![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[VID]](/icons/movie.gif) | 3 Main Types of Rocks.mp4 | 2025-02-05 14:13 | 66M | |
| 5 most important organs in the Human body - Human Anatomy Kenhub.mp4 | 2025-01-27 17:02 | 8.4M | |
| A Year of Life Science in 3 Minutes.mp4 | 2025-01-15 11:52 | 63M | |
| All of Biology in 9 minutes.mp4 | 2025-01-15 11:52 | 70M | |
| Anaerobic respiration by yeast – fermentation Physiology Biology FuseSchool.mp4 | 2025-01-22 14:14 | 15M | |
| Angiosperms and gymnosperms - Logos Academy.mp4 | 2025-01-27 14:10 | 23M | |
| Are your traits dominant.mp4 | 2025-01-22 14:45 | 4.8M | |
| Arteries vs Veins ( Circulatory System ).mp4 | 2025-01-28 09:44 | 5.8M | |
| Asexual and Sexual Reproduction.mp4 | 2025-01-28 10:00 | 9.3M | |
| Autosomal Recessive Inheritance - Genetics.mp4 | 2025-01-22 14:45 | 14M | |
| Body Cavities - Body Cavity Anatomy - Major Body Cavities.mp4 | 2025-01-27 15:18 | 6.1M | |
| Body Cavities - Drawn Defined.mp4 | 2025-01-27 15:23 | 7.7M | |
| Cardiovascular System Overview, Animation.mp4 | 2025-01-28 09:44 | 8.3M | |
| Catastrophism vs Uniformitarianism.mp4 | 2025-01-27 12:13 | 36M | |
| Cell Biology Cell Organelles explained in 5 minutes.mp4 | 2025-01-22 13:57 | 12M | |
| Cell Differentiation Genetics Biology FuseSchool.mp4 | 2025-01-27 15:19 | 17M | |
| Cell membrane-Structure and Function.mp4 | 2025-01-22 15:08 | 19M | |
| Cell organelles their functions.mp4 | 2025-01-22 15:08 | 64M | |
| Cells Tissues Organs Organ Systems.mp4 | 2025-01-27 17:02 | 11M | |
| Cellular Respiration.mp4 | 2025-01-22 14:14 | 5.2M | |
| Characteristics of Living Organisms - MRS GREN.mp4 | 2025-01-15 11:45 | 11M | |
| Characteristics of Living Things-What makes something alive.mp4 | 2025-01-22 12:49 | 35M | |
| Chordates - CrashCourse Biology 24.mp4 | 2025-01-27 15:20 | 147M | |
| Classification of Living Things.mp4 | 2025-01-27 13:16 | 11M | |
| Continental Drift.mp4 | 2025-01-27 13:00 | 56M | |
![[IMG]](/icons/image2.gif) | Copy of Goal Setting(1).png | 2025-01-29 11:03 | 684K | |
| Dig In To Paleontology.mp4 | 2025-01-27 12:13 | 37M | |
| Domains and Kingdoms.mp4 | 2025-01-27 13:16 | 20M | |
| Domains and Kingdoms of life.mp4 | 2025-01-27 13:16 | 4.8M | |
| ELECTROMAGNETIC SPECTRUM SONG Science Music Video.mp4 | 2025-01-22 13:29 | 12M | |
| Electron Configuration - Basic introduction.mp4 | 2025-01-24 16:58 | 12M | |
| Electron Configuration Diagrams Properties of Matter Chemistry FuseSchool.mp4 | 2025-01-24 16:46 | 8.4M | |
| Evidence for Evolution.mp4 | 2025-01-27 13:06 | 20M | |
| Extinction of Species Evolution Biology FuseSchool.mp4 | 2025-01-27 13:06 | 5.8M | |
| Fossil Record Mystery National Geographic.mp4 | 2025-01-27 13:06 | 18M | |
| Fossils 101 National Geographic.mp4 | 2025-01-27 12:59 | 61M | |
| Fossils Evidence For Evolution Evolution Biology FuseSchool.mp4 | 2025-01-27 12:12 | 11M | |
| Geology Bowens Reaction Series.mp4 | 2025-02-05 14:13 | 77M | |
| Goal Setting.png | 2025-01-29 09:37 | 467K | |
| Gymnosperms Long-Distance Pollination.mp4 | 2025-01-27 14:11 | 61M | |
| Heredity- Why you look the way you do.mp4 | 2025-01-22 14:46 | 6.5M | |
| Heredity Who Are You Science Trek.mp4 | 2025-01-22 18:09 | 80M | |
| Homeostasis Feedback Mechanisms.mp4 | 2025-01-28 09:51 | 5.8M | |
| How Are Organisms Classified Evolution Biology FuseSchool.mp4 | 2025-01-27 13:16 | 7.1M | |
| How Do Fossils Form Evolution Biology FuseSchool.mp4 | 2025-01-27 12:59 | 5.6M | |
| How Does Radiometric Dating Work Ars Technica.mp4 | 2025-01-27 12:12 | 43M | |
| How your muscular system works - Emma Bryce.mp4 | 2025-01-27 17:02 | 22M | |
| Human Body 101 National Geographic.mp4 | 2025-01-28 09:32 | 41M | |
| Igneous Rocks.mp4 | 2025-02-05 14:13 | 12M | |
| Index Fossils.mp4 | 2025-01-27 12:59 | 13M | |
| Introduction to The Brain Physiology Biology FuseSchool.mp4 | 2025-01-28 09:52 | 16M | |
| Invertebrates The Dr. Binocs Show Learn Videos For Kids.mp4 | 2025-01-27 15:18 | 27M | |
| Killer T cell attacking cancer.mp4 | 2025-01-22 14:14 | 6.0M | |
| LAB SAFETY Video - I Think School.com.mp4 | 2025-01-15 11:52 | 14M | |
| Living and Non-living Things for Kids Learn why some things are alive and others are not.mp4 | 2025-01-22 13:30 | 130M | |
| Mass Extinctions.mp4 | 2025-01-27 12:13 | 111M | |
| Maya Kings and Cities.png | 2025-02-03 10:41 | 947K | |
| Meiosis (Updated).mp4 | 2025-01-22 14:45 | 13M | |
| Metamorphic Rocks.mp4 | 2025-02-05 14:12 | 5.7M | |
| Mitosis vs Meiosis Rap Battle SCIENCE SONGS.mp4 | 2025-01-22 14:46 | 37M | |
| Nucleus Cell Infinity Learn.mp4 | 2025-01-22 15:08 | 11M | |
| PLANT GROWTH AND RESPONSES 1.mp4 | 2025-01-27 14:48 | 5.9M | |
| Parts of Flower Pollination Video Video for Kids.mp4 | 2025-01-27 14:10 | 21M | |
| Phanerozoic Eon Geologic Time Scale with events.mp4 | 2025-01-27 12:59 | 18M | |
| Photosynthesis.mp4 | 2025-01-22 14:14 | 4.8M | |
| Plant Processes.mp4 | 2025-01-27 14:47 | 22M | |
| Plant Reproduction in Angiosperms.mp4 | 2025-01-27 14:10 | 15M | |
| Producers, Consumers, Decomposers.mp4 | 2025-01-27 15:18 | 10M | |
| Prokaryotic Vs. Eukaryotic Cells.mp4 | 2025-01-22 13:57 | 6.3M | |
| Prokaryotic vs. Eukaryotic Cells (Updated)-1.mp4 | 2025-01-22 15:08 | 12M | |
| Prokaryotic vs. Eukaryotic Cells (Updated).mp4 | 2025-01-22 13:57 | 12M | |
| Reflection of Light Dont Memorise.mp4 | 2025-01-22 13:30 | 5.5M | |
| Refraction and Diffraction (The Bending Of Light).mp4 | 2025-01-22 13:30 | 21M | |
| Relationship between Photosynthesis and Cellular Respiration.mp4 | 2025-01-27 14:48 | 35M | |
| Relative Dating.mp4 | 2025-01-27 12:12 | 13M | |
| Relative Dating vs Absolute Dating (Updated).mp4 | 2025-01-27 12:12 | 28M | |
| Reproductive System - The InfluenSir.mp4 | 2025-01-28 10:00 | 7.0M | |
| Reproductive Systems.mp4 | 2025-01-28 10:00 | 8.1M | |
| Respiratory System - How The Respiratory System Works.mp4 | 2025-01-28 09:44 | 9.8M | |
| Scientific Models.mp4 | 2025-01-15 11:52 | 6.8M | |
| Sedimentary Rocks.mp4 | 2025-02-05 14:12 | 15M | |
| Seed Plants Biology Botany.mp4 | 2025-01-27 14:10 | 10M | |
| Seedless Plants Vs. Seed Plants.mp4 | 2025-01-27 14:11 | 65M | |
| Sexual Reproduction In Flowering Plants.mp4 | 2025-01-27 14:48 | 20M | |
| Skeletal System Human Skeleton.mp4 | 2025-01-27 17:02 | 9.5M | |
| Stages Of Human Growth And Development.mp4 | 2025-01-28 10:00 | 51M | |
| Structure Of The Small Intestine - Functions Of The Small Intestine - What Are Villi.mp4 | 2025-01-27 15:19 | 11M | |
| Structure of the nervous system Organ Systems MCAT Khan Academy.mp4 | 2025-01-28 09:51 | 21M | |
| Structures and Functions of Living Organisms (Animals).mp4 | 2025-01-27 13:41 | 20M | |
| THE PARTS OF A CELL SONG Science Music Video-1.mp4 | 2025-01-22 15:08 | 5.9M | |
| THE PARTS OF A CELL SONG Science Music Video.mp4 | 2025-01-22 13:57 | 5.9M | |
| The Cell Cycle (and cancer) [Updated].mp4 | 2025-01-22 14:14 | 18M | |
| The Central Nervous System- Introduction iKen iKen Edu iKen App.mp4 | 2025-01-28 09:51 | 70M | |
| The Components of Blood and Their Importance.mp4 | 2025-01-28 09:44 | 27M | |
| The Heart and Circulatory System - How They Work.mp4 | 2025-01-28 09:44 | 5.1M | |
| The Lungs and the Pulmonary Circuit.mp4 | 2025-01-28 09:44 | 44M | |
| The Necessities of Life Part 1.mp4 | 2025-01-22 12:49 | 31M | |
| The Nervous System Peripheral Nervous System (PNS).mp4 | 2025-01-28 09:51 | 7.2M | |
| The Rock Cycle Sedimentary, Metamorphic, Igneous Learning Made Fun.mp4 | 2025-02-05 14:14 | 147M | |
| The Theory of Evolution (by Natural Selection) Cornerstones Education.mp4 | 2025-01-27 13:06 | 9.2M | |
| The scientific method.mp4 | 2025-01-15 11:52 | 10M | |
| Trace Fossils.mp4 | 2025-01-27 13:00 | 105M | |
| Transpiration In Plants.mp4 | 2025-01-27 14:47 | 13M | |
| Understanding the Rock Cycle.mp4 | 2025-02-05 14:13 | 9.5M | |
| Unicellular vs Multicellular Cells Biology FuseSchool.mp4 | 2025-01-22 15:08 | 7.0M | |
| Units of Measure Scientific Measurements SI System.mp4 | 2025-01-15 11:52 | 7.0M | |
| Vascular vs. Nonvascular Plants.mp4 | 2025-01-27 14:10 | 13M | |
| Welcome to the reproductive system Reproductive system physiology NCLEX-RN Khan Academy.mp4 | 2025-01-28 10:00 | 9.8M | |
| What Are The Levels Of Organization In The Body - Organization Of The Human Body.mp4 | 2025-01-27 17:02 | 7.2M | |
| What Makes Something Alive Biology for Kids.mp4 | 2025-01-22 12:49 | 63M | |
| What Makes a Species a Species.mp4 | 2025-01-27 13:06 | 31M | |
| What are Tissues Infinity Learn.mp4 | 2025-01-27 17:02 | 8.8M | |
| What are cells Cells Biology FuseSchool.mp4 | 2025-01-22 12:49 | 20M | |
| What is Biology.mp4 | 2025-01-15 11:52 | 20M | |
| What is Biology Biology Areas of Study and Definition.mp4 | 2025-01-15 11:52 | 11M | |
| What is CHLOROPHYLL 🌿 Function, Types and more 👇.mp4 | 2025-01-27 14:48 | 116M | |
| What is Eukaryote Explain Eukaryote, Define Eukaryote, Meaning of Eukaryote.mp4 | 2025-01-22 13:57 | 5.3M | |
| What is Evolution.mp4 | 2025-01-27 13:06 | 67M | |
| What is Light Maxwell and the Electromagnetic Spectrum.mp4 | 2025-01-22 13:29 | 21M | |
| What is Metabolism.mp4 | 2025-01-22 12:49 | 49M | |
| What is Organism Explain Organism, Define Organism, Meaning of Organism.mp4 | 2025-01-22 13:57 | 4.1M | |
| What is an Electromagnetic Wave.mp4 | 2025-01-22 13:30 | 57M | |
| What is a trait-Genetics and Inherited Traits.mp4 | 2025-01-22 14:46 | 5.8M | |
| Where do genes come from - Carl Zimmer.mp4 | 2025-01-22 14:45 | 20M | |
| Why Is Our Skeleton On the Inside.mp4 | 2025-01-27 15:19 | 90M | |
| earth’s history portrayed by minecraft.mp4 | 2025-01-27 11:55 | 59M | |
|
|---|
.png){kind=link}
