![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1Elements Banner.png | 2021-04-22 10:24 | 369K | |
| 1st Grade Pre.png | 2021-04-09 13:34 | 81K | |
| 1stamericans.png | 2021-05-25 12:40 | 373K | |
| 1st gradepre-posttest.pdf | 2021-04-09 13:32 | 934K | |
| 2nd Grade Pre.png | 2021-04-09 14:55 | 84K | |
| 2ndgradepre-p.pdf | 2021-04-09 14:52 | 1.3M | |
| 3rd.png | 2021-06-23 14:45 | 77K | |
| 3rdgradepre-post.pdf | 2021-04-12 09:15 | 1.4M | |
| 4teenamendmanent ratified.PNG | 2021-06-09 14:29 | 914K | |
| 4th grade Math.png | 2022-03-01 10:19 | 12K | |
| 4thgradepre-posttestst.pdf | 2021-04-12 09:27 | 325K | |
| 5 4 tri.png | 2021-04-13 10:31 | 3.9K | |
| 5th grade.png | 2021-04-12 09:53 | 80K | |
| 5th grade math.png | 2021-04-12 14:24 | 346K | |
| 5thgradepre-post.pdf | 2021-04-12 09:40 | 794K | |
| 6th Grade Physical Science Workbook.pdf | 2021-04-15 16:08 | 8.5M | |
| 6thGradePre-PostTest.pdf | 2021-04-09 11:17 | 574K | |
| 6th grade math.png | 2021-04-12 13:27 | 348K | |
| 7th Grade Pre test.png | 2021-04-09 12:08 | 80K | |
| 7thgradepre-post.pdf | 2021-04-09 12:04 | 582K | |
| 8th grade.pdf | 2021-04-12 10:37 | 294K | |
| 8th grade math.png | 2021-04-12 11:40 | 440K | |
| 8thgradepre-post.pdf | 2021-04-09 12:24 | 672K | |
| 8th grade pre tes.png | 2021-04-09 12:27 | 81K | |
| 9th Pre Test Image.PNG | 2021-04-08 14:05 | 124K | |
| 9th grade Pre Test.pdf | 2021-04-08 09:52 | 543K | |
| 10th Pre Test Image.PNG | 2021-04-08 14:05 | 103K | |
| 10 th grade.png | 2021-04-08 15:36 | 81K | |
| 10th grade Pre Test.pdf | 2021-04-08 11:13 | 269K | |
| 11th Pre Test Image.PNG | 2021-04-08 14:05 | 101K | |
| 11 th grade.png | 2021-04-08 16:02 | 80K | |
| 11th grade Pre Test.pdf | 2021-04-08 11:51 | 303K | |
| 12gradepre-po.pdf | 2021-04-08 13:39 | 880K | |
| 12th Pre Test Image.PNG | 2021-04-08 14:05 | 100K | |
| 12 th grade.png | 2021-04-08 16:07 | 81K | |
| 100 years wars.PNG | 2021-05-20 12:17 | 571K | |
| AAlonso.PNG | 2021-05-14 13:39 | 1.0M | |
| ABCD Line Chart.png | 2021-04-13 14:03 | 6.9K | |
| AEgy.PNG | 2021-05-10 14:33 | 949K | |
| AF Civil.png | 2021-05-14 11:49 | 301K | |
| AJ.png | 2021-06-04 11:06 | 470K | |
| ALC SPANISH 1 ERRORS UNIT 4.docx | 2021-05-04 08:16 | 12K | |
| A Nation dividing.png | 2021-06-08 13:42 | 433K | |
| A Solar System Apply.pdf | 2021-04-20 08:59 | 1.7M | |
| ATC.png | 2021-05-26 14:35 | 442K | |
| ATG Banner.png | 2021-05-10 12:37 | 155K | |
| Abolitoninist banner.png | 2021-06-08 10:48 | 339K | |
| Absolute Monarchs.PNG | 2021-05-20 12:40 | 564K | |
| Acceleration.png | 2021-06-23 10:02 | 199K | |
| Acceleration 2.PNG | 2021-06-23 10:15 | 467K | |
| Acid Base Reactions.PNG | 2021-06-18 14:59 | 221K | |
| Acid Bases and Salts.png | 2021-06-22 09:29 | 288K | |
| Acid and Bases Apply.pdf | 2021-04-23 09:12 | 793K | |
| Acid and Bases banner.png | 2021-04-28 08:46 | 125K | |
| Acids and Bases Banner.png | 2021-04-23 09:05 | 277K | |
| Acids and banner.png | 2021-04-27 16:00 | 226K | |
| Acids bases and ph banner.png | 2021-06-18 12:23 | 230K | |
| Aernas.PNG | 2021-05-11 11:24 | 943K | |
| Af Banner.png | 2021-05-13 13:53 | 320K | |
| Africa Banner 1.png | 2021-05-13 13:43 | 235K | |
| Africa Geography banner.png | 2021-05-14 08:57 | 281K | |
| Africa banner.png | 2021-07-06 10:00 | 299K | |
| African American Regimine.PNG | 2021-05-28 13:50 | 1.1M | |
| African Savannah.PNG | 2021-05-13 14:03 | 1.0M | |
| Age of Exploratation Banner.png | 2021-05-24 12:27 | 390K | |
| Agriculture.png | 2021-07-06 11:21 | 304K | |
| Agusta Pax toma.PNG | 2021-05-11 13:02 | 1.0M | |
| Ahisma.PNG | 2021-05-06 10:44 | 611K | |
| Aj Banner.png | 2021-06-04 11:04 | 427K | |
| A kingdom divided.PNG | 2021-05-03 16:36 | 1.0M | |
| Al Aadoenous.PNG | 2021-05-13 11:51 | 393K | |
| Alexandria Egypy.PNG | 2021-05-10 14:21 | 941K | |
| Alg2PreTest-1.pdf | 2021-04-14 10:51 | 84K | |
| Algebra 1.png | 2021-04-14 09:09 | 79K | |
| Algebra 2.png | 2021-04-14 11:03 | 408K | |
| Alien Act.PNG | 2021-06-02 15:26 | 606K | |
| Alkali metals.PNG | 2021-06-16 11:07 | 349K | |
| Alpha Beta Gama.PNG | 2021-06-22 11:05 | 448K | |
| American Rev.png | 2021-05-28 12:33 | 313K | |
| Americas geo banner.png | 2021-05-14 14:43 | 298K | |
| Amnesty Act.PNG | 2021-06-10 13:01 | 1.0M | |
| Amr Banner.png | 2021-05-28 12:52 | 380K | |
| Anasazi.PNG | 2021-05-25 14:55 | 958K | |
| A nation.png | 2021-06-08 13:46 | 71K | |
| Anazi Culture.PNG | 2021-05-17 10:53 | 959K | |
| Anceint China Banna.png | 2021-05-06 13:48 | 414K | |
| Anci Rome.png | 2021-05-11 09:04 | 241K | |
| Ancient China banner.png | 2021-05-06 14:23 | 330K | |
| Ancient Greece Banner.png | 2021-05-07 14:06 | 362K | |
| Ancient Rome 1.png | 2021-05-11 08:52 | 258K | |
| Ancient r B.png | 2021-05-12 14:03 | 429K | |
| Andrew.png | 2021-06-04 13:23 | 326K | |
| Andrew Jackson.png | 2021-06-04 13:20 | 386K | |
| Anism.PNG | 2021-05-13 14:09 | 854K | |
| Arabic numerals.PNG | 2021-05-06 12:47 | 452K | |
| Arch Principles.PNG | 2021-06-15 12:50 | 353K | |
| Aristole.PNG | 2021-05-10 16:24 | 631K | |
| Arranging Elements Apply.pdf | 2021-04-22 10:05 | 1.5M | |
| Arranging the Elements.PNG | 2021-04-07 14:29 | 678K | |
| Arthenian Democracy Banner.png | 2021-05-10 11:13 | 407K | |
| Artisians.PNG | 2021-04-29 16:04 | 1.2M | |
| As.png | 2021-06-15 14:37 | 347K | |
| Assessments banner.png | 2021-04-30 09:20 | 306K | |
| Astro.PNG | 2021-05-25 16:52 | 413K | |
| Astrolabe.PNG | 2021-05-24 12:42 | 420K | |
| At gre banner.png | 2021-05-07 15:13 | 279K | |
| Athens and Sparta.png | 2021-05-10 09:20 | 372K | |
| Athens and sparta banner.png | 2021-05-07 15:56 | 408K | |
| Atom.png | 2021-06-15 14:40 | 201K | |
| Atomic Struct.png | 2021-06-15 14:35 | 160K | |
| Atomic Structure Banner.png | 2021-06-15 14:27 | 321K | |
| Atoms and Peridic Table.PNG | 2021-04-07 14:18 | 585K | |
| Atoms banner.png | 2021-06-16 12:01 | 264K | |
| BTP.png | 2021-05-28 09:50 | 290K | |
| Babylion Captivity.PNG | 2021-05-03 16:33 | 328K | |
| Background Rad.PNG | 2021-06-22 16:26 | 723K | |
| Bacons Rebllion.PNG | 2021-05-26 16:41 | 1.0M | |
| Bal Equa.png | 2021-06-17 13:19 | 62K | |
| Balancing.png | 2021-06-17 13:14 | 138K | |
| B and F.png | 2021-05-27 11:11 | 94K | |
| Banner Africa.png | 2021-05-13 16:10 | 294K | |
| Barth Diax.PNG | 2021-05-26 11:11 | 770K | |
| Basic Propability.png | 2022-03-01 13:35 | 607K | |
| Battleground.png | 2021-06-03 11:41 | 126K | |
| Battle of BullRun.png | 2021-06-09 13:34 | 294K | |
| Battle of Bunker Hill.PNG | 2021-05-28 10:49 | 781K | |
| Battle of Ches.PNG | 2021-06-03 10:22 | 1.0M | |
| Battle of Cowpens.PNG | 2021-06-01 13:11 | 883K | |
| Battle of Lake Eerie.PNG | 2021-06-03 12:05 | 502K | |
| Battle of Long Island.PNG | 2021-05-28 13:01 | 795K | |
| Battle of New Orleans.PNG | 2021-06-03 11:53 | 1.0M | |
| Battle of Shilol.PNG | 2021-06-09 13:43 | 555K | |
| Battle of Yorktown.PNG | 2021-06-01 13:52 | 817K | |
| Battle of franks.png | 2021-06-10 09:13 | 399K | |
| Battle of fred.png | 2021-06-10 09:24 | 286K | |
| Battle of quebec.PNG | 2021-05-27 12:30 | 859K | |
| Battles of Saratoga.PNG | 2021-05-28 13:47 | 914K | |
| Batttle.png | 2021-06-10 09:29 | 358K | |
| Begining of civilization.png | 2021-07-06 08:59 | 393K | |
| Ben Franklin.PNG | 2021-05-27 11:24 | 487K | |
| Biochemical Compounds.png | 2021-06-17 10:06 | 90K | |
| Biochemical compounds banner.png | 2021-06-17 10:10 | 197K | |
| Black Codes.PNG | 2021-06-10 11:54 | 359K | |
| Black soliders.PNG | 2021-06-09 14:23 | 605K | |
| Bleeding Kansas.PNG | 2021-06-08 14:04 | 240K | |
| Blue Learn More.png | 2021-06-22 13:49 | 32K | |
| BookGraphic.png | 2021-05-11 09:11 | 147K | |
| Border States.PNG | 2021-06-09 13:09 | 744K | |
| Boston.png | 2021-05-28 09:52 | 603K | |
| Boston Tea Party Banner.png | 2021-05-28 08:55 | 411K | |
| Britian France Banner.png | 2021-05-27 11:02 | 262K | |
| Bud.png | 2021-05-06 10:30 | 490K | |
| Bud banner.png | 2021-05-06 10:48 | 433K | |
| Buoyancy.PNG | 2021-06-15 12:56 | 522K | |
| Buoyancy Apply.pdf | 2021-04-16 12:17 | 1.0M | |
| Buoyancy and Densiy Apply.pdf | 2021-04-16 11:56 | 1.0M | |
| Buuilding.png | 2021-06-08 10:05 | 236K | |
| Byzantine Empire banner.png | 2021-05-12 12:50 | 457K | |
| Byzantine Empire banner1.png | 2021-05-12 12:54 | 459K | |
| C Congress banner.png | 2021-05-28 10:33 | 399K | |
| Calderon.PNG | 2021-05-18 16:27 | 410K | |
| Captain John Smith.PNG | 2021-05-26 14:55 | 530K | |
| Carbon The Element of Life.PNG | 2021-04-28 11:14 | 650K | |
| Carbon dating.PNG | 2021-05-25 11:44 | 855K | |
| Carbs.PNG | 2021-04-28 13:51 | 685K | |
| Cash Crop.PNG | 2021-05-27 09:17 | 670K | |
| Catalyst.PNG | 2021-06-17 15:45 | 228K | |
| Central and South banner.png | 2021-05-17 09:06 | 316K | |
| Ch 4 Ancient egypt.PNG | 2021-05-04 12:47 | 553K | |
| Ch 7 Ancient Greece.PNG | 2021-05-07 11:32 | 636K | |
| Ch 9 The Rise of Rome.PNG | 2021-05-11 08:36 | 427K | |
| Change in Matter Banner.png | 2021-06-14 16:31 | 276K | |
| Changes in matter.png | 2021-06-14 16:49 | 186K | |
| Changes of State Appply.pdf | 2021-04-20 13:25 | 1.2M | |
| Changing world banne.png | 2021-05-25 16:27 | 123K | |
| Chemcial Reaction types banner.png | 2021-06-17 12:04 | 327K | |
| Chemcical formula banner.png | 2021-04-22 13:46 | 271K | |
| Chemical.png | 2021-06-17 11:29 | 260K | |
| Chemical Bond Video.PNG | 2021-04-23 11:43 | 582K | |
| Chemical Bonding (1)-1.pdf | 2021-06-01 10:41 | 344K | |
| Chemical Bonding.png | 2021-04-22 11:16 | 191K | |
| Chemical Bonding 11.PNG | 2021-04-23 12:38 | 855K | |
| Chemical Bonding Banner.png | 2021-04-23 11:17 | 166K | |
| Chemical Energy.PNG | 2021-06-17 11:32 | 745K | |
| Chemical Formuals and Equations apply.pdf | 2021-04-22 13:49 | 961K | |
| Chemical Formulas.PNG | 2021-04-26 12:40 | 167K | |
| Chemical React.PNG | 2021-04-26 11:47 | 795K | |
| Chemical Reaction.png | 2021-06-17 11:24 | 171K | |
| Chemical Reaction bann.png | 2021-06-17 10:54 | 322K | |
| Chemical Reactions Banner.png | 2021-04-26 11:02 | 455K | |
| Chemical Reaction types.PNG | 2021-06-17 12:29 | 245K | |
| Chemical equations bannner.png | 2021-06-17 13:06 | 311K | |
| Chemical formula banner.png | 2021-06-16 15:57 | 236K | |
| Chemical properties apply.pdf | 2021-04-20 13:02 | 1.1M | |
| Cherokee Nation.PNG | 2021-06-04 12:53 | 1.0M | |
| Chesapeka battle.png | 2021-06-03 11:04 | 298K | |
| China 1 Banner.png | 2021-05-07 09:46 | 381K | |
| China B.png | 2021-05-17 12:28 | 324K | |
| China Banner.png | 2021-05-17 12:19 | 365K | |
| Chinese dynaasty.PNG | 2021-05-06 15:21 | 958K | |
| Chr.PNG | 2021-05-11 16:26 | 723K | |
| Chrisis of succession.PNG | 2021-05-13 11:08 | 1.1M | |
| Christianity bannert.png | 2021-05-11 16:10 | 370K | |
| Cities and e.png | 2021-05-25 13:14 | 324K | |
| City States.PNG | 2021-07-06 14:01 | 1.0M | |
| Civil.png | 2021-06-09 12:51 | 201K | |
| Civil War Banner.png | 2021-06-08 12:13 | 372K | |
| Civil War Draft Law banner.PNG | 2021-06-09 16:10 | 594K | |
| Civil War Recon banner.png | 2021-06-10 12:14 | 174K | |
| Civilization banner.png | 2021-07-06 11:51 | 87K | |
| Civil war.png | 2021-06-08 12:16 | 193K | |
| Civil war Header.png | 2021-06-09 09:49 | 393K | |
| Civil war he.png | 2021-06-09 16:00 | 319K | |
| Civil war life.png | 2021-06-09 16:07 | 230K | |
| Civil war what was law.PNG | 2021-06-09 16:20 | 776K | |
| Classification of elements.PNG | 2021-06-16 11:04 | 478K | |
| Clipper Ships Dynasty.PNG | 2021-06-07 09:36 | 427K | |
| Clipper ships.png | 2021-06-07 09:31 | 258K | |
| Clovis.PNG | 2021-05-12 12:20 | 1.0M | |
| Code of Hamm.PNG | 2021-07-06 14:03 | 706K | |
| Code of Law.PNG | 2021-05-03 13:43 | 472K | |
| Colloids.PNG | 2021-06-18 09:38 | 423K | |
| Colonial.png | 2021-05-26 14:32 | 463K | |
| Colonial America.png | 2021-05-26 13:43 | 432K | |
| Colonial America paper.png | 2021-05-26 14:09 | 434K | |
| Colonial Governement.png | 2021-05-27 10:18 | 309K | |
| Colonialism Banner.png | 2021-05-24 13:16 | 354K | |
| Colonian America Banner.png | 2021-05-26 14:00 | 348K | |
| Colonies Banner.png | 2021-05-27 08:27 | 349K | |
| Colonies middle.PNG | 2021-05-26 16:16 | 466K | |
| Communites banner.png | 2021-04-29 13:52 | 257K | |
| Comporomise.png | 2021-06-10 14:38 | 1.2M | |
| Compound.png | 2021-06-24 10:56 | 622K | |
| Compound Banner.png | 2021-04-23 08:51 | 315K | |
| Compound Machine.PNG | 2021-06-24 10:38 | 561K | |
| Compound banner 1.png | 2021-04-27 13:12 | 469K | |
| Compound name and formuals.png | 2021-06-16 16:05 | 63K | |
| Compounds.png | 2021-04-20 15:44 | 295K | |
| Compounds Apply.pdf | 2021-04-20 15:43 | 655K | |
| Compounds in Living things Banner.png | 2021-04-23 09:51 | 298K | |
| Compounds in living thingd Apply.pdf | 2021-04-23 09:57 | 1.2M | |
| Compromise if 1850 Banner.png | 2021-06-08 13:38 | 236K | |
| Compromise if 1850 Banner1.png | 2021-06-08 13:39 | 232K | |
| Compromise of 1850.PNG | 2021-06-08 13:04 | 791K | |
| Compromise of 1877.PNG | 2021-06-10 13:13 | 1.0M | |
| Concentration of Solutions.PNG | 2021-04-07 12:36 | 697K | |
| Condensation.PNG | 2021-06-15 11:29 | 886K | |
| Confederate States.PNG | 2021-06-09 12:54 | 360K | |
| Congress Continental.png | 2021-05-28 10:42 | 505K | |
| Conservation of Energy.png | 2021-06-24 14:03 | 122K | |
| Constrine The Great.PNG | 2021-05-12 10:14 | 667K | |
| Continental.png | 2021-05-28 10:36 | 291K | |
| Cortes zonquers.PNG | 2021-05-26 12:08 | 1.0M | |
| Cottin Gin.PNG | 2021-06-07 13:40 | 950K | |
| Cotton Banner.png | 2021-06-07 10:57 | 301K | |
| Cotton Gin.PNG | 2021-06-03 13:05 | 833K | |
| Counting Atoms.PNG | 2021-06-16 12:27 | 791K | |
| Cov And Metal.png | 2021-04-22 12:09 | 252K | |
| Cov Bonding.PNG | 2021-04-27 14:06 | 407K | |
| Cov and Ion Apply.pdf | 2021-04-22 12:20 | 1.5M | |
| Covelne bonding.PNG | 2021-06-16 15:31 | 410K | |
| Creating a Nation.png | 2021-06-11 11:43 | 449K | |
| Crusaders.png | 2021-05-20 10:50 | 86K | |
| Crusaders banner.png | 2021-05-20 10:52 | 118K | |
| Cube.png | 2021-04-13 09:46 | 14K | |
| Cubes.png | 2021-04-13 15:41 | 4.2K | |
| Cultural Diffusion.PNG | 2021-05-07 10:32 | 586K | |
| Cuneiform.PNG | 2021-07-06 12:32 | 700K | |
| Daoism.PNG | 2021-05-06 16:17 | 717K | |
| Daosim banner.png | 2021-05-06 15:55 | 397K | |
| Delcaration Approved.PNG | 2021-05-28 11:45 | 281K | |
| Developmnent of the Atomic Theory Apply.pdf | 2021-04-22 08:59 | 1.7M | |
| Diaspora.PNG | 2021-05-04 11:21 | 38K | |
| Dicelen Empire.PNG | 2021-05-12 12:09 | 808K | |
| Dissolve.png | 2021-06-18 10:25 | 415K | |
| Distance and Displacement.PNG | 2021-06-23 09:20 | 1.1M | |
| Doc 1.pdf | 2021-04-23 16:25 | 95M | |
| Document 1 | 2021-04-23 16:21 | 95M | |
| Document_2021-04-23_163143.pdf | 2021-04-23 16:17 | 50M | |
| Document_2021-04-23_163143_opt.pdf | 2021-04-23 16:29 | 23M | |
| Double Displacment.PNG | 2021-06-17 12:35 | 929K | |
| Dred Scott Decision.PNG | 2021-06-08 14:54 | 854K | |
| Dynastic Cycle.PNG | 2021-05-06 15:11 | 402K | |
| Dynastic cycle in China.PNG | 2021-07-06 16:05 | 393K | |
| EP.png | 2021-06-09 14:19 | 169K | |
| Early Americas.png | 2021-05-26 14:28 | 361K | |
| Early CHistians in.PNG | 2021-05-11 16:24 | 723K | |
| Early Human Societies Banner.png | 2021-04-29 12:14 | 288K | |
| Eastern.PNG | 2021-05-12 13:42 | 796K | |
| Economic.png | 2021-06-03 12:58 | 215K | |
| Economic Growth.png | 2021-06-03 12:56 | 105K | |
| Economic Growth banner.png | 2021-06-03 12:52 | 336K | |
| Egypt Banner.png | 2021-05-05 12:36 | 284K | |
| Egypt Mummt.PNG | 2021-05-05 11:06 | 608K | |
| Egypt_video8k.png | 2022-08-23 16:00 | 3.4M | |
| Electiong of 1796.PNG | 2021-06-02 15:22 | 322K | |
| Election of 1832.PNG | 2021-06-04 13:35 | 610K | |
| Election of 1856.PNG | 2021-06-08 14:49 | 715K | |
| Election of 1864.PNG | 2021-06-10 09:37 | 500K | |
| Electrolyte.PNG | 2021-06-18 13:41 | 523K | |
| Elementary English Banner.png | 2021-04-09 13:18 | 339K | |
| Elements2 Banner.png | 2021-04-23 09:43 | 299K | |
| Elements Apply.pdf | 2021-04-20 13:45 | 750K | |
| Elements Banner.png | 2021-04-22 10:21 | 356K | |
| Elements banner.png | 2021-06-16 10:48 | 156K | |
| Elements in Living things Apply.pdf | 2021-04-23 09:45 | 665K | |
| Elements of Geography.png | 2021-04-30 09:28 | 155K | |
| Elements of Life.PNG | 2021-04-28 11:33 | 615K | |
| Elements vs Compounds.PNG | 2021-06-14 13:50 | 171K | |
| Eli Wit.PNG | 2021-06-07 13:37 | 1.1M | |
| Eliz era.PNG | 2021-05-21 11:53 | 380K | |
| Emp Formula.PNG | 2021-06-16 16:24 | 737K | |
| Emp Musa.PNG | 2021-05-13 15:35 | 1.1M | |
| Emulsion.PNG | 2021-06-18 09:41 | 499K | |
| End of Reconstruction.PNG | 2021-06-10 12:57 | 925K | |
| Endo vs Exo.PNG | 2021-04-26 11:29 | 592K | |
| Energy and Matter.png | 2021-06-15 10:14 | 272K | |
| Energy transformations.PNG | 2021-06-28 08:36 | 161K | |
| English+2-Unit_2_Test_Combined.pdf | 2021-06-10 16:02 | 10M | |
| English 9.png | 2021-04-08 15:33 | 81K | |
| English Bill of Rights.PNG | 2021-05-27 10:31 | 304K | |
| English Common LAw.PNG | 2021-05-20 13:38 | 199K | |
| English Language Arts.png | 2021-04-09 10:38 | 89K | |
| English settlements.png | 2021-05-26 14:07 | 380K | |
| Enzymes.PNG | 2021-06-17 15:49 | 271K | |
| Ethics.PNG | 2021-05-11 16:36 | 611K | |
| Exo Endo.PNG | 2021-06-17 11:34 | 469K | |
| Exploration banner.png | 2021-05-26 10:19 | 282K | |
| Exploration banner1.png | 2021-05-26 11:53 | 329K | |
| Exploring the Renassiance.PNG | 2021-05-21 10:06 | 541K | |
| FRANCE and britian.png | 2021-05-27 11:07 | 161K | |
| Fallen Timber.PNG | 2021-06-02 14:13 | 483K | |
| Fall of Rome Banner.png | 2021-05-12 12:03 | 291K | |
| Families of elements.png | 2021-06-16 10:59 | 365K | |
| Fertile Soil.PNG | 2021-04-29 15:59 | 1.1M | |
| Feudalism Banner 1.png | 2021-05-20 09:35 | 308K | |
| Feudalism banner.png | 2021-05-20 09:29 | 335K | |
| First Americans banner.png | 2021-05-25 11:10 | 443K | |
| First Battle of Bullrun.PNG | 2021-06-09 13:40 | 809K | |
| First Communites Banner.png | 2021-05-03 10:08 | 449K | |
| Fission.png | 2021-06-22 12:24 | 145K | |
| Fluid and Pressure Apply.pdf | 2021-04-16 11:51 | 1.0M | |
| Fluid properties.png | 2021-06-15 12:44 | 81K | |
| Fluids bannner.png | 2021-06-15 12:40 | 69K | |
| Force and Motion Banner.png | 2021-06-23 10:45 | 329K | |
| Force and motion.png | 2021-06-23 12:02 | 195K | |
| Formation of Ions.PNG | 2021-04-23 15:14 | 379K | |
| Formation of the Universe Apply.pdf | 2021-04-16 15:26 | 820K | |
| Formulas Banner.png | 2021-04-26 13:22 | 244K | |
| Fort Sumter Banner.png | 2021-06-09 12:46 | 408K | |
| Fort Sumter Image.png | 2021-06-09 12:48 | 239K | |
| Fort sUMTER.PNG | 2021-06-08 16:44 | 842K | |
| Free Fall.PNG | 2021-06-23 13:47 | 701K | |
| Freedman.png | 2021-06-07 10:33 | 197K | |
| Freedman JOurnal.png | 2021-06-07 10:31 | 229K | |
| Freedmans Bank.PNG | 2021-06-10 12:23 | 708K | |
| Freedmans Bureau.PNG | 2021-06-10 11:01 | 1.0M | |
| French and.png | 2021-05-27 12:23 | 804K | |
| French and In.png | 2021-05-27 12:50 | 512K | |
| French and Indian War Banner.png | 2021-05-27 11:40 | 319K | |
| French and Indian war.png | 2021-05-27 12:20 | 383K | |
| Friction banner.png | 2021-04-16 10:41 | 339K | |
| Fwertile.PNG | 2021-05-05 09:40 | 590K | |
| GFW.PNG | 2021-06-02 14:19 | 681K | |
| GW.png | 2021-06-02 10:14 | 220K | |
| Galaxies Apply.pdf | 2021-04-16 15:04 | 537K | |
| General Washington.PNG | 2021-05-27 11:20 | 930K | |
| Genghis Khan.PNG | 2021-05-17 16:47 | 1.0M | |
| Geo Of Americas.PNG | 2021-05-14 15:17 | 777K | |
| Geocentric.PNG | 2021-05-24 11:23 | 715K | |
| Geography of Meso.PNG | 2021-05-03 11:07 | 363K | |
| Geometry.png | 2021-04-12 12:31 | 114K | |
| Geometry Banner.png | 2021-04-12 12:37 | 352K | |
| Geometry CP Pre & Post Test-1.pdf | 2021-04-12 12:26 | 505K | |
| Geometry Post pre.png | 2021-04-12 12:53 | 358K | |
| George.png | 2021-06-02 11:24 | 566K | |
| George W.png | 2021-06-02 10:33 | 566K | |
| Georgraphy of ancient Greece.PNG | 2021-05-07 13:10 | 1.0M | |
| Gettysburg Address.PNG | 2021-06-10 09:35 | 890K | |
| Gin cotton.png | 2021-06-03 13:21 | 157K | |
| Glhandi.PNG | 2021-05-06 12:36 | 525K | |
| Golden Age Banner.png | 2021-05-13 11:37 | 275K | |
| Golden Age Vi.PNG | 2021-05-13 11:43 | 906K | |
| Golden Age of Greece banner.png | 2021-05-10 15:02 | 453K | |
| Government Banner.png | 2021-05-20 13:30 | 318K | |
| Graant banner.png | 2021-06-10 11:24 | 285K | |
| Grade 5.pdf | 2021-04-12 14:36 | 194K | |
| Grade 6 math.pdf | 2021-04-12 13:42 | 198K | |
| Grade 8 Math Practice.pdf | 2021-04-12 10:52 | 159K | |
| Grade 8 Mathematics.pdf | 2021-04-12 10:47 | 298K | |
| Grant.PNG | 2021-06-10 12:00 | 758K | |
| Gravity.png | 2021-06-23 13:12 | 228K | |
| Gravity Apply.pdf | 2021-04-16 11:11 | 906K | |
| Gravity Banner.png | 2021-06-23 13:08 | 74K | |
| Gravity and Motion Apply.pdf | 2021-04-16 11:16 | 1.4M | |
| Great Schism.PNG | 2021-05-21 12:34 | 353K | |
| Great Zimb.PNG | 2021-05-14 12:06 | 1.0M | |
| Greece.png | 2021-05-07 11:49 | 380K | |
| Greece Banner.png | 2021-05-07 12:34 | 390K | |
| Greece Banner1.png | 2021-05-07 12:48 | 441K | |
| Greece Banner2.png | 2021-05-07 12:50 | 442K | |
| Greek City States.PNG | 2021-05-03 12:23 | 1.0M | |
| Greek Direct Democraxy.PNG | 2021-05-10 11:29 | 949K | |
| Green Learn More.png | 2021-06-22 13:49 | 32K | |
| Grey Learn More.png | 2021-06-22 14:39 | 15K | |
| Grey Learn More1.png | 2021-06-22 14:51 | 17K | |
| Grouping the Elements Apply.pdf | 2021-04-22 10:29 | 1.3M | |
| Groups of the Perioidic Table.PNG | 2021-04-07 14:48 | 239K | |
| Gutenberg.PNG | 2021-05-21 11:22 | 422K | |
| Gwba.png | 2021-06-02 10:18 | 175K | |
| Habeous Corpus.PNG | 2021-05-20 13:47 | 366K | |
| Half Life.PNG | 2021-06-22 11:09 | 490K | |
| Ham vs Bu.PNG | 2021-06-03 09:30 | 843K | |
| Han Dynasty collapse.PNG | 2021-05-17 12:33 | 676K | |
| H and H Mixtures.PNG | 2021-06-18 09:30 | 675K | |
| Hapan banner.png | 2021-05-18 14:31 | 419K | |
| Harapan.PNG | 2021-07-06 15:11 | 1.1M | |
| Hatsheput.PNG | 2021-05-05 14:13 | 787K | |
| HebrewActivityBanner.png | 2021-05-03 15:35 | 303K | |
| Hellenstic Age.PNG | 2021-05-10 14:05 | 820K | |
| Henrey Clay.png | 2021-06-08 12:32 | 327K | |
| Hiero.PNG | 2021-07-06 14:43 | 793K | |
| Hierogylphs.PNG | 2021-05-05 10:44 | 799K | |
| Hindu Numbers.PNG | 2021-05-06 12:51 | 301K | |
| Hinduism.PNG | 2021-05-06 08:48 | 1.0M | |
| Hinduism 2.png | 2021-05-06 08:54 | 346K | |
| History of America.PNG | 2021-05-25 11:17 | 884K | |
| History of Law and religion.PNG | 2021-05-12 14:20 | 396K | |
| History of corn.PNG | 2021-05-25 11:36 | 1.0M | |
| History of the Atom.PNG | 2021-06-15 14:47 | 512K | |
| Holcolu.PNG | 2021-05-25 14:52 | 1.0M | |
| Homosaphiens.PNG | 2021-07-06 10:38 | 551K | |
| House Hold.PNG | 2021-06-22 09:36 | 1.0M | |
| How Islam Began.PNG | 2021-05-13 09:19 | 613K | |
| How The Ice Ages Happen.PNG | 2021-05-25 11:29 | 265K | |
| How to Balance Equations.PNG | 2021-06-17 14:00 | 487K | |
| Hunter Gathers.PNG | 2021-04-29 15:03 | 753K | |
| Hydrogen bonding.PNG | 2021-06-18 10:36 | 533K | |
| INDO.png | 2021-07-06 16:53 | 232K | |
| I and C Bonds.PNG | 2021-04-23 15:33 | 556K | |
| Ibe Pren.PNG | 2021-05-13 10:31 | 1.1M | |
| Impacts.PNG | 2021-06-09 14:26 | 497K | |
| Inda ban.png | 2021-05-06 11:57 | 352K | |
| India Geography Banner1.jpg | 2021-05-05 15:35 | 108K | |
| India Life Baner.png | 2021-05-05 15:42 | 247K | |
| India Subcontinent.PNG | 2021-05-05 16:12 | 425K | |
| Indian Subcontinent.PNG | 2021-07-06 15:07 | 424K | |
| Indicatores.PNG | 2021-04-27 16:34 | 303K | |
| IndoEuropean Banner.png | 2021-07-06 16:36 | 351K | |
| Indus banner.png | 2021-07-06 14:55 | 418K | |
| Industrial Rev.png | 2021-06-03 12:47 | 262K | |
| Indus valley.PNG | 2021-05-05 16:17 | 1.1M | |
| Inic and cov bond banner.png | 2021-06-16 14:17 | 129K | |
| Intolderable acts.PNG | 2021-05-28 10:13 | 735K | |
| Into to mole.PNG | 2021-06-16 12:19 | 262K | |
| Invention of the telegraph.PNG | 2021-06-07 09:39 | 412K | |
| Inxlined plane.PNG | 2021-06-24 10:42 | 741K | |
| Ion.PNG | 2021-06-16 16:30 | 750K | |
| Ionic.png | 2021-06-16 14:27 | 123K | |
| Ionic Bonds.PNG | 2021-04-23 15:08 | 670K | |
| Ionic Bonds Banner.png | 2021-04-22 11:47 | 305K | |
| Ionic Compounds.PNG | 2021-04-27 14:02 | 405K | |
| Ionic and Covalent Compounds Apply.pdf | 2021-04-23 08:53 | 854K | |
| Ionic bonds Apply.pdf | 2021-04-22 11:49 | 1.2M | |
| Ionic bonf banner.png | 2021-04-23 13:52 | 78K | |
| Iroqiois Confed.PNG | 2021-05-17 11:04 | 1.0M | |
| Islam Banner 3.png | 2021-05-13 08:30 | 321K | |
| Italian Renassiance Banner.png | 2021-05-21 09:52 | 336K | |
| Jacksonial Democracy Banner.png | 2021-06-04 11:15 | 317K | |
| Jacksonian democracy.png | 2021-06-04 11:27 | 195K | |
| Jacx.png | 2021-06-04 11:34 | 313K | |
| James Monroe.PNG | 2021-06-03 15:57 | 737K | |
| Jamestown.png | 2021-05-26 14:14 | 473K | |
| Japan 1 Banner.png | 2021-05-18 14:40 | 386K | |
| Japan Middle Ages.PNG | 2021-05-18 15:04 | 776K | |
| Jax Banner.png | 2021-06-04 11:35 | 245K | |
| Joan of Arc.PNG | 2021-05-20 12:21 | 712K | |
| John Calvin.PNG | 2021-05-21 14:33 | 1.1M | |
| John Dalton Atomic Theory.PNG | 2021-06-15 15:06 | 440K | |
| John Paul Jones.PNG | 2021-06-01 12:28 | 1.1M | |
| Journal.png | 2021-05-25 14:29 | 24K | |
| Judasims.PNG | 2021-05-03 15:56 | 868K | |
| Judiary Act.PNG | 2021-06-02 10:59 | 664K | |
| Julius Ce.PNG | 2021-05-11 12:27 | 1.0M | |
| Justinan.PNG | 2021-05-12 13:18 | 942K | |
| Justinan Code.PNG | 2021-05-12 13:47 | 392K | |
| Kansas Nebraska Act.PNG | 2021-06-08 14:02 | 1.1M | |
| Khelmer Empire.PNG | 2021-05-18 16:22 | 923K | |
| Kilwa.PNG | 2021-05-14 13:45 | 1.1M | |
| Kinetic Energy.PNG | 2021-06-24 11:24 | 501K | |
| King John And Magna.PNG | 2021-05-20 13:42 | 451K | |
| King Piye.PNG | 2021-05-05 14:29 | 921K | |
| Korea Banner.png | 2021-05-18 16:11 | 289K | |
| Kush Power.PNG | 2021-05-05 14:23 | 892K | |
| Kush banner.png | 2021-05-05 13:36 | 227K | |
| LCE.PNG | 2021-06-24 14:05 | 881K | |
| LDV.PNG | 2021-05-21 10:21 | 1.0M | |
| LE chat prin.PNG | 2021-06-17 15:53 | 456K | |
| La Purchase.png | 2021-06-02 16:49 | 158K | |
| Lang Arts.png | 2021-04-12 09:58 | 83K | |
| Language Arts II Banner.png | 2021-04-09 11:59 | 353K | |
| Law of Conservation of Mass.PNG | 2021-04-26 13:28 | 684K | |
| Law of definte.PNG | 2021-06-17 14:08 | 373K | |
| Law of motion.png | 2021-06-23 12:46 | 59K | |
| Learn More.png | 2021-06-22 13:29 | 37K | |
| Learn More Blue.png | 2021-06-22 13:32 | 38K | |
| Learn More Green.png | 2021-06-22 13:35 | 39K | |
| LearnMore Purple.png | 2021-06-22 14:35 | 32K | |
| Learn More red.png | 2021-06-22 13:40 | 67K | |
| Learn More red1.png | 2021-06-22 13:45 | 32K | |
| Lesson 1 The Earliest Humans Societies.PNG | 2021-04-29 16:55 | 607K | |
| Levers.PNG | 2021-06-24 10:34 | 350K | |
| Lexington and Concord.PNG | 2021-05-28 10:58 | 873K | |
| Liberia.png | 2021-06-08 11:05 | 197K | |
| Life during the Civil War.png | 2021-06-09 16:04 | 278K | |
| Life in Athend.PNG | 2021-05-10 09:44 | 1.1M | |
| Life in the Colonies Banner.png | 2021-05-27 08:37 | 428K | |
| Lincoln elected as president.PNG | 2021-06-08 16:36 | 587K | |
| Living things banner.png | 2021-04-28 10:39 | 253K | |
| Lord Cornwall.PNG | 2021-06-01 13:59 | 754K | |
| Lost Colony.PNG | 2021-05-26 14:49 | 667K | |
| Lost Colony of.PNG | 2021-05-26 14:50 | 667K | |
| Lousiana expanison.png | 2021-06-02 16:43 | 411K | |
| Loyola.PNG | 2021-05-21 14:14 | 424K | |
| MJ Lang 1 Arts.png | 2021-04-09 11:21 | 82K | |
| Macedonian Empire.PNG | 2021-05-10 13:01 | 1.0M | |
| Mag Field.png | 2022-02-14 17:50 | 248K | |
| Magellian.PNG | 2021-05-26 11:22 | 915K | |
| Marco Polo.PNG | 2021-05-17 16:53 | 1.0M | |
| Marlbury vs madison.PNG | 2021-06-02 16:18 | 790K | |
| Martin Luther and the Protestant Reformation.PNG | 2021-05-21 12:45 | 333K | |
| Masada.PNG | 2021-05-04 11:26 | 1.0M | |
| Mason Dixon Line.PNG | 2021-05-26 16:39 | 684K | |
| Math 1.png | 2022-03-01 13:27 | 461K | |
| Math banner.png | 2021-04-12 11:25 | 128K | |
| Matter and energy banner.png | 2021-06-15 10:08 | 195K | |
| Matter vs energy.png | 2021-06-15 10:26 | 239K | |
| Matter vs energy1.png | 2021-06-15 10:29 | 338K | |
| Maya History.PNG | 2021-05-25 13:24 | 562K | |
| Mayan Cities Banner.png | 2021-05-25 12:50 | 379K | |
| Mayflower Compact.PNG | 2021-05-26 15:30 | 460K | |
| Measuring in Motion Apply.pdf | 2021-04-16 10:55 | 914K | |
| Meausring in Motion Banner.png | 2021-06-23 09:08 | 98K | |
| Mechanical Energy.PNG | 2021-06-24 11:27 | 1.0M | |
| Meghal smpire banner.png | 2021-05-19 08:32 | 263K | |
| Melting Point.PNG | 2021-06-14 15:42 | 658K | |
| Meoptamia banner.png | 2021-07-06 13:24 | 347K | |
| Meos.png | 2021-07-06 13:36 | 393K | |
| Mercan.PNG | 2021-05-24 13:29 | 577K | |
| Mercasntilism.PNG | 2021-05-27 10:24 | 824K | |
| Mesoamerica.PNG | 2021-05-14 14:50 | 536K | |
| Mesopotamia.png | 2021-05-03 10:52 | 411K | |
| Mesopotamia 1.png | 2021-05-03 10:54 | 207K | |
| Metallic Bonding.PNG | 2021-04-23 15:43 | 383K | |
| Metals and non metals.PNG | 2021-06-16 11:10 | 371K | |
| MichaelAngelo.PNG | 2021-05-21 10:29 | 748K | |
| MicrosoftTeams-image.png | 2022-03-03 13:03 | 211K | |
| Middle Kingdom.PNG | 2021-05-05 12:21 | 967K | |
| Midle colonies.png | 2021-05-26 15:50 | 343K | |
| Midle colonies1.png | 2021-05-26 15:53 | 402K | |
| Missouri Compromise.png | 2021-06-03 15:55 | 305K | |
| Missourii.PNG | 2021-06-03 15:59 | 938K | |
| Mixtures1 Banner.png | 2021-04-22 08:47 | 275K | |
| Mixtures Apply.pdf | 2021-04-22 08:49 | 1.3M | |
| Mixtures and Charachter.PNG | 2021-04-07 12:28 | 503K | |
| Molar Mass.PNG | 2021-06-16 12:33 | 327K | |
| Mole Ratio.PNG | 2021-06-17 14:03 | 637K | |
| Molecular Formula.PNG | 2021-06-16 16:28 | 715K | |
| Mole vs compound.png | 2021-06-16 13:16 | 138K | |
| Momentum 1.PNG | 2021-06-23 14:47 | 520K | |
| Momentum 2.PNG | 2021-06-23 14:49 | 486K | |
| Mongolian Empire.png | 2021-05-17 16:21 | 40K | |
| Monothesism.PNG | 2021-05-03 15:52 | 210K | |
| Monroe Doc.PNG | 2021-06-03 16:09 | 795K | |
| Montzumia II.PNG | 2021-05-17 09:35 | 861K | |
| Monument Banner.png | 2021-06-02 10:04 | 380K | |
| Morse Code Banner.png | 2021-06-07 09:08 | 161K | |
| Mose Code.PNG | 2021-06-07 09:59 | 806K | |
| Moses and the Ten.PNG | 2021-05-03 15:59 | 820K | |
| Mosque.PNG | 2021-05-25 16:48 | 1.0M | |
| Moss.png | 2021-06-08 12:34 | 411K | |
| Motion Speed.png | 2021-06-23 09:10 | 140K | |
| Moundbuils.PNG | 2021-05-25 15:01 | 1.0M | |
| Mount Olympus.PNG | 2021-05-07 14:36 | 860K | |
| Mughaul Decline.PNG | 2021-05-19 09:46 | 372K | |
| Muslim rULE.png | 2021-05-13 10:16 | 101K | |
| My video - Date (1).mp4 | 2021-05-25 12:10 | 17M | |
| NE BAnner.png | 2021-05-26 15:15 | 310K | |
| NE COLONY MSP.png | 2021-05-26 15:20 | 44K | |
| NE colonies.png | 2021-05-26 15:28 | 102K | |
| NE colony map.png | 2021-05-26 15:26 | 44K | |
| Narmer.PNG | 2021-07-06 14:36 | 619K | |
| Nat Turner.png | 2021-06-07 14:35 | 373K | |
| Nat Turner Bio.PNG | 2021-06-07 16:51 | 1.1M | |
| Natural occuring.PNG | 2021-06-17 10:26 | 413K | |
| Navatism.PNG | 2021-06-07 10:39 | 595K | |
| Navigating the Oceans.PNG | 2021-05-24 12:39 | 322K | |
| Neoltic Age.PNG | 2021-07-06 10:32 | 425K | |
| Neoltic revolution.PNG | 2021-07-06 11:33 | 1.2M | |
| Neutralization Reaction.PNG | 2021-06-18 15:05 | 485K | |
| Neutralization Reaction1.PNG | 2021-06-18 15:07 | 485K | |
| New Nation Banner.png | 2021-06-02 09:47 | 88K | |
| New Spain.PNG | 2021-05-26 16:44 | 904K | |
| New Substance apply.pdf | 2021-04-22 13:27 | 936K | |
| Newtons LAws Apply.pdf | 2021-04-16 11:28 | 1.4M | |
| Newtons Laws.png | 2021-06-23 12:39 | 278K | |
| Nile Banner 2.png | 2021-05-04 14:48 | 288K | |
| Nile Pyramid.png | 2021-07-06 14:28 | 205K | |
| Nile Pyramid Banner.png | 2021-07-06 14:23 | 404K | |
| Nile River Banner.png | 2021-05-04 14:24 | 411K | |
| Nile River Banner1.png | 2021-05-04 15:21 | 283K | |
| Nomads.PNG | 2021-04-29 14:52 | 453K | |
| North.png | 2021-05-26 14:41 | 528K | |
| North American Banner.png | 2021-05-26 12:39 | 419K | |
| North American Peoples.png | 2021-05-25 14:23 | 582K | |
| Northwest passage.PNG | 2021-05-26 12:59 | 969K | |
| Nuc acidsa.PNG | 2021-04-28 14:01 | 454K | |
| Nucl.png | 2021-06-22 12:18 | 76K | |
| Nuclear Energy.PNG | 2021-06-22 16:32 | 169K | |
| Nuclear Fission.PNG | 2021-06-22 12:43 | 519K | |
| Nuclear Fission and Fussion.png | 2021-06-22 12:14 | 358K | |
| Nuclear Fussion.PNG | 2021-06-22 12:49 | 473K | |
| Nuclear Radiatrion.png | 2021-06-22 16:19 | 240K | |
| Nuclear power plant banner.png | 2021-06-22 16:12 | 301K | |
| Number Line.png | 2021-04-13 10:52 | 8.1K | |
| Olive Branch Petition.PNG | 2021-05-28 11:31 | 249K | |
| Oliver plantation.png | 2021-06-07 08:56 | 448K | |
| Oliver plantation 1.png | 2021-06-07 09:00 | 243K | |
| Olympics.PNG | 2021-05-07 14:42 | 1.0M | |
| Omar Khayyam.PNG | 2021-05-13 11:47 | 875K | |
| Oracle Bones.PNG | 2021-05-06 14:35 | 1.1M | |
| Oracle bone.PNG | 2021-07-06 16:00 | 1.1M | |
| Oragnizing your Data Apply.pdf | 2021-04-20 12:27 | 1.0M | |
| Ott Empire.png | 2021-05-19 10:15 | 74K | |
| Outcomes.png | 2022-03-01 13:31 | 334K | |
| Overlin College Banner.png | 2021-06-08 09:56 | 379K | |
| P Parties Banner.png | 2021-06-02 15:08 | 331K | |
| PS-Int_Reader_and_Study_Guide.pdf | 2021-04-15 16:06 | 8.5M | |
| PS-Int_Reader_and_Study_Guide2.pdf | 2021-04-20 16:56 | 8.5M | |
| Pachutti.PNG | 2021-05-17 09:14 | 1.0M | |
| Panic of 1837.PNG | 2021-06-04 13:37 | 556K | |
| Parables.PNG | 2021-05-11 16:32 | 544K | |
| Patriots and Loyalisrt.PNG | 2021-05-28 10:53 | 1.1M | |
| Pax.PNG | 2021-05-11 13:52 | 779K | |
| Pearson Math 5.png | 2022-03-02 12:51 | 4.9K | |
| Peoples of North America banner.png | 2021-05-17 10:34 | 383K | |
| Per Machine.PNG | 2021-06-28 08:43 | 640K | |
| Perichles.PNG | 2021-05-10 11:25 | 784K | |
| Periodic TAble of elements.PNG | 2021-04-07 14:25 | 46K | |
| Periodic table.png | 2021-06-15 16:52 | 273K | |
| Periodic table banner.png | 2021-06-15 16:44 | 350K | |
| Perioidc element banner.png | 2021-04-07 14:09 | 220K | |
| Perodic table.png | 2021-06-15 13:46 | 249K | |
| Peublo Indians.PNG | 2021-05-17 11:12 | 863K | |
| Phoeneicians.PNG | 2021-05-07 13:01 | 718K | |
| Ph scalre.PNG | 2021-04-27 16:28 | 438K | |
| Physical.PNG | 2021-06-14 14:00 | 199K | |
| Physical Properties Apply.pdf | 2021-04-20 12:57 | 1.2M | |
| Physical Science.PNG | 2021-06-14 13:19 | 532K | |
| Pilgrimage to Mecca.PNG | 2021-05-13 09:40 | 931K | |
| Pizzaro.PNG | 2021-05-26 12:11 | 951K | |
| Plateaus.PNG | 2021-05-05 09:52 | 1.0M | |
| Plato.PNG | 2021-05-10 16:20 | 726K | |
| Point Located.png | 2021-04-13 09:52 | 12K | |
| PolParties.png | 2021-06-02 15:16 | 88K | |
| Polar Bond.PNG | 2021-06-18 10:33 | 269K | |
| Polar Compound Banner.png | 2021-06-18 10:15 | 37K | |
| Polar and Non Polar.PNG | 2021-06-18 10:41 | 368K | |
| Political Party.png | 2021-06-02 15:12 | 140K | |
| Polotics of reconstruction.png | 2021-06-10 12:53 | 112K | |
| Polymers.PNG | 2021-06-17 10:18 | 394K | |
| Polythesism.PNG | 2021-05-03 12:36 | 286K | |
| Pontiacs War.PNG | 2021-05-27 12:35 | 1.1M | |
| Potential Energy.PNG | 2021-06-24 11:21 | 328K | |
| President Andrew Johnson.PNG | 2021-06-10 11:07 | 590K | |
| President John Adms.PNG | 2021-06-02 15:32 | 713K | |
| President Washinton.PNG | 2021-06-02 10:39 | 563K | |
| Prinicpal.png | 2021-06-17 15:28 | 92K | |
| Projectile Motion.PNG | 2021-06-23 13:58 | 283K | |
| Properites of Matter.png | 2021-06-14 15:13 | 231K | |
| Properites of Matter 1.png | 2021-06-14 15:21 | 43K | |
| Properties of Matter Banner.png | 2021-06-14 15:01 | 94K | |
| Properties of mattteer.png | 2021-06-14 13:38 | 108K | |
| Proteins.PNG | 2021-04-28 13:55 | 430K | |
| Protestant Reformation.PNG | 2021-05-21 12:40 | 541K | |
| Providence Plantations.PNG | 2021-05-26 15:38 | 713K | |
| Purple.png | 2021-06-22 14:15 | 54K | |
| Purple1learnmore.png | 2021-06-22 14:07 | 63K | |
| Purple2Learnmore.png | 2021-06-22 14:09 | 42K | |
| Purple2Learnmore1.png | 2021-06-22 14:22 | 13K | |
| Purple Learn More.png | 2021-06-22 13:54 | 26K | |
| Pyramid Construction.PNG | 2021-05-05 12:04 | 953K | |
| Quakers.PNG | 2021-05-26 16:21 | 873K | |
| Radical.PNG | 2021-06-10 11:57 | 660K | |
| Radical Reconstruction.png | 2021-06-10 11:31 | 262K | |
| Radical Repub.png | 2021-06-10 11:28 | 185K | |
| Radioactive banne.png | 2021-06-22 09:57 | 310K | |
| Radioactivity.png | 2021-06-22 10:14 | 298K | |
| Railroads and canals.PNG | 2021-06-03 15:15 | 1.0M | |
| RandR.PNG | 2021-05-11 11:33 | 496K | |
| RandR Banner 1.png | 2021-05-20 15:42 | 337K | |
| Rates of Change banner.png | 2021-06-17 15:22 | 215K | |
| Re Moves Weat.png | 2021-06-01 11:38 | 404K | |
| Reactants and products.PNG | 2021-06-17 11:47 | 196K | |
| Reactivity.PNG | 2021-06-14 15:50 | 174K | |
| ReadLearnMore.png | 2021-06-22 13:49 | 32K | |
| Recantants and Products.PNG | 2021-04-26 13:32 | 197K | |
| Recon.png | 2021-06-10 10:39 | 350K | |
| Reconstruction.png | 2021-06-10 10:34 | 150K | |
| Reconstruction Banner.png | 2021-06-10 10:09 | 285K | |
| Reconstruction era.png | 2021-06-10 10:41 | 436K | |
| Reconstruction in de south.png | 2021-06-10 12:44 | 406K | |
| Reconstruction in the south.png | 2021-06-10 12:18 | 362K | |
| Reform Movements.png | 2021-06-08 10:22 | 202K | |
| Reformation Banner.png | 2021-05-21 12:30 | 379K | |
| Reformers.png | 2021-05-21 13:50 | 225K | |
| Reformers banner.png | 2021-05-21 14:01 | 280K | |
| Reincarnation.PNG | 2021-05-06 09:24 | 796K | |
| Ren Banner 1.png | 2021-05-21 11:05 | 346K | |
| Renaming Improepr.png | 2022-03-01 15:37 | 384K | |
| Ren mid.png | 2021-05-19 11:51 | 212K | |
| Republican party.png | 2021-06-02 16:06 | 267K | |
| Republican party 1.png | 2021-06-02 16:12 | 170K | |
| Rev War.png | 2021-05-28 12:35 | 369K | |
| Rev Won.png | 2021-06-01 13:38 | 306K | |
| Rev bAnner.png | 2021-06-01 13:32 | 441K | |
| Rev moves west and south.png | 2021-06-01 12:08 | 279K | |
| Revo.png | 2021-05-28 12:57 | 266K | |
| Rise of Christianity.PNG | 2021-05-12 10:24 | 259K | |
| Rise of Democracy.PNG | 2021-05-07 15:38 | 437K | |
| Rising sun.PNG | 2021-05-18 14:56 | 717K | |
| River dynasty.png | 2021-07-06 15:55 | 251K | |
| Road to Indepence.png | 2021-05-27 14:17 | 138K | |
| Roll Call (1).mp4 | 2021-05-12 13:21 | 1.8M | |
| Roman Church Banner.png | 2021-05-12 10:06 | 392K | |
| Roman Coll.PNG | 2021-05-11 15:40 | 1.0M | |
| Roman Em Ban.png | 2021-05-11 12:01 | 317K | |
| Roman Empire Banner.png | 2021-05-11 10:40 | 233K | |
| Roman Mythology.PNG | 2021-05-11 15:29 | 887K | |
| Roman Republic Banner.png | 2021-05-11 11:04 | 370K | |
| Roman aqueducts.PNG | 2021-05-11 15:33 | 867K | |
| Romulus.PNG | 2021-05-11 11:21 | 897K | |
| Rule of Roman Boot.PNG | 2021-05-04 10:51 | 849K | |
| SBH.PNG | 2021-06-22 09:40 | 506K | |
| Safety in Science Apply.pdf | 2021-04-20 12:04 | 795K | |
| Sahara Desert.PNG | 2021-05-13 13:59 | 505K | |
| Saladin.PNG | 2021-05-20 11:16 | 768K | |
| Samuel Su Champlain.PNG | 2021-05-26 13:03 | 928K | |
| S and C Banner.png | 2021-06-18 11:15 | 304K | |
| Saratoga.png | 2021-05-28 14:24 | 272K | |
| Saratoga Battle.png | 2021-05-28 14:28 | 202K | |
| Sat unsat.PNG | 2021-06-18 11:48 | 720K | |
| S carolina.PNG | 2021-06-08 16:40 | 524K | |
| Sceinetific Banner.png | 2021-05-24 10:54 | 510K | |
| Science Element Banner.png | 2021-04-20 13:43 | 164K | |
| Science Physical.png | 2021-06-14 13:24 | 346K | |
| Science and Scientist Apply.pdf | 2021-04-20 11:09 | 1.1M | |
| Science banner.png | 2021-05-24 16:07 | 183K | |
| Scientific Method.PNG | 2021-05-24 11:30 | 831K | |
| Scientific Revolution Banner.png | 2021-05-24 10:14 | 288K | |
| Scientiifc Rev.PNG | 2021-05-24 11:26 | 915K | |
| Scribes.PNG | 2021-05-05 10:53 | 787K | |
| Secession and war banner.png | 2021-06-08 15:17 | 376K | |
| Second continental congress banner.png | 2021-05-28 11:23 | 304K | |
| Section 1 Review Matter in Motion.pdf | 2021-04-16 09:28 | 134K | |
| Section 1 Review Mix.pdf | 2021-04-16 10:13 | 102K | |
| Section 1 review 8.7.c | 2021-04-16 10:10 | 102K | |
| Section 2 Review What is Force.pdf | 2021-04-16 10:16 | 80K | |
| Section 3 Review Friction.pdf | 2021-04-16 10:44 | 911K | |
| Seneca Falls.PNG | 2021-06-08 11:40 | 791K | |
| Seven cities of fold.PNG | 2021-05-26 12:16 | 832K | |
| Shaded box.png | 2021-04-13 13:51 | 1.9K | |
| Shaping a new nation.png | 2021-06-02 09:57 | 446K | |
| Sharecropping.PNG | 2021-06-10 12:29 | 790K | |
| Shi hun.PNG | 2021-05-06 16:53 | 463K | |
| Shinto.PNG | 2021-05-18 14:46 | 1.0M | |
| Siddhartha Gautama.PNG | 2021-05-06 11:12 | 960K | |
| Silk Road.PNG | 2021-05-07 10:20 | 762K | |
| Simeple Mach.png | 2021-06-24 10:25 | 47K | |
| Simple.png | 2021-06-24 10:01 | 118K | |
| Simple Machine Banner.png | 2021-06-24 10:18 | 278K | |
| Simple Machines Banner.png | 2021-06-24 09:41 | 332K | |
| Single Reaction.PNG | 2021-06-17 12:32 | 834K | |
| Slam Banner.png | 2021-05-13 08:18 | 392K | |
| Slash and burn.PNG | 2021-07-06 11:39 | 850K | |
| Slave.png | 2021-06-08 15:01 | 185K | |
| Slave code.PNG | 2021-06-07 16:48 | 539K | |
| Slavery.PNG | 2021-05-10 09:50 | 1.0M | |
| Slavery.png | 2021-06-08 14:45 | 178K | |
| Slavery and the west banner.png | 2021-06-08 12:27 | 423K | |
| Slave trade banner.png | 2021-06-07 14:24 | 345K | |
| Small bodies solar system Apply.pdf | 2021-04-20 09:48 | 950K | |
| Social Classs.PNG | 2021-05-06 09:14 | 586K | |
| Social Reform.png | 2021-06-08 10:47 | 148K | |
| Social Reform Banner.png | 2021-06-08 10:17 | 134K | |
| Socrates.PNG | 2021-05-10 16:16 | 882K | |
| Soluability.png | 2021-06-18 11:35 | 267K | |
| Soluability video.PNG | 2021-06-18 11:40 | 200K | |
| Solution of acids and bases apply.pdf | 2021-04-23 09:24 | 631K | |
| Solutions and Mixtures.png | 2021-06-18 09:13 | 563K | |
| Solutions banner.png | 2021-04-27 16:47 | 230K | |
| Solvent and Solute.PNG | 2021-04-07 12:21 | 855K | |
| Songhai People.PNG | 2021-05-25 16:44 | 825K | |
| South Korea Geo.PNG | 2021-05-18 16:19 | 368K | |
| Southern Colonies banner.png | 2021-05-26 16:30 | 322K | |
| Southern Cotton Kin.png | 2021-06-07 11:05 | 163K | |
| Southern coloniess.png | 2021-05-26 16:50 | 280K | |
| Spain Reconquista.PNG | 2021-05-20 11:22 | 1.0M | |
| Spain in America.png | 2021-05-26 14:37 | 247K | |
| Spanish americna.PNG | 2021-05-28 14:46 | 438K | |
| Spanish explorers.png | 2021-05-26 12:02 | 708K | |
| Speed and Vel.PNG | 2021-06-23 10:12 | 783K | |
| Speed and Velocity.png | 2021-06-23 09:14 | 130K | |
| Speed velovity displacment.PNG | 2021-06-23 09:33 | 525K | |
| Speed vs Velocity.PNG | 2021-06-23 09:37 | 705K | |
| Spread of budd.PNG | 2021-05-07 10:38 | 1.0M | |
| Sprread od Bus.PNG | 2021-05-17 13:18 | 570K | |
| Sr Banner.png | 2021-05-24 10:12 | 283K | |
| StRhomas.PNG | 2021-05-20 11:10 | 684K | |
| St Thomas.PNG | 2021-05-20 11:08 | 688K | |
| Stamp Act Congress.PNG | 2021-05-27 15:23 | 521K | |
| Stars Apply.pdf | 2021-04-16 14:30 | 902K | |
| States of Matter.png | 2021-06-14 12:32 | 331K | |
| States of Matter Apply.pdf | 2021-04-20 13:19 | 787K | |
| States of Matter banner.png | 2021-06-14 13:00 | 124K | |
| Stone Age Banner.png | 2021-07-06 11:00 | 213K | |
| Stone age.PNG | 2021-07-06 10:27 | 1.0M | |
| Story of the Cotton Gin.PNG | 2021-06-07 13:45 | 730K | |
| Student Assem.PNG | 2021-06-14 14:34 | 82K | |
| Student Assements.png | 2021-06-14 14:28 | 393K | |
| Substace banner.png | 2021-04-22 13:23 | 334K | |
| Substances dissolve.pdf | 2022-02-15 12:52 | 1.2M | |
| Suc.png | 2021-06-08 16:34 | 240K | |
| Success and war.png | 2021-06-08 16:33 | 229K | |
| Sui Tand Dynasty.PNG | 2021-05-17 12:53 | 459K | |
| Sum and Differences.png | 2022-03-02 14:34 | 443K | |
| Sumer.png | 2021-07-06 12:04 | 288K | |
| Supersturated.PNG | 2021-06-18 11:55 | 363K | |
| Susan B Anthony.PNG | 2021-06-08 11:47 | 724K | |
| Taj Mahal.PNG | 2021-05-19 09:38 | 969K | |
| Taxation.png | 2021-05-27 14:58 | 198K | |
| Taxwithout.png | 2021-05-27 15:26 | 5.4K | |
| Teams.png | 2022-01-18 14:55 | 17K | |
| Tears.png | 2021-06-04 12:42 | 223K | |
| Tenant Farming.PNG | 2021-06-07 14:41 | 561K | |
| Tenm.PNG | 2021-05-25 13:39 | 1.1M | |
| Tennant Farmer.png | 2021-06-07 14:37 | 378K | |
| Terminal Velocity.PNG | 2021-06-23 13:53 | 407K | |
| Terms and definitions.png | 2021-06-04 14:41 | 50K | |
| TerraCotta.PNG | 2021-05-07 09:05 | 728K | |
| Test PRep.png | 2021-04-12 10:28 | 377K | |
| Texas Becomes A State.PNG | 2021-06-08 13:01 | 1.1M | |
| Texttile.PNG | 2021-06-03 13:11 | 1.1M | |
| The Akkadian Empire.PNG | 2021-05-03 13:46 | 1.1M | |
| The Almoarvoias.PNG | 2021-05-13 15:31 | 367K | |
| The American Journey.png | 2021-05-25 10:10 | 173K | |
| The Americas Banner.png | 2021-05-14 14:37 | 333K | |
| The Babyloian Rempire.PNG | 2021-05-03 13:53 | 1.1M | |
| The Battle of Anietnam.PNG | 2021-06-09 14:06 | 1.1M | |
| The Bill of rights.PNG | 2021-06-02 11:24 | 846K | |
| The Boston Masacre.PNG | 2021-05-28 09:56 | 833K | |
| The Boston tea party.PNG | 2021-05-28 10:01 | 698K | |
| The Colonies.png | 2021-05-27 08:32 | 161K | |
| The Columbian Exchange.PNG | 2021-05-24 13:23 | 945K | |
| The Columbian Exchange1.PNG | 2021-05-26 12:54 | 1.1M | |
| The Conestoga Wagon.PNG | 2021-06-03 09:20 | 882K | |
| The Courrupt Bargin.PNG | 2021-06-04 11:42 | 539K | |
| The Delian League.PNG | 2021-05-10 11:44 | 1.2M | |
| The Eerie Canal.PNG | 2021-06-03 15:18 | 1.1M | |
| The Embargo Act.PNG | 2021-06-03 10:24 | 568K | |
| The Empire of Ghana.PNG | 2021-05-13 15:41 | 644K | |
| The Forbidden City.PNG | 2021-05-18 12:23 | 728K | |
| The Freedom Journal Banner.png | 2021-06-07 10:24 | 151K | |
| The Great Wall.PNG | 2021-05-06 16:56 | 763K | |
| The Indian Removal Act.PNG | 2021-06-04 12:45 | 909K | |
| The Indus River.png | 2021-07-06 15:03 | 236K | |
| The Inner Planets Applhy.pdf | 2021-04-20 09:20 | 1.0M | |
| The Know Nothing.PNG | 2021-06-07 10:42 | 638K | |
| The Lifecycle of Stars Apply.pdf | 2021-04-16 14:56 | 1.2M | |
| The Lincoln Douglass Debates.PNG | 2021-06-08 14:58 | 859K | |
| The Middle Ages.PNG | 2021-05-20 10:05 | 769K | |
| The Middle Passage.PNG | 2021-05-27 09:20 | 631K | |
| The Middle ones.png | 2021-05-26 15:48 | 335K | |
| The Ming Dynasty.PNG | 2021-05-18 12:51 | 440K | |
| The Missourri Compromise.PNG | 2021-06-08 12:36 | 943K | |
| The Moons Apply.pdf | 2021-04-20 09:44 | 1.4M | |
| The Mughals.PNG | 2021-05-19 09:28 | 791K | |
| The Nulification Chriss.PNG | 2021-06-04 11:47 | 778K | |
| The Old Kingdom.PNG | 2021-05-05 12:01 | 1.0M | |
| The Olmecs.PNG | 2021-05-17 09:10 | 1.0M | |
| The Philistines.PNG | 2021-05-03 16:41 | 917K | |
| The Polis.PNG | 2021-05-07 15:34 | 1.1M | |
| The Qin.png | 2021-05-06 16:46 | 351K | |
| The Seige of Boston.PNG | 2021-05-28 11:37 | 856K | |
| The Sugar Act.PNG | 2021-05-27 15:19 | 804K | |
| The Trail of Tears.PNG | 2021-06-04 12:49 | 857K | |
| The election of 1800.PNG | 2021-06-02 16:15 | 628K | |
| TheocrACY.PNG | 2021-07-06 14:40 | 422K | |
| The rise of islam.PNG | 2021-05-12 14:48 | 529K | |
| Thermal Energy.PNG | 2021-06-15 10:48 | 611K | |
| Thew Newburg Conspiracy.PNG | 2021-06-01 14:03 | 771K | |
| Third Grade.png | 2021-04-12 09:18 | 81K | |
| Thomas.png | 2021-06-02 15:56 | 255K | |
| Tools and Models in Science Apply.pdf | 2021-04-20 12:20 | 1.3M | |
| Tour of the Perioidic table.PNG | 2021-06-16 08:50 | 281K | |
| Trade Unions.PNG | 2021-06-07 10:46 | 568K | |
| Trail of Tears.png | 2021-06-04 12:35 | 345K | |
| Trail of Tears Banner.png | 2021-06-04 12:31 | 378K | |
| Treaty of Paris.PNG | 2021-05-27 12:32 | 963K | |
| Treaty of Tordesillas.PNG | 2021-05-24 12:45 | 1.0M | |
| Trianglular Trade.PNG | 2021-05-24 13:27 | 1.0M | |
| Triangular Trade Routes.png | 2021-05-27 08:55 | 485K | |
| Types of Chemical Bonds.PNG | 2021-04-27 13:47 | 674K | |
| Types of Chemical Reaction.PNG | 2021-04-27 10:22 | 968K | |
| Types of Chemical Reactions.png | 2021-06-17 12:14 | 77K | |
| Types of Colonies.PNG | 2021-05-27 10:28 | 534K | |
| Types of Friction.PNG | 2021-06-23 12:20 | 738K | |
| Types of Government.PNG | 2021-05-07 15:31 | 682K | |
| Types of chemical.png | 2021-06-17 12:17 | 37K | |
| UR City.PNG | 2021-07-06 12:14 | 1.0M | |
| US Hist Banner.png | 2021-05-25 08:40 | 264K | |
| USS Philadelphia.png | 2021-06-03 10:18 | 245K | |
| Umayaa.PNG | 2021-05-13 10:22 | 1.0M | |
| Uncle Toms Cabin.PNG | 2021-06-08 14:07 | 1.0M | |
| Unit 1 Different World Meet.PNG | 2021-05-25 10:22 | 512K | |
| Unit 1 Different World Meet 1.PNG | 2021-05-25 10:22 | 944K | |
| Unit 1 History Beginings.PNG | 2021-04-29 16:55 | 907K | |
| Unit 2 Ancient Asia and africa.PNG | 2021-05-04 12:45 | 787K | |
| Unit 3 Classic Greece.PNG | 2021-05-07 11:32 | 945K | |
| Unit 4 Ancient Rome.PNG | 2021-05-11 08:36 | 860K | |
| Unit 5 Regional.PNG | 2021-05-12 14:48 | 842K | |
| Unit 6 medevil.PNG | 2021-05-19 11:45 | 1.0M | |
| Unit 6 medevil 1.PNG | 2021-05-19 11:45 | 422K | |
| Unit_1_Test_Combined[.pdf | 2021-05-07 08:27 | 1.0M | |
| Unit_2_Test_Combined-1.pdf | 2021-05-17 09:16 | 11M | |
| Unit_2_Test_Combined.pdf | 2021-05-03 13:30 | 11M | |
| Unity and Sectionalism banner.png | 2021-06-03 15:36 | 195K | |
| Uses of NR.PNG | 2021-06-22 16:35 | 568K | |
| Uss Philly.png | 2021-06-03 10:12 | 448K | |
| Valence Electrons.PNG | 2021-04-23 11:56 | 233K | |
| Valley Forge.PNG | 2021-05-28 14:41 | 783K | |
| Vasco.PNG | 2021-05-26 11:15 | 1.0M | |
| Viscoity of liquids.PNG | 2021-06-15 12:59 | 720K | |
| Vomp.png | 2021-06-16 16:12 | 75K | |
| Votes for Women.png | 2021-06-08 11:27 | 314K | |
| Voyages of Zeng.PNG | 2021-05-18 13:16 | 1.0M | |
| W Ward Exp.png | 2021-06-03 15:07 | 289K | |
| Wade Davis Bill.PNG | 2021-06-10 10:58 | 454K | |
| War Civil.png | 2021-06-09 13:21 | 372K | |
| War Won.png | 2021-06-01 13:40 | 526K | |
| War against the banks.PNG | 2021-06-03 13:15 | 889K | |
| War of 1812 banner.png | 2021-06-03 11:27 | 139K | |
| Wash.PNG | 2021-06-02 14:25 | 1.1M | |
| Wathawks.PNG | 2021-06-03 10:28 | 1.1M | |
| West.png | 2021-06-03 15:09 | 457K | |
| West Virginia.PNG | 2021-06-09 13:01 | 499K | |
| Westside Documents.pdf | 2022-03-01 17:59 | 33M | |
| Westward Ex banner.PNG | 2021-06-03 15:21 | 767K | |
| Westward Expansion Banner.png | 2021-06-03 14:06 | 279K | |
| What are Acids.PNG | 2021-06-22 09:38 | 804K | |
| What are Acids and Bases.PNG | 2021-06-18 13:33 | 804K | |
| What are Atoms.PNG | 2021-06-15 15:10 | 683K | |
| What are Fluids.png | 2021-06-15 12:34 | 126K | |
| What are Salts.PNG | 2021-06-18 15:02 | 598K | |
| What are acids.PNG | 2021-04-27 16:24 | 795K | |
| What ia a drought.PNG | 2021-05-03 11:35 | 888K | |
| What is Acceleration.PNG | 2021-06-23 10:04 | 594K | |
| What is Chemistry.PNG | 2021-06-14 13:46 | 231K | |
| What is Chilvary.PNG | 2021-05-20 10:14 | 250K | |
| What is Critical Mass.PNG | 2021-06-22 12:56 | 380K | |
| What is Density.PNG | 2021-06-14 15:44 | 420K | |
| What is Dharma.PNG | 2021-05-06 10:56 | 482K | |
| What is Energy.png | 2021-06-24 11:04 | 365K | |
| What is Energy1.png | 2021-06-24 11:16 | 126K | |
| What is Forve Apply.pdf | 2021-04-16 10:50 | 566K | |
| What is Friction.PNG | 2021-06-23 12:18 | 291K | |
| What is Irrigation.PNG | 2021-04-29 15:53 | 1.0M | |
| What is Karma.PNG | 2021-05-06 09:20 | 880K | |
| What is Matter Apply.pdf | 2021-04-20 12:39 | 954K | |
| What is Stoich.PNG | 2021-05-12 14:15 | 167K | |
| What is Theocracy.PNG | 2021-05-25 13:20 | 419K | |
| What is Work.PNG | 2021-06-24 09:47 | 869K | |
| What is a Delra.PNG | 2021-05-04 16:02 | 1.1M | |
| What is a Monsoon.PNG | 2021-07-06 15:14 | 1.0M | |
| What is a chemical formula.PNG | 2021-04-26 13:45 | 86K | |
| What is a floodPlain.PNG | 2021-05-03 11:11 | 488K | |
| What is a molcule.PNG | 2021-04-23 15:37 | 355K | |
| What is a moonsoon.PNG | 2021-05-05 16:53 | 1.0M | |
| What is an Atom.PNG | 2021-06-14 13:54 | 384K | |
| What is a nuclear Radation.PNG | 2021-06-22 11:03 | 603K | |
| What is evaporation.PNG | 2021-06-15 11:20 | 1.0M | |
| What is lissasc gfaire.PNG | 2021-06-02 16:25 | 548K | |
| What is motion.PNG | 2021-06-23 12:12 | 911K | |
| What is pH.PNG | 2021-06-18 13:37 | 630K | |
| What is power.PNG | 2021-06-24 09:50 | 863K | |
| What is the roman.PNG | 2021-05-12 10:20 | 352K | |
| What s a mosque.PNG | 2021-05-13 09:23 | 377K | |
| What was the Bronze Age.PNG | 2021-07-06 12:36 | 931K | |
| Whigs.PNG | 2021-06-04 13:40 | 859K | |
| Whiskey Reb.png | 2021-06-02 14:02 | 537K | |
| Whiskey Reb1.png | 2021-06-02 14:05 | 679K | |
| Whiskey Rebellion Banner.png | 2021-06-02 12:06 | 301K | |
| Who are the reformers.PNG | 2021-05-21 14:08 | 791K | |
| Why Did rome Dall.PNG | 2021-05-12 12:16 | 264K | |
| Why do people Migrate.PNG | 2021-04-29 15:08 | 722K | |
| William Penn.PNG | 2021-05-26 16:19 | 1.1M | |
| Winter at Vally.PNG | 2021-05-28 14:48 | 766K | |
| Wlliams Shakesper.PNG | 2021-05-21 11:17 | 822K | |
| Women during the civil war.PNG | 2021-06-09 16:14 | 620K | |
| Womens Suffrage.PNG | 2021-06-08 11:43 | 910K | |
| Womens movement banner.png | 2021-06-08 11:23 | 262K | |
| Work Power and Machines.png | 2021-06-24 09:21 | 69K | |
| Work and Energy.PNG | 2021-06-24 09:53 | 537K | |
| World Hist.png | 2021-04-30 09:05 | 556K | |
| WorldHistory.pdf | 2021-07-06 10:16 | 119M | |
| World History Book.PNG | 2021-07-06 10:09 | 439K | |
| Writ.PNG | 2021-05-27 15:09 | 653K | |
| Yuctan.PNG | 2021-05-14 15:03 | 1.1M | |
| Zebulan Pike.PNG | 2021-06-03 09:26 | 821K | |
| Zhenge He.PNG | 2021-05-18 12:27 | 1.2M | |
| Ziggurat.PNG | 2021-05-03 12:30 | 934K | |
| Zues.PNG | 2021-05-07 14:38 | 834K | |
| abo.png | 2021-06-08 10:54 | 380K | |
| acid base ph.png | 2021-06-18 12:26 | 186K | |
| american Revoluntion.png | 2021-05-28 12:54 | 306K | |
| analyzing Data Apply.pdf | 2021-04-20 12:31 | 1.1M | |
| banking2.pdf | 2021-05-04 10:36 | 710K | |
| banking3.pdf | 2021-05-04 11:05 | 710K | |
| battle.png | 2021-05-28 14:21 | 395K | |
| battle of Gettsyburg.PNG | 2021-06-10 09:32 | 1.1M | |
| battle of Kings Mountain.PNG | 2021-06-01 13:06 | 1.1M | |
| carpet.PNG | 2021-06-10 12:27 | 871K | |
| chap_brief 5.pdf | 2022-02-03 09:37 | 121K | |
| chemical bonding apply.pdf | 2021-04-22 11:29 | 868K | |
| china banner.png | 2021-07-06 15:31 | 309K | |
| code Moris.png | 2021-06-07 09:34 | 132K | |
| confucianism.PNG | 2021-05-06 16:14 | 721K | |
| cov bond.png | 2021-04-23 14:12 | 237K | |
| development of Atom apply.pdf | 2021-04-22 09:36 | 1.3M | |
| early Exploration.png | 2021-05-26 10:05 | 599K | |
| early Folks.png | 2021-05-25 14:18 | 442K | |
| el.png | 2021-06-18 09:22 | 172K | |
| electron config.PNG | 2021-06-16 09:20 | 859K | |
| elementary engish.png | 2021-04-09 13:08 | 288K | |
| eman Proc.png | 2021-06-09 14:17 | 391K | |
| eng.png | 2021-04-09 09:29 | 67K | |
| english Banner.png | 2021-04-08 09:31 | 306K | |
| english Icon.png | 2021-04-08 09:43 | 101K | |
| fertile and meso.PNG | 2021-07-06 13:45 | 858K | |
| feudalsism.PNG | 2021-07-06 16:10 | 706K | |
| fourth Grade.png | 2021-04-12 09:29 | 81K | |
| geo.png | 2022-01-26 12:09 | 281K | |
| geo1.png | 2022-01-26 12:12 | 277K | |
| government religion and culture.png | 2021-05-27 10:08 | 507K | |
| govt Rel Cul.png | 2021-05-27 10:21 | 296K | |
| greece pen.PNG | 2021-05-07 12:57 | 1.0M | |
| history of Sparta.PNG | 2021-05-10 09:22 | 716K | |
| human origina.png | 2021-07-06 11:15 | 223K | |
| hundred banner.png | 2021-05-20 12:08 | 369K | |
| hunter gathers.PNG | 2021-07-06 11:29 | 1.0M | |
| improper fractions.png | 2022-03-01 15:32 | 718K | |
| industrial banner.png | 2021-06-03 12:43 | 364K | |
| ion apply.pdf | 2021-04-22 12:25 | 1.5M | |
| ionic bonding.PNG | 2021-06-16 15:14 | 667K | |
| iroqouis.PNG | 2021-05-27 11:14 | 1.0M | |
| isotopes.PNG | 2021-06-16 09:32 | 538K | |
| jamestownSettlement.PNG | 2021-05-26 14:58 | 1.0M | |
| janis.PNG | 2021-05-19 10:44 | 612K | |
| kubla.PNG | 2021-05-17 16:50 | 667K | |
| lANGUAGE arts banner.png | 2021-04-09 09:50 | 97K | |
| lattices.PNG | 2021-04-23 15:22 | 325K | |
| law of conservation of energy.PNG | 2021-04-26 11:41 | 146K | |
| line pu.png | 2021-06-22 14:27 | 25K | |
| metallic bonding.PNG | 2021-06-16 15:24 | 547K | |
| mossiac.PNG | 2021-05-12 14:08 | 1.0M | |
| motion-graphics-copy-2.mp4 | 2021-04-12 11:51 | 20M | |
| ne3rdlaw.PNG | 2021-06-23 14:53 | 1.0M | |
| newtons 3rd law.png | 2021-06-23 14:39 | 45K | |
| numb.png | 2021-06-16 12:41 | 214K | |
| organic and inorganic.PNG | 2021-06-17 10:15 | 564K | |
| organic compound.PNG | 2021-04-28 11:26 | 562K | |
| osman.PNG | 2021-05-19 10:55 | 753K | |
| pH Scale.PNG | 2021-04-28 09:11 | 438K | |
| pH Scale_lab-12.pdf | 2021-05-10 15:11 | 113K | |
| ppu.png | 2021-06-02 16:51 | 582K | |
| ptable.png | 2021-06-15 16:55 | 158K | |
| pyramid Banner.png | 2021-05-05 12:47 | 267K | |
| qin.png | 2021-05-06 16:48 | 389K | |
| road to.png | 2021-05-27 14:45 | 290K | |
| romans.png | 2021-05-11 15:13 | 350K | |
| rome christianity Banner.png | 2021-05-12 09:54 | 441K | |
| sHAPES.png | 2021-04-13 11:54 | 5.5K | |
| scientific methods apply.pdf | 2021-04-20 11:27 | 1.5M | |
| social Studies.PNG | 2021-04-29 14:38 | 329K | |
| ss project unit one.pdf | 2021-04-22 10:35 | 11M | |
| suley.PNG | 2021-05-19 10:48 | 719K | |
| tHE ELEction of 1824.PNG | 2021-06-04 11:39 | 461K | |
| tand and Song Dynasty banner.png | 2021-05-17 13:39 | 295K | |
| tax.png | 2021-05-27 16:12 | 368K | |
| the Father of Europe.PNG | 2021-05-20 10:11 | 761K | |
| the Outer Planets Apply.pdf | 2021-04-20 09:36 | 1.1M | |
| the burning of DC.PNG | 2021-06-03 11:46 | 607K | |
| thomas Jeffereson banner.png | 2021-06-02 15:53 | 282K | |
| three chinese philosphers.PNG | 2021-05-06 16:23 | 282K | |
| triangular trade.PNG | 2021-05-27 09:14 | 728K | |
| triple P.PNG | 2021-05-26 15:34 | 659K | |
| us His.png | 2021-05-25 09:31 | 297K | |
| wellness.png | 2022-02-01 14:01 | 338K | |
| western.png | 2021-05-13 15:27 | 428K | |
| world History.png | 2021-04-29 12:18 | 168K | |
