![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[VID]](/icons/movie.gif) | U1 How to Write an Autobiography.mp4 | 2023-08-17 15:17 | 9.3M | |
| U1L1 5 Examples Of Chronological Order.mp4 | 2023-08-17 15:31 | 34M | |
| U1L1 Autobiography - What is an autobiography.mp4 | 2023-08-17 15:33 | 53M | |
| U1L1 Sequence of Events English For Kids Mind Blooming.mp4 | 2023-08-17 15:26 | 4.8M | |
| U1L2 Context Clues English For Kids Mind Blooming.mp4 | 2023-08-17 15:43 | 9.8M | |
| U1L3 Autobiography incident.mp4 | 2023-08-17 15:49 | 6.5M | |
| U1L3 Introduce my self with powtoon.mp4 | 2023-08-17 16:01 | 3.0M | |
| U1L3 Writing an Autobiography 1.mp4 | 2023-08-17 16:02 | 1.8M | |
| U1L3 self introduction - animation.mp4 | 2023-08-17 15:58 | 6.4M | |
| U1L4 Writing an Autobiography 2.mp4 | 2023-08-17 16:32 | 3.7M | |
| U1L5 Action verbs.mp4 | 2023-08-17 16:48 | 4.5M | |
| U2 How to write an article.mp4 | 2023-08-17 16:58 | 9.6M | |
| U2L1 Analyzing Newspaper Article.mp4 | 2023-08-17 17:04 | 10M | |
| U2L1 How to find the main idea.mp4 | 2023-08-17 17:07 | 4.3M | |
| U2L1 Main Idea Summarising Reading Strategies.mp4 | 2023-08-17 17:10 | 7.7M | |
| U2L2 Inverted Pyramid Tutorial.mp4 | 2023-08-17 17:09 | 15M | |
| U2L2 Using Context Clues.mp4 | 2023-08-18 08:05 | 5.7M | |
| U2L3 How to Read a Newspaper.mp4 | 2023-08-18 08:47 | 50M | |
| U2L3 Writing With Your Audience in Mind.mp4 | 2023-08-18 08:54 | 14M | |
| U2L4 Creating a News Report.mp4 | 2023-08-18 08:59 | 18M | |
| U2L4 How to write an article for your school newspaper the basics.mp4 | 2023-08-18 09:01 | 8.1M | |
| U2L5 Compound Sentences.mp4 | 2023-08-18 09:07 | 13M | |
| U3L1 How to Brush Your Teeth - Procedural Writin.mp4 | 2023-08-18 09:35 | 2.8M | |
| U3L1 How to Make Hot Chocolate.mp4 | 2023-08-18 09:34 | 3.8M | |
| U3L1 How to write a Procedure-for kids.mp4 | 2023-08-21 07:56 | 5.4M | |
| U3L1 Procedural Writing.mp4 | 2023-08-18 09:32 | 3.5M | |
| U3L2 Compound Words.mp4 | 2023-08-21 08:05 | 4.0M | |
| U3L3 Author´s Purpose and Intended Audience.mp4 | 2023-08-21 08:33 | 8.3M | |
| U3L3 How-To Writing For Kids.mp4 | 2023-08-21 08:29 | 2.5M | |
| U3L3 Informative Writing.mp4 | 2023-08-21 08:31 | 13M | |
| U3L4 PRINCIPLES OF COHESION AND COHERENCE.mp4 | 2023-08-21 08:42 | 18M | |
| U3L4 Transitional words and phrases.mp4 | 2023-08-21 08:47 | 10M | |
| U3 What is How-To Writing.mp4 | 2023-08-18 09:26 | 8.3M | |
| Writing an Autobiography 1.mp4 | 2023-08-17 16:18 | 1.8M | |
|
|---|