![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| word pr.png | 2021-02-25 15:21 | 99K | |
| willwoudlcould.png | 2021-03-15 13:17 | 421K | |
| war banner.png | 2021-02-24 09:32 | 280K | |
| v2.png | 2021-02-04 11:52 | 56K | |
| unit 4 Project Banner.png | 2021-03-12 10:34 | 62K | |
| unit 3 We Love our Country A.PNG | 2021-03-08 09:50 | 1.0M | |
| unit 3 We Love our Country.PNG | 2021-03-08 09:50 | 496K | |
| unit 2 B.PNG | 2021-02-19 11:23 | 130K | |
| unit 1 Numbers to 10.png | 2021-03-04 12:27 | 574K | |
| types of Supernova.PNG | 2021-03-19 12:48 | 926K | |
| types of Stars.PNG | 2021-03-19 12:45 | 281K | |
| together-we-can-copy.mp4 | 2021-03-18 12:36 | 16M | |
| the Outer Planets Banner.png | 2021-03-30 09:17 | 401K | |
| the Great Awakening.PNG | 2021-02-12 12:23 | 761K | |
| terminal Velocity.PNG | 2021-03-18 11:16 | 404K | |
| tenament.png | 2022-01-27 16:24 | 930K | |
| suit.png | 2021-03-11 09:56 | 29K | |
| suffrage banner.png | 2021-02-24 11:22 | 177K | |
| spanish settlement.PNG | 2021-02-08 11:11 | 427K | |
| slave trADE.PNG | 2021-02-12 12:37 | 830K | |
| short Answers.png | 2021-03-16 12:29 | 36K | |
| safety banner.png | 2021-03-31 14:30 | 226K | |
| relationship.png | 2021-03-12 11:55 | 406K | |
| regroupping.png | 2021-02-25 14:43 | 532K | |
| proyecta 11.mp4 | 2021-02-03 09:23 | 80M | |
| proyect 11.mp4 | 2021-02-01 09:32 | 66M | |
| pps tense.PNG | 2021-03-10 15:23 | 405K | |
| pppp.PNG | 2021-02-12 10:48 | 525K | |
| powwow.PNG | 2021-02-08 10:58 | 1.2M | |
| pets Banner.png | 2021-03-04 09:28 | 318K | |
| navas.PNG | 2021-02-08 11:05 | 767K | |
| na banner.png | 2021-02-11 10:40 | 390K | |
| mproper Fractions Banner.png | 2021-02-26 14:15 | 106K | |
| mnTH.pdf | 2021-04-05 09:53 | 446K | |
| midwest farmngn.PNG | 2021-02-05 16:44 | 729K | |
| mf.PNG | 2021-02-04 10:49 | 442K | |
| mex inda.PNG | 2021-02-16 10:08 | 428K | |
| mean Averages.png | 2021-02-26 11:00 | 494K | |
| mathematics Banner.png | 2021-02-25 12:23 | 61K | |
| math.pdf | 2021-03-05 09:52 | 461K | |
| less 1.pdf | 2021-02-03 10:05 | 425K | |
| last proyect.mp4 | 2021-02-04 14:10 | 75M | |
| l23.PNG | 2021-02-19 11:34 | 129K | |
| kidney.pdf | 2022-02-10 12:41 | 95K | |
| isolation Banner.png | 2021-02-23 17:07 | 312K | |
| intensifersn.PNG | 2021-03-10 16:35 | 268K | |
| http banner.png | 2021-02-24 14:25 | 327K | |
| housingstats.png | 2022-01-27 16:58 | 302K | |
| history of totem Poles.PNG | 2021-02-11 10:58 | 864K | |
| history.docx | 2021-02-19 13:14 | 20K | |
| grey coat.png | 2021-03-11 10:39 | 17K | |
| fractions 4th.png | 2021-02-26 12:47 | 362K | |
| fossils Banner.png | 2021-03-02 11:06 | 306K | |
| endlsave.PNG | 2021-02-11 17:14 | 873K | |
| earth Past 2.png | 2021-03-02 11:01 | 337K | |
| earth Past 1.png | 2021-03-02 10:59 | 266K | |
| digital.pdf | 2021-03-08 17:19 | 1.1M | |
| density.PNG | 2021-03-18 14:21 | 662K | |
| deduction and speculation.png | 2021-03-15 13:15 | 674K | |
| collegeadmission.png | 2022-01-27 17:02 | 522K | |
| collective Noun.PNG | 2021-02-22 16:17 | 800K | |
| begiuning.png | 2021-02-13 16:16 | 80K | |
| battles.PNG | 2021-02-15 12:26 | 444K | |
| basket ball.png | 2021-03-12 10:57 | 301K | |
| basics Multiplication.png | 2021-02-25 13:30 | 132K | |
| astro unit.PNG | 2021-03-29 14:01 | 902K | |
| assignemtns.txt | 2021-02-26 14:28 | 11K | |
| article.png | 2022-01-27 17:01 | 276K | |
| ansers.PNG | 2021-03-29 09:51 | 1.7K | |
| aerobics.png | 2021-03-12 11:03 | 264K | |
| add with regroup assignment.pdf | 2021-02-26 11:47 | 446K | |
| add and sub.png | 2021-03-05 10:29 | 242K | |
| activity 2a.PNG | 2021-03-29 09:03 | 7.6K | |
| activity 1.png | 2021-02-10 15:40 | 40K | |
| abrams.png | 2022-01-27 17:12 | 1.5M | |
| Zoo Banner.png | 2021-03-03 10:30 | 375K | |
| Yorktown.PNG | 2021-02-15 12:20 | 824K | |
| Yellow Fractions Banner.png | 2021-02-26 12:41 | 338K | |
| Writing BAnner.png | 2021-03-03 12:13 | 251K | |
| World War II Timeline.PNG | 2021-02-18 11:42 | 378K | |
| World Civil.png | 2021-02-23 14:48 | 219K | |
| Womens Suffrage.PNG | 2021-02-18 11:00 | 494K | |
| Wolf Banner.png | 2021-03-03 11:04 | 313K | |
| Will and Going.PNG | 2021-03-10 10:24 | 411K | |
| Why Use Past.png | 2021-03-12 13:03 | 229K | |
| Why Punctuation is Hard.png | 2021-03-12 15:24 | 624K | |
| Why Do Dhips Float.PNG | 2021-03-18 16:47 | 510K | |
| Whole Numbers Banner.png | 2021-02-26 14:25 | 381K | |
| Who is God.png | 2021-02-13 15:02 | 159K | |
| What makes an atom.PNG | 2021-04-06 13:43 | 389K | |
| What is stomata.PNG | 2021-02-19 15:12 | 337K | |
| What is scientiic investigation.PNG | 2021-03-31 11:57 | 272K | |
| What is science.PNG | 2021-03-31 11:49 | 742K | |
| What is a satellite.PNG | 2021-03-30 10:49 | 553K | |
| What is a Molecule.PNG | 2021-04-07 11:31 | 355K | |
| What is a Missionary.PNG | 2021-02-11 17:11 | 891K | |
| What is a Light Year.PNG | 2021-03-19 10:00 | 738K | |
| What is a Drought.PNG | 2021-02-08 10:01 | 936K | |
| What is Religon.png | 2021-02-09 16:29 | 312K | |
| What is Photosystheiss.PNG | 2021-02-19 15:02 | 562K | |
| What is Nebula.PNG | 2021-03-29 13:57 | 1.0M | |
| What is Forece.PNG | 2021-03-17 14:15 | 792K | |
| What is Average Speed.PNG | 2021-03-17 12:33 | 227K | |
| What i Pressure.PNG | 2021-03-18 14:15 | 366K | |
| What are Stars.PNG | 2021-03-19 10:03 | 549K | |
| What are Fungi.PNG | 2021-02-19 11:18 | 810K | |
| What are Comets.PNG | 2021-04-01 12:56 | 806K | |
| Wh Questions banner.png | 2021-03-16 14:24 | 9.6K | |
| Wh Questions.png | 2021-03-16 14:25 | 77K | |
| Wetland Banner 2.png | 2021-03-09 10:47 | 28K | |
| Wetland Banner.png | 2021-03-09 10:47 | 314K | |
| Western Europe Banner1.png | 2021-02-23 15:26 | 361K | |
| Western Europe Banner.png | 2021-02-23 15:25 | 511K | |
| Welcome to theatre banner1.png | 2021-02-23 09:56 | 360K | |
| Welcome to theatre banner.png | 2021-02-23 09:54 | 360K | |
| Welcome to Factors Banner.png | 2021-02-25 12:11 | 163K | |
| Weights.png | 2021-03-11 10:53 | 36K | |
| Website Evlautation.pdf | 2021-03-05 12:42 | 88K | |
| Weather Banner.png | 2021-03-03 09:56 | 244K | |
| Waterview Bannrt.png | 2021-02-23 17:00 | 416K | |
| Water evaporation experiment.PNG | 2021-04-05 14:22 | 762K | |
| War of 1812.PNG | 2021-02-15 17:45 | 702K | |
| Wampum.PNG | 2021-02-11 13:29 | 782K | |
| Voting rights.PNG | 2021-02-18 13:41 | 840K | |
| Volcanoes.PNG | 2021-02-08 17:17 | 725K | |
| Vj.png | 2021-02-04 12:27 | 140K | |
| Vietnam War.PNG | 2021-02-18 14:18 | 306K | |
| Victoria.png | 2021-03-15 08:39 | 417K | |
| Very Pretty.PNG | 2021-03-10 16:33 | 579K | |
| Vert Invert.PNG | 2021-02-19 11:07 | 930K | |
| Verb tense.PNG | 2021-03-10 15:32 | 495K | |
| Verbs d.png | 2021-03-03 16:08 | 206K | |
| Verbs and Time.png | 2021-03-03 13:22 | 278K | |
| Veggtie.png | 2021-03-15 13:56 | 271K | |
| Vcan.png | 2021-02-04 11:47 | 59K | |
| Vball.png | 2021-03-12 10:55 | 346K | |
| Vascular plants.png | 2021-02-19 13:23 | 385K | |
| Vascular Non Vas.PNG | 2021-02-19 11:11 | 1.1M | |
| Using Would have could have.png | 2021-03-12 13:40 | 436K | |
| Usage Conditionals.png | 2021-03-16 12:28 | 100K | |
| Usafge.png | 2021-03-15 15:40 | 101K | |
| Universe Banner.png | 2021-03-29 13:01 | 339K | |
| Unit Cell and multi.PNG | 2021-02-19 10:14 | 378K | |
| Unit 11 Project.png | 2021-03-16 10:19 | 70K | |
| Unit 10 Project.png | 2021-03-15 14:05 | 81K | |
| Unit 10 Lesson 2 Journal.pdf | 2021-03-15 12:57 | 224K | |
| Unit 10 Lesson 1 Journal.pdf | 2021-03-15 12:29 | 175K | |
| Unit 9 Project.png | 2021-03-15 12:10 | 62K | |
| Unit 8 b.PNG | 2021-02-17 15:48 | 421K | |
| Unit 8 The Modern Era.PNG | 2021-02-17 15:48 | 1.0M | |
| Unit 8 Project.png | 2021-03-15 10:52 | 48K | |
| Unit 8 A.PNG | 2021-02-17 15:48 | 456K | |
| Unit 7 The Nation Grows.PNG | 2021-02-17 09:55 | 1.2M | |
| Unit 7 Project.png | 2021-03-15 09:26 | 50K | |
| Unit 7 Magnets Lesson 1 Apply.pdf | 2021-02-05 10:25 | 400K | |
| Unit 7 Lesson 3 Motors and Generators Apply.pdf | 2021-02-05 10:25 | 419K | |
| Unit 7 Lesson 2 Electromagnets Apply.pdf | 2021-02-05 10:25 | 420K | |
| Unit 7 B.PNG | 2021-02-17 09:55 | 427K | |
| Unit 6 a.PNG | 2021-02-16 10:40 | 529K | |
| Unit 6 Studying the Universe B.PNG | 2021-03-19 09:07 | 698K | |
| Unit 6 Studying the Universe A.PNG | 2021-03-19 09:07 | 852K | |
| Unit 6 Salvery.PNG | 2021-02-16 11:13 | 1.1M | |
| Unit 6 Recall.png | 2021-02-25 15:25 | 242K | |
| Unit 6 Project.png | 2021-03-12 13:58 | 52K | |
| Unit 6 Ordinal and Position Numbers.png | 2021-03-05 11:33 | 515K | |
| Unit 6 Fractions and Mixed Numbers.png | 2021-02-25 15:25 | 616K | |
| Unit 6 Electricity Lesson 3 Apply.pdf | 2021-02-05 09:51 | 395K | |
| Unit 6 Electricity Lesson 2 Apply.pdf | 2021-02-05 09:51 | 424K | |
| Unit 6 Electricity Lesson 1 Apply.pdf | 2021-02-05 09:51 | 414K | |
| Unit 5 lesson 3.pdf | 2021-02-04 16:24 | 130K | |
| Unit 5 Story Structure B.png | 2021-03-03 17:02 | 361K | |
| Unit 5 Story Structure.png | 2021-03-03 17:02 | 667K | |
| Unit 5 Shapes and Patterns.png | 2021-03-04 17:06 | 413K | |
| Unit 5 Recall.png | 2021-02-26 10:28 | 271K | |
| Unit 5 Project Banner.png | 2021-03-12 12:27 | 43K | |
| Unit 5 Motion.PNG | 2021-03-17 10:47 | 723K | |
| Unit 5 Meeting People.png | 2021-03-08 10:47 | 406K | |
| Unit 5 Meeting People !.png | 2021-03-08 11:08 | 584K | |
| Unit 5 Forces.PNG | 2021-03-17 10:47 | 697K | |
| Unit 5 Earths Resources B.png | 2021-03-02 12:25 | 543K | |
| Unit 5 Earths Resources A.png | 2021-03-02 12:21 | 312K | |
| Unit 5 Data and Prob.png | 2021-02-26 10:26 | 355K | |
| Unit 5 B.PNG | 2021-02-15 13:51 | 486K | |
| Unit 5 A.PNG | 2021-02-15 13:51 | 531K | |
| Unit 4 tables and line Gaphs.png | 2021-02-26 09:47 | 822K | |
| Unit 4 The Struggle For North America.PNG | 2021-02-12 14:28 | 1.0M | |
| Unit 4 Subtraction facts.png | 2021-03-04 14:43 | 349K | |
| Unit 4 Recall Priot KNowledge.png | 2021-02-26 09:49 | 253K | |
| Unit 4 Introduction.PNG | 2021-03-31 10:08 | 766K | |
| Unit 4 Intoduction B.PNG | 2021-03-31 10:08 | 628K | |
| Unit 4B.png | 2021-03-03 14:45 | 378K | |
| Unit 4A.png | 2021-03-03 14:45 | 738K | |
| Unit 3 Whole Numbers multi and div.png | 2021-02-25 13:14 | 552K | |
| Unit 3 Recall Page.png | 2021-02-25 13:16 | 325K | |
| Unit 3 Project yo.png | 2021-03-11 09:39 | 48K | |
| Unit 3 Phots for Project.png | 2021-03-11 09:41 | 603K | |
| Unit 3 Into B.PNG | 2021-03-31 09:56 | 652K | |
| Unit 3 Colonial America.PNG | 2021-02-12 10:59 | 1.1M | |
| Unit 3 Colnial Americxa.PNG | 2021-02-12 10:57 | 1.1M | |
| Unit 3 A.png | 2021-03-03 12:39 | 746K | |
| Unit 2 Where People Live B.PNG | 2021-03-08 09:36 | 936K | |
| Unit 2 Where People Live.PNG | 2021-03-08 09:36 | 703K | |
| Unit 2 Project.png | 2021-03-10 16:39 | 47K | |
| Unit 2 Plants and Structures.PNG | 2021-02-19 11:23 | 187K | |
| Unit 2 Number Bonds.png | 2021-03-04 13:24 | 391K | |
| Unit 2 Lesson 4 Addition with Regrouping in Tens Apply.pdf | 2021-02-26 11:50 | 258K | |
| Unit 2 Intro.PNG | 2021-03-31 09:49 | 767K | |
| Unit 2 Intro. B.PNG | 2021-03-31 09:49 | 661K | |
| Unit 2 Ecploration and Colonization.PNG | 2021-02-11 14:03 | 970K | |
| Unit 2 B.png | 2021-03-03 10:40 | 385K | |
| Unit 2 A.png | 2021-03-03 10:40 | 641K | |
| Unit 1 School Spirit.png | 2021-03-05 15:05 | 614K | |
| Unit 1 Rules and LAws 1.png | 2021-03-08 09:21 | 673K | |
| Unit 1 Rules and LAws.png | 2021-03-08 09:21 | 625K | |
| Unit 1 Native Peoples of North America.PNG | 2021-02-11 10:33 | 1.0M | |
| Unit 1 Lesson 1 Objects.png | 2021-03-04 12:52 | 343K | |
| Unit 1 Into to Physical Science B.PNG | 2021-03-31 09:23 | 521K | |
| Unit 1 Into to Physical Science A.PNG | 2021-03-31 09:23 | 715K | |
| Unit 1 B.png | 2021-03-03 09:42 | 379K | |
| Unit 1 A.png | 2021-03-03 09:40 | 916K | |
| Ultimate Banner refined.png | 2021-03-05 14:46 | 195K | |
| Ubit 6b.PNG | 2021-02-16 10:40 | 478K | |
| Uaing a table.png | 2021-02-26 10:07 | 364K | |
| UYnit 5 A New NAtion.PNG | 2021-02-15 13:49 | 1.1M | |
| UYnit 3 Intro A.PNG | 2021-03-31 09:56 | 759K | |
| U7 People PLaces.PNG | 2021-02-17 09:55 | 454K | |
| U5 2.PNG | 2021-02-12 14:35 | 432K | |
| U5 1.PNG | 2021-02-12 14:35 | 537K | |
| Typrd.PNG | 2021-02-03 14:57 | 431K | |
| Types of Wetlands.PNG | 2021-02-05 13:46 | 498K | |
| Types of Scientist.PNG | 2021-03-31 12:03 | 445K | |
| Types of Friction.PNG | 2021-03-17 16:22 | 179K | |
| Types of Conditions.PNG | 2021-03-16 13:50 | 451K | |
| Types of.PNG | 2021-03-17 09:21 | 453K | |
| TuskeegeeAirmen.PNG | 2022-01-28 15:15 | 680K | |
| Tuckets Travel banner.png | 2021-02-24 15:13 | 309K | |
| Triple Ms.PNG | 2021-04-01 14:39 | 696K | |
| Tree Rings.PNG | 2021-02-19 13:57 | 905K | |
| Treaty of Paris.PNG | 2021-02-15 12:12 | 852K | |
| Treaty.PNG | 2021-02-16 10:00 | 564K | |
| Travel Banner.png | 2021-03-03 15:07 | 389K | |
| Transport and Homeostasis.pdf | 2022-02-08 14:07 | 277K | |
| Translovation.PNG | 2021-02-19 13:46 | 540K | |
| Transformations banner.png | 2021-02-24 09:52 | 109K | |
| Transcontinental railroad.PNG | 2021-02-17 10:28 | 611K | |
| Trail of Tears.PNG | 2021-02-05 15:02 | 403K | |
| Trail.PNG | 2021-02-16 09:40 | 530K | |
| Trading Stocks.png | 2021-03-15 09:54 | 239K | |
| Traction banner.png | 2021-03-04 16:15 | 167K | |
| Totem Poles.PNG | 2021-02-11 10:47 | 878K | |
| Tools of Science.PNG | 2021-04-01 10:12 | 666K | |
| Tiger Banner.png | 2021-03-02 10:19 | 448K | |
| Thomas J.PNG | 2021-02-15 17:13 | 509K | |
| Thomas Edision.PNG | 2021-02-17 14:11 | 287K | |
| Theory Vs Law.PNG | 2021-04-01 10:44 | 286K | |
| Theatre mask.png | 2021-02-23 09:58 | 111K | |
| Theatre chairs banner.png | 2021-02-23 10:33 | 172K | |
| Theatre book icon.png | 2021-02-23 09:50 | 5.6K | |
| Theatre banner 1.png | 2021-02-23 13:56 | 222K | |
| Theatre banner.png | 2021-02-23 11:23 | 383K | |
| Theatre Book Banner.png | 2021-02-23 11:13 | 282K | |
| Theatre Behind the sceens banner.png | 2021-02-23 10:40 | 350K | |
| The Underground Railroad.PNG | 2021-02-16 13:07 | 694K | |
| The Stamp Act.PNG | 2021-02-12 16:38 | 384K | |
| The Sourhern colonies.PNG | 2021-02-12 11:40 | 751K | |
| The Scientific Method.PNG | 2021-03-31 13:50 | 399K | |
| The Robbery Banner.png | 2021-03-15 09:40 | 83K | |
| The Nucelus.PNG | 2021-04-06 13:49 | 593K | |
| The Middle Colonies.PNG | 2021-02-12 11:15 | 802K | |
| The Lousiana Purchase.PNG | 2021-02-15 17:07 | 805K | |
| The Lion KIng.png | 2021-03-15 08:36 | 439K | |
| The Haunted House.png | 2021-03-16 09:57 | 293K | |
| The Great Train Robbery.png | 2021-03-15 09:54 | 409K | |
| The Great Salt Lake.PNG | 2021-02-08 11:48 | 907K | |
| The Great Plains.PNG | 2021-02-05 16:39 | 1.0M | |
| The Great Lakes.PNG | 2021-02-05 15:18 | 1.0M | |
| The Great Compromiser.PNG | 2021-02-15 14:38 | 506K | |
| The French in Lousinana.PNG | 2021-02-12 14:30 | 970K | |
| The Four Major Religions.docx | 2021-02-14 12:21 | 18K | |
| The Errie Canal.PNG | 2021-02-16 09:21 | 1.1M | |
| The English Alphabet.png | 2021-03-12 15:28 | 587K | |
| The Creation Apply.docx | 2021-02-13 16:26 | 14K | |
| The Call of Abram Apply.docx | 2021-02-14 14:38 | 14K | |
| The Boston Masacre.PNG | 2021-02-12 16:45 | 824K | |
| The Biug Surprise.png | 2021-03-15 11:51 | 105K | |
| The Big Bang Theory.PNG | 2021-03-29 13:11 | 1.0M | |
| The BIll of Rights.PNG | 2021-02-15 15:12 | 942K | |
| The Articles of Confederationb.PNG | 2021-02-15 14:30 | 1.0M | |
| Terr vs Jov.PNG | 2021-03-30 09:40 | 496K | |
| Tennis Raquets.png | 2021-03-12 10:59 | 94K | |
| Telling Stories Banner.png | 2021-03-03 10:52 | 301K | |
| Tell Vs Say.png | 2021-03-10 10:27 | 66K | |
| Teepee experience.PNG | 2021-02-11 12:39 | 1.0M | |
| Team Banner.png | 2021-02-24 12:56 | 260K | |
| Teaching Engllish.png | 2021-03-15 16:05 | 541K | |
| Tally Chart.png | 2021-02-26 09:57 | 247K | |
| Talk About Sports in English.PNG | 2021-03-11 12:18 | 698K | |
| TH Sounds.png | 2021-03-12 15:39 | 833K | |
| Sw Region Georgraphy.PNG | 2021-02-08 09:49 | 461K | |
| Supreme couret.PNG | 2021-02-15 15:09 | 679K | |
| Sunday Morning.PNG | 2021-02-05 13:39 | 601K | |
| Subtracting Mixed Numbers 1.png | 2021-02-26 13:11 | 278K | |
| Subtracting Mixed Numbers.png | 2021-02-25 16:26 | 695K | |
| Subtracting Mixed.png | 2021-02-26 13:39 | 97K | |
| Sub Banner traction.png | 2021-03-04 15:15 | 107K | |
| Study of matter banner.png | 2021-04-06 12:06 | 110K | |
| Strucutew of matter.png | 2021-03-30 14:50 | 410K | |
| Strucure.PNG | 2021-02-18 16:47 | 238K | |
| Structure 1.PNG | 2021-02-18 16:47 | 222K | |
| Storm Waters Banner.png | 2021-02-24 13:45 | 306K | |
| Stono reb.PNG | 2021-02-12 12:58 | 567K | |
| Statric.PNG | 2021-02-03 14:39 | 969K | |
| Static Electricty.PNG | 2021-02-03 14:25 | 391K | |
| States of matter Banner.png | 2021-04-05 12:43 | 359K | |
| States of Matter Video.PNG | 2021-04-05 12:56 | 484K | |
| States of Matter Lab-1 (1).pdf | 2021-02-19 15:36 | 272K | |
| States of Matter.PNG | 2021-04-05 08:36 | 396K | |
| Stars galaxies banner.png | 2021-03-19 09:52 | 303K | |
| Stars banner.png | 2021-03-19 10:57 | 335K | |
| Stars and the HR Diagram.PNG | 2021-03-19 12:51 | 515K | |
| St2.PNG | 2021-02-18 16:51 | 246K | |
| Spread banner.png | 2021-02-23 17:49 | 447K | |
| Sports Do.png | 2021-03-11 14:56 | 102K | |
| Sports Banner.png | 2021-03-11 11:59 | 38K | |
| Spiral Galaxy.PNG | 2021-03-19 13:58 | 1.1M | |
| Spanish American War.PNG | 2021-02-17 14:59 | 571K | |
| Spaninards.PNG | 2021-02-11 14:36 | 919K | |
| Spains Oversseas.PNG | 2021-02-11 17:01 | 834K | |
| Spain.PNG | 2021-02-11 17:19 | 1.1M | |
| Southeast Economy.PNG | 2021-02-05 14:16 | 1.0M | |
| South Surrenders.PNG | 2021-02-16 14:10 | 812K | |
| Solving word Problems.png | 2021-02-25 15:12 | 535K | |
| Solve.png | 2021-03-01 12:28 | 63K | |
| Solar System Banner.png | 2021-03-29 13:40 | 353K | |
| Solar Energy.PNG | 2021-02-08 10:10 | 899K | |
| Soil Banner.png | 2021-03-02 10:37 | 434K | |
| Social Banner.png | 2021-02-10 10:39 | 253K | |
| Social.png | 2021-02-01 14:36 | 225K | |
| Sneakers.png | 2021-03-11 09:56 | 22K | |
| Small Bodies Banner.png | 2021-03-30 11:55 | 274K | |
| Slope of a Line.PNG | 2021-04-01 14:47 | 529K | |
| Skiing Banner.png | 2021-03-17 12:09 | 255K | |
| Skeletald.pdf | 2022-02-10 10:13 | 14M | |
| Skeletal.pdf | 2022-02-10 09:40 | 14M | |
| Sk.pdf | 2022-02-10 09:44 | 13M | |
| Sink or Float.PNG | 2021-03-18 16:39 | 589K | |
| Single Cell.PNG | 2021-02-19 10:10 | 965K | |
| Sing and Plural.PNG | 2021-02-22 16:12 | 636K | |
| Sing Plural.png | 2021-03-03 12:22 | 212K | |
| Simple end.png | 2021-03-16 09:40 | 257K | |
| Simple Sub and Pred.PNG | 2021-02-22 10:57 | 679K | |
| Simple Present Passive.png | 2021-03-15 09:06 | 271K | |
| Simple Passive Banner'.png | 2021-03-15 09:04 | 57K | |
| Simple Future.png | 2021-03-10 10:22 | 473K | |
| Si Measurements.PNG | 2021-04-01 10:08 | 477K | |
| Show Sequence.png | 2021-03-12 13:09 | 520K | |
| Should Have d.png | 2021-03-12 13:37 | 476K | |
| Should Have.png | 2021-03-12 13:23 | 184K | |
| Shot Answers.png | 2021-03-12 12:56 | 188K | |
| Shermans MArch to sea.PNG | 2021-02-16 14:06 | 773K | |
| Shays Rebellion.PNG | 2021-02-15 14:34 | 854K | |
| Sharecropping.PNG | 2021-02-17 09:45 | 798K | |
| Shapes and Patterns Banner.png | 2021-03-05 10:20 | 378K | |
| Shapes Banner.png | 2021-03-05 10:29 | 64K | |
| Sequence Words.png | 2021-03-15 08:56 | 453K | |
| Sentence Structure.PNG | 2021-02-22 11:13 | 540K | |
| See Shapes Banner.png | 2021-03-05 10:43 | 221K | |
| Second conditional.png | 2021-03-16 12:31 | 110K | |
| Second Continental Congress.PNG | 2021-02-15 10:05 | 762K | |
| Second Con.PNG | 2021-03-16 13:16 | 522K | |
| Seasons BAnner.png | 2021-03-03 13:08 | 391K | |
| Searching for nw.PNG | 2021-02-11 17:47 | 819K | |
| Scientific Method Banner.png | 2021-03-31 13:16 | 233K | |
| Science Tools Banner.png | 2021-04-01 09:47 | 258K | |
| Science E Banner.png | 2021-04-05 10:26 | 87K | |
| Science Banner.png | 2021-02-10 11:57 | 127K | |
| Science 1 Banner.png | 2021-03-31 11:23 | 318K | |
| Say and Tell.PNG | 2021-03-10 11:29 | 306K | |
| Say Tell.PNG | 2021-03-10 10:33 | 549K | |
| S and Z sounds.png | 2021-03-12 15:47 | 790K | |
| S and S.PNG | 2021-04-06 10:52 | 853K | |
| Saff.PNG | 2021-03-16 11:42 | 595K | |
| SImple Or Continouis.png | 2021-03-15 10:21 | 530K | |
| Rules Wh Questions.png | 2021-03-16 14:27 | 82K | |
| Rules.png | 2021-03-12 12:36 | 277K | |
| Rule of Law.png | 2021-03-15 09:35 | 325K | |
| R sound.png | 2021-03-12 15:45 | 485K | |
| Royal Mystery Banner.png | 2021-02-24 12:52 | 289K | |
| Rounding Whole Numbers.png | 2021-02-25 12:09 | 462K | |
| Round To Estimate.png | 2021-02-25 12:04 | 502K | |
| Rome Banner.png | 2021-02-23 15:12 | 394K | |
| Rocks Chassing Banner.png | 2021-03-02 10:33 | 459K | |
| Rocks Banner.png | 2021-03-02 10:29 | 335K | |
| Rock and Learn.PNG | 2021-03-17 12:58 | 1.0M | |
| Rock Reporting Banner.png | 2021-02-24 14:57 | 347K | |
| Road ton Civil War Bannere.png | 2021-02-24 10:51 | 337K | |
| Riddles of LAwq.png | 2021-03-15 09:37 | 401K | |
| Ri banner.png | 2021-02-23 17:48 | 396K | |
| Revising and Editing Checklist for a Research Paper.pdf | 2023-08-18 09:07 | 1.5M | |
| Reported Spech.png | 2021-03-15 11:26 | 217K | |
| RenewResources.PNG | 2021-02-05 14:10 | 455K | |
| Renassiance Banner.png | 2021-02-23 17:02 | 457K | |
| Remainders.png | 2021-02-25 15:14 | 578K | |
| Religous Education.png | 2021-02-09 17:08 | 318K | |
| Religion banner.png | 2021-02-13 14:44 | 290K | |
| Religion.png | 2021-02-13 14:14 | 327K | |
| Rel.png | 2021-02-14 10:56 | 895K | |
| Reformation banner.png | 2021-02-23 17:04 | 436K | |
| Red Fractiosn Banner.png | 2021-02-25 16:18 | 299K | |
| Red 1 Fractions Banner.png | 2021-02-26 15:07 | 71K | |
| Reconstruction Sovciet.PNG | 2021-02-17 09:41 | 675K | |
| Reconstruction.PNG | 2021-02-16 15:08 | 1.0M | |
| Recon banner.png | 2021-02-18 10:08 | 352K | |
| Recon.png | 2021-02-17 15:26 | 430K | |
| Reaction to Civil War.PNG | 2021-02-16 12:46 | 459K | |
| Range of Response banner.png | 2021-03-15 11:05 | 136K | |
| Range.png | 2021-02-26 11:18 | 25K | |
| Rang.png | 2021-02-26 12:33 | 25K | |
| Rafting.png | 2021-03-12 10:38 | 326K | |
| Racism.png | 2022-02-09 13:20 | 275K | |
| Questions 1.png | 2021-03-15 11:21 | 317K | |
| Questionms wh.png | 2021-03-16 14:29 | 41K | |
| Question Grammar.png | 2021-03-03 15:02 | 345K | |
| PushPull Banner.png | 2021-03-02 14:33 | 316K | |
| Pure Substance.PNG | 2021-04-05 16:22 | 544K | |
| Punctuation Exercises.png | 2021-03-12 15:20 | 852K | |
| Punctuation Banner.png | 2021-03-12 16:16 | 89K | |
| Pug.png | 2021-03-11 10:53 | 39K | |
| Pueblos.PNG | 2021-02-11 12:11 | 855K | |
| Public Speaking Banner.png | 2021-03-03 13:54 | 265K | |
| Proyect 11 (2) (1).mp4 | 2021-02-03 10:16 | 62M | |
| Properties of Matter.PNG | 2021-04-05 11:54 | 825K | |
| Properties of Mater Banner.png | 2021-04-05 08:21 | 123K | |
| Properties.PNG | 2021-04-05 12:10 | 740K | |
| Proofreading Checklist.pdf | 2023-08-18 11:27 | 1.9M | |
| Pronouns Grammar.png | 2021-03-03 17:49 | 232K | |
| Pronounce Months of the year.png | 2021-03-12 15:32 | 723K | |
| Proclomation of 1763.PNG | 2021-02-12 15:31 | 818K | |
| Probility of Fractiosn.png | 2021-02-26 12:06 | 95K | |
| Probability to Fractiosn.png | 2021-02-26 12:05 | 495K | |
| Probability Banner.png | 2021-02-26 11:58 | 69K | |
| Prob.png | 2021-02-26 12:10 | 500K | |
| Prime and Composite.png | 2021-02-25 12:21 | 419K | |
| Prime Factorization.png | 2021-02-25 12:19 | 424K | |
| Presentation1.pptx | 2021-02-09 10:00 | 16M | |
| Present Rules.png | 2021-03-15 09:08 | 244K | |
| Present Perfect Cont.png | 2021-03-15 10:12 | 84K | |
| Prepo.png | 2021-03-03 16:35 | 220K | |
| Predictions Banner.png | 2021-03-10 10:11 | 72K | |
| Power of Circuits.PNG | 2021-02-03 15:04 | 835K | |
| Potlach.PNG | 2021-02-11 10:53 | 795K | |
| Pol.PNG | 2021-02-12 10:50 | 409K | |
| Point by Point Outline Worksheet.pdf | 2023-08-18 08:51 | 24K | |
| Poety Banner.png | 2021-02-23 11:10 | 360K | |
| Poessive Pronouns.png | 2021-03-04 09:38 | 212K | |
| Plasma Gas.PNG | 2021-04-05 13:00 | 522K | |
| Plants vs Animals Banner.png | 2021-03-02 12:48 | 429K | |
| Plants banner.png | 2021-03-01 15:02 | 353K | |
| Plant and animal cells.PNG | 2021-02-18 17:02 | 613K | |
| Plant Stem Classification.PNG | 2021-02-19 14:05 | 462K | |
| Plant Repro and Class.PNG | 2021-02-19 12:36 | 646K | |
| Plant Classification.PNG | 2021-02-19 12:33 | 824K | |
| Place Value Video.png | 2021-02-25 11:05 | 514K | |
| Pioneer Days.PNG | 2021-02-08 09:29 | 899K | |
| Pioneer Banner.png | 2021-02-24 15:26 | 336K | |
| Physical and Chemniucal.PNG | 2021-04-05 12:00 | 418K | |
| Physical and Chemical Changes.PNG | 2021-04-05 10:59 | 276K | |
| Physical Science Texbook.png | 2021-03-17 11:40 | 240K | |
| Physical Sceince project.png | 2021-04-01 15:36 | 275K | |
| Physical Properties of Matter.PNG | 2021-04-05 10:45 | 402K | |
| Phrasal Verbs in Daily English.png | 2021-03-15 12:40 | 349K | |
| Phrasal Verbs TRips.png | 2021-03-15 12:43 | 452K | |
| Phrasal Verbs 4.png | 2021-03-15 12:36 | 114K | |
| Phrasal Verbs 3.png | 2021-03-15 12:34 | 269K | |
| Phrasal Verbs 2.png | 2021-03-15 12:32 | 235K | |
| Phrasal Verbs 1.png | 2021-03-15 12:31 | 189K | |
| Phrasal Verbs.png | 2021-03-15 12:24 | 73K | |
| Phr Verbs.PNG | 2021-03-15 12:46 | 634K | |
| People of the Midwest.PNG | 2021-02-08 09:22 | 794K | |
| People of eastern woodland.PNG | 2021-02-11 12:57 | 691K | |
| People and events 2.PNG | 2021-02-12 10:40 | 410K | |
| People and Events.PNG | 2021-02-12 10:40 | 525K | |
| Peg.PNG | 2021-03-16 09:50 | 433K | |
| Patterns Banner.png | 2021-03-04 13:08 | 222K | |
| Patriots and loyalist.PNG | 2021-02-15 10:41 | 1.0M | |
| Past Tense Responses.png | 2021-03-16 09:32 | 124K | |
| Past Simple Responses.png | 2021-03-16 09:34 | 272K | |
| Past Simple Banner.png | 2021-03-10 14:36 | 115K | |
| Past Simple.png | 2021-03-16 09:43 | 256K | |
| Past Perfect Banner.png | 2021-03-12 12:31 | 47K | |
| Past Partivple.png | 2021-03-12 13:06 | 259K | |
| Past Part.png | 2021-03-16 09:38 | 347K | |
| Past Continous Tenese BAnner.png | 2021-03-15 15:59 | 737K | |
| Past Continous Banner.png | 2021-03-15 15:37 | 84K | |
| Passive Voicw.png | 2021-03-15 09:18 | 454K | |
| Parts of a plant banner.png | 2021-03-01 14:05 | 403K | |
| Partcipating.png | 2021-03-16 09:36 | 324K | |
| Part V.png | 2021-03-12 14:07 | 501K | |
| Part 1 Sports.PNG | 2021-03-11 14:07 | 1.0M | |
| Panada Banner.png | 2021-03-03 13:26 | 304K | |
| Package Banner.png | 2021-03-05 14:37 | 288K | |
| PPC Tense.png | 2021-03-15 10:19 | 390K | |
| PIQ.PNG | 2021-03-16 09:47 | 415K | |
| PCt.png | 2021-03-15 15:57 | 749K | |
| PCT3.png | 2021-03-16 09:04 | 217K | |
| PCT2.png | 2021-03-16 09:02 | 248K | |
| PCT.png | 2021-03-16 09:00 | 229K | |
| Outcome BAnner.png | 2021-02-26 11:29 | 115K | |
| Organs and Organ Systems.PNG | 2021-02-19 10:20 | 345K | |
| Orange Fractions Banner.png | 2021-02-26 12:58 | 299K | |
| Omniscient.png | 2021-02-13 15:19 | 265K | |
| Omnipressewnce.png | 2021-02-14 12:37 | 241K | |
| Omnipotent.png | 2021-02-13 15:27 | 302K | |
| Old Yeller Banner.png | 2021-03-09 10:32 | 251K | |
| Oil and Gas Formation.PNG | 2021-02-05 14:27 | 827K | |
| Off and Running Banner.png | 2021-03-05 14:50 | 283K | |
| Observing in Science.PNG | 2021-03-31 13:59 | 716K | |
| Numbers to 100 Banner.png | 2021-02-25 10:39 | 358K | |
| Numbers 1 to 10.png | 2021-03-12 15:34 | 516K | |
| Number Forms Video.png | 2021-02-25 11:07 | 221K | |
| Noun Grammar.png | 2021-03-03 09:53 | 402K | |
| Notebook Banner.png | 2021-03-03 10:06 | 336K | |
| Nonmetals.PNG | 2021-04-05 16:25 | 670K | |
| Newtons seond.PNG | 2021-03-18 12:55 | 703K | |
| Newtons Third Law.PNG | 2021-03-18 12:57 | 649K | |
| Newtons Law of Universal Gravation.PNG | 2021-03-18 09:42 | 893K | |
| Newtons Law Banner.png | 2021-03-18 12:05 | 278K | |
| Newtons First.PNG | 2021-03-18 12:52 | 607K | |
| Newtonian Gravity.PNG | 2021-03-18 09:51 | 694K | |
| New directory/ | 2022-01-27 16:57 | - | |
| New France.PNG | 2021-02-12 10:12 | 1.0M | |
| Never Give up.png | 2021-03-10 13:58 | 378K | |
| Neighboorhood lessob 4.png | 2021-03-03 10:23 | 366K | |
| Neighboorhood Banner.png | 2021-03-03 10:21 | 410K | |
| Natural resources banner.png | 2021-03-02 12:31 | 364K | |
| Natural resources.PNG | 2021-02-09 16:05 | 840K | |
| Natives of the southwest.PNG | 2021-02-08 10:39 | 1.0M | |
| Native Americans History.PNG | 2021-02-11 12:33 | 357K | |
| Native Americans.PNG | 2021-02-05 14:46 | 842K | |
| Native.PNG | 2021-02-11 12:28 | 875K | |
| Name of Months.png | 2021-03-03 15:23 | 128K | |
| NW Passage.PNG | 2021-02-11 17:36 | 478K | |
| Must have banner.png | 2021-03-12 11:21 | 54K | |
| Must Have.png | 2021-03-12 11:30 | 290K | |
| Must.png | 2021-03-12 11:25 | 396K | |
| Music Banner.png | 2021-03-03 11:16 | 382K | |
| Multiplication Practice.png | 2021-02-25 13:58 | 123K | |
| Multiplication Banner.png | 2021-02-25 12:53 | 191K | |
| Multiplication Arrays.png | 2021-02-25 13:08 | 336K | |
| Multi and Div.png | 2021-02-25 15:17 | 413K | |
| Multi Rays Use.png | 2021-02-25 13:10 | 460K | |
| Multi Digit Sub.png | 2021-02-25 11:44 | 539K | |
| Multi Digit Add.png | 2021-02-25 11:42 | 531K | |
| Mound Builders.PNG | 2021-02-11 10:23 | 881K | |
| Motion tutorial.PNG | 2021-03-17 12:40 | 269K | |
| Motion Banner.png | 2021-03-02 14:12 | 365K | |
| Moses.png | 2021-02-16 14:50 | 492K | |
| Moons of the.PNG | 2021-03-30 10:54 | 666K | |
| Moon banner.png | 2021-03-30 10:41 | 135K | |
| Money vs Barter.PNG | 2021-02-11 14:11 | 283K | |
| Monarchs banner.png | 2021-02-23 17:16 | 365K | |
| Molly Pitcher Banner.png | 2021-02-24 14:16 | 332K | |
| Modern America Banner.png | 2021-02-24 11:09 | 342K | |
| Modeling division.png | 2021-02-25 14:36 | 273K | |
| Mode.png | 2021-02-26 11:16 | 78K | |
| Modals of deduction.png | 2021-03-15 12:55 | 91K | |
| Modal Verbs.PNG | 2021-03-11 09:29 | 557K | |
| Mod.png | 2021-02-26 12:31 | 78K | |
| Mixtures banner.png | 2021-04-06 10:05 | 259K | |
| Mixtures and Solutions.PNG | 2021-04-06 10:47 | 824K | |
| Mixtures and Compounds.PNG | 2021-04-07 09:07 | 875K | |
| Mixed Numbers.png | 2021-02-25 16:28 | 278K | |
| Mix Numbers Banner.png | 2021-02-26 13:21 | 146K | |
| Missourri compromise.PNG | 2021-02-16 11:16 | 949K | |
| Mime banner.png | 2021-02-23 11:00 | 109K | |
| Millionaire.png | 2021-03-15 11:56 | 587K | |
| Might May Will Banner.png | 2021-03-11 09:21 | 91K | |
| Might Have banner.png | 2021-03-12 13:21 | 111K | |
| Midwest Rivers.PNG | 2021-02-05 15:24 | 950K | |
| Midwest Landforms.PNG | 2021-02-05 15:29 | 594K | |
| Middle Colonies.PNG | 2021-02-12 11:08 | 1.0M | |
| Middle Ages Banne.png | 2021-02-23 15:22 | 505K | |
| Mexico Banner.png | 2021-02-24 10:00 | 334K | |
| Metals and NOn Metals.PNG | 2021-04-05 16:36 | 856K | |
| Melting.PNG | 2021-04-05 14:32 | 544K | |
| Medieval Nammer.png | 2021-02-23 15:29 | 445K | |
| Medians.png | 2021-02-26 12:29 | 155K | |
| Median.png | 2021-02-26 11:14 | 155K | |
| Mean or Average.png | 2021-02-26 10:58 | 104K | |
| MeanMedianRange.png | 2021-02-26 11:06 | 131K | |
| Mccarthyism.PNG | 2021-02-18 12:55 | 514K | |
| Math Tables Banner.png | 2021-02-26 10:05 | 104K | |
| Math Mangement Banner.png | 2021-02-25 13:20 | 200K | |
| Mass vs Weight.PNG | 2021-04-05 08:48 | 336K | |
| Mass volume densitry.PNG | 2021-04-05 08:44 | 323K | |
| Mass Production.PNG | 2021-02-18 11:16 | 450K | |
| Maryland and Georga.PNG | 2021-02-12 11:53 | 705K | |
| Marcopolo.PNG | 2021-02-11 14:21 | 1.0M | |
| Manifest.PNG | 2021-02-16 09:43 | 696K | |
| M and M.PNG | 2021-02-04 10:41 | 260K | |
| M and D Banner.png | 2021-02-25 15:02 | 116K | |
| Mammals Banner.png | 2021-03-02 09:47 | 303K | |
| Making a Table.png | 2021-02-26 09:54 | 449K | |
| Making Number Bonds Banner.png | 2021-03-04 13:33 | 255K | |
| Magnets.PNG | 2021-02-04 10:45 | 780K | |
| Magnetism Banner.png | 2021-02-04 10:35 | 234K | |
| Magnetism 2.png | 2021-02-04 10:29 | 115K | |
| Magnetism 1.png | 2021-02-04 10:29 | 183K | |
| MOdals in the Pasr.png | 2021-03-15 13:05 | 461K | |
| MBA Application.png | 2021-03-16 10:20 | 30K | |
| MAgic INgredient.png | 2021-03-15 08:33 | 446K | |
| Love Story Banner.png | 2021-03-12 11:32 | 91K | |
| Lost Colony.PNG | 2021-02-12 11:18 | 651K | |
| LordOfTheRings.pdf | 2021-04-01 11:53 | 13M | |
| Look inside a flower.PNG | 2021-02-19 12:57 | 518K | |
| Long Multiplication Song.png | 2021-02-25 13:53 | 475K | |
| Long Division.png | 2021-02-25 14:56 | 493K | |
| Listen vs Hear.png | 2021-03-16 09:08 | 78K | |
| Listen and hear Vocab.png | 2021-03-16 09:28 | 202K | |
| Listen and Hear.png | 2021-03-16 09:27 | 253K | |
| Linking and Helping Verbs.PNG | 2021-02-22 16:36 | 607K | |
| Link WOrds.png | 2021-03-15 08:56 | 327K | |
| Linear non Linear.PNG | 2021-04-01 13:07 | 424K | |
| Line Plot Banner.png | 2021-02-26 15:25 | 118K | |
| Line Graphs 2.png | 2021-02-26 10:19 | 254K | |
| Line Graphs1.png | 2021-02-26 10:14 | 354K | |
| Line Graphs.png | 2021-02-26 10:11 | 264K | |
| Line Graph Video.png | 2021-02-26 10:21 | 325K | |
| Lights BVanner.png | 2021-02-24 09:54 | 192K | |
| Life on a Slave Ship.PNG | 2021-02-12 13:45 | 870K | |
| Life on a Slave.PNG | 2021-02-16 11:19 | 826K | |
| Life of the Navajo.PNG | 2021-02-11 12:15 | 1.0M | |
| Life in the 13 colonies.PNG | 2021-02-12 11:44 | 1.0M | |
| Life Cycles Banner.png | 2021-03-04 09:42 | 300K | |
| Lessson 15 Panda.png | 2021-03-03 13:28 | 351K | |
| Lessson 6 recon.PNG | 2021-02-17 09:15 | 1.0M | |
| Lessson 4 Seeing Shapes.png | 2021-03-05 10:53 | 195K | |
| Lesson on Surprise.png | 2021-03-15 11:54 | 424K | |
| Lesson Ways to Add.png | 2021-03-04 14:01 | 220K | |
| Lesson Possessive nouns.png | 2021-03-03 10:03 | 224K | |
| Lesson PLants and their homes.png | 2021-03-01 15:14 | 379K | |
| Lesson Grammar Statement.png | 2021-03-03 11:23 | 310K | |
| Lesson Grammar Adjectives.png | 2021-03-03 10:26 | 341K | |
| Lesson Action verbs.png | 2021-03-03 10:13 | 310K | |
| Lesson 29.png | 2021-03-04 11:52 | 392K | |
| Lesson 27 content.png | 2021-03-04 10:40 | 363K | |
| Lesson 27 Grammar Kinds of sentces.png | 2021-03-04 10:44 | 342K | |
| Lesson 26 exclamation.png | 2021-03-04 10:29 | 292K | |
| Lesson 26 Anchor text.png | 2021-03-04 10:25 | 371K | |
| Lesson 26 Anchor Peter.png | 2021-03-04 10:27 | 424K | |
| Lesson 25 My Friends.png | 2021-03-04 09:55 | 383K | |
| Lesson 24 Country.png | 2021-03-04 09:45 | 355K | |
| Lesson 23.png | 2021-03-04 09:34 | 384K | |
| Lesson 22.png | 2021-03-03 17:46 | 396K | |
| Lesson 20.png | 2021-03-03 16:33 | 401K | |
| Lesson 19.png | 2021-03-03 16:06 | 387K | |
| Lesson 18 Agriculture.png | 2021-03-03 15:21 | 395K | |
| Lesson 17 Ways to Travel.png | 2021-03-03 15:11 | 406K | |
| Lesson 16 Astrro.png | 2021-03-03 15:01 | 378K | |
| Lesson 14 Citizenship.png | 2021-03-03 13:19 | 382K | |
| Lesson 13 Subjects and Veerbs.png | 2021-03-03 13:13 | 313K | |
| Lesson 13 Season.png | 2021-03-03 13:11 | 361K | |
| Lesson 12 Jungle Animals.png | 2021-03-03 12:58 | 398K | |
| Lesson 11 Marine.png | 2021-03-03 12:51 | 364K | |
| Lesson 11 Authors.png | 2021-03-03 12:41 | 364K | |
| Lesson 10 Feelings.png | 2021-03-03 12:29 | 357K | |
| Lesson 9 Writing.png | 2021-03-03 12:19 | 374K | |
| Lesson 8 The War Ends.PNG | 2021-02-15 12:06 | 1.0M | |
| Lesson8 Music.png | 2021-03-03 11:21 | 393K | |
| Lesson 7 War With mexico.PNG | 2021-02-16 09:54 | 1.0M | |
| Lesson 7 Colonial Givernments.PNG | 2021-02-12 13:58 | 1.0M | |
| Lesson 7 Aniumal.png | 2021-03-03 11:09 | 355K | |
| Lesson 6 Traditional Stories.png | 2021-03-03 10:56 | 385K | |
| Lesson 6 Present day.PNG | 2021-02-18 14:28 | 907K | |
| Lesson 6 Fighting the War.PNG | 2021-02-15 10:32 | 964K | |
| Lesson 6 Colonial economics.PNG | 2021-02-12 13:34 | 1.0M | |
| Lesson 5 The War ends.PNG | 2021-02-16 14:02 | 900K | |
| Lesson 5 The Declaration of Indepenence.PNG | 2021-02-15 09:52 | 875K | |
| Lesson 5 Slavery in Colonies.PNG | 2021-02-12 12:44 | 890K | |
| Lesson 5 New States and Terrioties.PNG | 2021-02-17 14:56 | 1.0M | |
| Lesson 5 Industrial Reb.PNG | 2021-02-16 09:07 | 1.0M | |
| Lesson 5 At the Zoo.png | 2021-03-03 10:33 | 384K | |
| Lesson 5 ATime For Change.PNG | 2021-02-18 13:24 | 1.0M | |
| Lesson 4 the revolution begins.PNG | 2021-02-12 16:56 | 940K | |
| Lesson 4 Union moves to victory.PNG | 2021-02-16 12:59 | 838K | |
| Lesson 4 The War of 1812.PNG | 2021-02-15 17:39 | 925K | |
| Lesson 4 The Cold War.PNG | 2021-02-18 12:29 | 926K | |
| Lesson 4 Seeing Shapes Around Us.pdf | 2021-03-05 11:25 | 255K | |
| Lesson 4 PLants and their homes.png | 2021-03-01 15:12 | 443K | |
| Lesson 4 Native Amercicans of the Plains.PNG | 2021-02-11 12:24 | 907K | |
| Lesson 4 Making Fact Families.png | 2021-03-04 16:37 | 256K | |
| Lesson 4 Makinf Fact Families.png | 2021-03-04 16:39 | 219K | |
| Lesson 4 How Animals.png | 2021-03-02 10:25 | 439K | |
| Lesson 4 Growing Cities.PNG | 2021-02-17 14:37 | 1.0M | |
| Lesson 4 Colonial America.PNG | 2021-02-12 12:14 | 917K | |
| Lesson 4 Changing Motion.png | 2021-03-02 14:39 | 367K | |
| Lesson 3 electric energy.png | 2021-02-03 16:45 | 157K | |
| Lesson 3 War.PNG | 2021-02-18 11:34 | 830K | |
| Lesson 3 The Southern Colonies.PNG | 2021-02-12 11:37 | 965K | |
| Lesson 3 Spanish exploration.PNG | 2021-02-11 15:14 | 965K | |
| Lesson 3 Soil.png | 2021-03-02 10:39 | 505K | |
| Lesson 3 School.png | 2021-03-03 10:09 | 382K | |
| Lesson 3 Resources of California.png | 2021-03-02 12:56 | 466K | |
| Lesson 3 Real World Subtraction1.png | 2021-03-04 16:18 | 221K | |
| Lesson 3 Real World Addition.png | 2021-03-04 14:28 | 236K | |
| Lesson 3 Pushes and Pulls.png | 2021-03-02 14:35 | 223K | |
| Lesson 3 Protest British Rule.PNG | 2021-02-12 16:52 | 1.1M | |
| Lesson 3 Plants Grow and Change.png | 2021-03-01 15:08 | 368K | |
| Lesson 3 Photo.PNG | 2021-02-19 14:44 | 273K | |
| Lesson 3 People of Southwest.PNG | 2021-02-11 12:00 | 789K | |
| Lesson 3 Motors.png | 2021-02-04 13:22 | 217K | |
| Lesson 3 Making Pictures and Models with Shapes Apply.pdf | 2021-03-05 11:17 | 46K | |
| Lesson 3 Making Picture Models.png | 2021-03-05 10:39 | 199K | |
| Lesson 3 LA Purchase.PNG | 2021-02-15 17:03 | 1.1M | |
| Lesson 3 Fossils of California.png | 2021-03-02 12:00 | 465K | |
| Lesson 3 Diversity.PNG | 2021-02-19 10:46 | 219K | |
| Lesson 3 Big Business.PNG | 2021-02-17 14:05 | 1.0M | |
| Lesson 3 Animals from Eggs.png | 2021-03-02 10:10 | 456K | |
| Lesson 3 A Nation Divided by war.PNG | 2021-02-16 12:20 | 933K | |
| Lesson 2 electro.jpg | 2021-02-04 10:56 | 104K | |
| Lesson 2 Weather.png | 2021-03-03 10:00 | 390K | |
| Lesson 2 United States Consiuttion.PNG | 2021-02-15 15:02 | 1.0M | |
| Lesson 2 The Plains.PNG | 2021-02-17 12:18 | 921K | |
| Lesson 2 Rock Changing.png | 2021-03-02 10:35 | 532K | |
| Lesson 2 Plant trans.PNG | 2021-02-19 13:32 | 372K | |
| Lesson 2 Plants and Animal Resoures.png | 2021-03-02 12:52 | 320K | |
| Lesson 2 Pattern.png | 2021-03-04 13:13 | 103K | |
| Lesson 2 Objectives.png | 2021-03-04 13:02 | 343K | |
| Lesson 2 Native Americans of the West.PNG | 2021-02-11 10:43 | 910K | |
| Lesson 2 Motion.png | 2021-03-02 14:14 | 347K | |
| Lesson 2 Mammals.png | 2021-03-02 09:50 | 341K | |
| Lesson 2 Making Subtraction Stories.png | 2021-03-04 15:19 | 285K | |
| Lesson 2 Making Addition Stories.png | 2021-03-04 14:22 | 296K | |
| Lesson 2 Heading towards war.PNG | 2021-02-16 12:20 | 1.0M | |
| Lesson 2 French and Indian War.PNG | 2021-02-12 15:20 | 1.0M | |
| Lesson 2 Flowers and Fruits.png | 2021-03-01 14:17 | 254K | |
| Lesson 2 Finding CLues.png | 2021-03-02 11:55 | 429K | |
| Lesson 2 Exploring Solids.png | 2021-03-05 10:32 | 192K | |
| Lesson 2 Exploring Solid Shapes Apply.pdf | 2021-03-05 11:10 | 47K | |
| Lesson 2 Cells to organs.PNG | 2021-02-19 09:58 | 109K | |
| Lesson 2.4 multi using Methods.png | 2021-02-25 13:01 | 403K | |
| Lesson 2.3 Multiples.png | 2021-02-25 12:58 | 344K | |
| Lesson 1 ways to Subtract.png | 2021-03-04 15:10 | 262K | |
| Lesson 1 fossils.png | 2021-03-02 11:10 | 362K | |
| Lesson1 Vascular Plants.PNG | 2021-02-19 12:27 | 179K | |
| Lesson 1 The World Expands.PNG | 2021-02-11 14:03 | 1.0M | |
| Lesson 1 Static 1.png | 2021-02-03 14:21 | 303K | |
| Lesson 1 Static.png | 2021-02-03 14:10 | 77K | |
| Lesson 1 Slavery.PNG | 2021-02-16 11:12 | 923K | |
| Lesson 1 Settling the West.PNG | 2021-02-17 10:11 | 963K | |
| Lesson 1 Settling America.PNG | 2021-02-11 10:33 | 745K | |
| Lesson 1 Rocks.png | 2021-03-02 10:32 | 273K | |
| Lesson 1 Position.png | 2021-03-02 14:09 | 357K | |
| Lesson 1 PLants and thier Parts.png | 2021-03-01 14:09 | 234K | |
| Lesson 1 PLanning New Government.PNG | 2021-02-15 14:26 | 866K | |
| Lesson1 New England.PNG | 2021-02-12 11:01 | 911K | |
| Lesson 1 New Century.PNG | 2021-02-17 16:13 | 885K | |
| Lesson 1 Natural Resources.png | 2021-03-02 12:43 | 550K | |
| Lesson 1 Making Number Bonds.png | 2021-03-04 13:35 | 177K | |
| Lesson 1 Magnets.png | 2021-02-04 10:38 | 177K | |
| Lesson 1 King Cotton.PNG | 2021-02-16 11:35 | 917K | |
| Lesson 1 Kinds of Animals.png | 2021-03-02 09:45 | 239K | |
| Lesson 1 Friendship Forever.png | 2021-03-03 09:48 | 475K | |
| Lesson 1 Exploring Plane Shapes Apply.pdf | 2021-03-05 11:04 | 48K | |
| Lesson 1 Exploring Plane Shapes.png | 2021-03-05 10:23 | 204K | |
| Lesson 1 Cells.PNG | 2021-02-18 17:25 | 286K | |
| Lesason 7 American Victories.PNG | 2021-02-15 11:10 | 957K | |
| Leisure activities banner.png | 2021-03-10 13:46 | 64K | |
| Learn English.PNG | 2021-03-10 16:37 | 737K | |
| Layeras of the Sun.PNG | 2021-03-29 14:06 | 717K | |
| Lat and long.PNG | 2021-02-11 14:28 | 457K | |
| Landforms of the Southeast.PNG | 2021-02-05 13:57 | 805K | |
| Laff Banner.png | 2021-02-24 14:49 | 339K | |
| Lady in ted.png | 2021-03-11 09:56 | 28K | |
| Lady in coat.png | 2021-03-11 09:56 | 32K | |
| Labor Units.PNG | 2021-02-17 14:18 | 486K | |
| LYMPHMATIC_SYSTEM.pdf | 2022-02-10 13:35 | 1.3M | |
| LEWIs and clak.PNG | 2021-02-11 14:43 | 678K | |
| LESSON 2 Good Times.PNG | 2021-02-18 10:55 | 857K | |
| LCM.png | 2021-02-25 12:29 | 604K | |
| L3.PNG | 2021-02-19 14:04 | 129K | |
| Knoits and Surgeons.png | 2021-03-15 09:33 | 340K | |
| King George baNNER.png | 2021-02-24 14:10 | 300K | |
| Kinds of asjectives.png | 2021-03-04 11:15 | 191K | |
| Kinds of Animals Banner.png | 2021-03-02 09:39 | 422K | |
| Kin Fric.PNG | 2021-03-17 16:32 | 539K | |
| Kansas nebraska act.PNG | 2021-02-16 11:42 | 1.1M | |
| Jupiters moons.PNG | 2021-03-30 10:58 | 949K | |
| Jupiter.PNG | 2021-03-30 09:25 | 675K | |
| Jungle Aniumals Banner.png | 2021-03-03 12:55 | 405K | |
| Journal Unit 6 Lesson 1.pdf | 2021-03-15 11:07 | 501K | |
| John Paul Zinger.PNG | 2021-02-12 14:09 | 753K | |
| John D Rock.PNG | 2021-02-17 14:23 | 672K | |
| John.PNG | 2021-02-16 11:27 | 831K | |
| Jogging.png | 2021-03-11 09:56 | 40K | |
| Japan Banner.png | 2021-02-24 09:56 | 368K | |
| Jamestown Colony.PNG | 2021-02-12 11:21 | 741K | |
| James Monroe.PNG | 2021-02-15 17:51 | 519K | |
| Jacques.PNG | 2021-02-12 10:17 | 491K | |
| JIm Crow Laws.PNG | 2021-02-17 09:49 | 357K | |
| Isotopes.PNG | 2021-04-06 14:43 | 193K | |
| Iruroqois Conded.PNG | 2021-02-11 13:20 | 1.0M | |
| Irrigationb.PNG | 2021-02-08 10:19 | 409K | |
| Irregular galaxy.PNG | 2021-03-19 14:04 | 899K | |
| Iro.PNG | 2021-02-11 13:24 | 1.0M | |
| IrRevolution banner.png | 2021-02-23 17:38 | 352K | |
| In your journal.pdf | 2021-03-11 14:48 | 174K | |
| Introduction to the Bible Apply.docx | 2021-02-13 15:57 | 13K | |
| Introduction to science.PNG | 2021-02-01 09:19 | 1.0M | |
| Introduction to Religion.docx | 2021-02-13 14:54 | 13K | |
| Intro 2.PNG | 2021-03-31 09:30 | 525K | |
| Intro 1.PNG | 2021-03-31 09:30 | 717K | |
| Interroative.png | 2021-03-15 15:43 | 61K | |
| Interaction of Matter.png | 2021-03-31 09:15 | 228K | |
| Intensifers banner.png | 2021-03-10 16:26 | 78K | |
| Insects Banner.png | 2021-03-04 11:56 | 267K | |
| Input Output Tables.png | 2021-02-26 10:01 | 534K | |
| Inner Planets Banner.png | 2021-03-29 15:54 | 202K | |
| Industrial banner.png | 2021-02-23 17:32 | 445K | |
| Industrial Revolution.PNG | 2021-02-16 09:13 | 871K | |
| Industrial Rev.PNG | 2021-03-16 11:38 | 828K | |
| Indirect Speechj.png | 2021-03-15 11:28 | 222K | |
| Indians Wars.PNG | 2021-02-17 12:09 | 1.1M | |
| Indianapolismotorspeedway.PNG | 2021-02-08 09:41 | 695K | |
| Indepenedernt variables.PNG | 2021-04-01 13:01 | 515K | |
| Independent Variables.PNG | 2021-04-01 12:56 | 486K | |
| Indefinite Pronoun.png | 2021-03-04 09:47 | 168K | |
| Inca Facts.PNG | 2021-02-11 16:20 | 894K | |
| Improve your English.png | 2021-03-12 12:19 | 334K | |
| Improve Yur.png | 2021-03-12 12:21 | 467K | |
| Improper and MIxed.png | 2021-02-26 14:00 | 197K | |
| Improper FractionsMixewd.png | 2021-02-26 14:06 | 268K | |
| Improper Fractions Banner.png | 2021-02-26 13:50 | 184K | |
| Improper Fractions.png | 2021-02-26 14:02 | 132K | |
| Imports and Exports.PNG | 2021-02-12 10:07 | 855K | |
| Impearlism banner.png | 2021-02-24 09:58 | 288K | |
| Iditirod.PNG | 2021-02-10 10:08 | 751K | |
| IR Revolution banner.png | 2021-02-23 17:37 | 479K | |
| INTRODUCTION TO RELIGION LESSON 1 (1).docx | 2021-02-09 16:25 | 17K | |
| IAN2.png | 2021-03-16 08:39 | 61K | |
| IAN.png | 2021-03-16 08:35 | 101K | |
| Hypothesis.PNG | 2021-03-31 13:55 | 546K | |
| Human Body Systemd 1.png | 2021-03-09 15:08 | 182K | |
| Human Body Systemd.png | 2021-03-09 15:08 | 239K | |
| Human.PNG | 2021-03-09 15:33 | 718K | |
| Hsunted Castle Banner.png | 2021-03-16 09:55 | 90K | |
| How t works.PNG | 2021-02-03 14:29 | 532K | |
| How to write a Thesis Statement.pdf | 2023-08-18 08:51 | 9.5M | |
| How to imporve.png | 2021-03-12 15:17 | 387K | |
| How to do averages.png | 2021-02-26 10:56 | 490K | |
| How to Say Tell.PNG | 2021-03-10 11:17 | 671K | |
| How to Pronounce English.png | 2021-03-12 15:30 | 862K | |
| How to Add Gr.png | 2021-02-26 12:50 | 198K | |
| How to Add Fractions.png | 2021-02-25 15:37 | 198K | |
| How does Gravity work.PNG | 2021-03-18 09:37 | 1.0M | |
| How an elevator works.PNG | 2021-02-05 16:35 | 917K | |
| Homestea Act.PNG | 2021-02-17 11:24 | 570K | |
| Hobbies.png | 2021-03-10 13:58 | 524K | |
| History of thge microscope.PNG | 2021-02-18 17:11 | 702K | |
| History of bikes.PNG | 2021-03-16 11:45 | 1.0M | |
| History of Slave rebellions.PNG | 2021-02-12 13:06 | 761K | |
| History Journal.png | 2021-03-16 11:19 | 657K | |
| History Banner.png | 2021-03-03 16:02 | 335K | |
| History Banne1r.png | 2021-03-16 11:18 | 38K | |
| Historical.PNG | 2021-03-15 08:47 | 815K | |
| Hiking.png | 2021-03-12 11:05 | 266K | |
| High Heel Shoes.png | 2021-03-11 09:56 | 13K | |
| High Heel Boots.png | 2021-03-11 09:56 | 13K | |
| Henry exp.PNG | 2021-02-11 17:43 | 558K | |
| Henry Hudson.PNG | 2021-02-11 17:40 | 1.0M | |
| Hear Listen Sound.png | 2021-03-16 09:25 | 172K | |
| Hawaii and Alaska.PNG | 2021-02-17 15:13 | 420K | |
| Have to.png | 2021-03-12 11:27 | 447K | |
| Harry Potter.PNG | 2021-03-16 10:02 | 963K | |
| Halloween Special.PNG | 2021-03-16 09:59 | 1.0M | |
| Halloween Sounds.PNG | 2021-03-16 10:01 | 28K | |
| HBF.PNG | 2021-03-09 16:03 | 822K | |
| Gym banner.png | 2021-03-05 14:54 | 260K | |
| Guitar Banner.png | 2021-03-05 10:37 | 278K | |
| Greater Than Less than.png | 2021-02-25 11:24 | 439K | |
| Gray flats.png | 2021-03-11 09:56 | 12K | |
| Gravity and Motion Banner.png | 2021-03-18 11:08 | 231K | |
| Gravity Explained.PNG | 2021-03-29 13:14 | 1.0M | |
| Gravity Banner.png | 2021-03-18 09:08 | 122K | |
| Gravatational Force.PNG | 2021-04-05 08:54 | 750K | |
| Grammar to be.png | 2021-03-03 13:30 | 218K | |
| Grammare Coimmons in a Series.png | 2021-03-03 11:11 | 292K | |
| Grammar banner.png | 2021-02-24 12:41 | 122K | |
| Grammar Subject Pronounsa.png | 2021-03-03 17:11 | 255K | |
| Grammar Snacks.png | 2021-03-15 10:29 | 434K | |
| Grammar Contraction.png | 2021-03-04 09:57 | 259K | |
| Grammar Compond Sentences.png | 2021-03-03 15:15 | 180K | |
| Grammar Commands.png | 2021-03-03 13:01 | 188K | |
| Grammar Articles.png | 2021-03-03 12:33 | 188K | |
| Grammar Adverbs.png | 2021-03-04 11:54 | 174K | |
| Gramm Banner.png | 2021-03-03 09:50 | 122K | |
| Golf.png | 2021-03-12 11:09 | 281K | |
| Gold Rush.PNG | 2021-02-16 10:14 | 658K | |
| Gods omino.png | 2021-02-13 15:10 | 272K | |
| God Is good.docx | 2021-02-13 15:41 | 13K | |
| Geysers.PNG | 2021-02-08 17:21 | 784K | |
| Geo.PNG | 2021-02-11 11:45 | 1.3K | |
| Genesis Chapter 1 and 2.PNG | 2021-02-14 13:26 | 577K | |
| Geneis 1.PNG | 2021-02-14 14:25 | 608K | |
| Gen 21.PNG | 2021-02-14 14:27 | 751K | |
| Gen.PNG | 2021-02-14 14:31 | 628K | |
| Gas_Properties_Laws_student_directions.pdf | 2021-02-16 15:50 | 169K | |
| Gardens Banner.png | 2021-03-03 17:07 | 420K | |
| Galaxies banner.png | 2021-03-19 13:45 | 399K | |
| GCF and LCM.png | 2021-02-25 12:31 | 540K | |
| GCF.png | 2021-02-25 12:16 | 212K | |
| Future Tense.PNG | 2021-03-10 10:20 | 290K | |
| Front End Estimation.png | 2021-02-25 12:07 | 349K | |
| Friendship Banner.png | 2021-03-03 09:46 | 259K | |
| Frictrional Forcea.PNG | 2021-03-17 16:26 | 733K | |
| Friction banner.png | 2021-03-17 16:14 | 283K | |
| French and Indian War.PNG | 2021-02-12 15:26 | 716K | |
| French Rev.png | 2021-02-23 17:20 | 395K | |
| French Colonies.PNG | 2021-02-12 09:56 | 1.0M | |
| Free Fall.PNG | 2021-03-18 11:23 | 663K | |
| Fractions banner.png | 2021-02-25 15:29 | 338K | |
| Fractions Addition.png | 2021-02-25 15:40 | 405K | |
| Fractions.png | 2021-02-25 15:36 | 362K | |
| Fraction Addition.png | 2021-02-26 12:52 | 405K | |
| Foundation of religion.png | 2021-02-09 17:15 | 163K | |
| Fossils of California Banner.png | 2021-03-02 11:58 | 388K | |
| Fossils banner 2.png | 2021-03-02 11:48 | 330K | |
| Forget Shoppig.PNG | 2021-03-10 17:04 | 817K | |
| Forece and Net Force.PNG | 2021-03-17 14:19 | 306K | |
| Forece and Motion.PNG | 2021-03-17 12:27 | 546K | |
| Force and motion.PNG | 2021-03-18 11:29 | 486K | |
| Flwwas.png | 2021-02-16 14:56 | 604K | |
| Fluid and Pressure Banner.png | 2021-03-18 14:00 | 305K | |
| Flowers and Fruits Banner.png | 2021-03-01 14:15 | 244K | |
| Flling in love.png | 2021-03-12 11:50 | 332K | |
| First battle at bullrun.PNG | 2021-02-16 12:51 | 710K | |
| Fireworks.png | 2021-03-30 14:19 | 262K | |
| Find the Smaller Number.png | 2021-02-25 11:28 | 290K | |
| Film Banner.png | 2021-03-15 08:29 | 23K | |
| Feudal System.pdf | 2022-02-03 14:52 | 292K | |
| Feelings Header.png | 2021-03-03 16:31 | 242K | |
| Feelings Banner.png | 2021-03-03 12:27 | 242K | |
| Fashiuon banner.png | 2021-03-10 16:52 | 49K | |
| Fashion Vocabulary.png | 2021-03-10 17:10 | 91K | |
| Farm Animals BAnner.png | 2021-03-03 17:44 | 272K | |
| F and V sounds.png | 2021-03-12 15:49 | 471K | |
| Factors and Multiple.png | 2021-02-25 12:33 | 447K | |
| Extreme Sports.PNG | 2021-03-11 12:16 | 825K | |
| Expressing yourslef.png | 2021-03-15 11:58 | 538K | |
| Expanded Form.png | 2021-02-25 11:09 | 275K | |
| Event Keywords.png | 2021-03-12 12:58 | 264K | |
| Eurpope Plunges into war.png | 2021-02-24 09:30 | 370K | |
| Eurpeam nammer.png | 2021-02-23 17:08 | 336K | |
| Estimation Bannner.png | 2021-02-25 11:55 | 314K | |
| Equstrian.png | 2021-03-12 11:07 | 451K | |
| Emancipation proclomation.PNG | 2021-02-16 13:03 | 707K | |
| Ellipitical Galaxy.PNG | 2021-03-19 14:01 | 527K | |
| Eli.PNG | 2021-02-16 09:17 | 839K | |
| Elements vs Compound.PNG | 2021-04-06 09:20 | 325K | |
| Elements and Compounds.PNG | 2021-04-06 09:27 | 719K | |
| Element banner.png | 2021-04-05 15:55 | 265K | |
| Electrity2.png | 2021-02-03 13:48 | 124K | |
| Electrity.png | 2021-02-03 13:48 | 160K | |
| Electric Current.PNG | 2021-02-03 14:52 | 382K | |
| Electric Circuits.png | 2021-02-03 14:48 | 85K | |
| Electric.PNG | 2021-02-03 17:11 | 966K | |
| Election of 1860.PNG | 2021-02-16 11:45 | 728K | |
| Elec.PNG | 2021-02-03 17:07 | 476K | |
| ESL Unit 1 Project.png | 2021-03-10 14:14 | 48K | |
| ESL Have you ever.PNG | 2021-03-10 15:27 | 767K | |
| Dwarf Planets.PNG | 2021-03-30 09:33 | 611K | |
| Doretha lango.PNG | 2021-02-10 10:03 | 419K | |
| Dog Newspaper Banner.png | 2021-02-24 14:53 | 358K | |
| Division with Regrouping.png | 2021-02-25 14:40 | 428K | |
| Division Banner.png | 2021-02-25 14:32 | 275K | |
| Div Banner.png | 2021-02-25 14:48 | 50K | |
| Displaying Data.png | 2021-02-26 09:51 | 334K | |
| Discussion banner.png | 2021-03-19 15:32 | 180K | |
| Discovery of the Electron.PNG | 2021-04-06 13:59 | 594K | |
| Direct and Indirect Speech.png | 2021-03-15 11:30 | 304K | |
| Direct and Indirect.PNG | 2021-02-22 16:56 | 393K | |
| Differences.PNG | 2021-03-30 12:26 | 600K | |
| Difference between Aparent madnitue.PNG | 2021-03-19 09:56 | 850K | |
| DesantisArticle.pdf | 2022-01-28 15:10 | 108K | |
| Deomo Reform.png | 2021-02-24 09:28 | 307K | |
| Density ci.PNG | 2021-03-18 16:43 | 398K | |
| Density Demonanstrations.PNG | 2021-04-05 10:51 | 326K | |
| Declaration of Indepence.PNG | 2021-02-15 09:57 | 926K | |
| Data banner.png | 2021-04-01 14:26 | 264K | |
| Data and Probability.png | 2021-02-26 12:36 | 353K | |
| Dangeours Banner.png | 2021-02-24 14:06 | 259K | |
| DNA GENEGES.pdf | 2022-02-08 16:59 | 134K | |
| DBA.png | 2021-03-19 15:34 | 164K | |
| Crime and Criminals.png | 2021-03-15 09:54 | 334K | |
| Crime Banner.png | 2021-03-15 09:30 | 26K | |
| Crime.png | 2021-03-15 09:29 | 29K | |
| Creation Story.png | 2021-02-13 16:12 | 259K | |
| Creating Bar Graphs.png | 2021-02-26 09:59 | 380K | |
| Couple.png | 2021-03-11 10:53 | 42K | |
| Counting to 10 banner.png | 2021-03-04 12:48 | 143K | |
| Could WOuld SHould.png | 2021-03-12 13:35 | 364K | |
| Could Might Banner.PNG | 2021-03-11 09:29 | 741K | |
| Cougars banner.png | 2021-02-24 13:59 | 255K | |
| Coral reef Banner.png | 2021-03-02 14:07 | 437K | |
| Coral Reef Banner.png | 2021-03-03 12:48 | 434K | |
| Cooking as Alchamemy.png | 2021-03-15 13:54 | 578K | |
| Cooking Terms.png | 2021-03-15 14:00 | 478K | |
| Cooking Journal.pdf | 2021-03-15 13:48 | 280K | |
| Cooking.png | 2021-03-15 13:47 | 40K | |
| Contruction interrorgative.png | 2021-03-12 12:33 | 130K | |
| Continious passr.png | 2021-03-16 08:21 | 82K | |
| Continental Army.PNG | 2021-02-15 10:01 | 938K | |
| Construction.png | 2021-03-15 10:14 | 118K | |
| Conquisadors.PNG | 2021-02-11 15:26 | 1.1M | |
| Connectors Banner.png | 2021-03-15 08:51 | 42K | |
| Conditionals Banner.png | 2021-03-16 12:24 | 6.4K | |
| Condensation.PNG | 2021-04-05 14:27 | 875K | |
| Concentration of Solution.PNG | 2021-04-06 11:06 | 698K | |
| Compromise of 1850.PNG | 2021-02-16 11:39 | 500K | |
| Compounds inorg.PNG | 2021-04-07 11:37 | 563K | |
| Compounds and elemnts.PNG | 2021-04-06 09:24 | 389K | |
| Compounds Banner.png | 2021-04-06 09:11 | 469K | |
| Compounds.PNG | 2021-04-07 11:29 | 714K | |
| Complwtre Sentences.PNG | 2021-02-22 11:03 | 437K | |
| Complete Sentence Grammar.png | 2021-03-03 10:58 | 287K | |
| Complete Lab Report_Gas Laws.docx | 2021-02-19 15:21 | 92K | |
| Complete Lab Report1.pdf | 2021-02-23 11:06 | 255K | |
| Complete Lab Report.docx | 2021-02-12 16:00 | 99K | |
| Complete Lab Report-2.pdf | 2021-03-02 10:51 | 257K | |
| Complete Lab Report (1).pdf | 2021-02-16 15:36 | 255K | |
| Comparing Whole NUmbers.png | 2021-02-25 11:26 | 319K | |
| Comparing Numbers Banner.png | 2021-03-04 13:00 | 155K | |
| Comparing.png | 2021-02-25 11:46 | 199K | |
| Common Nouns.PNG | 2021-02-22 13:17 | 184K | |
| Comets and Asteroids.PNG | 2021-03-30 12:49 | 550K | |
| Columbus voyages.PNG | 2021-02-11 14:53 | 556K | |
| Columbian Exchange.PNG | 2021-02-11 14:47 | 929K | |
| Colonial Slavery.PNG | 2021-02-12 12:54 | 1.1M | |
| Collecting data banner.png | 2021-04-01 12:30 | 280K | |
| Cold war the Korean War.PNG | 2021-02-18 12:39 | 575K | |
| Clorhwa AND fashion.PNG | 2021-03-10 17:01 | 345K | |
| Climate Change.PNG | 2021-02-18 15:28 | 640K | |
| Civilization.PNG | 2021-02-11 10:16 | 1.0M | |
| Civil Rifhts.PNG | 2021-02-05 14:52 | 749K | |
| Civil.PNG | 2021-02-18 13:35 | 619K | |
| Citizenship Banner.png | 2021-03-03 13:17 | 288K | |
| Church Reform Banner.png | 2021-02-23 15:27 | 399K | |
| China Leaders banner.png | 2021-02-23 17:10 | 353K | |
| Chemical properties banner.png | 2021-04-05 11:39 | 331K | |
| Chemical Proprties of Salt.PNG | 2021-04-05 11:32 | 93K | |
| Chemical Bonding (1).docx | 2021-02-09 14:31 | 128K | |
| Checks and Balances.PNG | 2021-02-15 15:17 | 679K | |
| Chapter 2 Recall.png | 2021-02-25 11:52 | 234K | |
| Chapter 2 Estimation and Number Theory.png | 2021-02-25 11:50 | 755K | |
| Changing Motion Banner.png | 2021-03-02 14:37 | 315K | |
| Ch 1 Working with WHole Recall Prior.png | 2021-02-25 10:53 | 308K | |
| Ch 1 Working With Whole Numbers.png | 2021-02-25 10:53 | 822K | |
| Cell to organism,.png | 2021-02-18 17:46 | 330K | |
| Cells Banner.png | 2021-02-18 17:20 | 319K | |
| Cell Resp.PNG | 2021-02-19 15:29 | 493K | |
| Causes of the Great Depression.PNG | 2021-02-18 11:08 | 895K | |
| Cause and Effect.png | 2021-03-15 08:56 | 478K | |
| Cattle Drives.PNG | 2021-02-17 11:30 | 1.1M | |
| Capture.PNG | 2021-03-30 08:30 | 2.5K | |
| Calligraphy Art.pdf | 2022-02-03 14:20 | 421K | |
| California Gold rush.PNG | 2021-02-09 15:26 | 378K | |
| California Banner.png | 2021-03-02 12:54 | 427K | |
| CT_knights_tale.pdf | 2021-04-07 08:19 | 264K | |
| CH JJ Sounds.png | 2021-03-12 15:36 | 709K | |
| CEBA.png | 2021-03-29 09:49 | 3.1K | |
| Bulldozer Banner.png | 2021-03-17 13:46 | 392K | |
| Building your acting skills banner.png | 2021-02-23 10:04 | 310K | |
| Buffalo Soliders.PNG | 2021-02-17 15:03 | 941K | |
| British Pass and Simple.PNG | 2021-03-16 09:45 | 1.0M | |
| Brain in Love.png | 2021-03-12 11:52 | 320K | |
| Boy.png | 2021-03-11 10:53 | 15K | |
| Boston tea PArty.PNG | 2021-02-12 16:41 | 1.0M | |
| Books and Literature Banner.png | 2021-03-12 12:05 | 81K | |
| Books and Literature.png | 2021-03-12 12:15 | 389K | |
| Books and It.png | 2021-03-12 12:17 | 389K | |
| Booda.png | 2021-02-23 15:19 | 386K | |
| Body systems.PNG | 2021-03-09 15:59 | 578K | |
| Blue Subtraction Banner.png | 2021-03-04 15:07 | 87K | |
| Black dress.png | 2021-03-11 09:56 | 10K | |
| Black and Red Fractions banner.png | 2021-02-26 15:18 | 48K | |
| BlackVeteran.PNG | 2022-01-28 15:13 | 840K | |
| Black Dress shoes.png | 2021-03-11 09:56 | 18K | |
| Birds Banner.png | 2021-02-24 13:41 | 314K | |
| Birch HOuse Banner.png | 2021-02-24 15:19 | 329K | |
| Big Odea.PNG | 2021-02-19 11:38 | 129K | |
| Big Idea.PNG | 2021-02-19 11:36 | 129K | |
| Bible.png | 2021-02-13 15:47 | 514K | |
| Be more creative.png | 2021-03-10 13:58 | 400K | |
| Belt.png | 2021-03-11 14:11 | 24K | |
| Bee Banner.png | 2021-02-19 10:37 | 338K | |
| Battle of Trendton.PNG | 2021-02-15 11:45 | 736K | |
| Battle of Little Big Horn.PNG | 2021-02-17 12:05 | 732K | |
| Battle Saratoga.PNG | 2021-02-15 11:33 | 850K | |
| Balnced and unbalanced forces.PNG | 2021-03-17 14:25 | 292K | |
| BIblewse.png | 2021-02-13 16:42 | 394K | |
| B4.PNG | 2021-03-29 10:13 | 896 | |
| B3.PNG | 2021-03-29 10:13 | 873 | |
| B2.PNG | 2021-03-29 10:13 | 878 | |
| B1.PNG | 2021-03-29 10:13 | 887 | |
| Aztec empire.PNG | 2021-02-11 15:31 | 766K | |
| Axis and Coord.png | 2021-02-26 10:17 | 480K | |
| Average Banner.png | 2021-02-26 10:32 | 202K | |
| Attack on Pearl Harbour.PNG | 2021-02-18 11:51 | 542K | |
| Atoms.png | 2021-03-30 16:50 | 248K | |
| Atomic Numbers etc.PNG | 2021-04-06 14:54 | 673K | |
| Atomic Mass.PNG | 2021-04-06 14:47 | 192K | |
| Atom banner.png | 2021-04-06 13:26 | 51K | |
| Atom Ban.png | 2021-04-06 14:21 | 27K | |
| Atlantic World Banner.png | 2021-02-23 17:12 | 419K | |
| Astronaut Banner.png | 2021-03-03 14:58 | 251K | |
| Arnold Lobel.png | 2021-03-04 11:13 | 668K | |
| Arms Race.PNG | 2021-02-18 13:01 | 452K | |
| Area Models.png | 2021-02-25 13:06 | 412K | |
| Area Model 1.png | 2021-02-25 13:32 | 618K | |
| Archimedes Principle Banner.png | 2021-03-18 16:20 | 191K | |
| Archaeologistsd.PNG | 2021-02-11 10:06 | 642K | |
| Anton.PNG | 2021-02-18 17:16 | 421K | |
| Animals from Eggs Banner.png | 2021-03-02 10:08 | 388K | |
| Anglo.PNG | 2021-03-17 09:19 | 614K | |
| Anfrew Jackson.PNG | 2021-02-16 09:33 | 898K | |
| AmericasCowboys banner.png | 2021-02-24 15:22 | 302K | |
| American rev War.PNG | 2021-02-12 17:00 | 419K | |
| American Bison.PNG | 2021-02-10 09:53 | 915K | |
| Alaskan Pipeline.PNG | 2021-02-09 15:30 | 714K | |
| Air vs Water Pressure.PNG | 2021-03-18 14:18 | 705K | |
| Agriculture Banner.png | 2021-03-03 15:19 | 446K | |
| Age of the Universe.PNG | 2021-03-29 13:18 | 732K | |
| Age of Democracy banner.png | 2021-02-24 09:26 | 468K | |
| Age of Andrew Jackson.PNG | 2021-02-16 09:27 | 1.0M | |
| Affirmitive Sentences.png | 2021-03-15 11:17 | 246K | |
| AffirmativeActionArticle.pdf | 2022-01-28 14:41 | 136K | |
| Adverbs of Frequent.PNG | 2021-03-12 10:12 | 809K | |
| Adverbs Mov.PNG | 2021-03-12 10:10 | 928K | |
| Adverbs Define.PNG | 2021-03-12 10:16 | 615K | |
| Adverbs Banner.png | 2021-03-11 17:13 | 47K | |
| Advan and Disa.PNG | 2021-02-16 12:54 | 818K | |
| Adjectives Grammar.png | 2021-03-03 10:35 | 271K | |
| Addition facts up to 10.png | 2021-03-04 13:41 | 626K | |
| Addition Header.png | 2021-03-04 14:20 | 312K | |
| Addition Banner.png | 2021-03-04 13:59 | 78K | |
| Adding and Subtracting Fractions.png | 2021-02-26 13:06 | 580K | |
| Adding Mixed Numbers.png | 2021-02-26 13:37 | 280K | |
| AddSubtraction Fractions.png | 2021-02-25 16:24 | 580K | |
| Adam and Eve.png | 2021-02-13 16:32 | 537K | |
| Adam and Eve.docx | 2021-02-13 16:46 | 13K | |
| Actors banner.png | 2021-02-23 11:26 | 225K | |
| Activity 5.PNG | 2021-03-29 09:08 | 103K | |
| Activity 3.PNG | 2021-03-29 09:05 | 52K | |
| Activity 2.PNG | 2021-03-29 09:00 | 60K | |
| Activity 1a.PNG | 2021-03-29 08:58 | 33K | |
| Active vs Passive Voice.png | 2021-03-15 09:17 | 175K | |
| Active and Passive.PNG | 2021-03-15 09:22 | 221K | |
| Activbity 4.PNG | 2021-03-29 09:06 | 59K | |
| Acquifwe.PNG | 2021-02-08 09:54 | 873K | |
| Acn Pueblo.PNG | 2021-02-11 12:08 | 772K | |
| Ace.png | 2021-02-11 11:32 | 3.6K | |
| Accuracy.PNG | 2021-04-01 14:43 | 540K | |
| Ab.png | 2021-02-16 14:21 | 11K | |
| 100000 Banner.png | 2021-02-25 10:45 | 296K | |
| 2005.png | 2021-03-15 15:42 | 67K | |
| 507 Banner.png | 2021-02-25 11:31 | 453K | |
| 18e190413af045db88dfbd29609eb877.db.ses | 2021-03-04 17:18 | 53 | |
| 13 regions.PNG | 2021-02-12 13:49 | 663K | |
| 6th grade Science/ | 2021-03-17 12:28 | - | |
| 6.9 Line Plotd.png | 2021-02-26 15:29 | 238K | |
| 6.8 world word probltems.png | 2021-02-26 15:20 | 267K | |
| 6.7 Fractions of a set.png | 2021-02-26 15:11 | 321K | |
| 6.6 Renaming Whole Numbers.png | 2021-02-26 14:30 | 354K | |
| 6.5 Renamiong improper.png | 2021-02-26 14:17 | 262K | |
| 6.4 Improper Fractions.png | 2021-02-26 13:52 | 259K | |
| 6.3 Mixed Numbers.png | 2021-02-26 13:27 | 321K | |
| 6.2 Subtracting Fractions.png | 2021-02-25 16:21 | 379K | |
| 6.1 Adding Fractions1.png | 2021-02-26 12:43 | 377K | |
| 6.1 Adding Fractions.png | 2021-02-25 15:33 | 377K | |
| 5.6 Real World Problem.png | 2021-02-26 12:38 | 243K | |
| 5.5 Probability as a Fraction.png | 2021-02-26 12:00 | 268K | |
| 5.4 Outcomes.png | 2021-02-26 11:31 | 334K | |
| 5.2 Men Median.png | 2021-02-26 12:25 | 235K | |
| 5.2 Median.png | 2021-02-26 11:09 | 365K | |
| 5.1 Aveerage.png | 2021-02-26 10:34 | 368K | |
| 4 aspects of verbs.PNG | 2021-02-22 16:29 | 703K | |
| 3rd lesson.PNG | 2021-02-19 11:01 | 217K | |
| 3rdgradeMathInFoucs.png | 2022-02-24 15:08 | 227K | |
| 3 Easy ways.PNG | 2021-03-11 09:29 | 585K | |
| 3.5 Real World.png | 2021-02-25 15:08 | 318K | |
| 3.4 Div By 1.png | 2021-02-25 14:50 | 409K | |
| 3.4 Div.png | 2021-02-25 14:54 | 48K | |
| 3.2 multiplying by 2 digit.png | 2021-02-25 14:05 | 219K | |
| 3.1 multiplication 1 digit.png | 2021-02-25 13:34 | 251K | |
| 2fi.png | 2021-02-25 13:36 | 231K | |
| 2 digit by 1 digit.png | 2021-02-25 13:28 | 101K | |
| 2 by 2 Bultiplication.png | 2021-02-25 13:54 | 104K | |
| 2 Mixed Numbers '.png | 2021-02-26 13:44 | 551K | |
| 2.1 Estimation.png | 2021-02-25 11:57 | 258K | |
| 1 digit divisor.png | 2021-02-25 14:58 | 465K | |
| 1Who is God.png | 2021-02-13 15:07 | 256K | |
| 1.3 Adding and Subing.png | 2021-02-25 11:34 | 261K | |
| 1.2 Comparing Numbers to 100000.png | 2021-02-25 11:20 | 292K | |
| 1.1 Numbers to 100000.png | 2021-02-25 10:58 | 280K | |
