
| Lifestyle Banner.png | 2022-10-18 09:00 | 240K | |
| Lit.png | 2022-10-11 13:06 | 246K | |
| Literature banner.png | 2022-10-11 13:00 | 291K | |
| Lizzard Banner.png | 2022-10-26 14:34 | 349K | |
| Lobes.png | 2022-11-29 11:42 | 186K | |
| Long Study.png | 2022-11-23 12:57 | 95K | |
| Lowe Art Museum.png | 2022-10-04 08:55 | 207K | |
| Macro vs Micro.PNG | 2022-10-17 13:15 | 195K | |
| Main Chordates.PNG | 2022-10-24 12:34 | 653K | |
| Major Animal Phyla.PNG | 2022-10-20 09:16 | 433K | |
| Mamals 3.png | 2022-10-27 14:50 | 577K | |
| Mammal Ancestrors.png | 2022-10-31 09:39 | 268K | |
| Mammal Banner.png | 2022-10-27 15:02 | 371K | |
| Mammal Characters.PNG | 2022-10-27 15:28 | 1.0M | |
| Mammal Class banner.png | 2022-10-28 08:54 | 392K | |
| Mammal Classification.PNG | 2022-10-27 15:22 | 498K | |
| Mammal Heart Size.PNG | 2022-10-28 10:22 | 839K | |
| Mammal Teeth.PNG | 2022-10-27 15:31 | 917K | |
| Mammals 1.png | 2022-10-27 14:28 | 221K | |
| Mammals 2.png | 2022-10-27 14:48 | 557K | |
| Mammals Header.png | 2022-10-27 14:23 | 185K | |
| Mammanth Teeth.PNG | 2022-10-28 10:26 | 650K | |
| Management Stress.png | 2022-10-17 15:25 | 105K | |
| Marine Flatworms.png | 2022-10-21 14:24 | 857K | |
| Maska.png | 2022-10-11 14:52 | 269K | |
| Masks.png | 2022-10-11 11:03 | 144K | |
| Mastaba.PNG | 2022-10-06 10:27 | 909K | |
| Media and Processes.PNG | 2022-10-06 09:05 | 1.0M | |
| Memories Banner.png | 2022-11-30 12:43 | 149K | |
| Memory.png | 2022-11-30 14:07 | 700K | |
| Memory Functions.png | 2022-11-30 13:00 | 130K | |
| Mental Benefits.PNG | 2022-10-13 10:12 | 570K | |
| Mental Health Banner.png | 2022-12-09 11:10 | 329K | |
| Mental Health Disorders.png | 2022-12-09 11:34 | 642K | |
| Mental Health Terminology.PNG | 2022-12-12 10:17 | 918K | |
| Mental Illness.png | 2022-12-09 16:12 | 199K | |
| Mental Wellness bannder.png | 2022-12-12 09:44 | 75K | |
| Mental health Treatment.png | 2022-12-12 10:07 | 292K | |
| Mental health Treatment1.png | 2022-12-12 10:10 | 225K | |
| Microphone.png | 2022-10-04 13:25 | 50K | |
| Milky Way.PNG | 2022-12-16 16:38 | 838K | |
| Mime.png | 2022-10-11 11:55 | 214K | |
| Mime Basics.PNG | 2022-10-11 12:37 | 765K | |
| Mimes.PNG | 2022-10-11 12:03 | 292K | |
| Mint Mus.png | 2022-10-04 15:51 | 164K | |
| Miranda Rights.PNG | 2022-11-04 15:35 | 627K | |
| Modern Art.png | 2022-10-05 13:54 | 113K | |
| Modern Art Banner.png | 2022-10-05 13:29 | 424K | |
| Modern Era Banner.png | 2022-10-04 15:36 | 205K | |
| Molusks banner.png | 2022-10-21 14:41 | 360K | |
| Monet.PNG | 2022-10-06 13:35 | 500K | |
| Motovation.png | 2022-12-06 16:34 | 160K | |
| Mound Builders.PNG | 2022-10-06 12:30 | 827K | |
| Muscle Flex.PNG | 2022-10-14 10:23 | 843K | |
| Music An Appreciation.pdf | 2022-11-17 09:51 | 134M | |
| Music Appreciation Book Cover.png | 2022-11-17 10:00 | 285K | |
| Mus of Art.PNG | 2022-10-03 13:41 | 1.2M | |
| Mus of Fine Arts.png | 2022-09-30 15:56 | 252K | |
| National Musuem of woman.png | 2022-09-30 12:00 | 111K | |
| Native Americans Banner.png | 2022-10-04 11:34 | 313K | |
| Nature vs Nurture.PNG | 2022-10-20 10:14 | 735K | |
| Neo.png | 2022-12-07 17:22 | 723K | |
| Neoclassical.PNG | 2022-10-06 13:24 | 965K | |
| Nervous System Banner.png | 2022-11-23 17:04 | 210K | |
| Newtons universal Law of Grav.png | 2022-09-28 11:41 | 827K | |
| Nutiriention Standards.PNG | 2022-10-17 13:11 | 770K | |
| Nutrition Banner.png | 2022-10-17 12:20 | 493K | |
| Obesity and Weight Management.PNG | 2022-10-17 14:10 | 362K | |
| Opereant Cond.PNG | 2022-11-29 15:39 | 576K | |
| Oral Interp.PNG | 2022-10-11 13:24 | 412K | |
| Origin of our Solar Systgem.png | 2022-09-28 12:01 | 462K | |
| Overview Motovation.png | 2022-12-07 09:28 | 190K | |
| Ovio Animals.PNG | 2022-10-25 09:42 | 687K | |
| Ovov.PNG | 2022-10-25 09:18 | 689K | |
| Owle.png | 2022-10-04 12:29 | 130K | |
| Oxygen UPtake.PNG | 2022-10-14 10:15 | 920K | |
| Pablo Picasso.PNG | 2022-10-06 14:45 | 753K | |
| Paleo Period.PNG | 2022-10-06 09:59 | 667K | |
| Pantomime.png | 2022-10-11 12:40 | 404K | |
| Pantomime Banner.png | 2022-10-11 12:14 | 342K | |
| Parole System.PNG | 2022-11-09 14:41 | 858K | |
| Parts of the Nervous System.PNG | 2022-11-28 10:35 | 94K | |
| Paul Cezanne.png | 2022-10-05 11:46 | 35K | |
| Paul Gauguin.png | 2022-10-05 11:46 | 60K | |
| Paula Modersohn.png | 2022-10-05 13:01 | 34K | |
| Pedometers.PNG | 2022-10-14 14:39 | 566K | |
| Pequins social behavior.PNG | 2022-10-20 15:19 | 888K | |
| Personal Fitness Header.png | 2022-10-17 10:16 | 384K | |
| Personal Trainer Banner.png | 2022-10-17 09:11 | 314K | |
| Personality.png | 2022-12-07 14:05 | 162K | |
| Personality Banner.png | 2022-12-07 13:45 | 289K | |
| Personality What Is.png | 2022-12-07 14:21 | 441K | |
| Personality banner 1.png | 2022-12-07 15:16 | 251K | |
| Personality disorders.png | 2022-12-09 14:09 | 581K | |
| Pharamones.PNG | 2022-10-20 15:21 | 929K | |
| Phases of the Moon From South.png | 2022-09-28 11:46 | 551K | |
| Physical Activity Guidliness.PNG | 2022-10-13 10:38 | 532K | |
| Physical fit.png | 2022-10-14 14:05 | 323K | |
| Physical wellness Book Cover.PNG | 2022-10-12 15:22 | 912K | |
| Physical wellness banner.png | 2022-10-12 15:03 | 303K | |
| Phytonutrients.PNG | 2022-10-17 13:23 | 431K | |
| Pitch Explained.PNG | 2022-11-17 14:44 | 403K | |
| Planetary ring Systems.png | 2022-09-28 13:51 | 488K | |
| Play Banner.png | 2022-10-10 15:42 | 364K | |
| Plymetric Training.PNG | 2022-10-17 11:23 | 470K | |
| Pol.png | 2022-11-04 15:15 | 95K | |
| Polar Bear.png | 2022-10-28 09:56 | 372K | |
| Polar Bear Banner.png | 2022-10-28 10:41 | 323K | |
| Police.png | 2022-11-04 10:43 | 371K | |
| Police2.png | 2022-11-04 11:02 | 317K | |
| Police3.png | 2022-11-04 11:25 | 99K | |
| Police Corruption.PNG | 2022-11-04 14:48 | 627K | |
| Police banner.png | 2022-11-04 10:16 | 274K | |
| Policing.png | 2022-11-04 13:51 | 230K | |
| Policing Banner.png | 2022-11-04 12:07 | 315K | |
| Policing today.PNG | 2022-11-04 11:41 | 910K | |
| Portion Control.PNG | 2022-10-18 13:45 | 592K | |
| Post Impressionism.PNG | 2022-10-06 13:43 | 1.2M | |
| Pre Comp.PNG | 2022-10-13 14:18 | 219K | |
| Prehistoric Pin up.PNG | 2022-10-03 12:33 | 801K | |
| Pretrial.png | 2022-11-08 14:26 | 112K | |
| Pretrial Banner.png | 2022-11-08 13:59 | 230K | |
| Prinicples of Design.PNG | 2022-10-06 08:45 | 786K | |
| Prison Experience.png | 2022-11-10 11:09 | 185K | |
| Prison Experience1.png | 2022-11-10 11:09 | 208K | |
| Prison Violence.png | 2022-11-10 11:33 | 274K | |
| Prison banner.png | 2022-11-10 10:36 | 440K | |
| Private Pisons.png | 2022-11-10 10:02 | 628K | |
| Proable Cause.png | 2022-11-08 14:51 | 651K | |
| Probation.PNG | 2022-11-09 14:34 | 618K | |
| Probation banner.png | 2022-11-09 13:50 | 290K | |
| Producing.png | 2022-10-11 08:44 | 202K | |
| Producing Plays Banner.png | 2022-10-11 08:37 | 237K | |
| Production Process.png | 2022-10-11 09:07 | 285K | |
| Production Process 1.png | 2022-10-11 09:35 | 720K | |
| Prompt Book.PNG | 2022-10-11 09:30 | 959K | |
| Protag Vs Antag.PNG | 2022-10-10 11:26 | 701K | |
| Protein intake.PNG | 2022-10-17 14:21 | 908K | |
| Proto.png | 2022-10-21 12:54 | 451K | |
| Pschology banner.png | 2022-11-22 10:45 | 284K | |
| Psy Banner.png | 2022-12-07 17:40 | 186K | |
| Psych banner.png | 2022-12-08 12:12 | 138K | |
| Psychological research banner.png | 2022-11-22 15:50 | 279K | |
| Psychology.png | 2022-11-22 12:53 | 149K | |
| Psychology1.png | 2022-11-22 12:55 | 178K | |
| Psychology2e_WEB.pdf | 2022-11-21 10:30 | 84M | |
| Psychology Banner.png | 2022-11-22 12:19 | 263K | |
| Psychology Banner 2.png | 2022-11-22 13:47 | 278K | |
| Psychology Book Cover.png | 2022-11-22 12:27 | 88K | |
| Punishment Definitions.png | 2022-11-09 10:48 | 62K | |
| Punishment Definitions1.png | 2022-11-09 10:50 | 249K | |
| Puppets.png | 2022-10-11 15:09 | 302K | |
| Qual and Quan.png | 2022-11-23 12:40 | 383K | |
| Racoon Banner.png | 2022-10-24 13:07 | 374K | |
| Racoons.png | 2022-10-24 13:13 | 387K | |
| Radio theatre.png | 2022-10-11 14:38 | 301K | |
| Radio theatre1.png | 2022-10-11 14:40 | 106K | |
| Rational Choice theory.png | 2022-11-02 11:05 | 296K | |
| Ray Finned Fish.PNG | 2022-10-25 15:59 | 200K | |
| Renior.PNG | 2022-10-06 09:43 | 1.1M | |
| Rentering Society.png | 2022-11-10 11:40 | 558K | |
| Repro.png | 2022-10-21 09:31 | 270K | |
| Repro Fish.png | 2022-10-25 15:16 | 110K | |
| Reproduction and Behavior.PNG | 2022-10-26 10:32 | 864K | |
| Reproductive Animals Behavior banner.png | 2022-10-21 09:22 | 335K | |
| Rept.PNG | 2022-10-26 13:53 | 600K | |
| Reptile.png | 2022-10-26 14:43 | 140K | |
| Reptile Hatching.png | 2022-10-26 15:15 | 390K | |
| Reptile Reproduction.PNG | 2022-10-26 15:32 | 937K | |
| Reptile banner.png | 2022-10-26 13:33 | 359K | |
| Reptile header.png | 2022-10-27 08:29 | 288K | |
| Reptiles.png | 2022-10-26 13:45 | 348K | |
| Reptiless.png | 2022-10-27 08:42 | 125K | |
| Research.png | 2022-11-23 12:11 | 250K | |
| Research Methods.PNG | 2022-11-22 17:16 | 885K | |
| Rigers.png | 2022-10-20 11:28 | 364K | |
| Robert S. Feldman - Essentials of Understanding Psychology 2018.pdf | 2022-11-21 12:22 | 33M | |
| Role of the Prosecutor.png | 2022-11-08 14:34 | 322K | |
| Roman Aqueducts.PNG | 2022-10-06 11:32 | 1.1M | |
| Roman Art Banner.png | 2022-10-03 15:59 | 379K | |
| Roman arch.PNG | 2022-10-06 11:29 | 1.0M | |
| Romantism.PNG | 2022-10-06 13:30 | 339K | |
| Rooster.PNG | 2022-12-16 09:36 | 809K | |
| Rotation.png | 2022-12-06 10:14 | 210K | |
| Rules of Improv.PNG | 2022-10-10 13:52 | 609K | |
| Rules of Punctioning.PNG | 2022-10-10 14:03 | 333K | |
| Salamanders and Newts.PNG | 2022-10-26 11:32 | 494K | |
| Salmon Spawning.PNG | 2022-10-25 15:32 | 768K | |
| Scale.png | 2022-11-01 14:52 | 303K | |
| Scar.PNG | 2022-10-06 10:23 | 1.1M | |
| Science of Hypnosis.PNG | 2022-11-28 13:25 | 489K | |
| Seastar.PNG | 2022-10-24 10:31 | 1.2M | |
| Self Confidence.png | 2022-10-07 14:41 | 211K | |
| Self talkj.png | 2022-10-07 14:36 | 156K | |
| Sensation and Perception.png | 2022-11-28 16:33 | 107K | |
| Sensation vs Perception.png | 2022-11-29 09:16 | 167K | |
| Sensation vs Perception1.png | 2022-11-29 09:30 | 330K | |
| Sensation vs Perception Banner.png | 2022-11-29 11:31 | 34K | |
| Sesnation and Perception Differences.PNG | 2022-11-29 09:35 | 241K | |
| Shark and Find Endo.PNG | 2022-10-24 13:26 | 764K | |
| Sheep Banner.png | 2022-10-24 14:58 | 348K | |
| Sheriff Police.PNG | 2022-11-04 14:28 | 828K | |
| Short and Long Term.PNG | 2022-10-13 10:45 | 587K | |
| Sleep Managment.PNG | 2022-10-17 15:56 | 774K | |
| Soci.png | 2022-12-07 18:01 | 235K | |
| Social Animals.PNG | 2022-10-28 12:57 | 1.1M | |
| Social Behaviors of Animals Banner.png | 2022-10-20 15:03 | 450K | |
| Social Disorganization.png | 2022-11-02 11:10 | 878K | |
| Social Psych.png | 2022-12-08 11:09 | 488K | |
| Social Psych2.png | 2022-12-08 11:15 | 360K | |
| Social Psych3.png | 2022-12-08 11:17 | 336K | |
| Social Psych4.png | 2022-12-08 11:19 | 322K | |
| Social Psychology.png | 2022-12-07 18:09 | 616K | |
| Social behaviors of Animals.png | 2022-10-20 15:09 | 277K | |
| Social psy.png | 2022-12-08 08:28 | 130K | |
| Social roles.png | 2022-12-08 11:29 | 348K | |
| Socioculktural model.PNG | 2022-12-12 10:21 | 201K | |
| Solar Cycle 2.png | 2022-09-28 15:07 | 626K | |
| Sound.png | 2022-11-17 14:25 | 202K | |
| Sound2.png | 2022-11-17 14:30 | 215K | |
| Sound Banner.png | 2022-11-17 14:02 | 238K | |
| Sources of Stress.PNG | 2022-10-17 15:54 | 707K | |
| Special Issues.png | 2022-11-10 12:21 | 510K | |
| Speedy trials.png | 2022-11-08 16:14 | 512K | |
| Sponges.png | 2022-10-21 13:24 | 583K | |
| Sponges Banner.png | 2022-10-21 12:36 | 397K | |
| Sponges header.png | 2022-10-21 13:29 | 381K | |
| Stages of Development.png | 2022-12-06 14:17 | 392K | |
| States of Matter.pdf | 2022-11-29 14:21 | 205K | |
| Statue.png | 2022-10-04 09:48 | 89K | |
| Statue1.png | 2022-10-04 09:53 | 122K | |
| Story Elements.PNG | 2022-10-07 13:26 | 957K | |
| Story Structure.PNG | 2022-10-10 15:56 | 801K | |
| StoryTelling.png | 2022-10-11 13:54 | 214K | |
| StoryTelling 1.png | 2022-10-11 14:03 | 340K | |
| StoryTelling Banner.png | 2022-10-11 13:51 | 214K | |
| Stress.png | 2022-10-17 15:20 | 103K | |
| Stress Management.png | 2022-10-17 15:30 | 115K | |
| Stress Management 1.PNG | 2022-10-17 15:41 | 477K | |
| Stress Management Banner.png | 2022-10-17 15:05 | 250K | |
| Stress Response.PNG | 2022-10-17 15:44 | 208K | |
| Stress and Lifestyle.png | 2022-12-08 14:24 | 199K | |
| Stress and Lifestyle banner.png | 2022-12-08 15:53 | 187K | |
| Stress and Regulation.png | 2022-12-09 10:52 | 509K | |
| Stress banner.png | 2022-12-08 14:07 | 262K | |
| Stress bucket.PNG | 2022-10-17 15:51 | 97K | |
| Stress lifestyle and Health.png | 2022-12-08 14:34 | 371K | |
| Stresslifestyle health.png | 2022-12-09 10:00 | 142K | |
| Stretech Reflex.PNG | 2022-10-14 14:52 | 701K | |
| Structure and Function.png | 2022-10-25 12:07 | 391K | |
| Structure of the Court Systems.PNG | 2022-11-07 09:49 | 857K | |
| Study Skills.png | 2022-11-30 10:32 | 217K | |
| Supreme Court.PNG | 2022-11-07 10:40 | 717K | |
| Surrealism.PNG | 2022-10-06 14:59 | 618K | |
| Tadpole Larvae.PNG | 2022-10-26 10:29 | 952K | |
| Tarpon Banner.png | 2022-10-25 11:55 | 451K | |
| Terry Vs Ohio.PNG | 2022-11-04 15:27 | 119K | |
| Tetrapods.PNG | 2022-10-26 09:24 | 954K | |
| The 4th Amendment.PNG | 2022-11-04 15:21 | 680K | |
| The Anatomy of Flight.PNG | 2022-10-27 10:26 | 639K | |
| The Bill of Rights.PNG | 2022-11-04 10:06 | 914K | |
| The Brain.png | 2022-11-30 15:41 | 216K | |
| The Brain1.png | 2022-11-30 15:49 | 165K | |
| The Cave Paintings of Lascaux.PNG | 2022-10-06 10:07 | 1.0M | |
| The Chordates.PNG | 2022-10-24 12:44 | 172K | |
| The Color Wheel.PNG | 2022-10-06 08:49 | 767K | |
| The Crime Funnel.PNG | 2022-11-04 09:35 | 254K | |
| The Elements of Drama.PNG | 2022-10-07 13:15 | 440K | |
| The Endocrine System.PNG | 2022-11-28 10:40 | 381K | |
| The Giants Planets.png | 2022-09-28 13:34 | 667K | |
| The Kingdom of Benin.PNG | 2022-10-06 13:01 | 1.2M | |
| The Lifespan Perspective.png | 2022-12-06 14:32 | 314K | |
| The Locus of Control.PNG | 2022-10-13 14:15 | 337K | |
| The Patriot Act.png | 2022-11-10 14:53 | 593K | |
| The Purpose of Sentencing.PNG | 2022-11-09 10:57 | 225K | |
| The Roman Republic.PNG | 2022-10-06 11:24 | 838K | |
| Theatre, Brief Version.pdf | 2022-11-17 09:51 | 135M | |
| Theatre.png | 2022-10-11 11:18 | 160K | |
| Theatre 1.png | 2022-10-07 14:51 | 293K | |
| Theatre 2.png | 2022-10-10 08:24 | 105K | |
| Theatre 20 Banner.png | 2022-10-11 11:46 | 291K | |
| Theatre Appreciation.PNG | 2022-10-11 08:52 | 690K | |
| Theatre Banner.png | 2022-10-07 08:21 | 222K | |
| Theatre Banner 1.png | 2022-10-07 10:25 | 272K | |
| Theatre Banner 2.png | 2022-10-11 10:30 | 263K | |
| Theatre Design.PNG | 2022-10-11 07:56 | 814K | |
| Theatre HIstory.png | 2022-10-11 14:32 | 64K | |
| Theatre Header.png | 2022-10-07 09:47 | 350K | |
| Theatre Masks.png | 2022-10-11 10:43 | 109K | |
| Theatre Play.png | 2022-10-10 16:01 | 307K | |
| Theatre Production Banner.png | 2022-10-11 09:00 | 343K | |
| Theatre Resources.png | 2022-10-10 09:30 | 224K | |
| Theatre Scenes.png | 2022-10-11 09:46 | 276K | |
| Theatre Stage Banner.png | 2022-10-11 07:40 | 326K | |
| Theatre Terms.PNG | 2022-10-07 13:20 | 394K | |
| Theatre behind the scenes banner.png | 2022-10-11 09:42 | 269K | |
| Theatre header 1.png | 2022-10-11 11:11 | 192K | |
| Theatre improv.png | 2022-10-10 14:10 | 323K | |
| Theatre mask Banner.png | 2022-10-11 14:47 | 192K | |
| Theatre play 1.png | 2022-10-11 11:34 | 261K | |
| Theatrical Conventions.PNG | 2022-10-11 10:56 | 334K | |
| Theme.PNG | 2022-10-10 15:59 | 546K | |
| Theories of Emotions.png | 2022-12-07 13:25 | 282K | |
| Therapy.png | 2022-12-09 16:24 | 120K | |
| Therapy and Treatment.png | 2022-12-09 14:37 | 286K | |
| Thikning.png | 2022-11-29 16:30 | 95K | |
| Thinking Banner.png | 2022-11-30 11:03 | 392K | |
| Thinking and Intelligence.PNG | 2022-11-29 16:46 | 268K | |
| Thomas Eakins.PNG | 2022-10-06 14:06 | 753K | |
| Thomas Eskins.png | 2022-10-05 11:46 | 52K | |
| Thoughts.png | 2022-11-29 16:39 | 50K | |
| Tiger Banner.png | 2022-10-24 12:15 | 343K | |
| Totem Poles.PNG | 2022-10-06 12:26 | 761K | |
| Traits.PNG | 2022-10-31 09:27 | 729K | |
| Transtgheroticsl Model.PNG | 2022-10-13 14:21 | 583K | |
| Treatment.png | 2022-12-09 16:18 | 246K | |
| Tree of Life.PNG | 2022-10-31 09:31 | 169K | |
| Trig.PNG | 2022-10-18 10:48 | 783K | |
| Triton.png | 2022-09-28 13:47 | 193K | |
| Turtle banner.png | 2022-10-24 15:37 | 318K | |
| Types of Diab.PNG | 2022-10-18 10:52 | 585K | |
| Types of Fish.PNG | 2022-10-25 15:53 | 712K | |
| Types of Mammals.PNG | 2022-10-27 14:43 | 307K | |
| Types of Stages.png | 2022-10-11 08:00 | 286K | |
| Types of Stretching.PNG | 2022-10-14 15:01 | 661K | |
| Types of intelligence.png | 2022-11-30 11:54 | 236K | |
| US FOOD AN DRU.PNG | 2022-10-18 13:38 | 456K | |
| Understanding Art Banner.png | 2022-09-30 11:36 | 352K | |
| Understanding Characterization.PNG | 2022-10-10 15:29 | 408K | |
| Unit 1 Example for LMS.pdf | 2022-12-05 13:54 | 410K | |
| Unit 3 Lesson 2 Apply Fact and Opinion (1).pdf | 2022-10-10 14:43 | 31M | |
| Us vs Federal.PNG | 2022-11-07 10:01 | 854K | |
| VVG.PNG | 2022-10-06 13:54 | 890K | |
| Values and Behaviors.PNG | 2022-10-13 14:09 | 422K | |
| Vegan Dietr.PNG | 2022-10-17 13:28 | 644K | |
| Veretebrate Animals.PNG | 2022-10-24 13:33 | 353K | |
| Vertebrate banner.png | 2022-10-24 14:27 | 285K | |
| Vertebrates.PNG | 2022-10-24 12:06 | 1.2M | |
| Vertebrates 1.PNG | 2022-10-24 13:20 | 775K | |
| Vert evolution.png | 2022-10-24 16:12 | 39K | |
| Vertrabe banner.png | 2022-10-24 11:32 | 276K | |
| Verts.png | 2022-10-24 11:40 | 286K | |
| Vertsabrae.png | 2022-10-25 09:02 | 155K | |
| Video Camera.png | 2022-10-04 14:24 | 97K | |
| Video Reorder.png | 2022-10-05 15:00 | 61K | |
| Vincent Van Gogh.png | 2022-10-05 11:46 | 38K | |
| Violin.png | 2022-11-17 12:26 | 283K | |
| Violin2.png | 2022-11-17 12:31 | 289K | |
| Virtual Globe Theatre.png | 2022-10-07 14:07 | 147K | |
| Visual Pathway to Brain.PNG | 2022-11-29 12:01 | 414K | |
| Visual Vocabulary Banner.png | 2022-09-30 14:48 | 357K | |
| Viv Animals.PNG | 2022-10-25 09:35 | 712K | |
| Vocabulary Banner 1.png | 2022-09-29 13:19 | 278K | |
| Voice.png | 2022-10-10 12:29 | 202K | |
| Voice Banner.png | 2022-10-10 12:22 | 177K | |
| Voice Developing.png | 2022-10-10 13:00 | 83K | |
| VoiceThread.png | 2022-10-05 15:11 | 212K | |
| Voire Dire.png | 2022-11-08 16:18 | 486K | |
| Water Exercises.PNG | 2022-10-17 11:30 | 905K | |
| Weight Managment Banner.png | 2022-10-17 13:38 | 317K | |
| Weight Managment Banner1.png | 2022-10-17 13:50 | 352K | |
| Welcome to Hope COre.png | 2022-10-12 13:10 | 325K | |
| Wellness Banner.png | 2022-10-13 09:39 | 284K | |
| Wellness and Fitness banner.png | 2022-10-18 12:37 | 357K | |
| Wellness lifestyke.PNG | 2022-10-18 09:48 | 109K | |
| Welness.png | 2022-10-17 12:53 | 244K | |
| Welnness banner.png | 2022-10-26 14:27 | 319K | |
| What are Animals.PNG | 2022-10-19 13:08 | 1.0M | |
| What is Audiotry System.PNG | 2022-11-29 12:11 | 320K | |
| What is Chl.PNG | 2022-10-18 09:58 | 151K | |
| What is Cognition.png | 2022-11-30 12:02 | 595K | |
| What is Conciousness.PNG | 2022-11-28 11:45 | 613K | |
| What is CyberCrime.png | 2022-11-10 14:15 | 559K | |
| What is Fine Art.png | 2022-10-05 16:43 | 279K | |
| What is Lifestyle Development.png | 2022-12-06 14:07 | 291K | |
| What is Obesity.PNG | 2022-10-17 14:03 | 259K | |
| What is Ph.png | 2022-11-22 14:41 | 101K | |
| What is Ph1.png | 2022-11-22 14:45 | 94K | |
| What is Physchology.PNG | 2022-11-22 13:06 | 543K | |
| What is Psychology.png | 2022-11-22 14:08 | 238K | |
| What is Sound.PNG | 2022-10-10 12:46 | 279K | |
| What is Sound1.PNG | 2022-11-17 14:37 | 755K | |
| What is Stress.png | 2022-12-09 10:47 | 250K | |
| What is Theatre.PNG | 2022-10-07 13:00 | 792K | |
| What is Wellness.PNG | 2022-10-13 10:50 | 706K | |
| What is White Collar Crime.png | 2022-11-10 14:45 | 442K | |
| What is a Phroash.PNG | 2022-10-06 10:15 | 707K | |
| What is justice.PNG | 2022-11-16 09:47 | 537K | |
| What is personality.png | 2022-12-07 17:17 | 730K | |
| What is social psychology.png | 2022-12-08 11:25 | 612K | |
| Whats your story.png | 2022-10-11 14:14 | 206K | |
| Who Are You.png | 2022-12-07 14:02 | 194K | |
| Why You Need Exercise.PNG | 2022-10-17 10:57 | 360K | |
| Wings and Feathers.PNG | 2022-10-27 10:12 | 1.1M | |
| Winslow Homer.png | 2022-10-05 11:46 | 30K | |
| Worlds largest telescope.png | 2022-09-28 11:57 | 702K | |
| You and Theatre Banner.png | 2022-10-07 13:33 | 318K | |
| Zoology.pdf | 2022-10-19 12:44 | 37M | |
| Zoology Banner.png | 2022-10-19 11:48 | 206K | |
| Zoology Book Cover.png | 2022-10-19 12:50 | 264K | |
| animal Behaviors.PNG | 2022-10-20 10:18 | 1.0M | |
| bar.PNG | 2022-12-16 16:34 | 460K | |
| bird.png | 2022-10-24 15:10 | 250K | |
| chapter_5_extra_practice.pdf | 2022-12-16 10:35 | 59K | |
| const.png | 2022-11-04 15:04 | 377K | |
| core hope.png | 2022-10-14 15:46 | 56K | |
| court room banner.png | 2022-11-09 10:27 | 329K | |
| eating disorders.PNG | 2022-10-17 13:31 | 690K | |
| endo Ectro.PNG | 2022-10-28 12:22 | 798K | |
| f and w banner.png | 2022-10-18 12:59 | 367K | |
| fish Vert.PNG | 2022-10-25 13:27 | 668K | |
| flat and roundworms banner.png | 2022-10-21 13:46 | 486K | |
| history of Phy Banner.png | 2022-11-22 11:27 | 261K | |
| immediate sanctions.PNG | 2022-11-09 14:44 | 404K | |
| innate firsh.PNG | 2022-10-20 11:04 | 1.1M | |
| jail vs Prison.png | 2022-11-10 10:17 | 488K | |
| juvenile banner.png | 2022-11-10 12:06 | 206K | |
| mimicry.png | 2022-10-21 09:49 | 864K | |
| mito and brain.PNG | 2022-10-28 12:27 | 798K | |
| muscular Strength.PNG | 2022-10-14 10:20 | 412K | |
| nutritrion.png | 2022-10-17 12:27 | 229K | |
| nutritrion and wellness.png | 2022-10-17 12:27 | 498K | |
| nutritrion and wellness banner.png | 2022-10-17 12:32 | 267K | |
| octopus.png | 2022-10-31 10:06 | 252K | |
| parole.png | 2022-11-09 14:20 | 336K | |
| physical fitness header.png | 2022-10-14 08:54 | 360K | |
| physical fitness test.png | 2022-10-14 09:43 | 238K | |
| processed-C5759F4A-5375-4C3E-AE07-A2A2A0CFCF62-C0B48825-9E75-49CE-BF7C-250C54BCD3FB.mp4 | 2022-12-20 14:24 | 18M | |
| psy3(1).png | 2022-11-22 11:45 | 21K | |
| psycho disorder.png | 2022-12-09 13:55 | 229K | |
| psychological disorders.png | 2022-12-09 11:22 | 126K | |
| psychological disorders 1.png | 2022-12-09 13:29 | 238K | |
| psychological disorders babber.png | 2022-12-09 13:20 | 382K | |
| psychological research banner.png | 2022-11-23 11:26 | 401K | |
| psychology5.png | 2022-11-22 16:13 | 270K | |
| psychology of learning.png | 2022-11-29 13:24 | 271K | |
| reptile Respiration.PNG | 2022-10-26 15:03 | 701K | |
| research.png | 2022-11-22 16:52 | 346K | |
| round.png | 2022-10-21 11:25 | 402K | |
| roundWorms.png | 2022-10-21 14:15 | 375K | |
| script.png | 2022-10-14 12:52 | 166K | |
| social1.png | 2022-11-08 12:52 | 28K | |
| social psychology banner.png | 2022-12-08 10:52 | 127K | |
| table 5.2.png | 2022-12-06 15:19 | 123K | |
| tang Dynasty.PNG | 2022-10-06 12:11 | 1.0M | |
| testing.png | 2022-11-22 11:19 | 234K | |
| the Giant Planet.png | 2022-09-29 07:47 | 194K | |
| the Giant Planets1.png | 2022-09-29 07:51 | 202K | |
| wHAT is Phy.PNG | 2022-11-22 14:17 | 588K | |
| what is cardio.PNG | 2022-10-18 09:51 | 698K | |
| white Collar Crimes.PNG | 2022-11-01 15:06 | 229K | |
| zMam bann.png | 2022-10-28 15:14 | 227K | |
