![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 2 digit Multiplication.PNG | 2022-03-07 12:53 | 11K | |
| 4thMath/ | 2022-02-18 15:27 | - | |
| 5 points of calvinism.PNG | 2021-07-23 10:40 | 780K | |
| 5thMath/ | 2021-12-07 09:14 | - | |
| 6thLang/ | 2024-04-13 08:13 | - | |
| 6thMath/ | 2021-06-14 14:58 | - | |
| 6thScience/ | 2021-10-22 13:19 | - | |
| 7 codes.PNG | 2021-07-20 10:52 | 796K | |
| 7thLang/ | 2022-03-16 11:46 | - | |
| 7thMath/ | 2021-06-14 14:37 | - | |
| 7 yuears war banner.png | 2021-08-02 14:15 | 443K | |
| 8thLang/ | 2022-02-23 12:42 | - | |
| 8thScience/ | 2021-12-07 16:11 | - | |
| 9 Times Tables.PNG | 2022-03-07 10:50 | 37K | |
| 30 Years War.PNG | 2021-08-02 14:33 | 155K | |
| 100 year war.PNG | 2021-07-21 15:17 | 514K | |
| 690bf398-87e1-4a4b-a705-b4e0bcf5fe6f(1).mp4 | 2021-07-13 12:03 | 33M | |
| 948afa6d-6177-452f-948f-922b7265f0e7.mp4 | 2021-07-14 16:36 | 16M | |
| 1618324687240.jpg | 2021-05-05 16:20 | 86K | |
| ACDC.PNG | 2021-06-30 10:30 | 210K | |
| AD22files/ | 2022-03-31 10:12 | - | |
| AF banner.png | 2021-07-09 12:48 | 397K | |
| Abe Linc.PNG | 2021-08-05 11:14 | 425K | |
| Absolute Zero.PNG | 2021-06-28 10:12 | 741K | |
| Acid rain.PNG | 2021-07-01 16:18 | 522K | |
| Acropolis.PNG | 2021-07-08 08:26 | 1.1M | |
| Adam smith.PNG | 2021-08-04 16:28 | 668K | |
| Add sub Time.PNG | 2022-03-09 11:02 | 239K | |
| Aegean Sea.PNG | 2021-07-07 09:58 | 872K | |
| Africa Banner.png | 2021-08-05 11:41 | 174K | |
| African Savanah.PNG | 2021-07-09 14:05 | 1.1M | |
| Agean Sea.png | 2021-07-07 09:30 | 178K | |
| Aksum.PNG | 2021-07-12 09:37 | 781K | |
| Aksumite.PNG | 2021-07-12 09:25 | 1.1M | |
| Al Andadu.PNG | 2021-07-12 14:50 | 287K | |
| Alexader the great.png | 2021-07-08 10:01 | 410K | |
| Alexander Defeats Persians.PNG | 2021-07-08 12:15 | 891K | |
| Alexander Ne.PNG | 2021-07-12 17:00 | 786K | |
| Alexander Vid.PNG | 2021-07-08 12:16 | 772K | |
| Algebra 1 - welcome video.mp4 | 2021-08-18 11:09 | 28M | |
| Algebra1Intro.mp4 | 2021-07-13 14:59 | 13M | |
| Algebra2/ | 2022-02-07 17:03 | - | |
| Alien Angles.PNG | 2022-03-09 11:52 | 456K | |
| All Combined.pdf | 2021-08-12 14:02 | 1.7M | |
| Alligator.PNG | 2022-03-09 17:25 | 208K | |
| American Culture.PNG | 2021-08-12 09:16 | 599K | |
| American Demographics.PNG | 2021-08-12 09:08 | 479K | |
| American Drama.png | 2022-03-23 08:34 | 2.1K | |
| American Government.png | 2021-08-11 16:19 | 661K | |
| American Government banner.png | 2021-08-11 16:43 | 361K | |
| American Government book.png | 2021-08-11 16:25 | 197K | |
| American Govt Banner.png | 2021-08-12 08:26 | 324K | |
| AmericanHist/ | 2022-02-16 12:58 | - | |
| American People.png | 2021-08-12 08:45 | 248K | |
| American People banner.png | 2021-08-12 08:39 | 294K | |
| Anatomy/ | 2021-11-17 14:41 | - | |
| Angles.PNG | 2022-03-09 12:46 | 59K | |
| Animism.PNG | 2021-07-09 14:09 | 1.0M | |
| Animism Video.PNG | 2021-07-12 08:15 | 942K | |
| Ankor wat temple.PNG | 2021-07-20 11:36 | 863K | |
| Application.PNG | 2021-05-28 14:30 | 355K | |
| Arch Facts.PNG | 2021-07-08 13:13 | 954K | |
| Area.PNG | 2022-03-09 13:34 | 480K | |
| Area Climber.PNG | 2022-03-09 13:39 | 30K | |
| Area of Rectangle.PNG | 2022-03-09 13:48 | 17K | |
| Articles of Confederation.PNG | 2021-08-12 11:13 | 1.0M | |
| Askum.png | 2021-07-12 09:07 | 217K | |
| Asohka.PNG | 2021-07-09 10:36 | 927K | |
| Assarian Empire.png | 2021-07-07 11:51 | 447K | |
| Assarian Empire banner.png | 2021-07-07 11:53 | 389K | |
| Assaryian Popweer.PNG | 2021-07-07 12:27 | 881K | |
| Asteroids.PNG | 2021-06-30 12:31 | 537K | |
| Astronomy.PNG | 2021-06-30 13:24 | 872K | |
| Astronomy/ | 2022-02-22 14:06 | - | |
| Atilia the huN.PNG | 2021-07-08 16:20 | 834K | |
| Atmosphere banner.png | 2021-07-02 09:05 | 261K | |
| Augustus Empire.PNG | 2021-07-08 14:47 | 763K | |
| Aztec Empire.png | 2021-07-22 14:20 | 201K | |
| Aztec History.PNG | 2021-07-22 14:26 | 884K | |
| Aztec banner.png | 2021-07-22 14:09 | 281K | |
| BANNER2.jpg | 2021-05-04 16:50 | 35K | |
| BANNER3.jpg | 2021-05-04 16:50 | 55K | |
| BANNER4.jpg | 2021-05-04 16:50 | 31K | |
| Balance of power.PNG | 2021-08-03 15:54 | 438K | |
| Banking Basics cover.PNG | 2021-05-04 10:49 | 27K | |
| Banner11.PNG | 2021-06-24 14:43 | 247K | |
| Banner imperalism.png | 2021-08-05 12:19 | 278K | |
| Bantu Speaking People Migration.PNG | 2021-07-12 08:57 | 1.0M | |
| Bar Graph Vocabulary.PNG | 2022-03-11 10:05 | 110K | |
| Bar Graphs.PNG | 2022-03-08 12:04 | 22K | |
| Batholmeu Diaz.PNG | 2021-07-23 14:11 | 769K | |
| Battle of Traf.PNG | 2021-08-03 13:45 | 1.0M | |
| Bedtime Bandits.PNG | 2022-03-09 09:48 | 312K | |
| Beringa Land Bridge.png | 2021-07-12 10:17 | 338K | |
| Beringa Land Bridge 1.png | 2021-07-12 10:27 | 193K | |
| Beriniga Land.PNG | 2021-07-12 10:35 | 578K | |
| Berlin Conference.PNG | 2021-08-05 11:59 | 764K | |
| Billl of Rights.PNG | 2021-08-03 11:00 | 849K | |
| Bill of Rights.PNG | 2021-08-12 12:23 | 847K | |
| Bill of rights banner.png | 2021-08-12 12:44 | 365K | |
| Biology/ | 2022-02-18 12:12 | - | |
| Biznark.PNG | 2021-08-04 11:41 | 551K | |
| Black Holes.PNG | 2021-06-30 14:39 | 827K | |
| Boer Wars.PNG | 2021-08-05 12:05 | 150K | |
| Boxer Reb.PNG | 2021-08-06 09:01 | 1.1M | |
| Brahma.PNG | 2021-07-09 11:33 | 1.0M | |
| Bridge.png | 2021-07-21 14:25 | 320K | |
| Britan conquer india.PNG | 2021-08-05 14:12 | 735K | |
| Byz Empiore.png | 2021-07-12 16:22 | 234K | |
| Byzantine Empire Banner.png | 2021-07-12 16:18 | 418K | |
| CHapter 5.PNG | 2021-05-04 15:09 | 491K | |
| CK12Geometry/ | 2021-10-29 08:50 | - | |
| Calculus/ | 2022-03-25 13:21 | - | |
| Calvin.png | 2021-07-23 10:34 | 108K | |
| Canaan.PNG | 2021-07-07 10:37 | 954K | |
| Capture.PNG | 2021-05-04 10:03 | 676K | |
| Cardinal Ric.PNG | 2021-08-02 13:49 | 615K | |
| Caroling.PNG | 2021-07-20 13:27 | 770K | |
| Cash out.PNG | 2022-03-07 16:55 | 472K | |
| Caste systgem.PNG | 2021-07-07 08:26 | 1.0M | |
| Catch the Factors.PNG | 2022-03-07 14:38 | 41K | |
| Catherine the Great.PNG | 2021-08-03 10:09 | 648K | |
| Causes of Pollution.PNG | 2021-07-02 15:08 | 688K | |
| Causes of REformation.png | 2021-07-23 10:02 | 92K | |
| Central Monarchs.png | 2021-08-02 14:18 | 239K | |
| Chalderons.PNG | 2021-07-07 12:40 | 915K | |
| Changes In Medevil Society.png | 2021-07-21 12:36 | 143K | |
| CharChar.png | 2021-07-20 12:32 | 269K | |
| Char and the Franks.PNG | 2021-07-20 12:58 | 447K | |
| Charlemenge.png | 2021-07-20 12:29 | 338K | |
| Chartism.PNG | 2021-08-05 08:52 | 823K | |
| Checks and Bal.PNG | 2021-08-03 10:56 | 338K | |
| Chemistry/ | 2022-02-03 16:25 | - | |
| China Banner.png | 2021-08-05 16:16 | 330K | |
| Christianity.png | 2021-07-08 15:23 | 265K | |
| Christianity Banner.png | 2021-07-08 15:21 | 405K | |
| ChurchReform.png | 2021-07-21 11:49 | 290K | |
| Circuit Board Banner.png | 2021-06-29 15:43 | 363K | |
| Circuits.png | 2021-06-29 15:46 | 285K | |
| Circulatory system.png | 2021-07-19 12:49 | 331K | |
| Civics/ | 2021-10-27 10:58 | - | |
| CivicsIntro.mp4 | 2021-07-13 14:19 | 25M | |
| Civil.png | 2021-08-12 16:01 | 196K | |
| Civil Rights banner.png | 2021-08-12 15:51 | 345K | |
| Civil Service Laws.PNG | 2021-08-13 14:07 | 795K | |
| Civili Liberties and Civil rights.PNG | 2021-08-12 14:06 | 313K | |
| Claims.pdf | 2022-07-18 19:10 | 946K | |
| Classification of Glaxies.PNG | 2021-06-30 15:49 | 782K | |
| Classify Angles.PNG | 2022-03-09 11:57 | 22K | |
| Climate change.PNG | 2021-07-02 14:54 | 756K | |
| Clock Maker.PNG | 2022-03-09 10:50 | 328K | |
| Clock WOrks.PNG | 2022-03-09 10:45 | 318K | |
| Coastal Eroision.PNG | 2021-07-01 16:22 | 588K | |
| Codex.PNG | 2021-07-22 13:48 | 692K | |
| Collision that formed the moon.PNG | 2021-06-30 13:28 | 782K | |
| Columbian Exchange banner.png | 2021-08-02 11:47 | 196K | |
| Columbian exchange video.PNG | 2021-08-02 12:01 | 801K | |
| Columbus.PNG | 2021-08-02 09:39 | 747K | |
| Combine4d.pdf | 2021-08-12 16:14 | 1.0M | |
| Combined.pdf | 2021-08-12 11:38 | 612K | |
| Commercial Revolution.PNG | 2021-07-21 12:50 | 679K | |
| Compare Fr.PNG | 2022-03-08 14:17 | 70K | |
| Comparing Fractions.PNG | 2022-03-08 14:05 | 214K | |
| Comparing NUmbers.PNG | 2022-03-09 17:33 | 285K | |
| Comparing ordering whole nbumbers.PNG | 2022-03-09 17:37 | 146K | |
| Comptetion in Eo.PNG | 2021-07-02 13:33 | 1.0M | |
| Concave Mirrors.PNG | 2021-06-29 10:42 | 305K | |
| Concert of europe.PNG | 2021-08-03 15:57 | 567K | |
| Confusious.PNG | 2021-07-07 14:22 | 844K | |
| Congress.PNG | 2021-08-03 15:39 | 455K | |
| Congress of Vienna.png | 2021-08-03 14:33 | 283K | |
| Congruent Practice.PNG | 2022-03-09 13:17 | 506K | |
| Constaintine and christinity.PNG | 2021-07-08 15:38 | 1.0M | |
| Coop Federalism.PNG | 2021-08-13 10:22 | 1.0M | |
| Corilos effect.PNG | 2021-07-02 11:50 | 827K | |
| Cortes.PNG | 2021-08-02 09:42 | 853K | |
| Counting Mon.PNG | 2022-03-07 17:24 | 101K | |
| Counting Money.PNG | 2022-03-07 16:46 | 287K | |
| Crest and Troufgh.PNG | 2021-06-28 13:55 | 857K | |
| Crimean War.PNG | 2021-08-05 13:28 | 215K | |
| Crim war.png | 2021-08-05 12:59 | 260K | |
| Crusadea.png | 2021-07-21 12:46 | 348K | |
| Culinary/ | 2021-11-19 14:23 | - | |
| Cuture.png | 2021-07-08 12:57 | 302K | |
| Cyrus the great.PNG | 2021-07-07 13:33 | 878K | |
| DNARNA.png | 2021-07-19 09:23 | 127K | |
| Dall of Rome.png | 2021-07-08 16:10 | 381K | |
| Daoism.PNG | 2021-07-07 14:30 | 715K | |
| Declaration.PNG | 2021-08-09 10:59 | 376K | |
| Demo.png | 2021-08-05 08:32 | 404K | |
| Desports.PNG | 2021-08-03 10:06 | 735K | |
| Diapora.PNG | 2021-07-08 15:34 | 682K | |
| Diffraction.PNG | 2021-06-28 15:45 | 328K | |
| Digestive System.png | 2021-07-19 14:03 | 229K | |
| Divided Power.PNG | 2021-08-11 16:54 | 508K | |
| Divine Right.PNG | 2021-08-02 13:17 | 436K | |
| Division.PNG | 2022-03-07 14:48 | 107K | |
| Division Word Pr.PNG | 2022-03-07 16:08 | 324K | |
| Division Word Problems.PNG | 2022-03-07 11:04 | 326K | |
| Division with Remainer.PNG | 2022-03-07 13:39 | 427K | |
| Doppler Effect.PNG | 2021-06-28 14:02 | 1.1M | |
| Do you have enough money.PNG | 2022-03-07 17:34 | 83K | |
| Due Process.PNG | 2021-08-12 15:23 | 767K | |
| Dutch.png | 2021-07-23 14:07 | 314K | |
| EP.PNG | 2021-08-05 11:20 | 400K | |
| ESL/ | 2021-10-25 08:33 | - | |
| Early Civilizations.png | 2021-07-12 11:08 | 283K | |
| Earth Moon Sun Banner.png | 2021-06-30 10:49 | 199K | |
| EarthScience/ | 2022-02-18 10:26 | - | |
| Earth moon and Sun.png | 2021-06-30 10:53 | 281K | |
| East India Company BAnner.png | 2021-07-23 14:01 | 304K | |
| Eco.PNG | 2021-07-02 13:26 | 1.0M | |
| Economics/ | 2022-03-29 14:19 | - | |
| Ecosystems b anner.png | 2021-07-02 13:08 | 358K | |
| Ecoystem.png | 2021-07-02 13:10 | 325K | |
| Elapsed Time.PNG | 2022-03-09 11:13 | 16K | |
| Electo Spectrum.PNG | 2021-06-29 08:54 | 523K | |
| Electric Charge.png | 2021-06-29 13:04 | 167K | |
| Electric Curren.png | 2021-06-29 14:17 | 112K | |
| Electric Curren 1.png | 2021-06-29 14:17 | 193K | |
| Electric Current.PNG | 2021-06-29 13:22 | 566K | |
| Electric Current banner.png | 2021-06-29 13:58 | 224K | |
| Electric Field.PNG | 2021-06-29 13:34 | 745K | |
| Electric Potentional Diffference.PNG | 2021-06-29 13:30 | 182K | |
| Electrical Res.PNG | 2021-06-29 14:31 | 483K | |
| Electric current12.png | 2021-06-30 10:10 | 154K | |
| Electromag.PNG | 2021-06-30 09:52 | 516K | |
| Electromagnetic.PNG | 2021-06-29 08:50 | 0 | |
| Electromagnetic Wae.PNG | 2021-06-28 13:07 | 485K | |
| ElementaryMath/ | 2021-08-09 13:14 | - | |
| Empire of the Askum.PNG | 2021-07-12 08:22 | 925K | |
| Empitr.png | 2021-08-02 13:00 | 275K | |
| En Banner.png | 2021-07-07 11:12 | 338K | |
| End Number.PNG | 2022-03-08 12:52 | 248K | |
| Endocrine Stem.png | 2021-07-19 12:35 | 135K | |
| Energy Transfer Banner.png | 2021-06-28 10:39 | 222K | |
| Energy and resouces banner.png | 2021-07-02 14:03 | 274K | |
| Energy trans.png | 2021-06-28 10:50 | 78K | |
| Eng 3 bannewr.png | 2021-07-13 15:12 | 139K | |
| English1/ | 2021-11-17 07:11 | - | |
| English2/ | 2021-08-12 10:53 | - | |
| English3/ | 2022-01-20 17:43 | - | |
| English 3Intro.mp4 | 2021-07-13 16:16 | 27M | |
| English4/ | 2021-10-21 14:40 | - | |
| English Civil War.png | 2021-08-03 08:41 | 395K | |
| English Monarchs.png | 2021-08-03 08:34 | 117K | |
| Epicenter vs Focus.PNG | 2021-07-01 10:27 | 481K | |
| Equi Fractions Practice.PNG | 2022-03-08 13:23 | 25K | |
| Equivlent fractions.PNG | 2022-03-08 13:46 | 80K | |
| Erwin.PNG | 2021-08-09 09:16 | 942K | |
| Europe War.png | 2021-08-09 08:39 | 326K | |
| Europe war banner.png | 2021-08-05 10:22 | 167K | |
| Euthrophication.PNG | 2021-07-02 15:02 | 1.0M | |
| Expanded Form.PNG | 2022-03-09 15:21 | 64K | |
| Exploringtheatmosphere.PNG | 2021-07-02 09:51 | 1.1M | |
| Fall fo Consta.PNG | 2021-07-08 16:17 | 618K | |
| Fall of the Mughals.PNG | 2021-07-23 13:25 | 293K | |
| Faradays Law.PNG | 2021-06-30 10:22 | 141K | |
| Federal System.png | 2021-08-13 08:45 | 155K | |
| Federal government banner.png | 2021-08-13 08:41 | 350K | |
| Federalism Banner.png | 2021-08-13 09:34 | 153K | |
| Federalism Vi.png | 2021-08-13 09:52 | 293K | |
| Federalists.PNG | 2021-08-12 12:18 | 1.0M | |
| Feudalism Banner.png | 2021-07-20 13:48 | 348K | |
| Field of magnetic field.PNG | 2021-06-30 08:44 | 231K | |
| Finanace Video pic.PNG | 2021-05-04 10:17 | 832K | |
| First indo.PNG | 2021-07-07 08:12 | 662K | |
| Fossill Fuels.PNG | 2021-07-02 14:15 | 1.0M | |
| Fraction Game.PNG | 2022-03-08 13:12 | 72K | |
| Fraction Slither.PNG | 2022-03-08 13:36 | 357K | |
| Fractions as whole numbers.PNG | 2022-03-08 14:50 | 303K | |
| France and England.png | 2021-07-21 14:28 | 203K | |
| Francisco.PNG | 2021-08-02 09:53 | 813K | |
| Fred the Great.PNG | 2021-08-02 15:45 | 753K | |
| French/ | 2021-12-03 09:22 | - | |
| French Rev.png | 2021-08-03 11:22 | 336K | |
| French Revolution banner.png | 2021-08-03 12:55 | 246K | |
| Fsll roman empire.png | 2021-07-08 15:54 | 386K | |
| Function Party combined.pdf | 2021-08-13 14:25 | 289K | |
| Galaxy Facts.PNG | 2021-06-30 15:42 | 884K | |
| Galvenomter.PNG | 2021-06-30 09:44 | 407K | |
| Gene Expression.png | 2021-07-19 11:05 | 286K | |
| Genghis Khaun.PNG | 2021-07-20 08:16 | 1.0M | |
| Geometry/ | 2022-01-11 15:40 | - | |
| Geopolotics.PNG | 2021-08-05 13:19 | 1.1M | |
| Geothermal Enerfy.PNG | 2021-07-02 14:24 | 725K | |
| Germanic Kingdoms Banner.png | 2021-07-20 12:18 | 239K | |
| Global.png | 2021-08-09 10:34 | 309K | |
| Global Interdependence.PNG | 2021-08-09 10:53 | 786K | |
| Global banner.png | 2021-08-09 10:13 | 191K | |
| Global econo.PNG | 2021-08-09 10:56 | 487K | |
| Glorious Revolution.PNG | 2021-08-03 08:52 | 232K | |
| Government.png | 2021-08-12 10:22 | 304K | |
| Government banner.png | 2021-08-12 10:19 | 303K | |
| Grading.png | 2021-07-15 08:56 | 75K | |
| Grams to Kilograms.PNG | 2022-03-08 09:39 | 16K | |
| Graphic.jpg | 2021-05-05 08:30 | 8.2K | |
| Graphic2-2 - Copy.PNG | 2021-11-22 17:38 | 384K | |
| Graphic2.jpg | 2021-05-05 08:30 | 9.4K | |
| Graphic3.jpg | 2021-05-05 08:30 | 9.2K | |
| Greco Roman Period.PNG | 2021-07-09 09:13 | 1.0M | |
| Greece Golden Age.png | 2021-07-08 08:51 | 254K | |
| Greece Golden Age banner.png | 2021-07-08 08:50 | 294K | |
| Greek City States.PNG | 2021-07-08 08:36 | 1.0M | |
| Greek Direct Democracy.PNG | 2021-07-08 08:58 | 953K | |
| Guilloyinr.PNG | 2021-08-03 13:16 | 878K | |
| Gupra Dynasty.PNG | 2021-07-09 10:40 | 508K | |
| Gutenberg.PNG | 2021-07-23 09:42 | 845K | |
| Habitats.PNG | 2021-07-02 13:29 | 1.1M | |
| Hagia Sophia.PNG | 2021-07-12 16:32 | 894K | |
| Han Dyn.PNG | 2021-07-09 12:15 | 1.0M | |
| Han Dynasty.PNG | 2021-07-09 12:11 | 404K | |
| Hannibals Army.PNG | 2021-07-08 14:20 | 640K | |
| Hatsheput.PNG | 2021-07-07 11:43 | 685K | |
| HealthClass/ | 2021-05-07 14:04 | - | |
| Heat.PNG | 2021-06-28 11:32 | 798K | |
| Heat Engines.PNG | 2021-06-28 12:06 | 741K | |
| Heat and Temp.PNG | 2021-06-28 12:19 | 706K | |
| Heat banner.png | 2021-06-28 11:53 | 233K | |
| Heat capacity.PNG | 2021-06-28 11:25 | 660K | |
| Hellenecic Culture.png | 2021-07-08 12:23 | 351K | |
| Hellenecic Period.PNG | 2021-07-08 13:05 | 946K | |
| Hidden Picture.PNG | 2022-03-07 14:52 | 67K | |
| Hind and Buddism.PNG | 2021-07-07 09:14 | 529K | |
| Hitler.png | 2021-08-09 08:44 | 149K | |
| Hitler banner.png | 2021-08-09 08:43 | 285K | |
| Hittie Empire.PNG | 2021-07-07 08:17 | 1.1M | |
| Hohkoum,.PNG | 2021-07-22 11:31 | 862K | |
| Horse trojan.png | 2021-07-07 16:16 | 208K | |
| How do I measure up.PNG | 2022-03-08 10:05 | 949K | |
| How iSLAM began.PNG | 2021-07-12 14:06 | 620K | |
| How the Universe works.PNG | 2021-06-30 16:21 | 442K | |
| Hunters and gatherers.PNG | 2021-07-12 10:58 | 268K | |
| Hurricanes.PNG | 2021-07-02 12:45 | 723K | |
| IMG_3300 _Trump_ .mov | 2021-07-12 12:46 | 26M | |
| IMG_3301 _Kennedy History_.mov | 2021-07-12 12:43 | 33M | |
| Igenous Rocks.PNG | 2021-07-01 14:20 | 873K | |
| Impearl Japan.PNG | 2021-08-06 10:39 | 311K | |
| Impearlism banner.png | 2021-08-05 13:41 | 398K | |
| In Light Menmt.png | 2021-08-03 09:56 | 320K | |
| Inca Government.PNG | 2021-07-22 16:22 | 939K | |
| Inca banner.png | 2021-07-22 15:56 | 373K | |
| India Banner.png | 2021-07-09 10:21 | 207K | |
| India Banner 1.png | 2021-07-09 11:06 | 167K | |
| Indust banner.png | 2021-08-04 14:25 | 126K | |
| Industrial Rev banner.png | 2021-08-04 15:53 | 335K | |
| Industrial Rev world.png | 2021-08-04 15:59 | 190K | |
| Industrial rev.png | 2021-08-04 12:48 | 308K | |
| Industrial revolution.png | 2021-08-04 12:54 | 176K | |
| Industrial revolution01.png | 2021-08-04 12:58 | 273K | |
| Infrasound.PNG | 2021-06-28 16:38 | 505K | |
| Inside the Earth.PNG | 2021-07-01 10:36 | 607K | |
| Int Graphs.PNG | 2022-03-08 11:46 | 54K | |
| Introduction to Cells.png | 2021-07-15 15:17 | 243K | |
| Islam Spreads banner.png | 2021-07-12 14:16 | 71K | |
| Islam expands.png | 2021-07-12 14:32 | 213K | |
| Ism.png | 2021-07-07 09:03 | 158K | |
| Italian unification.PNG | 2021-08-04 11:36 | 192K | |
| Italy Renassiance.png | 2021-07-23 08:29 | 339K | |
| Ivan.PNG | 2021-07-12 17:02 | 916K | |
| Ivan the Terrible.png | 2021-08-03 08:10 | 276K | |
| Jainism.PNG | 2021-07-07 09:07 | 954K | |
| Jamestown.PNG | 2021-08-02 10:21 | 729K | |
| Jannissary.PNG | 2021-07-23 12:15 | 615K | |
| Japan Returns to Isolation.PNG | 2021-07-23 15:13 | 314K | |
| Japan b.png | 2021-08-06 10:08 | 428K | |
| Japan b1.png | 2021-08-06 10:12 | 253K | |
| Japan banner.png | 2021-07-20 09:59 | 346K | |
| Japan isol.png | 2021-07-23 14:57 | 282K | |
| Japan to 1300.png | 2021-07-20 10:42 | 316K | |
| John Locke.PNG | 2021-08-03 09:28 | 451K | |
| Joint Stock Company.PNG | 2021-08-02 12:08 | 1.1M | |
| Judiams.png | 2021-07-07 10:24 | 71K | |
| Julius.PNG | 2021-07-08 14:44 | 865K | |
| Justian.PNG | 2021-07-12 16:25 | 954K | |
| Justianan Code.PNG | 2021-07-12 16:29 | 895K | |
| Kaiser.PNG | 2021-08-06 14:51 | 963K | |
| Karl MArx.PNG | 2021-08-04 16:32 | 682K | |
| Khelmer Empire Map.png | 2021-07-20 11:25 | 162K | |
| Khmer Empire.PNG | 2021-07-20 11:30 | 911K | |
| Kilogras and Grams.PNG | 2022-03-08 09:33 | 33K | |
| King Ezana.PNG | 2021-07-12 09:33 | 559K | |
| King Minos.PNG | 2021-07-07 10:05 | 702K | |
| Korean Kingdoms.PNG | 2021-07-20 11:40 | 919K | |
| Kublai.PNG | 2021-07-20 09:26 | 589K | |
| Laissez.PNG | 2021-08-04 16:24 | 548K | |
| Libeertrian Party.PNG | 2021-08-11 16:37 | 623K | |
| LifeScience/ | 2022-02-18 13:40 | - | |
| Life and Death of Stars.png | 2021-06-30 14:21 | 227K | |
| Life and Death of Stars Banner.png | 2021-06-30 14:14 | 310K | |
| Light Year.PNG | 2021-06-30 14:33 | 943K | |
| Light ray Banner.png | 2021-06-29 09:22 | 187K | |
| Line Pl,ots.PNG | 2022-03-08 12:30 | 149K | |
| Line Plots Practice.PNG | 2022-03-08 12:36 | 147K | |
| Lithospshere.PNG | 2021-07-01 09:06 | 318K | |
| Lois.png | 2021-08-02 13:22 | 381K | |
| Lois XIV.PNG | 2021-08-02 13:39 | 793K | |
| Long Division Word Problems.PNG | 2022-03-07 15:55 | 10K | |
| Lottery Elec.PNG | 2021-07-19 15:15 | 702K | |
| MIssissipiian.PNG | 2021-07-22 11:38 | 806K | |
| Machu Pichu.PNG | 2021-07-22 16:18 | 1.0M | |
| Maeia trh.PNG | 2021-08-02 15:35 | 1.0M | |
| Magnetic Field.png | 2021-06-29 16:44 | 293K | |
| Magnetic field banner.png | 2021-06-29 16:40 | 338K | |
| Magnetism.PNG | 2021-06-29 16:56 | 779K | |
| Magnetism banner.png | 2021-06-30 09:25 | 282K | |
| Magnets.PNG | 2021-06-29 16:58 | 636K | |
| Making a new nation banner.png | 2021-08-12 11:00 | 61K | |
| Manifest Destiny.PNG | 2021-08-05 11:01 | 964K | |
| Map.png | 2021-07-08 10:18 | 364K | |
| Marco Polo.PNG | 2021-07-20 09:19 | 1.0M | |
| Marty.PNG | 2021-08-03 12:30 | 719K | |
| Mass mesasure volume.PNG | 2022-03-08 09:50 | 886K | |
| Matching Times.PNG | 2022-03-09 10:21 | 33K | |
| Mauryan Empire.png | 2021-07-09 10:28 | 507K | |
| Max.PNG | 2021-08-03 13:07 | 1.0M | |
| Maya Banner.png | 2021-07-22 13:00 | 446K | |
| Maya City.png | 2021-07-22 13:08 | 258K | |
| Measurement Quiz.PNG | 2022-03-08 15:25 | 33K | |
| Measurement Workshop.PNG | 2022-03-08 15:52 | 35K | |
| Measuring.PNG | 2022-03-08 15:19 | 239K | |
| Measuring LEngth.PNG | 2022-03-07 18:03 | 256K | |
| Mecantalism.PNG | 2021-08-12 10:39 | 576K | |
| Mechanical Waves.PNG | 2021-06-28 13:05 | 897K | |
| Mehid.PNG | 2021-07-23 12:10 | 488K | |
| Meiosis.png | 2021-07-16 14:42 | 197K | |
| Mendle.png | 2021-07-16 15:48 | 135K | |
| Mesoamerican.png | 2021-07-12 11:03 | 391K | |
| Mesoamerican Timeline.PNG | 2021-07-12 11:23 | 321K | |
| Mesoamerican banner.png | 2021-07-12 13:38 | 431K | |
| Meters to Kilo.PNG | 2022-03-08 09:18 | 33K | |
| Metric unit.PNG | 2022-03-07 18:11 | 59K | |
| Mex.png | 2021-08-06 13:18 | 211K | |
| Mexican American War.PNG | 2021-08-06 13:39 | 897K | |
| Mexico Banner.png | 2021-08-06 12:55 | 237K | |
| Middle Passage.PNG | 2021-08-02 11:31 | 1.0M | |
| Midevil society banner.png | 2021-07-21 12:26 | 318K | |
| Migration.png | 2021-07-12 08:34 | 331K | |
| Migration Banner.png | 2021-07-12 08:26 | 421K | |
| Milky way banner.png | 2021-06-30 16:00 | 255K | |
| Minerals.PNG | 2021-07-01 14:14 | 433K | |
| Ming.png | 2021-07-23 14:36 | 328K | |
| Minoan Civililzation.PNG | 2021-07-07 09:54 | 933K | |
| Miranda Rights.PNG | 2021-08-12 15:33 | 613K | |
| Misssing digit Division.PNG | 2022-03-07 15:08 | 44K | |
| Monarchy.PNG | 2021-08-11 16:31 | 863K | |
| Mongol Conquest.png | 2021-07-19 16:49 | 281K | |
| Mongol Empire.png | 2021-07-19 16:43 | 359K | |
| Mongol Empire Banner.png | 2021-07-20 09:00 | 285K | |
| Mongol Empire Image.png | 2021-07-20 09:06 | 336K | |
| Monostaries.PNG | 2021-07-20 13:18 | 308K | |
| Monoth.PNG | 2021-07-07 10:33 | 303K | |
| Monothesim.PNG | 2021-07-07 10:33 | 303K | |
| Monroe Doct.PNG | 2021-08-06 11:22 | 1.1M | |
| Monster Stroll Fractions.PNG | 2022-03-08 13:19 | 130K | |
| Mouche Civilization.PNG | 2021-07-12 12:24 | 1.0M | |
| Mughual Empire.png | 2021-07-23 13:02 | 378K | |
| Muhammed.PNG | 2021-07-12 14:13 | 704K | |
| Multiples of 9.PNG | 2022-03-07 10:43 | 546K | |
| Multiplication Tables.PNG | 2022-03-07 12:38 | 69K | |
| Multiplication word problems.PNG | 2022-03-07 15:38 | 362K | |
| Muscular System.png | 2021-07-19 11:47 | 245K | |
| Mutation.png | 2021-07-19 10:51 | 138K | |
| NEWChemistry/ | 2022-03-30 12:44 | - | |
| NEWPhysics/ | 2022-01-25 09:35 | - | |
| NEWUSGovt/ | 2022-01-31 09:05 | - | |
| NTGeometry/ | 2021-10-25 09:43 | - | |
| Nap.png | 2021-08-03 13:31 | 224K | |
| Nap1.PNG | 2021-08-03 13:35 | 905K | |
| Nap Code.PNG | 2021-08-03 13:39 | 784K | |
| Nasca Lines.PNG | 2021-07-12 12:21 | 1.0M | |
| Nationalism.PNG | 2021-08-04 10:07 | 327K | |
| Nation states.PNG | 2021-08-04 10:13 | 879K | |
| Needs vs Wants.PNG | 2021-05-04 12:42 | 86K | |
| Neoclassicism.PNG | 2021-08-03 10:02 | 1.0M | |
| Nerous.png | 2021-07-19 12:11 | 306K | |
| New Deal Combined.pdf | 2021-08-13 09:59 | 633K | |
| New Federalism.PNG | 2021-08-13 10:06 | 775K | |
| New France.PNG | 2021-08-02 10:17 | 708K | |
| New Nation.png | 2021-08-12 11:08 | 299K | |
| New Neterland.PNG | 2021-08-02 10:24 | 1.0M | |
| Nigeria.png | 2021-08-05 12:27 | 163K | |
| Ninevh.PNG | 2021-07-07 12:31 | 701K | |
| North America.png | 2021-08-02 10:14 | 213K | |
| North America Banner.png | 2021-08-02 10:11 | 383K | |
| North American Societies.png | 2021-07-22 09:39 | 362K | |
| North American Societies 1.png | 2021-07-22 09:43 | 268K | |
| Northern Renassiance.png | 2021-07-23 09:18 | 300K | |
| Northern Renassiance Bannere.png | 2021-07-23 09:09 | 360K | |
| Oliver Creoim.PNG | 2021-08-03 08:50 | 585K | |
| Olmec Civilization.PNG | 2021-07-12 11:36 | 967K | |
| Olmec Civilization a.PNG | 2021-07-12 11:36 | 965K | |
| Opium wars.PNG | 2021-08-06 08:48 | 537K | |
| Ottoman Empire Video.PNG | 2021-07-23 12:04 | 954K | |
| P Party Banner.png | 2021-08-13 12:27 | 47K | |
| Pachacuit.PNG | 2021-07-22 16:15 | 1.0M | |
| Pages combined.pdf | 2021-08-12 13:28 | 1.7M | |
| Palestine.PNG | 2021-07-07 10:47 | 868K | |
| P and P Lines.PNG | 2022-03-09 12:51 | 17K | |
| Par and.PNG | 2022-03-09 12:59 | 78K | |
| Parrel Circuots.PNG | 2021-06-29 16:13 | 529K | |
| Patorism.PNG | 2021-07-20 08:39 | 820K | |
| Pax.PNG | 2021-07-20 08:24 | 414K | |
| Pax romana.PNG | 2021-07-08 14:49 | 1.0M | |
| Peace of Augusberg.PNG | 2021-07-23 10:11 | 724K | |
| Pearlism.png | 2021-08-06 11:01 | 278K | |
| Pelop War.PNG | 2021-07-08 09:03 | 1.1M | |
| Pensula war timeline.PNG | 2021-08-03 14:16 | 542K | |
| Peo War.PNG | 2021-07-19 15:22 | 1.0M | |
| Permieter Climber.PNG | 2022-03-09 14:37 | 34K | |
| Permieter of polygons.PNG | 2022-03-09 14:45 | 35K | |
| Persian Empire.png | 2021-07-07 13:20 | 286K | |
| Persian Empire Banner.png | 2021-07-07 13:14 | 375K | |
| Personal Fin Banner2.PNG | 2021-05-04 13:27 | 196K | |
| Personal Finanace Basic Cover.PNG | 2021-05-04 11:24 | 326K | |
| Personal Financial Literacy SE Final PDF.pdf | 2021-05-04 11:31 | 21M | |
| Peter the great.PNG | 2021-08-03 08:17 | 850K | |
| Phillip the II.PNG | 2021-08-02 13:10 | 670K | |
| Photon.png | 2021-06-29 08:35 | 453K | |
| Photon Banner.png | 2021-06-29 08:33 | 286K | |
| PhysicalScience/ | 2022-02-18 09:33 | - | |
| Physical and chemical weathering.PNG | 2021-07-01 16:30 | 308K | |
| Physics/ | 2021-11-01 10:13 | - | |
| Place Value.PNG | 2022-03-09 15:29 | 375K | |
| Plate.png | 2021-07-01 08:58 | 308K | |
| Plate tect.PNG | 2021-07-01 09:13 | 754K | |
| Platetectonics.png | 2021-07-01 08:51 | 298K | |
| Political PArty Functions.PNG | 2021-08-13 14:03 | 576K | |
| Pollution banner.png | 2021-07-02 14:41 | 210K | |
| Polygons game.PNG | 2022-03-09 13:11 | 47K | |
| Pompeii.PNG | 2021-07-09 09:23 | 910K | |
| Popol VFuh.PNG | 2021-07-22 13:44 | 1.0M | |
| Postwar.png | 2021-08-09 09:41 | 346K | |
| Postwar banne.png | 2021-08-09 09:20 | 221K | |
| Potential Difference.PNG | 2021-06-29 14:27 | 878K | |
| PreAlgebra/ | 2021-09-16 12:11 | - | |
| Product Game.PNG | 2022-03-07 11:23 | 79K | |
| Progressive Era.PNG | 2021-08-13 11:02 | 790K | |
| ProjectBanner.jpg | 2021-12-02 16:35 | 63K | |
| Protein Synthesis.png | 2021-07-19 09:49 | 280K | |
| Protestant Reformation.PNG | 2021-07-23 10:06 | 1.0M | |
| Punic Wars.PNG | 2021-07-08 14:17 | 707K | |
| Push and Pull.PNG | 2021-07-12 08:53 | 641K | |
| Pyramid.png | 2021-08-03 16:36 | 69K | |
| Qin Dynasty.PNG | 2021-07-07 14:34 | 554K | |
| Qing Dynasty.PNG | 2021-07-23 14:47 | 1.1M | |
| Quasar.PNG | 2021-06-30 15:45 | 900K | |
| Queen V.PNG | 2021-08-05 08:59 | 1.0M | |
| Rate of Photosynthesis Lab (1).pdf | 2021-08-02 08:58 | 50K | |
| Read a Theeromoeter.PNG | 2022-03-09 11:22 | 21K | |
| Real and Virtual Images.PNG | 2021-06-29 10:13 | 317K | |
| Realism.PNG | 2021-08-04 12:16 | 1.0M | |
| Recyvle.png | 2021-07-02 14:44 | 372K | |
| Red Giants.PNG | 2021-06-30 14:37 | 550K | |
| Reflection of Color.PNG | 2021-06-29 09:19 | 677K | |
| Reflection of light.PNG | 2021-06-29 10:11 | 216K | |
| Reformation.png | 2021-07-23 10:02 | 212K | |
| Reformation 1 Banner.png | 2021-07-23 10:29 | 346K | |
| Reformation Banner.png | 2021-07-23 09:51 | 342K | |
| Refraction of light.png | 2021-06-29 11:19 | 134K | |
| Refraction of light banner.png | 2021-06-29 11:17 | 80K | |
| Refraction part 2.PNG | 2021-06-29 11:36 | 162K | |
| Refreation part 1.PNG | 2021-06-29 11:34 | 160K | |
| Refridgerantr.PNG | 2021-06-28 12:00 | 216K | |
| Refv1.png | 2021-08-04 12:01 | 102K | |
| Regan Revolution.PNG | 2021-08-13 10:10 | 385K | |
| Reigfn.png | 2021-08-02 13:28 | 388K | |
| Reign of terror.PNG | 2021-08-03 13:10 | 1.1M | |
| Renassiance Banner.png | 2021-07-23 08:24 | 463K | |
| Resources.PNG | 2021-07-02 14:18 | 553K | |
| Respiratory System.png | 2021-07-19 13:21 | 341K | |
| Rev French.png | 2021-08-03 13:01 | 331K | |
| Revo in Art.png | 2021-08-04 12:06 | 189K | |
| Revolution.png | 2021-08-04 11:59 | 76K | |
| Rhodes.PNG | 2021-07-08 13:16 | 1.1M | |
| Richard the Lionheart.PNG | 2021-07-21 11:59 | 867K | |
| Richter Scale.PNG | 2021-07-01 10:40 | 1.0M | |
| Rise and Fall of Mongol Rule.PNG | 2021-07-20 09:28 | 805K | |
| Rise of Islam Banner.png | 2021-07-12 13:22 | 52K | |
| Rocks Minerals abnner.png | 2021-07-01 13:27 | 432K | |
| Rocks and Minderals.png | 2021-07-01 13:49 | 404K | |
| Roman Government.PNG | 2021-07-09 09:26 | 1.0M | |
| Roman Republic Banner.png | 2021-07-08 13:46 | 323K | |
| Romantism.PNG | 2021-08-04 12:11 | 486K | |
| Roots of American Government.png | 2021-08-11 16:50 | 175K | |
| Roots of American Government bannner.png | 2021-08-11 16:44 | 364K | |
| Ruddian Empire Banner.png | 2021-07-12 16:38 | 33K | |
| Russai Banner.png | 2021-08-02 16:08 | 271K | |
| Russification.PNG | 2021-08-04 11:20 | 784K | |
| SOcrates Plato Aristo.PNG | 2021-07-08 09:09 | 436K | |
| SSRubric.pdf | 2021-11-22 14:14 | 1.1M | |
| Safavid Empire Video.PNG | 2021-07-23 12:44 | 833K | |
| Safavid empir.png | 2021-07-23 12:39 | 202K | |
| Safavid empire banner.png | 2021-07-23 12:31 | 175K | |
| Sahel.PNG | 2021-07-09 14:01 | 1.1M | |
| Saladin.PNG | 2021-07-21 11:55 | 769K | |
| SalsSubShop.PNG | 2022-03-08 15:14 | 125K | |
| Scorched Earth Polixy.PNG | 2021-08-03 14:19 | 827K | |
| Seafaring Traders.png | 2021-07-07 09:48 | 363K | |
| Seasosn.PNG | 2021-07-02 12:50 | 528K | |
| Seculareism.PNG | 2021-07-23 08:40 | 601K | |
| Separation of Powers.PNG | 2021-08-12 12:11 | 910K | |
| Sepoy United.PNG | 2021-08-05 14:16 | 252K | |
| Series Circuits.PNG | 2021-06-29 16:17 | 406K | |
| Shah.PNG | 2021-07-23 12:46 | 601K | |
| Shah Jahan.PNG | 2021-07-23 13:21 | 835K | |
| Shapping a new nation.PNG | 2021-08-12 10:33 | 626K | |
| Shays.PNG | 2021-08-12 11:16 | 852K | |
| Shintoism.PNG | 2021-07-20 10:49 | 950K | |
| Shogun.PNG | 2021-07-20 10:54 | 588K | |
| Shogunate.PNG | 2021-07-23 15:17 | 642K | |
| Siddhartha.PNG | 2021-07-07 09:20 | 958K | |
| Simon Bol.PNG | 2021-08-03 16:41 | 1.1M | |
| Slavs vs vikings.PNG | 2021-07-12 16:50 | 679K | |
| Slinky demo.PNG | 2021-06-28 13:10 | 760K | |
| Slk roads.PNG | 2021-07-09 11:37 | 524K | |
| Social Classes.PNG | 2021-07-08 14:11 | 198K | |
| Social Contact Theory.PNG | 2021-08-11 16:57 | 820K | |
| Social Darwinism.PNG | 2021-08-05 11:55 | 782K | |
| Society.png | 2021-07-09 13:57 | 220K | |
| Solenoid.PNG | 2021-06-30 09:39 | 278K | |
| Song Dynasty.PNG | 2021-07-19 16:21 | 1.0M | |
| Sound Waves and Hearing.PNG | 2021-06-28 16:42 | 523K | |
| Sound wave.png | 2021-06-28 16:04 | 118K | |
| Soundwaves banner.png | 2021-06-28 16:01 | 350K | |
| South America Banner.png | 2021-08-02 10:04 | 370K | |
| South east asia.PNG | 2021-08-05 14:22 | 1.0M | |
| Southeast asia banner.png | 2021-07-20 11:14 | 321K | |
| Spain Builds an Empire Banner.png | 2021-08-02 09:16 | 353K | |
| Spain Empire Builds.png | 2021-08-02 09:35 | 174K | |
| Spanish/ | 2022-01-10 14:52 | - | |
| Spanish American War.PNG | 2021-08-06 11:26 | 565K | |
| Sparta banner.png | 2021-07-08 08:15 | 297K | |
| Stamp Act Congress.PNG | 2021-08-12 10:42 | 381K | |
| Standard form.PNG | 2022-03-09 15:32 | 601K | |
| State Constitutions.PNG | 2021-08-13 10:59 | 1.0M | |
| State and Local.pdf | 2021-08-13 10:37 | 1.1M | |
| State and Local Govt.png | 2021-08-13 10:55 | 173K | |
| State and local government banner.png | 2021-08-13 10:49 | 290K | |
| Stratoshhere.PNG | 2021-07-02 09:48 | 718K | |
| Structure.PNG | 2021-07-09 12:20 | 248K | |
| Subtraction.PNG | 2022-03-07 17:10 | 270K | |
| Suez canal.PNG | 2021-08-05 13:33 | 745K | |
| Suffrage movement.PNG | 2021-08-12 16:34 | 660K | |
| Supremamcy Clause.PNG | 2021-08-13 09:12 | 356K | |
| Symmerty.PNG | 2022-03-09 13:24 | 338K | |
| Sys.PNG | 2021-08-13 09:07 | 257K | |
| Taiping Reb.PNG | 2021-08-06 08:55 | 206K | |
| Tamil Language.PNG | 2021-07-09 10:53 | 1.0M | |
| Tang and Song.png | 2021-07-19 16:10 | 143K | |
| Temp.png | 2021-06-28 09:58 | 202K | |
| Temperature.PNG | 2022-03-09 10:10 | 569K | |
| Temperature.png | 2021-06-28 09:56 | 175K | |
| Temperature Banner.png | 2021-06-28 09:54 | 451K | |
| Tennis Court OAth.PNG | 2021-08-03 12:33 | 698K | |
| Terrestrial Planets.PNG | 2021-06-30 12:18 | 795K | |
| The American Revolution.png | 2021-08-03 10:19 | 460K | |
| The American Revolution banner.png | 2021-08-03 10:12 | 334K | |
| The Atlantic Slave Trade.png | 2021-08-02 10:49 | 200K | |
| The Aztecx.PNG | 2021-07-22 14:39 | 1.2M | |
| The Chavin Culture.PNG | 2021-07-12 12:14 | 755K | |
| The Civil War Amendments.PNG | 2021-08-12 16:30 | 954K | |
| The Council of trrebt.PNG | 2021-07-23 10:43 | 501K | |
| The Crusades.PNG | 2021-07-21 12:12 | 883K | |
| The Daimyo.PNG | 2021-07-23 15:36 | 826K | |
| The Declaration of Independencer.PNG | 2021-08-03 10:51 | 909K | |
| The Dorian INvasion.PNG | 2021-07-07 16:37 | 1.0M | |
| The English Civil War.PNG | 2021-08-03 08:45 | 760K | |
| The French Revolution Banner.png | 2021-08-03 11:20 | 240K | |
| The French Revolution begins.PNG | 2021-08-03 12:38 | 1.0M | |
| The Great War.png | 2021-08-06 14:34 | 239K | |
| The Magna Carta.PNG | 2021-07-21 15:13 | 451K | |
| The Milky Way.png | 2021-06-30 15:32 | 233K | |
| The Ming Dynasty.PNG | 2021-07-23 14:40 | 970K | |
| The Missouri plan.PNG | 2021-08-13 11:06 | 355K | |
| The Moon.PNG | 2021-06-30 11:11 | 676K | |
| The Mughal Empire.png | 2021-07-23 13:07 | 302K | |
| The Myceaeans.PNG | 2021-07-07 16:33 | 792K | |
| The New Kingdom.PNG | 2021-07-07 11:31 | 1.0M | |
| The Northern Ren.PNG | 2021-07-23 09:30 | 917K | |
| The Persian Empire.PNG | 2021-07-07 13:27 | 1.0M | |
| The Persian Wars.PNG | 2021-07-08 08:30 | 337K | |
| The Photon.PNG | 2021-06-29 08:44 | 609K | |
| The Rise of Islam.png | 2021-07-12 13:31 | 318K | |
| The Roman.png | 2021-07-08 14:38 | 289K | |
| The Roman Empire.png | 2021-07-08 14:34 | 161K | |
| The Roman Republic.png | 2021-07-08 14:04 | 288K | |
| The Skeletal System.png | 2021-07-19 11:35 | 456K | |
| The Sun.PNG | 2021-06-30 11:05 | 906K | |
| The Tang Dynasty.PNG | 2021-07-19 16:17 | 1.0M | |
| The Texas Revolution.PNG | 2021-08-06 13:27 | 1.1M | |
| The Tropospher.PNG | 2021-07-02 09:44 | 564K | |
| The balkans.PNG | 2021-08-04 10:23 | 566K | |
| The generator Effect.PNG | 2021-06-30 10:18 | 552K | |
| Theocraccy.PNG | 2021-07-23 10:46 | 56K | |
| Thermal Conduction.PNG | 2021-06-28 11:22 | 483K | |
| Thermoeters.PNG | 2021-06-28 10:08 | 352K | |
| Thomas Aquanis.PNG | 2021-07-21 13:27 | 734K | |
| Three field System.PNG | 2021-07-21 13:03 | 674K | |
| Thurmose III.PNG | 2021-07-07 11:37 | 1.1M | |
| Tic Toe Tac.PNG | 2022-03-07 14:13 | 58K | |
| Tikal.PNG | 2021-07-22 13:40 | 1.0M | |
| Time Hunter.PNG | 2022-03-09 10:38 | 287K | |
| Totalataiamims.PNG | 2021-08-11 16:33 | 929K | |
| Transatlantic.png | 2021-08-02 11:02 | 179K | |
| Transatlantic slave trade.PNG | 2021-08-02 11:04 | 798K | |
| Treaty.PNG | 2021-07-23 14:15 | 1.0M | |
| Treaty of Kand.PNG | 2021-08-06 10:22 | 326K | |
| Triangfular Trade.PNG | 2021-08-02 11:09 | 606K | |
| Triple Entene.PNG | 2021-08-06 14:46 | 353K | |
| Tripple Alliance.PNG | 2021-08-06 14:39 | 806K | |
| Trojan Horse.png | 2021-07-07 16:12 | 353K | |
| Trojan war.PNG | 2021-07-07 16:29 | 1.1M | |
| Trojan war banner.png | 2021-07-07 16:02 | 302K | |
| Truman Doc.PNG | 2021-08-09 09:51 | 445K | |
| Turkish banner.png | 2021-07-15 09:24 | 191K | |
| Two American.png | 2021-08-13 14:43 | 69K | |
| Two Step.PNG | 2022-03-07 16:31 | 17K | |
| Two Step Word.PNG | 2022-03-08 11:32 | 20K | |
| Types of Faults.PNG | 2021-07-01 09:16 | 295K | |
| Types of Waves.png | 2021-06-28 12:33 | 311K | |
| Types of Waves 1.png | 2021-06-28 12:58 | 111K | |
| US Const.png | 2021-08-12 11:59 | 290K | |
| USGovt/ | 2021-11-23 12:51 | - | |
| USHistory/ | 2022-01-19 16:25 | - | |
| Ultrasound.PNG | 2021-06-28 16:32 | 448K | |
| Umyaad.PNG | 2021-07-12 14:35 | 1.0M | |
| Unit 2.PNG | 2021-05-04 15:09 | 46K | |
| Unit 2 Lesson 1 From Sea to Sea Apply.pdf | 2021-07-28 15:35 | 1.4M | |
| Unit 2 Lesson 2 Our Country's Regions Apply.pdf | 2021-07-28 15:35 | 524K | |
| Unit_3_Test_Combined Part.pdf | 2021-07-08 12:35 | 1.0M | |
| Unit_4_Test_Combined-13-2.pdf | 2021-08-11 10:18 | 9.1M | |
| Unit_4_Test_Combined-13-Student.pdf | 2021-08-02 17:08 | 9.1M | |
| United Nations.PNG | 2021-08-09 09:47 | 1.0M | |
| Units of Measurements.PNG | 2022-03-08 15:32 | 233K | |
| Universe.png | 2021-06-30 16:06 | 307K | |
| Untitled Combined.pdf | 2021-08-13 09:00 | 644K | |
| Untitled political parties.pdf | 2021-08-13 13:55 | 551K | |
| UpdateProfile.htm | 2022-10-29 06:59 | 16K | |
| Us Population.PNG | 2021-08-12 09:24 | 134K | |
| Using Heat.png | 2021-06-28 11:57 | 806K | |
| Vid1.PNG | 2021-06-01 14:09 | 442K | |
| Video of alexander.PNG | 2021-07-08 12:15 | 772K | |
| Vishnu.PNG | 2021-07-09 11:30 | 1.1M | |
| Volcano Banner.png | 2021-07-01 10:03 | 308K | |
| Voltage vs Current.PNG | 2021-06-29 14:23 | 344K | |
| Voltaire.PNG | 2021-08-03 09:31 | 902K | |
| Voting Banner.png | 2021-10-14 13:08 | 383K | |
| WLN.PNG | 2021-06-28 13:59 | 839K | |
| War Spanish Succession.PNG | 2021-08-02 13:45 | 249K | |
| Warring States.png | 2021-07-08 08:19 | 358K | |
| Warsaw pact.PNG | 2021-08-09 09:56 | 849K | |
| Water Acids and Bases.png | 2021-07-15 14:45 | 138K | |
| Water and Wind Banner.png | 2021-07-02 10:53 | 192K | |
| Watercycle.PNG | 2021-07-02 11:31 | 938K | |
| Water cycle.png | 2021-07-02 11:04 | 226K | |
| Waterloo.PNG | 2021-08-03 14:10 | 841K | |
| Watts steam engine.PNG | 2021-08-04 14:05 | 968K | |
| Wave Intensisty.PNG | 2021-06-29 08:47 | 438K | |
| Wave Reflections.PNG | 2021-06-28 15:40 | 510K | |
| Wave Refraction.PNG | 2021-06-28 15:42 | 445K | |
| Waves Banner.png | 2021-06-28 13:47 | 208K | |
| Weather Fronts.PNG | 2021-07-02 12:43 | 369K | |
| Weather banner.png | 2021-07-02 12:21 | 231K | |
| Weather climate.png | 2021-07-02 12:11 | 190K | |
| Weather climate1.png | 2021-07-02 12:18 | 302K | |
| Weathering.PNG | 2021-07-01 14:23 | 750K | |
| Weathering and Eroision.png | 2021-07-01 16:04 | 256K | |
| Western Civilization.png | 2021-07-09 08:57 | 537K | |
| Western Civilization banner.png | 2021-07-09 08:53 | 329K | |
| Westernmizing Russia.PNG | 2021-08-03 08:23 | 241K | |
| What are Political Party.PNG | 2021-08-13 13:59 | 1.1M | |
| What happens in a mosque.PNG | 2021-07-12 14:10 | 926K | |
| What is Dew Point.PNG | 2021-07-02 11:42 | 919K | |
| What is Heat.PNG | 2021-06-28 10:15 | 649K | |
| What is Nebula.PNG | 2021-06-30 13:11 | 1.1M | |
| What is Redshift.PNG | 2021-06-30 16:15 | 375K | |
| What is a Bishop.PNG | 2021-07-08 15:44 | 1.0M | |
| What is geopoltics.PNG | 2021-08-05 13:03 | 1.1M | |
| White Logo (1) (1).pdf | 2021-07-20 09:15 | 241K | |
| Who were First Americans.PNG | 2021-07-12 10:32 | 940K | |
| Why Do People Migrate.PNG | 2021-07-12 09:01 | 721K | |
| William Sha.PNG | 2021-07-23 09:38 | 530K | |
| William the Conquerer.PNG | 2021-07-21 15:03 | 1.1M | |
| Winston Churchill.PNG | 2021-08-09 09:07 | 831K | |
| Word History.png | 2021-07-14 15:09 | 264K | |
| Word Steph Multi.PNG | 2022-03-07 15:22 | 36K | |
| WorldHist/ | 2022-02-22 17:13 | - | |
| WorldHistoryIntro.mp4 | 2021-07-14 15:06 | 16M | |
| World History banner.png | 2021-07-14 12:32 | 375K | |
| Wu Zertin.PNG | 2021-07-19 16:36 | 1.0M | |
| Yellow Button.png | 2021-07-14 13:15 | 37K | |
| ZHOU MAP.png | 2021-07-07 14:14 | 100K | |
| Zapotechs.PNG | 2021-07-12 11:41 | 1.2M | |
| Zheng He.PNG | 2021-07-23 14:43 | 1.2M | |
| Zhou Dynasty banner.png | 2021-07-07 13:50 | 398K | |
| Zoraster.PNG | 2021-07-07 13:39 | 554K | |
| abbasids.PNG | 2021-07-12 14:45 | 1.0M | |
| absolute monatch.PNG | 2021-08-02 13:14 | 721K | |
| agricultutral rev.PNG | 2021-08-04 13:37 | 824K | |
| andes civilization.png | 2021-07-12 12:06 | 281K | |
| andes civilization 1.png | 2021-07-12 12:10 | 348K | |
| angleican.PNG | 2021-07-23 10:19 | 589K | |
| assyryia.png | 2021-07-07 11:59 | 382K | |
| atompshere.png | 2021-07-02 09:19 | 169K | |
| battle of brittian.PNG | 2021-08-09 09:12 | 1.0M | |
| bill.png | 2021-08-12 15:56 | 423K | |
| bio.png | 2021-07-13 12:17 | 361K | |
| british.png | 2021-08-05 14:29 | 114K | |
| building the canal.png | 2021-08-06 11:14 | 183K | |
| cHROMO.png | 2021-07-16 14:04 | 249K | |
| caligraphy.png | 2021-07-12 14:59 | 198K | |
| caligraphy banner.png | 2021-07-12 14:54 | 245K | |
| cathedrals banner.png | 2021-07-21 11:41 | 475K | |
| collspdr.png | 2021-08-03 13:57 | 325K | |
| columbian exchange.png | 2021-08-02 11:55 | 136K | |
| concurrent powers.PNG | 2021-08-13 09:22 | 711K | |
| const banner.png | 2021-08-12 12:05 | 357K | |
| diceoltin.PNG | 2021-07-08 16:14 | 945K | |
| direct and ineirect.PNG | 2021-08-11 17:00 | 659K | |
| dr party banner.png | 2021-08-13 14:21 | 444K | |
| e and n Empires.png | 2021-07-07 11:26 | 286K | |
| earth.PNG | 2021-06-30 11:13 | 352K | |
| electric charge banner.png | 2021-06-29 12:12 | 271K | |
| electric energy.PNG | 2021-06-29 16:09 | 520K | |
| electro.png | 2021-06-30 09:33 | 152K | |
| enerfgy.png | 2021-07-02 14:11 | 249K | |
| enlight.png | 2021-08-03 09:21 | 398K | |
| enlightmnent banner.png | 2021-08-03 09:15 | 467K | |
| esic of names.PNG | 2021-08-02 13:36 | 1.0M | |
| europe.png | 2021-08-04 09:06 | 410K | |
| europe plunges.png | 2021-08-05 10:33 | 184K | |
| europe rev.png | 2021-08-04 09:09 | 328K | |
| france invades mexico.PNG | 2021-08-06 13:31 | 151K | |
| han Empor.png | 2021-07-09 11:42 | 323K | |
| han EmporA.png | 2021-07-09 11:50 | 194K | |
| hindo.png | 2021-07-07 08:56 | 308K | |
| humanism.PNG | 2021-07-23 08:35 | 367K | |
| ienna banner.png | 2021-08-03 14:37 | 301K | |
| images.jpg | 2021-07-19 16:41 | 9.4K | |
| impact of ind.PNG | 2021-08-04 15:31 | 864K | |
| imperalism.PNG | 2021-08-04 12:23 | 463K | |
| industrialization.png | 2021-08-04 14:34 | 252K | |
| industrisl britisn.PNG | 2021-08-04 13:15 | 881K | |
| industr spread.png | 2021-08-04 15:43 | 239K | |
| ivan.PNG | 2021-08-03 08:14 | 532K | |
| japan isolation banner.png | 2021-07-23 14:55 | 227K | |
| judism banner.png | 2021-07-07 10:29 | 222K | |
| latin america banner.png | 2021-08-03 16:27 | 373K | |
| magentism.png | 2021-06-30 09:36 | 295K | |
| mercantaliosm.PNG | 2021-08-02 12:33 | 578K | |
| miguel.PNG | 2021-08-03 16:46 | 969K | |
| ming dynbasty banner.png | 2021-07-23 14:29 | 478K | |
| mountain Empire.png | 2021-07-22 16:08 | 263K | |
| mughal emperor.PNG | 2021-07-23 13:18 | 432K | |
| multiples of 6.PNG | 2022-03-07 11:16 | 37K | |
| mutliples 7.PNG | 2022-03-07 11:33 | 34K | |
| nap banmner.png | 2021-08-03 13:53 | 246K | |
| napolean.png | 2021-08-03 13:28 | 386K | |
| nationalism1.png | 2021-08-04 11:02 | 47K | |
| nationalism 2.png | 2021-08-04 11:17 | 104K | |
| opium war.png | 2021-08-05 16:26 | 264K | |
| ott.PNG | 2021-07-23 12:57 | 837K | |
| ottoman empire.png | 2021-07-23 11:56 | 305K | |
| ottoman empire banner.png | 2021-07-23 11:53 | 354K | |
| po9lotical theroy.PNG | 2021-08-03 09:35 | 632K | |
| p part.png | 2021-08-13 13:50 | 121K | |
| pre.PNG | 2021-07-14 16:36 | 2.3K | |
| publeo indians.PNG | 2021-07-22 11:45 | 484K | |
| quez.PNG | 2021-07-22 14:33 | 1.0M | |
| reflection of light 1.png | 2021-06-29 10:36 | 229K | |
| reform.png | 2021-08-05 08:48 | 74K | |
| reform Bill of 1832.PNG | 2021-08-05 10:17 | 949K | |
| refraction of wave.PNG | 2021-06-29 11:29 | 445K | |
| rise of Macedonia.PNG | 2021-07-08 12:15 | 1.0M | |
| roevelt.PNG | 2021-08-06 12:45 | 566K | |
| russian empire.png | 2021-07-12 16:40 | 93K | |
| russo Jappanese war.PNG | 2021-08-06 10:33 | 235K | |
| scramble for Africa.png | 2021-08-05 11:49 | 123K | |
| sog.png | 2021-07-19 16:13 | 336K | |
| solar.png | 2021-06-30 13:03 | 227K | |
| solar System.png | 2021-06-30 12:59 | 275K | |
| solar system 2.png | 2021-06-30 12:59 | 318K | |
| spanish under mexican rule.PNG | 2021-08-03 16:54 | 337K | |
| spread banner.png | 2021-08-04 15:37 | 372K | |
| suez cannal banner.png | 2021-08-05 12:49 | 273K | |
| the Big Bang theory.PNG | 2021-06-30 16:13 | 697K | |
| the Gas Giants.PNG | 2021-06-30 12:23 | 550K | |
| the universe banner.png | 2021-06-30 16:04 | 233K | |
| urbanizations.PNG | 2021-08-04 14:38 | 853K | |
| vasco da gama.PNG | 2021-07-23 14:19 | 567K | |
| war and expan.png | 2021-08-05 10:42 | 280K | |
| war and expansion1.png | 2021-08-05 10:56 | 251K | |
| waves.png | 2021-06-28 15:38 | 206K | |
| weather and ewroision banner.png | 2021-07-01 15:54 | 390K | |
| world war banner.png | 2021-08-06 14:22 | 350K | |
