![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[VID]](/icons/movie.gif) | muscular system works.mp4 | 2023-08-31 13:13 | 27M | |
| mRNA, tRNA, and rRNA function Types of RNA.mp4 | 2023-08-31 11:01 | 8.5M | |
| kidneys work.mp4 | 2023-09-01 10:32 | 18M | |
| how the digestive system works.mp4 | 2023-09-01 10:18 | 20M | |
![[IMG]](/icons/image2.gif) | gregory.png | 2023-08-10 09:08 | 920K | |
| autoimmune disease.mp4 | 2023-09-01 12:14 | 25M | |
| Why the integumentary system.mp4 | 2023-08-31 13:45 | 21M | |
| What is immunodeficiency.mp4 | 2023-09-01 12:18 | 7.9M | |
| What is a Carcinogen.mp4 | 2023-09-01 12:57 | 75M | |
| What is Biology.mp4 | 2023-08-08 12:26 | 25M | |
| What Happens.mp4 | 2023-09-01 10:41 | 11M | |
| Urinary system organs.mp4 | 2023-09-01 10:37 | 11M | |
| Urinary System.mp4 | 2023-09-01 10:35 | 78M | |
| U10 Introduction to the Immune System.mp4 | 2023-08-04 15:48 | 20M | |
| U9 The Respiratory System.mp4 | 2023-08-04 13:01 | 45M | |
| U9 Skeletal System Structure.mp4 | 2023-08-04 12:55 | 8.5M | |
| U9L4 What Happens If You Hold Your Pee In For Too Long.mp4 | 2023-08-04 15:45 | 11M | |
| U9L4 Urinary system organs and functions.mp4 | 2023-08-04 15:43 | 11M | |
| U9L4 Urinary System.mp4 | 2023-08-04 15:42 | 78M | |
| U9L4 Renal Replacement Therapy.mp4 | 2023-08-04 15:44 | 5.9M | |
| U9L4 How do your kidneys work.mp4 | 2023-08-04 15:40 | 18M | |
| U9L3 Structure Of The Small Intestine - Functions Of The Small Intestine.mp4 | 2023-08-04 15:39 | 14M | |
| U9L3 Large Intestine Structure and Function.mp4 | 2023-08-04 15:38 | 6.5M | |
| U9L3 Human Digestive System in VR.mp4 | 2023-08-04 15:35 | 303M | |
| U9L3 How your digestive system work.mp4 | 2023-08-04 15:31 | 17M | |
| U9L3 How our Digestive System Works.mp4 | 2023-08-04 15:32 | 20M | |
| U9L3 Digestive System.mp4 | 2023-08-04 15:37 | 35M | |
| U9L2 Respiratory System.mp4 | 2023-08-04 15:20 | 14M | |
| U9L2 Pneumonia, Animation.mp4 | 2023-08-04 15:29 | 5.4M | |
| U9L2 Mission Pathogen Luminex Virtual Reality.mp4 | 2023-08-04 15:24 | 362M | |
| U9L2 How breathing works.mp4 | 2023-08-04 15:27 | 46M | |
| U9L2 How Do Your Lungs Work.mp4 | 2023-08-04 15:28 | 13M | |
| U9L2 Dangers of smoking Health Biology FuseSchool.mp4 | 2023-08-04 15:26 | 13M | |
| U9L1 This Is How Your Body Makes New Blood.mp4 | 2023-08-04 15:17 | 59M | |
| U9L1 The Heart.mp4 | 2023-08-04 15:00 | 68M | |
| U9L1 Intro to the Circulatory System.mp4 | 2023-08-04 14:57 | 6.3M | |
| U9L1 Heart Disease Health Biology FuseSchool.mp4 | 2023-08-04 15:19 | 16M | |
| U9L1 Circulatory System and Pathway of Blood Through the Heart.mp4 | 2023-08-04 15:15 | 24M | |
| U9 How your digestive system works - Emma Bryce.mp4 | 2023-08-04 12:58 | 17M | |
| U9 Chapter 1 Circulation.mp4 | 2023-08-04 12:54 | 20M | |
| U8 The Sensory System.mp4 | 2023-08-04 11:20 | 31M | |
| U8 Structure of Skeletal Muscle.mp4 | 2023-08-04 11:19 | 19M | |
| U8 Skeletal System Structure and Function.mp4 | 2023-08-04 11:18 | 8.5M | |
| U8L6 The endocrine system.mp4 | 2023-08-04 12:36 | 2.3M | |
| U8L6 How the Endocrine System Works.mp4 | 2023-08-04 12:35 | 21M | |
| U8L6 Homeostasis and NegativePositive Feedback.mp4 | 2023-08-04 12:40 | 15M | |
| U8L6 Endocrine System, Part 1.mp4 | 2023-08-04 12:38 | 74M | |
| U8L5 Human Physiology - Somatic Nervous System.mp4 | 2023-08-04 12:37 | 12M | |
| U8L5 How do nerves work.mp4 | 2023-08-04 12:12 | 47M | |
| U8L5 Autonomic Nervous System.mp4 | 2023-08-04 12:27 | 59M | |
| U8L5 360 VR Video - Central Nervous System.mp4 | 2023-08-04 12:25 | 328M | |
| U8L4 Why the integumentary system.mp4 | 2023-08-04 12:03 | 21M | |
| U8L4 The science of skin.mp4 | 2023-08-04 12:06 | 16M | |
| U8L4 Hair Anatomy.mp4 | 2023-08-04 12:05 | 2.9M | |
| U8L4 Divisions of the Nervous System.mp4 | 2023-08-04 12:37 | 3.9M | |
| U8L4 Cells of the Epidermis.mp4 | 2023-08-04 12:04 | 16M | |
| U8L3The Sliding Filament Theory.mp4 | 2023-08-04 12:01 | 31M | |
| U8L3 The Muscular System.mp4 | 2023-08-04 11:59 | 35M | |
| U8L3 Muscular System for Kids.mp4 | 2023-08-04 11:58 | 98M | |
| U8L3 How your muscular system works.mp4 | 2023-08-04 11:56 | 27M | |
| U8L2 The Skeletal System.mp4 | 2023-08-04 11:42 | 91M | |
| U8L2 Skeletal System Overview.mp4 | 2023-08-04 11:44 | 76M | |
| U8L2 Ossification.mp4 | 2023-08-04 11:45 | 19M | |
| U8L2 Bone Cells.mp4 | 2023-08-04 11:46 | 24M | |
| U8L1 What Are The Levels Of Organization.mp4 | 2023-08-04 11:23 | 11M | |
| U8L1 WHAT HAPPENS INSIDE YOUR BODY 360 VR.mp4 | 2023-08-04 11:34 | 1.0G | |
| U8L1 Structural Organization of the Human Body.mp4 | 2023-08-04 11:39 | 83M | |
| U8L1 Introduction to Anatomy Physiology.mp4 | 2023-08-04 11:36 | 93M | |
| U8L1 Human Body Systems Functions.mp4 | 2023-08-04 11:40 | 17M | |
| U8 Human Body 101.mp4 | 2023-08-04 11:17 | 42M | |
| U7 Steps of translation.mp4 | 2023-08-04 10:33 | 11M | |
| U7 Molecular Genetics.mp4 | 2023-08-04 10:29 | 37M | |
| U7L4 The Short Answer.mp4 | 2023-08-04 11:08 | 17M | |
| U7L4 Operon.mp4 | 2023-08-04 11:13 | 27M | |
| U7L4 Lactase TATA Box.mp4 | 2023-08-04 11:15 | 12M | |
| U7L4 Homeobox genes.mp4 | 2023-08-04 11:10 | 7.0M | |
| U7L3 Mutations in DNA.mp4 | 2023-08-04 11:01 | 6.6M | |
| U7L3Mutations.mp4 | 2023-08-04 11:04 | 24M | |
| U7L3 Inherited Genetic Disorders Genetics.mp4 | 2023-08-04 11:00 | 9.7M | |
| U7L3 DNA Mutation 3D Animation.mp4 | 2023-08-04 10:59 | 19M | |
| U7L2 Transcription (DNA to mRNA).mp4 | 2023-08-04 10:53 | 17M | |
| U7L2 Protein Synthesis.mp4 | 2023-08-04 10:55 | 26M | |
| U7L2 How to Read a Codon Chart.mp4 | 2023-08-04 10:56 | 37M | |
| U7L2 How are Proteins Made.mp4 | 2023-08-04 10:47 | 26M | |
| U7L2 Genetic code.mp4 | 2023-08-04 10:51 | 10M | |
| U7L2 Codons.mp4 | 2023-08-04 10:52 | 4.9M | |
| U7L1 mRNA, tRNA, and rRNA function.mp4 | 2023-08-04 10:45 | 8.5M | |
| U7L1 The Central Dogma of Biology.mp4 | 2023-08-04 10:43 | 10M | |
| U7L1 DNA vs RNA.mp4 | 2023-08-04 10:37 | 17M | |
| U7L1 Chargaffs rules.mp4 | 2023-08-04 10:44 | 9.2M | |
| U7L1 Chapter 6 Introduction to the DNA.mp4 | 2023-08-04 10:41 | 215M | |
| U7 Chromosomal Abnormalities.mp4 | 2023-08-04 10:31 | 15M | |
| U7 Chargaffs Rules.mp4 | 2023-08-04 10:30 | 43M | |
| U6l1 Mendels Law of Independent Assortment.mp4 | 2023-08-04 10:00 | 6.3M | |
| U6 Learn Biology How to Draw a Punnett Square.mp4 | 2023-08-04 09:55 | 34M | |
| U6L2 Punnett Square Basics Mendelian Genetic.mp4 | 2023-08-04 10:07 | 5.6M | |
| U6L2 Mendels Principles of Inheritance.mp4 | 2023-08-04 10:03 | 13M | |
| U6L2 Incomplete Dominance Genetics.mp4 | 2023-08-04 10:06 | 9.7M | |
| U6L2 Codominance Genetics.mp4 | 2023-08-04 10:05 | 8.3M | |
| U6L1 What is an Allele.mp4 | 2023-08-04 09:59 | 6.7M | |
| U6L1 Gregor Mendel and DNA.mp4 | 2023-08-10 09:20 | 216M | |
| U6L1 Gregor Mendel.mp4 | 2023-08-04 09:57 | 15M | |
| U6L1 Difference between Genotype and Phenotype Genetics.mp4 | 2023-08-04 10:01 | 6.1M | |
| U6 Gregor Mendel.mp4 | 2023-08-04 09:54 | 15M | |
| U6 Genetics 101 National Geographic.mp4 | 2023-08-04 09:53 | 38M | |
| U6 Complex Patterns of Inheritance.mp4 | 2023-08-04 09:56 | 31M | |
| U5 What is a Chromosome.mp4 | 2023-08-04 08:41 | 26M | |
| U5 Mitosis Splitting Up is Complicated.mp4 | 2023-08-04 08:38 | 100M | |
| U5Meiosis (Updated).mp4 | 2023-08-09 13:15 | 19M | |
| U5L3 Meiosis.mp4 | 2023-08-04 09:48 | 19M | |
| U5L3 Meiosis (Updated).mp4 | 2023-08-04 09:51 | 19M | |
| U5L3 Gametes Reproduction.mp4 | 2023-08-04 09:50 | 7.2M | |
| U5L3 5.2.1 Haploid v. Diploid.mp4 | 2023-08-04 09:47 | 3.9M | |
| U5L2 Phases of Mitosis.mp4 | 2023-08-04 09:25 | 78M | |
| U5L2 Genes DNA and Chromosomes.mp4 | 2023-08-04 09:20 | 10M | |
| U5L2 Cell cycles, Chromosomes Mitosis 69.mp4 | 2023-08-04 09:21 | 11M | |
| U5L2 Anaphase.mp4 | 2023-08-04 09:23 | 59M | |
| U5L1 What is Binary fission 12.mp4 | 2023-08-04 09:09 | 8.4M | |
| U5L1 Mitosis The Amazing Cell Process.mp4 | 2023-08-04 09:13 | 15M | |
| U5L1 How Do Cells Divide.mp4 | 2023-08-04 08:47 | 17M | |
| U5L1 Cell Division VR.mp4 | 2023-08-04 09:07 | 51M | |
| U5L1 Cell Cycle Simplified.mp4 | 2023-08-04 09:11 | 79M | |
| U5 Cell Cycle (Overview, Interphase).mp4 | 2023-08-04 08:39 | 53M | |
| U5 Asexual vs Sexual Reproduction.mp4 | 2023-08-04 08:42 | 49M | |
| U4 The Magical Leaf.mp4 | 2023-08-03 16:02 | 32M | |
| U4 Photosynthesis vs. Cellular Respiration.mp4 | 2023-08-03 15:59 | 29M | |
| U4L4 What Is Anaerobic Respiration.mp4 | 2023-08-04 08:30 | 19M | |
| U4L4 Lactic Acid Fermentation.mp4 | 2023-08-04 08:35 | 8.0M | |
| U4L4 Anaerobic Respiration and Fermentation.mp4 | 2023-08-04 08:28 | 20M | |
| U4L4 Alcoholic Fermentation Made Easy.mp4 | 2023-08-04 08:33 | 6.0M | |
| U4L3 Krebs Cycle.mp4 | 2023-08-04 08:25 | 3.2M | |
| U4L3 Glycolysis.mp4 | 2023-08-04 08:24 | 6.8M | |
| U4L3 Cellular Respiration Simplified.mp4 | 2023-08-04 08:20 | 60M | |
| U4L3 Aerobic Respiration.mp4 | 2023-08-04 08:23 | 51M | |
| U4L2 WHAT IS CHLOROPHYLL.mp4 | 2023-08-03 16:48 | 6.7M | |
| U4L2 Photosynthesis.mp4 | 2023-08-03 16:44 | 21M | |
| U4L2 Electron Transport Chain.mp4 | 2023-08-03 16:44 | 3.6M | |
| U4L2 Calvin Cycle.mp4 | 2023-08-03 16:44 | 8.1M | |
| U4L1 Virtual Plant Cell Cell Explore.mp4 | 2023-08-03 16:17 | 50M | |
| U4L1 Photosynthesis explained.mp4 | 2023-08-03 16:22 | 11M | |
| U4L1 Glucose Concentration.mp4 | 2023-08-03 16:24 | 11M | |
| U4L1 Everything is Energy.mp4 | 2023-08-03 16:13 | 68M | |
| U4L1 Calvin Cycle.mp4 | 2023-08-03 16:40 | 8.1M | |
| U4L1 Autotroph vs Heterotroph.mp4 | 2023-08-03 16:20 | 36M | |
| U4 Glycolysis An Overview.mp4 | 2023-08-03 16:06 | 6.8M | |
| U4 AEROBIC vs ANAEROBIC DIFFERENCE.mp4 | 2023-08-03 16:04 | 18M | |
| U3 Prokaryotic Vs. Eukaryotic Cells.mp4 | 2023-08-03 13:57 | 9.2M | |
| U3L3 Sodium-Potassium Pump- How and Why.mp4 | 2023-08-03 15:45 | 17M | |
| U3L3 Homeostasis.mp4 | 2023-08-03 15:29 | 12M | |
| U3L3 Facilitated Diffusion.mp4 | 2023-08-03 15:39 | 3.6M | |
| U3L3 Active Transport Primary Secondary.mp4 | 2023-08-03 15:37 | 25M | |
| U3L2 What is ATP.mp4 | 2023-08-03 15:06 | 12M | |
| U3L2 The Endoplasmic Reticulum.mp4 | 2023-08-03 15:09 | 26M | |
| U3L2 Mitochondria structure and function.mp4 | 2023-08-03 15:13 | 12M | |
| U3L2 Cell Structure and Function.mp4 | 2023-08-03 15:04 | 57M | |
| U3L1 What is the Plasma Membrane.mp4 | 2023-08-03 14:44 | 179M | |
| U3 L1 What are Ribosomes.mp4 | 2023-08-03 14:51 | 10M | |
| U3L1 Prokaryotic Vs. Eukaryotic Cells.mp4 | 2023-08-03 14:49 | 9.2M | |
| U3L1 Introduction to Cells.mp4 | 2023-08-03 14:10 | 41M | |
| U3L1 Cellscape VR Biology Guided Tour.mp4 | 2023-08-03 14:38 | 182M | |
| U3 Function Cytoplasm.mp4 | 2023-08-03 14:01 | 13M | |
| U3 Cell Structure and Function.mp4 | 2023-08-03 13:55 | 17M | |
| U3 Biology Cell Structure I Nucleus Medical Media.mp4 | 2023-08-09 10:17 | 82M | |
| U2 introduction to metabolism.mp4 | 2023-08-03 12:17 | 8.2M | |
| U2What Is The pH Scale.mp4 | 2023-08-03 12:19 | 13M | |
| U2 What Is The pH Scale.mp4 | 2023-08-03 12:21 | 13M | |
| U2 The Chemistry of Life.mp4 | 2023-08-03 11:42 | 20M | |
| U2L3 What Is The pH Scale.mp4 | 2023-08-03 13:47 | 13M | |
| U2L3 Water - Liquid Awesome.mp4 | 2023-08-03 13:34 | 157M | |
| U2L3 Water, Acids, and Bases.mp4 | 2023-08-03 13:21 | 18M | |
| U2L3 Properties of Water.mp4 | 2023-08-03 13:32 | 20M | |
| U2L3 Hydrogen Bonds.mp4 | 2023-08-03 13:39 | 12M | |
| U2L3 How polarity.mp4 | 2023-08-03 13:41 | 25M | |
| U2L2 How to speed up chemical reactions.mp4 | 2023-08-03 12:59 | 37M | |
| U2L2 Biochemical Reactions.mp4 | 2023-08-03 12:54 | 16M | |
| U2L2 Activation energy.mp4 | 2023-08-03 12:57 | 49M | |
| U2L2 Activation Energy1.mp4 | 2023-08-03 13:00 | 29M | |
| U2L1 What is DNA.mp4 | 2023-08-03 12:33 | 33M | |
| U2L1 Photosynthesis.mp4 | 2023-08-03 16:34 | 21M | |
| U2L1 INTRO ELEMENTS COMPOUNDS.mp4 | 2023-08-03 12:27 | 7.6M | |
| U2L1 Enzymes.mp4 | 2023-08-03 12:36 | 13M | |
| U2L1 DNA vs RNA (Updated).mp4 | 2023-08-08 16:10 | 17M | |
| U2L1 Chromosome structure.mp4 | 2023-08-03 12:34 | 7.6M | |
| U2L1 Carbohydrates.mp4 | 2023-08-08 14:44 | 93M | |
| U2L1 Biomolecules.mp4 | 2023-08-03 12:50 | 15M | |
| U2L1 Amino Acids Explained.mp4 | 2023-08-03 12:31 | 106M | |
| U2 Carbohydrates .mp4 | 2023-08-03 12:21 | 93M | |
| U1 What is Homeostasis.mp4 | 2023-08-08 13:20 | 5.8M | |
| U1 Organism, Population, Community.mp4 | 2023-08-08 13:23 | 28M | |
| U1L2 What is Biodiversity.mp4 | 2023-08-03 09:59 | 27M | |
| U1L2 What Is Homeostasis.mp4 | 2023-08-03 10:11 | 8.9M | |
| U1L2 The Study of Life.mp4 | 2023-08-03 09:47 | 9.9M | |
| U1L2 Simple explanation of natural selection.mp4 | 2023-08-03 10:11 | 59M | |
| U1L2 GCSE Biology - Homeostasis.mp4 | 2023-08-03 10:17 | 16M | |
| U1L2 EARTHs ecosystems in 360 VR.mp4 | 2023-08-03 09:58 | 345M | |
| U1L2 360 Guided Tour of the Cell.mp4 | 2023-08-03 09:52 | 149M | |
| U1L1 The Scientific Method Steps, Terms and Examples.mp4 | 2023-08-03 09:12 | 11M | |
| U1L1 Science Real World.mp4 | 2023-08-03 08:59 | 114M | |
| U1L1 Sciemtific Theory.mp4 | 2023-08-03 09:06 | 23M | |
| U1L1 Independent, Dependent, and Controlled Variables.mp4 | 2023-08-03 09:21 | 10M | |
| U1L1Biology Independent vs. Dependent Variables.mp4 | 2023-08-08 13:52 | 16M | |
| U1 Fact vs. Theory vs. Hypothesis vs. Law.mp4 | 2023-08-08 12:54 | 91M | |
| U1Cell Theory Timeline.mp4 | 2023-08-03 10:17 | 5.1M | |
| Transcription (DNA to mRNA).mp4 | 2023-08-31 11:29 | 17M | |
| This Is How Your Body Makes New Blood.mp4 | 2023-09-01 09:36 | 59M | |
| The endocrine system.mp4 | 2023-08-31 14:33 | 2.3M | |
| The Sliding Filament Theory.mp4 | 2023-08-31 13:32 | 31M | |
| The Skeletal System I.mp4 | 2023-08-31 12:56 | 91M | |
| The Skeletal System.mp4 | 2023-08-31 12:42 | 91M | |
| The Sensory System.mp4 | 2023-08-31 12:22 | 31M | |
| The Respiratory System.mp4 | 2023-09-01 08:42 | 45M | |
| The Muscular System 1.mp4 | 2023-08-31 13:31 | 35M | |
| The Mitochondria.mp4 | 2023-08-09 11:38 | 575M | |
| The Magical Leaf.mp4 | 2023-08-09 11:35 | 32M | |
| The Lymphatic System.mp4 | 2023-09-01 11:22 | 14M | |
| The Immune System Explained.mp4 | 2023-09-01 11:55 | 32M | |
| The Heart.mp4 | 2023-09-01 09:18 | 68M | |
| The Central Dogma of Biology.mp4 | 2023-08-31 10:40 | 10M | |
| The Anatomy of Allergies.mp4 | 2023-09-01 12:16 | 13M | |
| Testosterone Production.mp4 | 2023-09-01 13:12 | 3.0M | |
| Structure of Skeletal Muscle.mp4 | 2023-08-31 12:20 | 19M | |
| Structure Of The Small Intestine.mp4 | 2023-09-01 10:25 | 14M | |
| Structural Organization of the Human Body.mp4 | 2023-08-31 12:36 | 83M | |
| Spermatogenesis.mp4 | 2023-09-01 13:13 | 11M | |
| Skeletal System Structure and Function.mp4 | 2023-08-31 12:19 | 8.5M | |
| Skeletal System Structure and Function-1.mp4 | 2023-09-01 08:40 | 8.5M | |
| Skeletal System Overview.mp4 | 2023-08-31 12:46 | 76M | |
| Skeletal System Overview-1.mp4 | 2023-08-31 12:59 | 76M | |
| Reproductive System, Part 1.mp4 | 2023-09-01 14:48 | 72M | |
| Renal Replacement Therapy.mp4 | 2023-09-01 10:39 | 5.9M | |
| Protein Synthesis (Updated).mp4 | 2023-08-31 11:40 | 26M | |
| Production and Action of Testosterone.mp4 | 2023-09-01 13:17 | 8.5M | |
| Pneumonia, Animation.mp4 | 2023-09-01 10:09 | 5.4M | |
| Ossification.mp4 | 2023-08-31 12:48 | 19M | |
| Organization Of The Human Body.mp4 | 2023-08-31 12:27 | 11M | |
| Operon.mp4 | 2023-08-31 12:11 | 27M | |
| Mutations in DNA.mp4 | 2023-08-31 11:54 | 6.6M | |
| Mutations Up.mp4 | 2023-08-31 11:56 | 24M | |
| Muscular System.mp4 | 2023-08-31 13:17 | 98M | |
| Most Dangerous Biological Weapons.mp4 | 2023-09-01 12:33 | 89M | |
| Molecular Genetics.mp4 | 2023-08-31 09:43 | 37M | |
| Mission Pathogen.mp4 | 2023-09-01 09:59 | 362M | |
| Miracle Of Life - 360 Video.mp4 | 2023-08-09 13:22 | 425M | |
| Menstrual Cycle Phases.mp4 | 2023-09-01 15:01 | 291M | |
| Menstrual Cycle Phases-1.mp4 | 2023-09-01 15:10 | 291M | |
| Menopause, Perimenopause, Symptoms and Management, Animation.mp4 | 2023-09-01 14:50 | 4.8M | |
| Mendel’s Law of Independent Assortment Explained.mp4 | 2023-08-09 13:47 | 6.3M | |
| Male Reproductive System Functions, Organs and Anatomy.mp4 | 2023-09-01 13:09 | 13M | |
| Male Reproductive System.mp4 | 2023-09-01 13:16 | 82M | |
| Large Intestine Structure.mp4 | 2023-09-01 10:22 | 6.5M | |
| Lactase TATA Box.mp4 | 2023-08-31 12:12 | 12M | |
| Intro to the Circulatory System Biology.mp4 | 2023-09-01 08:48 | 6.3M | |
| Introduction to the DNA.mp4 | 2023-08-31 10:04 | 215M | |
| Introduction to Anatomy Physiology.mp4 | 2023-08-31 12:34 | 93M | |
| Introduction Physiology Biology.mp4 | 2023-09-01 09:54 | 14M | |
| Inherited Genetic Disorders.mp4 | 2023-08-31 11:53 | 9.7M | |
| Immune System.mp4 | 2023-09-01 10:48 | 20M | |
| Immune System, Part 1.mp4 | 2023-09-01 12:06 | 78M | |
| INFLAMMATORY RESPONSE.mp4 | 2023-09-01 12:04 | 28M | |
| Human Physiology - Somatic Nervous System.mp4 | 2023-08-31 14:28 | 12M | |
| Human Body Systems Functions.mp4 | 2023-08-31 12:38 | 17M | |
| Human Body 101.mp4 | 2023-08-31 12:17 | 42M | |
| Human Anatomy Kenhub.mp4 | 2023-09-01 10:23 | 6.5M | |
| How your digestive system works1.mp4 | 2023-09-01 10:15 | 17M | |
| How your digestive system works.mp4 | 2023-09-01 08:43 | 17M | |
| How to Read a Codon Chart.mp4 | 2023-08-31 11:42 | 37M | |
| How the Endocrine System Works.mp4 | 2023-08-31 14:31 | 21M | |
| How do nerves work.mp4 | 2023-08-31 14:15 | 47M | |
| How breathing works.mp4 | 2023-09-01 10:07 | 46M | |
| How are Proteins Made.mp4 | 2023-08-31 11:08 | 26M | |
| How The Immune System.mp4 | 2023-09-01 11:25 | 147M | |
| How Do Your Lungs Work.mp4 | 2023-09-01 10:08 | 13M | |
| Homeostasis and NegativePositive Feedback.mp4 | 2023-08-31 14:36 | 15M | |
| Homeobox genes.mp4 | 2023-08-31 12:04 | 7.0M | |
| Heart Disease Health.mp4 | 2023-09-01 09:45 | 16M | |
| HIV.mp4 | 2023-09-01 12:19 | 19M | |
| Genetic code.mp4 | 2023-08-31 11:26 | 10M | |
| Gene Expression.mp4 | 2023-08-31 12:00 | 17M | |
| Female Reproductive System.mp4 | 2023-09-01 13:23 | 129M | |
| Endo.mp4 | 2023-08-31 14:35 | 74M | |
| Electron Transport Chain Animation Overview Chemiosmosis HQ.mp4 | 2023-08-09 11:46 | 3.6M | |
| Digestive System.mp4 | 2023-09-01 10:20 | 35M | |
| Development of Embryo.mp4 | 2023-09-01 14:43 | 13M | |
| Dangers of smoking.mp4 | 2023-09-01 10:00 | 13M | |
| DNA vs RNA.mp4 | 2023-08-31 09:59 | 17M | |
| DNA Mutation 3D Animation.mp4 | 2023-08-31 11:50 | 19M | |
| Codons.mp4 | 2023-08-31 11:27 | 4.9M | |
| Circulatory System.mp4 | 2023-09-01 09:33 | 24M | |
| Chromosomal Abnormalities.mp4 | 2023-08-31 09:53 | 15M | |
| Chargaffs rules-1.mp4 | 2023-08-31 11:00 | 9.2M | |
| Chargaffs Rules.mp4 | 2023-08-31 09:51 | 43M | |
| Chapter 7 RNA and Transcription.mp4 | 2023-08-31 11:19 | 488M | |
| Chapter 6 Introduction to the DNA.mp4 | 2023-08-08 16:17 | 180M | |
| Chapter 1 Circulation.mp4 | 2023-09-01 08:32 | 20M | |
| Central Nervous System.mp4 | 2023-08-31 14:24 | 328M | |
| Cell Defence Lymphocytes and Phagocytes.mp4 | 2023-09-01 12:08 | 11M | |
| Bone Cells.mp4 | 2023-08-31 12:49 | 24M | |
| Bone Cells-1.mp4 | 2023-08-31 13:04 | 24M | |
| Bloodstream Infection.mp4 | 2023-09-01 12:01 | 333M | |
| Assortment.PNG | 2023-08-09 13:44 | 380K | |
| Antibodies Health Biology.mp4 | 2023-09-01 11:20 | 14M | |
| Air Quality Index.mp4 | 2023-09-01 12:55 | 5.0M | |
| Air Pollution-1.mp4 | 2023-09-01 13:00 | 47M | |
| A Virtual Reality tour inside the Heart.mp4 | 2023-09-01 09:27 | 65M | |
| AIR POLLUTION.mp4 | 2023-09-01 12:53 | 347M | |
| 9 Months In The Womb A Remarkable.mp4 | 2023-09-01 15:03 | 36M | |
| 8 Stages of Development.mp4 | 2023-09-01 13:05 | 58M | |
| 2- steps of translation.mp4 | 2023-08-31 09:57 | 11M | |
| 2-Minute Neuroscience Divisions of the Nervous System.mp4 | 2023-08-31 14:27 | 3.9M | |
|
|---|
