![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | 47c0b3835860994044393af267bf2315f828579b4f8607066448fc6bcf821d9b._RI_TTW_.jpg | 2023-07-24 14:14 | 295K | |
![[IMG]](/icons/image2.gif) | ATF!.PNG | 2023-01-05 13:13 | 970K | |
![[IMG]](/icons/image2.gif) | ATF.png | 2023-01-05 12:12 | 87K | |
![[IMG]](/icons/image2.gif) | ATF Badge.png | 2023-01-05 12:15 | 538K | |
![[IMG]](/icons/image2.gif) | Addiction.png | 2023-01-06 14:32 | 117K | |
![[IMG]](/icons/image2.gif) | Analzying Handwriting.PNG | 2023-01-11 14:03 | 550K | |
![[IMG]](/icons/image2.gif) | Anitgens and antibodies.PNG | 2023-01-10 14:14 | 817K | |
![[IMG]](/icons/image2.gif) | Art History.png | 2022-12-27 16:16 | 18K | |
![[IMG]](/icons/image2.gif) | Art History5.png | 2022-12-27 16:16 | 67K | |
![[IMG]](/icons/image2.gif) | Biometeric Banner.png | 2023-01-04 13:31 | 302K | |
![[IMG]](/icons/image2.gif) | Biometeric Banner1.png | 2023-01-04 13:31 | 302K | |
![[IMG]](/icons/image2.gif) | Biometric Data.png | 2023-01-04 17:09 | 241K | |
![[IMG]](/icons/image2.gif) | Biometric Types.png | 2023-01-04 17:05 | 475K | |
![[IMG]](/icons/image2.gif) | Biometrics1.png | 2023-01-04 14:05 | 196K | |
![[IMG]](/icons/image2.gif) | Biometrics Banner.png | 2023-01-04 15:51 | 350K | |
![[IMG]](/icons/image2.gif) | Blood ALc.png | 2023-01-09 15:29 | 377K | |
![[IMG]](/icons/image2.gif) | Blood Banners.png | 2023-01-10 13:11 | 292K | |
![[IMG]](/icons/image2.gif) | Blood Splatter.PNG | 2023-01-03 15:13 | 396K | |
![[IMG]](/icons/image2.gif) | BloodStainFormation.PNG | 2023-01-03 14:47 | 441K | |
![[IMG]](/icons/image2.gif) | Blood Tubes Banner.png | 2023-01-10 14:53 | 294K | |
![[IMG]](/icons/image2.gif) | Bloodstain Pattern.PNG | 2023-01-03 15:07 | 633K | |
![[IMG]](/icons/image2.gif) | Buccal Swab Collection.png | 2022-12-30 16:18 | 620K | |
![[IMG]](/icons/image2.gif) | C Plus.png | 2023-01-24 10:42 | 31K | |
![[IMG]](/icons/image2.gif) | C Plus Plus Banner.png | 2023-01-24 10:42 | 309K | |
![[IMG]](/icons/image2.gif) | C Plus Plus Header.png | 2023-01-24 11:16 | 354K | |
![[IMG]](/icons/image2.gif) | CSI.png | 2022-12-30 14:41 | 542K | |
![[IMG]](/icons/image2.gif) | Chemistry of Explosives.PNG | 2023-01-11 11:57 | 518K | |
![[IMG]](/icons/image2.gif) | Chromotography.png | 2023-01-09 12:17 | 374K | |
![[IMG]](/icons/image2.gif) | Classify Drugs.PNG | 2023-01-10 09:23 | 271K | |
![[IMG]](/icons/image2.gif) | Collect Hair.PNG | 2023-01-06 13:26 | 742K | |
![[IMG]](/icons/image2.gif) | Collecting Evidence.png | 2022-12-30 16:39 | 439K | |
![[IMG]](/icons/image2.gif) | Collection of Glass.png | 2023-01-05 13:43 | 77K | |
![[IMG]](/icons/image2.gif) | Compound Microscopes.PNG | 2023-01-05 10:08 | 353K | |
![[IMG]](/icons/image2.gif) | Computer Forensics.png | 2023-01-11 14:28 | 247K | |
![[IMG]](/icons/image2.gif) | Computer Forensics 1.png | 2023-01-11 16:51 | 163K | |
![[IMG]](/icons/image2.gif) | Computer Forensics 2.png | 2023-01-11 17:01 | 277K | |
![[IMG]](/icons/image2.gif) | Computer Forensics Banner.png | 2023-01-11 14:18 | 210K | |
![[IMG]](/icons/image2.gif) | Computer Forensics Header.png | 2023-01-11 16:44 | 340K | |
![[IMG]](/icons/image2.gif) | Computer Forensics Video.PNG | 2023-01-11 14:54 | 951K | |
![[IMG]](/icons/image2.gif) | Computer Hardware.PNG | 2023-01-12 10:44 | 390K | |
![[IMG]](/icons/image2.gif) | Contamination Banner.png | 2023-01-11 12:05 | 399K | |
![[IMG]](/icons/image2.gif) | Controlled Substances Act.PNG | 2023-01-10 09:13 | 951K | |
![[IMG]](/icons/image2.gif) | Crime Scene.png | 2022-12-30 10:36 | 63K | |
![[IMG]](/icons/image2.gif) | Crime Scene Banner.png | 2022-12-29 12:18 | 228K | |
![[IMG]](/icons/image2.gif) | Crime Scene Header.png | 2022-12-30 15:27 | 248K | |
![[IMG]](/icons/image2.gif) | Crime Scene Investigator.png | 2022-12-30 13:44 | 194K | |
![[IMG]](/icons/image2.gif) | Crime Scene Reconstruct.PNG | 2023-01-03 13:56 | 699K | |
![[IMG]](/icons/image2.gif) | Crime Scene Reconstruction.png | 2023-01-03 13:20 | 325K | |
![[IMG]](/icons/image2.gif) | Crime Scene Reconstruction Bannert.png | 2023-01-03 12:53 | 395K | |
![[IMG]](/icons/image2.gif) | Criminalistics.png | 2022-12-28 15:59 | 337K | |
![[ ]](/icons/layout.gif) | Criminalistics Forensic Science-Pearson (2021)-1.pdf | 2022-12-29 09:42 | 43M | |
![[ ]](/icons/layout.gif) | Criminalistics Forensic Science-Pearson (2021)-1_opt.pdf | 2022-12-29 09:46 | 43M | |
![[ ]](/icons/layout.gif) | Curtis Flowers.pdf | 2023-07-24 13:45 | 894K | |
![[IMG]](/icons/image2.gif) | DNA.png | 2023-01-09 17:59 | 679K | |
![[IMG]](/icons/image2.gif) | DNA 112.png | 2023-01-10 15:10 | 326K | |
![[IMG]](/icons/image2.gif) | DNA Banner.png | 2023-01-09 17:33 | 343K | |
![[IMG]](/icons/image2.gif) | DNA Banner1.png | 2023-01-10 11:53 | 251K | |
![[IMG]](/icons/image2.gif) | DNA Database.PNG | 2023-01-03 12:39 | 204K | |
![[IMG]](/icons/image2.gif) | DNA FOR.png | 2023-01-09 17:47 | 334K | |
![[IMG]](/icons/image2.gif) | DNA Forensic Science Tool.PNG | 2023-01-10 15:20 | 452K | |
![[IMG]](/icons/image2.gif) | DNA Header.png | 2023-01-10 15:26 | 223K | |
![[IMG]](/icons/image2.gif) | DNA Profile.png | 2023-01-10 12:11 | 401K | |
![[IMG]](/icons/image2.gif) | DNA SAmples.png | 2023-01-10 16:53 | 762K | |
![[IMG]](/icons/image2.gif) | Detectives and Fingerprints.png | 2023-01-04 12:43 | 438K | |
![[IMG]](/icons/image2.gif) | Document Examination.png | 2023-01-11 12:25 | 130K | |
![[IMG]](/icons/image2.gif) | Document Examination Banner 1.png | 2023-01-11 12:38 | 194K | |
![[IMG]](/icons/image2.gif) | Document Examination banner.png | 2023-01-11 12:10 | 139K | |
![[IMG]](/icons/image2.gif) | Dom and Res Genes.PNG | 2023-01-10 14:38 | 160K | |
![[IMG]](/icons/image2.gif) | Drug Addicition.PNG | 2023-01-06 14:59 | 414K | |
![[IMG]](/icons/image2.gif) | Drug Dependence.png | 2023-01-09 10:07 | 342K | |
![[IMG]](/icons/image2.gif) | Drug Forsentics Banner.png | 2023-01-06 15:09 | 277K | |
![[IMG]](/icons/image2.gif) | Drug Laws.png | 2023-01-09 12:09 | 245K | |
![[IMG]](/icons/image2.gif) | Drug Poisons.png | 2023-01-09 15:35 | 669K | |
![[IMG]](/icons/image2.gif) | Drugs banner.png | 2023-01-06 14:01 | 88K | |
![[IMG]](/icons/image2.gif) | Evidence Physical.png | 2023-01-03 12:03 | 162K | |
![[IMG]](/icons/image2.gif) | Evidence reconstruction banner.png | 2023-01-03 14:02 | 188K | |
![[IMG]](/icons/image2.gif) | FP.png | 2023-01-03 15:53 | 363K | |
![[IMG]](/icons/image2.gif) | FP Classification.png | 2023-01-04 10:50 | 77K | |
![[IMG]](/icons/image2.gif) | Feronisic Serology.png | 2023-01-10 13:19 | 160K | |
![[IMG]](/icons/image2.gif) | Feronisic Serology1.PNG | 2023-01-10 13:22 | 892K | |
![[IMG]](/icons/image2.gif) | Fiber.png | 2023-01-05 15:44 | 160K | |
![[IMG]](/icons/image2.gif) | Fiber1.png | 2023-01-05 15:47 | 141K | |
![[IMG]](/icons/image2.gif) | Fibers1.png | 2023-01-06 13:47 | 88K | |
![[IMG]](/icons/image2.gif) | Fibers hair.png | 2023-01-06 12:05 | 161K | |
![[IMG]](/icons/image2.gif) | Fingerprint.png | 2023-01-04 10:23 | 321K | |
![[IMG]](/icons/image2.gif) | Fingerprint Class.png | 2023-01-04 12:34 | 739K | |
![[IMG]](/icons/image2.gif) | Fingerprinting.PNG | 2023-01-03 12:34 | 890K | |
![[IMG]](/icons/image2.gif) | Fingerprints.png | 2023-01-04 09:50 | 371K | |
![[IMG]](/icons/image2.gif) | Fingerprints Header.png | 2023-01-04 10:34 | 292K | |
![[IMG]](/icons/image2.gif) | Fingerprints banner.png | 2023-01-04 09:30 | 372K | |
![[IMG]](/icons/image2.gif) | Fire Explosives.PNG | 2023-01-11 10:15 | 648K | |
![[IMG]](/icons/image2.gif) | Fire Line Banner.png | 2023-01-11 11:03 | 385K | |
![[IMG]](/icons/image2.gif) | Fire and Explosion.png | 2023-01-11 11:33 | 297K | |
![[IMG]](/icons/image2.gif) | Fire and Explosion banner.png | 2023-01-11 09:33 | 352K | |
![[IMG]](/icons/image2.gif) | Firearm Evidence.PNG | 2023-01-05 12:46 | 835K | |
![[IMG]](/icons/image2.gif) | Firearm Investigations.PNG | 2023-01-05 12:37 | 918K | |
![[IMG]](/icons/image2.gif) | Firearms.png | 2023-01-05 10:43 | 251K | |
![[IMG]](/icons/image2.gif) | Firearms Banner.png | 2023-01-05 10:31 | 310K | |
![[IMG]](/icons/image2.gif) | Firearms Header.png | 2023-01-05 11:57 | 280K | |
![[IMG]](/icons/image2.gif) | Firearms banner 2.png | 2023-01-05 12:01 | 259K | |
![[IMG]](/icons/image2.gif) | Firewalls Explained.PNG | 2023-01-12 10:59 | 433K | |
![[IMG]](/icons/image2.gif) | For Finfw.png | 2023-01-04 16:34 | 112K | |
![[IMG]](/icons/image2.gif) | For Finger.png | 2023-01-04 16:38 | 227K | |
![[IMG]](/icons/image2.gif) | Fore Drugs.png | 2023-01-06 15:49 | 241K | |
![[IMG]](/icons/image2.gif) | Fore banner.png | 2023-01-03 16:56 | 322K | |
![[IMG]](/icons/image2.gif) | Forensic Anthropology.png | 2023-01-04 09:08 | 499K | |
![[IMG]](/icons/image2.gif) | Forensic DNA.png | 2023-01-10 16:30 | 286K | |
![[IMG]](/icons/image2.gif) | Forensic Documentation.PNG | 2023-01-11 12:31 | 868K | |
![[IMG]](/icons/image2.gif) | Forensic Entomologist.png | 2023-01-04 09:15 | 839K | |
![[IMG]](/icons/image2.gif) | Forensic Fire.png | 2023-01-11 09:49 | 287K | |
![[IMG]](/icons/image2.gif) | Forensic Hair and Dibers.PNG | 2023-01-05 15:59 | 378K | |
![[IMG]](/icons/image2.gif) | Forensic Ink.PNG | 2023-01-11 14:09 | 733K | |
![[IMG]](/icons/image2.gif) | Forensic MIcroscopes.PNG | 2023-01-05 10:20 | 831K | |
![[IMG]](/icons/image2.gif) | Forensic Science Banner.gif | 2023-07-21 12:39 | 503K | |
![[IMG]](/icons/image2.gif) | Forensic Sciences Banner.png | 2022-12-29 11:40 | 387K | |
![[IMG]](/icons/image2.gif) | Forensic Toxicology.png | 2023-01-04 09:03 | 711K | |
![[IMG]](/icons/image2.gif) | Forensic Toxicology 1.png | 2023-01-09 12:51 | 240K | |
![[IMG]](/icons/image2.gif) | Forensic Toxicology 2.png | 2023-01-09 12:55 | 216K | |
![[IMG]](/icons/image2.gif) | Forensic Toxicology Banner.png | 2023-01-09 12:32 | 421K | |
![[IMG]](/icons/image2.gif) | Forensic fibers.PNG | 2023-01-06 13:40 | 841K | |
![[IMG]](/icons/image2.gif) | Forensic pathologist.PNG | 2023-01-03 16:09 | 698K | |
![[IMG]](/icons/image2.gif) | Forensic toxicology 3.png | 2023-01-09 13:06 | 592K | |
![[IMG]](/icons/image2.gif) | Fore role.png | 2023-01-09 13:46 | 285K | |
![[IMG]](/icons/image2.gif) | Foresenic Biometreics.png | 2023-01-04 14:20 | 192K | |
![[IMG]](/icons/image2.gif) | Genes and Chromosomes.PNG | 2023-01-10 14:19 | 692K | |
![[IMG]](/icons/image2.gif) | Glass Examination.PNG | 2023-01-05 13:57 | 746K | |
![[IMG]](/icons/image2.gif) | Glass Examination Banner.png | 2023-01-05 14:12 | 139K | |
![[IMG]](/icons/image2.gif) | Glass Examination Forensics.png | 2023-01-05 14:28 | 298K | |
![[IMG]](/icons/image2.gif) | Glass Mater.png | 2023-01-05 13:02 | 230K | |
![[IMG]](/icons/image2.gif) | Hair and Fiber Banner.png | 2023-01-06 10:58 | 268K | |
![[IMG]](/icons/image2.gif) | Hairs and Fibers Banner.png | 2023-01-05 15:32 | 244K | |
![[IMG]](/icons/image2.gif) | History of Fingerprints.png | 2023-01-04 12:18 | 320K | |
![[IMG]](/icons/image2.gif) | How Does Wifi Work.PNG | 2023-01-12 12:19 | 354K | |
![[IMG]](/icons/image2.gif) | How GPS Works.PNG | 2023-01-12 12:10 | 862K | |
![[IMG]](/icons/image2.gif) | IP Address.PNG | 2023-01-12 10:56 | 665K | |
![[IMG]](/icons/image2.gif) | Inside the Crime Lab.png | 2023-01-09 17:03 | 696K | |
![[IMG]](/icons/image2.gif) | Investigator.png | 2023-01-03 17:09 | 340K | |
![[IMG]](/icons/image2.gif) | Investigator1.png | 2023-01-03 17:13 | 230K | |
![[IMG]](/icons/image2.gif) | Invstiagation banner.png | 2023-01-03 15:30 | 282K | |
![[IMG]](/icons/image2.gif) | Isoptopes and radioactivity .png | 2023-01-09 17:07 | 66K | |
![[ ]](/icons/layout.gif) | Joyner_IntroductiontoComputing_1stEdition.pdf | 2023-01-19 13:26 | 22M | |
![[IMG]](/icons/image2.gif) | Locards Priniciple.png | 2022-12-30 12:02 | 693K | |
![[IMG]](/icons/image2.gif) | Micro Scope.png | 2023-01-05 09:54 | 171K | |
![[IMG]](/icons/image2.gif) | Microscope.png | 2023-01-04 17:41 | 168K | |
![[IMG]](/icons/image2.gif) | Microscope Banner.png | 2023-01-04 13:13 | 228K | |
![[IMG]](/icons/image2.gif) | Microscope Basics.PNG | 2023-01-05 10:02 | 632K | |
![[IMG]](/icons/image2.gif) | Microscopes.png | 2023-01-04 17:50 | 327K | |
![[IMG]](/icons/image2.gif) | Mitrocondrial DNA.png | 2023-01-10 16:47 | 456K | |
![[IMG]](/icons/image2.gif) | Mobile Device Banner.png | 2023-01-12 11:06 | 249K | |
![[IMG]](/icons/image2.gif) | Mobile Device Banner 2.png | 2023-01-12 11:49 | 230K | |
![[IMG]](/icons/image2.gif) | Mobile Device Forensics.png | 2023-01-12 11:29 | 336K | |
![[IMG]](/icons/image2.gif) | Mobile Forencis.png | 2023-01-12 12:05 | 251K | |
![[IMG]](/icons/image2.gif) | Mobile Forensics 1.PNG | 2023-01-12 11:39 | 524K | |
![[IMG]](/icons/image2.gif) | Morphology of Hair.PNG | 2023-01-06 13:22 | 552K | |
![[IMG]](/icons/image2.gif) | Periodic Table.PNG | 2023-01-05 14:52 | 632K | |
![[IMG]](/icons/image2.gif) | Physchological and Phsyical Depenentancy.PNG | 2023-01-10 09:08 | 426K | |
![[IMG]](/icons/image2.gif) | Physical Evidence.png | 2023-01-03 10:14 | 438K | |
![[IMG]](/icons/image2.gif) | Physical Evidence Banner.png | 2023-01-03 10:00 | 391K | |
![[IMG]](/icons/image2.gif) | Police Line Banner.png | 2022-12-30 13:27 | 230K | |
![[IMG]](/icons/image2.gif) | Questioned Docs.PNG | 2023-01-11 13:43 | 594K | |
![[IMG]](/icons/image2.gif) | Questioned Document.png | 2023-01-11 13:15 | 343K | |
![[IMG]](/icons/image2.gif) | Reconstruction.png | 2023-01-03 14:22 | 190K | |
![[IMG]](/icons/image2.gif) | Refractive Index.PNG | 2023-01-05 15:07 | 502K | |
![[IMG]](/icons/image2.gif) | Scene of Crime.png | 2022-12-30 15:51 | 265K | |
![[IMG]](/icons/image2.gif) | Science Fore.png | 2022-12-30 11:39 | 317K | |
![[IMG]](/icons/image2.gif) | Sheriff Line Do not Cross.png | 2023-01-03 11:51 | 342K | |
![[IMG]](/icons/image2.gif) | Sim Card.PNG | 2023-01-12 12:14 | 681K | |
![[IMG]](/icons/image2.gif) | Soil.png | 2023-01-09 17:13 | 352K | |
![[IMG]](/icons/image2.gif) | Soil banner 1.png | 2023-01-09 15:57 | 535K | |
![[IMG]](/icons/image2.gif) | Soil banner 2.png | 2023-01-09 15:59 | 430K | |
![[IMG]](/icons/image2.gif) | The Nature of Matter.PNG | 2023-01-05 14:39 | 1.0M | |
![[ ]](/icons/layout.gif) | The Perfect Place Article.pdf | 2023-08-08 09:14 | 616K | |
![[IMG]](/icons/image2.gif) | Three Types of Heat Transfer.PNG | 2023-01-11 11:53 | 1.0M | |
![[IMG]](/icons/image2.gif) | Tox Banner.png | 2023-01-09 13:38 | 269K | |
![[IMG]](/icons/image2.gif) | Toxicology of Alchol.png | 2023-01-09 14:58 | 467K | |
![[IMG]](/icons/image2.gif) | Trace Evidence .png | 2023-01-09 16:30 | 376K | |
![[IMG]](/icons/image2.gif) | Trace elements.png | 2023-01-09 16:13 | 179K | |
![[IMG]](/icons/image2.gif) | Trace elements1.png | 2023-01-09 16:17 | 162K | |
![[IMG]](/icons/image2.gif) | Trace evidence1.png | 2023-01-09 16:45 | 147K | |
![[IMG]](/icons/image2.gif) | Trace evidence2.png | 2023-01-09 16:57 | 136K | |
![[IMG]](/icons/image2.gif) | Trace evidence banner.png | 2023-01-09 16:38 | 290K | |
![[IMG]](/icons/image2.gif) | Types of Firearms.PNG | 2023-01-05 12:28 | 305K | |
![[IMG]](/icons/image2.gif) | Understanding Chain Of Custody.png | 2022-12-30 16:28 | 334K | |
![[ ]](/icons/layout.gif) | VR Economics Project Rubric.pdf | 2023-08-08 15:25 | 109K | |
![[IMG]](/icons/image2.gif) | What is Biometrics.png | 2023-01-04 16:47 | 527K | |
![[IMG]](/icons/image2.gif) | What is DNA.png | 2023-01-10 16:37 | 543K | |
![[IMG]](/icons/image2.gif) | What is Fire.PNG | 2023-01-11 11:43 | 572K | |
![[IMG]](/icons/image2.gif) | What is Forensic Engineering.png | 2022-12-30 12:27 | 503K | |
![[IMG]](/icons/image2.gif) | What is Forensic Psychiatry.png | 2022-12-30 12:51 | 357K | |
![[IMG]](/icons/image2.gif) | What is Forensic Science.png | 2022-12-30 10:50 | 748K | |
![[IMG]](/icons/image2.gif) | What is Physical Evid.PNG | 2023-01-03 12:25 | 735K | |
![[IMG]](/icons/image2.gif) | What is Physical Evidence.PNG | 2023-01-03 10:19 | 800K | |
![[IMG]](/icons/image2.gif) | crime_unit10.png | 2023-07-27 10:39 | 440K | |
![[IMG]](/icons/image2.gif) | fingerprint-fs.png | 2023-07-07 12:32 | 102K | |
![[ ]](/icons/layout.gif) | office-2019-introductory-2019.pdf | 2023-01-18 15:57 | 104M | |
![[ ]](/icons/layout.gif) | problemsolving (1).pdf | 2023-01-18 13:25 | 14M | |
![[IMG]](/icons/image2.gif) | resources.png | 2022-12-29 11:46 | 326K | |
![[IMG]](/icons/image2.gif) | scienceoftraces.png | 2023-07-13 11:17 | 165K | |
![[IMG]](/icons/image2.gif) | test_dr.png | 2023-07-14 13:02 | 471K | |
![[IMG]](/icons/image2.gif) | toxicology.png | 2023-07-25 10:24 | 44K | |
![[IMG]](/icons/image2.gif) | unit4_forensic.png | 2023-07-21 12:14 | 31K | |
![[IMG]](/icons/image2.gif) | unit9_forensic.png | 2023-07-27 10:49 | 41K | |
|